Циклическое производное амина, содержащее замещенную алкильную группу



Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу
Циклическое производное амина, содержащее замещенную алкильную группу

Владельцы патента RU 2382771:

ДАЙИТИ САНКИО КОМПАНИ, ЛИМИТЕД (JP)

Изобретение относится к новым соединениям, имеющим общую формулу (I), представленную ниже,

где R1 представляет собой атом водорода, С1-С6 алкильную группу, С3-С6 циклоалкильную группу или С1-С6 алкоксигруппу; R2 представляет собой атом водорода или С1-С6 алкильную группу; R3 представляет собой замещенную С1-С6 алкильную группу {указанный заместитель представляет собой гетероциклильную группу или гетероциклильную группу, замещенную от 1 до 5 заместителями, выбранными из <группы заместителей α> (указанные гетероциклильные группы могут быть замещены от 1 до 4 оксогруппами); гетероарильную группу или гетероарильную группу, замещенную от 1 до 5 заместителями, выбранными из <группы заместителей α>; или заместитель, выбранный из <группы заместителей β>}, или гетероциклильную группу или гетероциклильную группу, замещенную от 1 до 5 заместителями, выбранными из <группы заместителей α> (указанные гетероциклильные группы могут быть замещены от 1 до 4 оксогруппами); где гетероарильная группа представляет собой 5- или 6-членную ароматическую гетероциклическую группу, содержащую по меньшей мере один атом азота, и гетероциклильная группа представляет собой, частично или полностью восстановленную 5- или 6-членную гетероциклическую группу, содержащую от 1 до 3 атомов серы, атомов кислорода и/или атомов азота; X1, X2, X3, X4 и X5, каждый, независимо, представляет собой атом водорода или атом галогена; n равно 1, <группа заместителей α> представлена карбоксигруппой, С2-С7 алкоксикарбонильной группой, карбамоильной группой, гидроксильной группой, С1-С6 алкильной группой, С2-С7 алканоильной группой, С2-С7 алкилкарбамоильной группой, ди(С1-С6 алкил)карбамоильной группой и группой формулы R4-CO-CR5R6-(CH2)m- {где R4 представляет собой гидроксильную группу или С1-С6 алкоксигруппу; R5 и R6 являются одинаковыми или различными и, каждый, представляет собой атом водорода или С1-С6 алкильную группу; и m равно целому числу от 0 до 5}; и <группа заместителей β> представлена карбоксигруппой, С2-С7 алкоксикарбонильной группой, карбамоильной группой, цианогруппой, гидроксильной группой, С1-С6 алкоксигруппой, С2-С7 алкилкарбамоильной группой, ди(С1-С6 алкил)карбамоильной группой и группой формулы R9-CO-(CH2)k-N(R10)- {где R9 представляет собой гидроксильную группу или С1-С6 алкоксигруппу; R10 представляет собой атом водорода или С1-С6 алкильную группу; и k равно целому числу от 0 до 5}, к его фармакологически приемлемьм солям или к С1-С6 алканоильным производным. Изобретение также относится к фармацевтической композиции, к применению, а также к способу профилактики или терапии заболеваний, связанных с тромбообразованием или образованием эмбола. Технический результат - получение новых биологически активных соединений, обладающих активностью в отношении ингибирования агрегации тромбоцитов. 5 н. и 19 з.п. формулы, 8 табл.

 

Область техники

Настоящее изобретение относится к соединениям, которые проявляют активность в отношении ингибирования агрегации тромбоцитов, к их фармакологически приемлемым солям и пролекарствам.

Уровень техники

В последнее время, в связи со старением населения и изменениями культуры питания и образа жизни, заметно возросло количество пациентов, страдающих сердечно-сосудистыми заболеваниями. Поскольку тромботические заболевания, такие как церебральный инфаркт, инфаркт миокарда и заболевания периферического кровообращения, составляют не только большое число заболеваний, но также приводят к неблагоприятному прогнозу и ограничению активности в повседневной жизни, пациент, страдающий этими заболеваниями, личностно недееспособен и лишен гражданской дееспособности. Хорошо известно, что непосредственными причинами этих заболеваний являются ангиостеноз, вызванный тромбообразованием вследствие активации тромбоцитов (адгезия к поврежденным участкам кровеносных сосудов, высвобождение физиологически активных веществ, коагулирование и так далее), и связанная с ангиостенозом ишемия. Таким образом, антитромботические агенты, ингибирующие активацию тромбоцитов, играют важную роль для профилактики возникновения и рецидива этих заболеваний, а также при их лечении. Кроме того, в будущем, эти агенты будут иметь еще большее значение, поскольку количество пациентов с тромботическими заболеваниями возрастает.

Некоторые биологические вещества, связанные с агрегацией тромбоцитов, например, такие как аденозин 5'-дифосфат (ADP), тромбоксан A2 (TXA2), коллаген, серотонин (5-гидрокситриптамин, 5-HT) и тому подобные, хорошо известны. Более того, рецепторы P2Y1 и P2Y12 известны в качестве рецепторов ADP. Некоторые существующие антитромботические средства оказывают антагонистическое действие на эти рецепторы. Примерами таких антитромботических средств являются тиклопидин и клопидогрел, которые имеют тиенопиридиновые структуры.

Кроме того, соединения, описанные в патентных документах 1 и 2, известны как соединения, имеющие не-тиенопиридиновые структуры и оказывающие антагонистическое действие на рецепторы ADP. Тем не менее, существуют определенные проблемы, в том смысле, что эти соединения являются химически нестабильными или только слабоактивными.

Патентный документ 1: WO98/08811

Патентный документ 2: WO99/43648

Описание изобретения

Задачи, решаемые изобретением

С целью разработки новых антитромботических агентов авторы настоящего изобретения тщательно исследовали химически стабильные соединения, имеющие не-тиенопиридиновые структуры и проявляющие активность в отношении ингибирования агрегации тромбоцитов, и обнаружили, что соединения, имеющие общую формулу (I), по настоящему изобретению, их фармакологически приемлемые соли и пролекарства обладают желаемыми свойствами, и таким образом создали настоящее изобретение.

Настоящее изобретение относится к соединениям, имеющим общую формулу (I), их фармакологически приемлемым солям или их пролекарствам; фармацевтическим композициям, содержащим в качестве активных компонентов соединения, имеющие общую формулу (I), их фармакологически приемлемые соли или пролекарства (в частности, к фармацевтическим композициям для средств профилактики или терапии заболеваний, связанных с тромбообразованием или образованием эмбола); к применению соединения, имеющего общую формулу (I), его фармакологически приемлемых солей или пролекарств при получении фармацевтических композиций (в частности, фармацевтических композиций для средств профилактики или терапии заболеваний, связанных с тромбообразованием или образованием эмбола); применению соединений, имеющих общую формулу (I), их фармакологически приемлемых солей или пролекарств для средств профилактики или терапии заболеваний, связанных с тромбообразованием или образованием эмбола; и к способам профилактики или терапии заболеваний (в частности, заболеваний, связанных с тромбообразованием или образованием эмбола) путем введения фармакологически эффективной дозы соединений, имеющих общую формулу (I), их фармакологически приемлемых солей или пролекарств теплокровным животным (в частности, человеку).

Способы решения задач изобретения

Настоящее изобретение относится к соединению, имеющему общую формулу (I), представленную ниже,

[где R1 представляет собой атом водорода, С1-С6 алкильную группу, которая может быть замещенной (указанный заместитель представляет собой атом галогена или С1-С6 алкоксигруппу), C3-C6 циклоалкильную группу, которая может быть замещенной (указанный заместитель представляет собой атом галогена или С1-С6 алкоксигруппу), С1-С6 алкоксигруппу, которая может быть замещенной (указанный заместитель представляет собой атом галогена или С1-С6 алкоксигруппу), или C6-C10 арильную группу, которая может быть замещенной (указанный заместитель представляет собой атом галогена, С1-С6 алкильную группу, С1-С6 алкоксигруппу, цианогруппу или нитрогруппу);

R2 представляет собой атом водорода, атом галогена, карбоксигруппу, C2-C7 алкоксикарбонильную группу, карбамоильную группу, цианогруппу, С1-С6 алкильную группу, галоген С1-С6 алкильную группу, С1-С6 алкильную группу, замещенную гетероарильной группой, С1-С6 алкоксигруппу, галоген С1-С6 алкоксигруппу, гидрокси С1-С6 алкильную группу, С2-С12 алкоксиалкильную группу, формильную группу, C2-C7 алканоильную группу, C4-C7 циклоалкилкрбонильную группу, C2-C7 алкилкарбамоильную группу, ди(C1-C6 алкил)карбамоильную группу, группу формулы R4-CO-CR5R6-(CH2)m- {где R4 представляет собой гидроксильную группу, аминогруппу, С1-С6 алкильную группу, C1-C6 алкиламиногруппу, ди(C1-C6 алкил)аминогруппу, гидроксиаминогруппу, C1-C6 алкоксиаминогруппу или С1-С6 алкоксигруппу; R5 и R6 являются одинаковыми или различными и, каждый представляет собой атом водорода или С1-С6 алкильную группу; и m равно целому числу от 0 до 5}, группу формулы R7-CO-(CH2)l-N(R8)- {где R7 представляет собой гидроксильную группу, аминогруппу, С1-С6 алкильную группу, C1-C6 алкиламиногруппу, ди(C1-C6 алкил)аминогруппу, гидроксиаминогруппу, C1-C6 алкоксиаминогруппу или С1-С6 алкоксигруппу; R8 представляет собой атом водорода или С1-С6 алкильную группу; и l равно целому числу от 0 до 5} или сульфамоил C1-C6 алкильную группу;

R3 представляет собой замещенную C1-C6 алкильную группу {указанный заместитель представляет собой C6-C10 арильную группу или C6-C10 арильную группу, замещенную от 1 до 5 заместителями, выбранными из <группы заместителей α>; гетероциклильную группу или гетероциклильную группу, замещенную от 1 до 5 заместителями, выбранными из <группы заместителей α> (указанные гетероциклильные группы могут быть замещены от 1 до 4 оксогруппами); гетероарильную группу или гетероарильную группу, замещенную от 1 до 5 заместителями, выбранными из <группы заместителей α>; или заместитель, выбранный из <группы заместителей β>}, или гетероциклильную группу или гетероциклильную группу, замещенную от 1 до 5 заместителями, выбранными из <группы заместителей α> (указанные гетероциклильные группы могут быть замещены от 1 до 4 оксогруппами);

каждый X1, X2, X3, X4 и X5 независимо представляет собой атом водорода, атом галогена, аминогруппу, карбоксигруппу, карбамоильную группу, цианогруппу, нитрогруппу, С1-С6 алкильную группу, галоген С1-С6 алкильную группу, С1-С6 алкоксигруппу или галоген С1-С6 алкоксигруппу;

n равно целому числу от 0 до 2,

<группа заместителей α> включает атом галогена, аминогруппу, карбоксигруппу, C2-C7 алкоксикарбонильную группу, карбамоильную группу, цианогруппу, гидроксильную группу, нитрогруппу, С1-С6 алкильную группу, галоген С1-С6 алкильную группу, С1-С6 алкильную группу, замещенную гетероарильной(ыми) группой(ами), С1-С6 алкоксигруппу, галоген С1-С6 алкоксигруппу, гидрокси С1-С6 алкильную группу, С2-С12 алкоксиалкильную группу, формильную группу, C2-C7 алканоильную группу, C4-C7 циклоалкилкрбонильную группу, C1-C6 алкиламиногруппу, ди(C1-C6 алкил)аминогруппу, C2-C7 алкилкарбамоильную группу, ди(C1-C6 алкил)карбамоильную группу, группу формулы R4-CO-CR5R6-(CH2)m- {где R4 представляет собой гидроксильную группу, аминогруппу, С1-С6 алкильную группу, C1-C6 алкиламиногруппу, ди(C1-C6 алкил)аминогруппу, гидроксиаминогруппу, C1-C6 алкоксиаминогруппу или С1-С6 алкоксигруппу; R5 и R6 являются одинаковыми или различными и, каждый представляет собой атом водорода или С1-С6 алкильную группу; и m равно целому числу от 0 до 5} и сульфамоил C1-C6 алкильную группу; и

<группа заместителей β> включает атом галогена, аминогруппу, карбоксигруппу, C2-C7 алкоксикарбонильную группу, карбамоильную группу, цианогруппу, гидроксильную группу, нитрогруппу, С1-С6 алкоксигруппу, галоген С1-С6 алкоксигруппу, формильную группу, C2-C7 алканоильную группу, C4-C7 циклоалкилкарбонильную группу, C1-C6 алкиламиногруппу, ди(C1-C6 алкил)аминогруппу, C2-C7 алкилкарбамоильную группу, ди(C1-C6 алкил)карбамоильную группу, гидроксиаминокарбонильную группу, (C1-C6 алкокси)аминокарбонильную группу, группу формулы R9-CO-(CH2)k-N(R10)- {где R9 представляет собой гидроксильную группу, аминогруппу, С1-С6 алкильную группу, C1-C6 алкиламиногруппу, ди(C1-C6 алкил)аминогруппу, гидроксиаминогруппу, C1-C6 алкоксиаминогруппу или С1-С6 алкоксигруппу; R10 представляет собой атом водорода или С1-С6 алкильную группу; и k равно целому числу от 0 до 5} и сульфамоил C1-C6 алкильную группу], их фармакологически приемлемые соли или пролекарства.

Соединение, имеющее общую формулу (I), представленную выше, его фармацевтически приемлемая соль или пролекарство представляет собой, предпочтительно,

(1) соединение, где R1 представляет собой С1-С6 алкильную группу, галоген С1-С6 алкильную группу, C3-C6 циклоалкильную группу, галоген C3-C6 циклоалкильную группу или С1-С6 алкоксигруппу, его фармакологически приемлемые соли или его пролекарства;

(2) соединение, где R1 представляет собой C3-C6 циклоалкильную группу, галоген C3-C6 циклоалкильную группу или С1-С6 алкоксигруппу, его фармакологически приемлемые соли или его пролекарства;

(3) соединение, где R1 представляет собой C3-C6 циклоалкильную группу или С1-С6 алкоксигруппу, его фармакологически приемлемые соли или его пролекарства;

(4) соединение, где R1 представляет собой циклопропильную группу или метоксигруппу, его фармакологически приемлемые соли или его пролекарства;

(5) соединение, где R1 представляет собой циклопропильную группу, его фармакологически приемлемые соли или его пролекарства;

(6) соединение, где R2 представляет собой атом водорода или С1-С6 алкильную группу, его фармакологически приемлемые соли или его пролекарства;

(7) соединение, где R2 представляет собой атом водорода или метильную группу, его фармакологически приемлемые соли или его пролекарства;

(8) соединение, где R2 представляет собой атом водорода, его фармакологически приемлемые соли или его пролекарства;

(9) соединение, где R3 представляет собой замещенную C1-C6 алкильную группу {указанный заместитель представляет собой гетероциклильную группу или гетероциклильную группу, замещенную 1 или 2 заместителями, выбранными из <группы заместителей α> (указанные гетероциклильные группы могут быть замещены 1 или 2 оксогруппами), гетероарильную группу или гетероарильную группу, замещенную 1 или 2 заместителями, выбранными из <группы заместителей α> или заместитель, выбранный из <группы заместителей β>}, или гетероциклильную группу или гетероциклильную группу, замещенную 1 или 2 заместителями, выбранными из <группы заместителей α> (указанные гетероциклильные группы могут быть замещены 1 или 2 оксогруппами), его фармакологически приемлемые соли или его пролекарства;

(10) соединение, где R3 представляет собой замещенную C1-C6 алкильную группу {указанный заместитель представляет собой 4-7-членную гетероциклильную группу, содержащую по меньшей мере один атом азота, которая может быть замещена 1 или 2 заместителями, выбранными из <группы заместителей α1> (указанная гетероциклильная группа может быть замещена одной оксогруппой), гетероарильную группу, содержащую по меньшей мере один атом азота, которая может быть замещена 1 или 2 заместителями, выбранными из <группы заместителей α1>, карбоксигруппу, C2-C7 алкоксикарбонильную группу, цианогруппу, гидроксильную группу, С1-С6 алкоксигруппу или группу формулы R9-CO-(CH2)k-N(R10)- (где R9 представляет собой гидроксильную группу или С1-С6 алкоксигруппу; R10 представляет собой С1-С6 алкильную группу; и k равно целому числу от 1 до 5)}, или 4-7-членную гетероциклильную группу, содержащую по меньшей мере один атом азота, которая может быть замещена одним заместителем, выбранным из <группы заместителей α1> (указанная гетероциклильная группа может быть замещена одной оксогруппой), и

<группа заместителей α1> представляет собой группу, состоящую из карбоксигруппы, C2-C7 алкоксикарбонильной группы и группы формулы R4-CO-CR5R6-(CH2)m- (где R4 представляет собой гидроксильную группу, аминогруппу, C1-C6 алкиламиногруппу, ди(C1-C6 алкил)аминогруппу, гидроксиаминогруппу, C1-C6 алкоксиаминогруппу или С1-С6 алкоксигруппу; R5 и R6, каждый, представляет собой атом водорода; и m равно целому числу от 0 до 5), его фармакологически приемлемые соли или его пролекарства;

(11) соединение, где R3 представляет собой замещенную C1-C3 алкильную группу {указанный заместитель представляет собой пирролидинильную, пиперидинильную, морфолинильную, тиоморфолинильную, пиперазинильную, пиразолильную, триазолильную или тетразолильную группу, которая может быть замещена 1 или 2 заместителями, выбранными из <группы заместителей α2> (указанная пирролидинильная, пиперидинильная, морфолинильная, тиоморфолинильная или пиперазинильная группа может быть замещена одной оксогруппой), карбоксигруппу, C2-C4 алкоксикарбонильную группу, гидроксильную группу или группу формулы R9-CO-(CH2)k-N(R10)- (где R9 представляет собой гидроксильную группу или C1-C3 алкоксигруппу; R10 представляет собой C1-C3 алкильную группу; и k равно целому числу от 1 до 3)}, или пирролидинильную, пиперидинильную, морфолинильную, тиоморфолинильную или пиперазинильную группу, которая может быть замещена одним заместителем, выбранным из <группы заместителей α2> (указанная пирролидинильная, пиперидинильная, морфолинильная, тиоморфолинильная или пиперазинильная группа может быть замещена одной оксогруппой), и

<группа заместителей α2> представляет собой группу, состоящую из карбоксигруппы, C2-C4 алкоксикарбонильной группы и группы формулы R4-CO-CR5R6-(CH2)m- (где R4 представляет собой гидроксильную группу или C1-C3 алкоксигруппу, R5 и R6, каждый, представляет собой атом водорода, и m равно целому числу от 0 до 2), его фармакологически приемлемые соли или его пролекарства;

(12) соединение, где R3 представляет собой замещенную метильную или этильную группу {указанный заместитель представляет собой пирролидинильную, пиперидинильную, пиперазинильную или пиразолильную группу, которая может быть замещена 1 или 2 заместителями, выбранными из <группы заместителей α3> (указанная пирролидинильная, пиперидинильная или пиперазинильная группа может быть замещена одной оксогруппой), карбоксигруппу или группу формулы R9-CO-(CH2)k-N(R10)- (где R9 представляет собой гидроксильную группу, метоксигруппу или этоксигруппу; R10 представляет собой метильную группу, этильную группу или изопропильную группу; и k равно целому числу от 1 до 3), и

<группа заместителей α3> представляет собой группу, состоящую из карбоксигруппы, метоксикарбонильной группы, этоксикарбонильной группы, карбоксиметильной группы, метоксикарбонилметильной группы, этоксикарбонилметильной группы, 2-(карбокси)этильной группы, 2-(метоксикарбонил)этильной группы и 2-(этоксикарбонил)этильной группы, его фармакологически приемлемые соли или его пролекарства;

(13) соединение, где X1, X2, X3, X4 и X5 представляют собой, независимо, атом водорода или атом галогена, его фармакологически приемлемые соли или его пролекарства;

(14) соединение, где X1 и X2 представляют собой, независимо, атом водорода или атом галогена; и X3, X4 и X5 представляют собой атом водорода, его фармакологически приемлемые соли или его пролекарства;

(15) соединение, где X1 представляет собой атом галогена; и X2, X3, X4 и X5 представляют собой атом водорода, его фармакологически приемлемые соли или его пролекарства;

(16) соединение, где X1 представляет собой атом фтора; и X2, X3, X4 и X5 представляют собой атом водорода, его фармакологически приемлемые соли или его пролекарства;

(17) соединение, где n равно 0 или 1, его фармакологически приемлемые соли или его пролекарства; и

(18) соединение, где n равно 1, его фармакологически приемлемые соли или его пролекарства.

Кроме того, в каждой группе (1)-(5), (6)-(8), (9)-(12), (13)-(16) и (17)-(18), описанной выше, более предпочтительное соединение обозначено большим числом [аналогичный принцип применяется к каждой группе (19)-(22), описанной ниже]. Соединение, полученное выбором R1 из каждой группы (1)-(5); R2 из каждой группы (6)-(8); R3 из каждой группы (9)-(12); X1, X2, X3, X4 и X5 из каждой группы (13)-(16); и n из каждой группы (17)-(18), соответственно, и последующего произвольного объединения этих выбранных групп, также является предпочтительным, и может представлять собой, например, следующее:

(19) соединение, где R1 представляет собой C3-C6 циклоалкильную группу или С1-С6 алкоксигруппу;

R2 представляет собой атом водорода или С1-С6 алкильную группу;

R3 представляет собой замещенную C1-C6 алкильную группу {указанный заместитель представляет собой гетероциклильную группу или гетероциклильную группу, замещенную 1 или 2 заместителями, выбранными из <группы заместителей α> (указанные гетероциклильные группы могут быть замещены 1 или 2 оксогруппами), гетероарильную группу или гетероарильную группу, замещенную 1 или 2 заместителями, выбранными из <группы заместителей α>, или заместителем, выбранным из <группы заместителей β>}, или гетероциклильную группу или гетероциклильную группу, замещенную 1 или 2 заместителями, выбранными из <группы заместителей α> (указанные гетероциклильные группы могут быть замещены 1 или 2 оксогруппами);

X1 и X2 представляют собой, независимо, атом водорода или атом галогена;

X3, X4, и X5 представляют собой атом водорода; и

n равно 0 или 1, его фармацевтически приемлемая соль или его пролекарство;

(20) соединение, где R1 представляет собой циклопропильную группу или метоксигруппу;

R2 представляет собой атом водорода или метильную группу;

R3 представляет собой замещенную C1-C6 алкильную группу {указанный заместитель представляет собой 4-7-членную гетероциклильную группу, содержащую по меньшей мере один атом азота, которая может быть замещена 1 или 2 заместителями, выбранными из <группы заместителей α1> (указанная гетероциклильная группа может быть замещена одной оксогруппой), гетероарильную группу, содержащую по меньшей мере один атом азота, которая может быть замещена 1 или 2 заместителями, выбранными из <группы заместителей α1>, карбоксигруппу, C2-C7 алкоксикарбонильную группу, цианогруппу, гидроксильную группу, С1-С6 алкоксигруппу или группу формулы R9-CO-(CH2)k-N(R10)- (где R9 представляет собой гидроксильную группу или С1-С6 алкоксигруппу; R10 представляет собой С1-С6 алкильную группу; и k равно целому числу от 1 до 5)}, или 4-7-членную гетероциклильную группу, содержащую по меньшей мере один атом азота, которая может быть замещена одним заместителем, выбранным из <группы заместителей α1> (указанная гетероциклильная группа может быть замещена одной оксогруппой), и

<группа заместителей α1> представляет собой группу, состоящую из карбоксигруппы, C2-C7 алкоксикарбонильной группы и группы формулы R4-CO-CR5R6-(CH2)m- (где R4 представляет собой гидроксильную группу, аминогруппу, C1-C6 алкиламиногруппу, ди(C1-C6 алкил)аминогруппу, гидроксиаминогруппу, C1-C6 алкоксиаминогруппу или С1-С6 алкоксигруппу; R5 и R6, каждый, представляет собой атом водорода; и m равно целому числу от 0 до 5);

X1 представляет собой атом галогена;

X2, X3, X4 и X5 представляют собой атом водорода; и

n равно 1, его фармакологически приемлемые соли или его пролекарства;

(21) соединение, где R1 представляет собой циклопропильную группу;

R2 представляет собой атом водорода;

R3 представляет собой замещенную C1-C3 алкильную группу {указанный заместитель представляет собой пирролидинильную, пиперидинильную, морфолинильную, тиоморфолинильную, пиперазинильную, пиразолильную, триазолильную или тетразолильную группу, которая может быть замещена 1 или 2 заместителями, выбранными из <группы заместителей α2> (указанная пирролидинильная, пиперидинильная, морфолинильная, тиоморфолинильная или пиперазинильная группа может быть замещена одной оксогруппой), карбоксигруппу, C2-C4 алкоксикарбонильную группу, гидроксильную группу или группу формулы R9-CO-(CH2)k-N(R10)- (где R9 представляет собой гидроксильную группу или C1-C3 алкоксигруппу; R10 представляет собой C1-C3 алкильную группу; и k равно целому числу от 1 до 3)}, или пирролидинильную, пиперидинильную, морфолинильную, тиоморфолинильную или пиперазинильную группу, которая может быть замещена одним заместителем, выбранным из <группы заместителей α2> (указанная пирролидинильная, пиперидинильная, морфолинильная, тиоморфолинильная или пиперазинильная группа может быть замещена одной оксогруппой), и

<группа заместителей α2> представляет собой группу, состоящую из карбоксигруппы, C2-C4 алкоксикарбонильной группы и группы формулы R4-CO-CR5R6-(CH2)m- (где R4 представляет собой гидроксильную группу или C1-C3 алкоксигруппу, R5 и R6, каждый, представляет собой атом водорода, и m равно целому числу от 0 до 2);

X1 представляет собой атом фтора;

X2, X3, X4 и X5 представляют собой атом водорода; и

n равно 1, его фармакологически приемлемые соли или его пролекарства, и

(22) соединение, где R1 представляет собой циклопропильную группу;

R2 представляет собой атом водорода;

R3 представляет собой замещенную метильную или этильную группу {указанный заместитель представляет собой пирролидинильную, пиперидинильную, пиперазинильную или пиразолильную группу, которая может быть замещена 1 или 2 заместителями, выбранными из <группы заместителей α3> (указанная пирролидинильная, пиперидинильная или пиперазинильная группа может быть замещена одной оксогруппой), карбоксигруппу или группу формулы R9-CO-(CH2)k-N(R10)- (где R9 представляет собой гидроксильную группу, метоксигруппу или этоксигруппу; R10 представляет собой метильную группу, этильную группу или изопропильную группу; и k равно целому числу от 1 до 3), и

<группа заместителей α3> представляет собой группу, состоящую из карбоксигруппы, метоксикарбонильной группы, этоксикарбонильной группы, карбоксиметильной группы, метоксикарбонилметильной группы, этоксикарбонилметильной группы, 2-(карбокси)этильной группы, 2-(метоксикарбонил)этильной группы и 2-(этоксикарбонил)этильной группы;

X1 представляет собой атом фтора;

X2, X3, X4 и X5 представляют собой атом водорода; и

n равно 1, его фармакологически приемлемые соли или его пролекарства.

Кроме того, другой аспект настоящего изобретения относится к лекарственному средству, содержащему соединение, его фармакологически приемлемые соли или его пролекарства, описанному в (1)-(22) выше (предпочтительно, антитромботическое средство); применению соединения, его фармакологически приемлемых солей или его пролекарств для получения фармацевтических композиций; применению соединения, его фармакологически приемлемых солей или его пролекарств для средств профилактики или терапии заболеваний, связанных с тромбообразованием или образованием эмбола; и способам профилактики или терапии заболеваний (в частности заболеваний, связанных с тромбообразованием или образованием эмбола) путем введения фармакологически эффективной дозы соединения, его фармакологически приемлемых солей или его пролекарств теплокровным животным (в частности, человеку).

«C1-C6 алкильная группа» в общей формуле (I), показанной выше, может представлять собой, например, алкильную группу с прямой или разветвленной цепью, содержащую от 1 до 6 атомов углерода, такую как метильная, этильная, пропильная, изопропильная, бутильная, изобутильная, втор-бутильная, трет-бутильная, пентильная, изопентильная, 2-метилбутильная, неопентильная, 1-этилпропильная, гексильная, 4-метилпентильная, 3-метилпентильная, 2-метилпентильная, 1-метилпентильная, 3,3-диметилбутильная, 2,2-диметилбутильная, 1,1-диметилбутильная, 1,2-диметилбутильная, 1,3-диметилбутильная, 2,3-диметилбутильная или 2-этилбутильная группа, и представляет собой, предпочтительно, алкильную группу с прямой или разветвленной цепью, содержащую от 1 до 4 атомов углерода, более предпочтительно, алкильную группу с прямой или разветвленной цепью, содержащую от 1 до 3 атомов углерода, еще более предпочтительно, метильную или этильную группу, и, наиболее предпочтительно, метильную группу.

«Атом галогена» в общей формуле (I), показанной выше, может представлять собой, например, атом фтора, атом хлора, атом брома или атом йода, и, предпочтительно, атом фтора или атом хлора, и, более предпочтительно, атом фтора.

«C1-C6 алкоксигруппа» в общей формуле (I), показанной выше, обозначает группу, где указанная «C1-C6 алкильная группа» связана с атомом кислорода и может представлять собой, например, алкоксигруппу с прямой или разветвленной цепью, содержащую от 1 до 6 атомов углерода, такую как метокси, этокси, н-пропокси, изопропокси, н-бутокси, изобутокси, втор-бутокси, трет-бутокси, н-пентилокси, изопентилокси, 2-метилбутокси, неопентилокси, н-гексилокси, 4-метилпентилокси, 3-метилпентилокси, 2-метилпентилокси, 3,3-диметилбутокси, 2,2-диметилбутокси, 1,1-диметилбутокси, 1,2-диметилбутокси, 1,3-диметилбутокси или 2,3-диметилбутокси группа, и представляет собой, предпочтительно, алкоксигруппу с прямой или разветвленной цепью, содержащую от 1 до 4 атомов углерода, более предпочтительно, алкоксигруппу с прямой или разветвленной цепью, содержащую от 1 до 3 атомов углерода, и, наиболее предпочтительно, метокси или этокси группу.

«C3-C6 циклоалкильная группа» в общей формуле (I), показанной выше, может представлять собой, например, 3-6-членную насыщенную циклическую углеводородную группу, такую как циклопропильная, циклобутильная, циклопентильная или циклогексильная группа, и представляет собой, предпочтительно, циклопропильную группу.

«C6-C10 арильная группа» в общей формуле (I), показанной выше, может представлять собой, например, ароматическую углеводородную группу, содержащую от 6 до 10 атомов углерода, такую как фенильная или нафтильная группа, и представляет собой, предпочтительно, фенильную группу.

«C2-C7 алкоксикарбонильная группа» в общей формуле (I), показанной выше, может представлять собой, например, алкоксикарбонильную группу с прямой или разветвленной цепью, содержащую от 2 до 7 атомов углерода, такую как метоксикарбонильная, этоксикарбонильная, н-пропоксикарбонильная, изопропоксикарбонильная, н-бутоксикарбонильная, изобутоксикарбонильная, втор-бутоксикарбонильная, трет-бутоксикарбонильная, н-пентилоксикарбонильная, изопентилоксикарбонильная, 2-метилбутоксикарбонильная, неопентилоксикарбонильная, н-гексилоксикарбонильная, 4-метилпентилоксикарбонильная, 3-метилпентилоксикарбонильная, 2-метилпентилоксикарбонильная, 3,3-диметилбутоксикарбонильная, 2,2-диметилбутоксикарбонильная, 1,1-диметилбутоксикарбонильная, 1,2-диметилбутоксикарбонильная, 1,3-диметилбутоксикарбонильная или 2,3-диметилбутоксикарбонильная группа, и представляет собой, предпочтительно, алкоксикарбонильную группу с прямой или разветвленной цепью, содержащую от 2 до 5 атомов углерода, более предпочтительно, алкоксикарбонильную группу с прямой или разветвленной цепью, содержащую от 2 до 4 атомов углерода, и, еще более предпочтительно, метоксикарбонильную или этоксикарбонильную группу.

«Галоген C1-C6 алкильная группа» в общей формуле (I), показанной выше, обозначает группу, в которой указанная «C1-C6 алкильная группа» замещена атомом(ами) галогена, и может представлять собой, например, трифторметильную, трихлорметильную, дифторметильную, дихлорметильную, дибромметильную, фторметильную, 2,2,2-трифторэтильную, 2,2,2-трихлорэтильную, 2-бромэтильную, 2-хлорэтильную, 2-фторэтильную, 2-йодэтильную, 3-хлорпропильную, 4-фторбутильную, 6-йодгексил или 2,2-дибромэтильную группу, и представляет собой, предпочтительно, трифторметильную группу.

«Гетероарильная группа» в общей формуле (I), показанной выше, может представлять собой, например, 5-7-членную ароматическую гетероциклическую группу, содержащую от 1 до 4 атом(ов) серы, атом(ов) кислорода и/или атом(ов) азота, такую как фурильная, тиенильная, пирролильная, пиразолильная, имидазолильная, оксазолильная, изоксазолильная, тиазолильная, изотиазолильная, триазолильная, тетразолильная, тиадиазолильная, оксадиазолильная, пиранильная, пиридильная, пиридазинильная, пиримидинильная или пиразинильная группа, или ароматическую гетероциклическую группу, конденсированную с другими циклическими группами, такую как изоиндолильная, индолильная, изохинолильная и хинолильная группа, и представляет собой, предпочтительно, 5-7-членную ароматическую гетероциклическую группу, содержащую по меньшей мере один атом азота, и, более предпочтительно, пиразолильную, триазолильную или тетразолильную группу.

«Галоген C1-C6 алкоксигруппа» в общей формуле (I), показанной выше, обозначает группу, в которой указанная «C1-C6 алкоксигруппа» замещена атомом(ами) галогена, и может представлять собой, например, трифторметокси, трихлорметокси, дифторметокси, дихлорметокси, дибромметокси, фторметокси, 2,2,2-трихлорэтокси, 2,2,2-трифторэтокси, 2-бромэтокси, 2-хлорэтокси, 2-фторэтокси или 2,2-дибромэтоксигруппу, и представляет собой, предпочтительно, 2-бромэтокси, 2-хлорэтокси или 2-фторэтокси группу.

«Гидрокси C1-C6 алкильная группа» в общей формуле (I), показанной выше, обозначает группу, в которой указанная «C1-C6 алкильная группа» замещена гидроксильной группой(ами), и может представлять собой, например, гидроксиметильную, 1-гидроксиэтильную, 2-гидроксиэтильную, 1-гидрокси-2-метилэтильную, 2-гидрокси-2-метилэтильную, 1-гидроксипропильную, 2-гидроксипропильную, 3-гидроксипропильную, 1-гидроксибутильную, 2-гидроксибутильную, 3-гидроксибутильную, 4-гидроксибутильную, 5-гидроксипентильную или 6-гидроксигексильную группу, и представляет собой, предпочтительно, гидроксиметильную, 2-гидроксиэтильную или 3-гидроксипропильную группу.

«C2-C12 алкоксиалкильная группа» в общей формуле (I), показанной выше, обозначает группу, в которой указанная «C1-C6 алкоксигруппа» связана с вышеуказанной «C1-C6 алкильной группой» и может представлять собой, например, метоксиметильную, этоксиметильную, н-пропоксиметильную, изопропоксиметильную, н-бутоксиметильную, изобутоксиметильную, втор-бутоксиметильную, трет-бутоксиметильную, н-пентилоксиметильную, изопентилоксиметильную, 2-метилбутоксиметильную, неопентилоксиметильную, н-гексилоксиметильную, 4-метилпентилоксиметильную, 3-метилпентилоксиметильную, 2-метилпентилоксиметильную, 3,3-диметилбутоксиметильную, 2,2-диметилбутоксиметильную, 1,1-диметилбутоксиметильную, 1,2-диметилбутоксиметильную, 1,3-диметилбутоксиметильную, 2,3-диметилбутоксиметильную, 2-метоксиэтильную, 2-этоксиэтильную, 2-(н-пропокси)этильную, 2-(изопропокси)этильную, 2-(н-бутокси)этильную, 2-(изобутокси)этильную, 2-(втор-бутокси)этильную, 2-(трет-бутокси)этильную, 2-(н-пентилокси)этильную, 2-(изопентилокси)этильную, 2-(2-метилбутокси)этильную, 2-(неопентилокси)этильную, 2-(н-гексилокси)этильную, 2-(4-метилпентилокси)этильную, 2-(3-метилпентилокси)этильную, 2-(2-метилпентилокси)этильную, 2-(3,3-диметилбутокси)этильную, 2,2-диметилбутоксиэтильную, 1,1-диметилбутоксиэтильную, 1,2-диметилбутоксиэтильную, 1,3-диметилбутоксиэтильную или 2,3-диметилбутоксиэтильную группу, и представляет собой, предпочтительно, алкоксиалкильную группу с прямой или разветвленной цепью, содержащую от 2 до 4 атомов углерода, и, более предпочтительно, метоксиметильную или метоксиэтильную группу.

«C2-C7 алканоильная группа» в общей формуле (I), показанной выше, может представлять собой, например, алканоильную группу с прямой или разветвленной цепью, содержащую от 2 до 7 атомов углерода, такую как ацетильную, пропионильную, бутирильную, изобутирильную, пентаноильную, пивалоильную, валерильную, изовалерильную, гексаноильную или гептаноильную группу, и представляет собой, предпочтительно, алканоильную группу с прямой или разветвленной цепью, содержащую от 2 до 5 атомов углерода, более предпочтительно, алканоильную группу с прямой или разветвленной цепью, содержащую от 2 до 4 атомов углерода, и, еще более предпочтительно, ацетильную группу.

«C4-C7 циклоалкилкарбонильная группа» в общей формуле (I), показанной выше, обозначает группу, в которой указанная «C3-C6 циклоалкильная группа» связана с карбонильной группой, и может представлять собой, например, циклопропилкарбонильную, циклобутилкарбонильную, циклопентилкарбонильную или циклогексилкарбонильную группу, и представляет собой, предпочтительно, циклопропилкарбонильную группу.

«C2-C7 алкилкарбамоильная группа» в общей формуле (I), показанной выше, обозначает группу, в которой одна «C1-C6 алкильная группа» связана с карбамоильной группой, и может представлять собой, например, метилкарбамоильную, этилкарбамоильную, пропилкарбамоильную, изопропилкарбамоильную, бутилкарбамоильную, изобутилкарбамоильную, втор-бутилкарбамоильную, трет-бутилкарбамоильную, пентилкарбамоильную, изопентилкарбамоильную, 2-метилбутилкарбамоильную, неопентилкарбамоильную, 1-этилпропилкарбамоильную, гексилкарбамоильную, 4-метилпентилкарбамоильную, 3-метилпентилкарбамоильную, 2-метилпентилкарбамоильную, 1-метилпентилкарбамоильную, 3,3-диметилбутилкарбамоильную, 2,2-диметилбутилкарбамоильную, 1,1-диметилбутилкарбамоильную, 1,2-диметилбутилкарбамоильную, 1,3-диметилбутилкарбамоильную, 2,3-диметилбутилкарбамоильную или 2-этилбутилкарбамоильную группу, и представляет собой, предпочтительно, алкилкарбамоильную группу, содержащую от 2 до 5 атомов углерода, и, более предпочтительно, метилкарбамоильную или этилкарбамоильную группу.

«Ди(C1-C6 алкил)карбамоильная группа» в общей формуле (I), показанной выше, обозначает группу, в которой карбамоильная группа дизамещена двумя «C1-C6 алкильными группами», и может представлять собой, например, диметилкарбамоильную, метилэтилкарбамоильную, диэтилкарбамоильную, ди-н-пропилкарбамоильную, диизопропилкарбамоильную, N-(н-пропил)-N-этилкарбамоильную, ди-н-бутилкарбамоильную, диизобутилкарбамоильную, ди-втор-бутилкарбамоильную, ди-трет-бутилкарбамоильную, ди-н-пентилкарбамоильную, диизопентилкарбамоильную, ди-2-метилбутилкарбамоильную, динеопентилкарбамоильную, ди-1-этилпропилкарбамоильную, ди-н-гексилкарбамоильную, ди-4-метилпентилкарбамоильную, ди-3-метилпентилкарбамоильную, ди-2-метилпентилкарбамоильную, ди-1-метилпентилкарбамоильную, ди-3,3-диметилбутилкарбамоильную, ди-2,2-диметилбутилкарбамоильную, ди-1,1-диметилбутилкарбамоильную, ди-1,2-диметилбутилкарбамоильную, ди-1,3-диметилбутилкарбамоильную, ди-2,3-диметилбутилкарбамоильную или ди-2-этилбутилкарбамоильную группу, и представляет собой, предпочтительно, диметилкарбамоильную, метилэтилкарбамоильную или диэтилкарбамоильную группу.

«C1-C6 алкиламиногруппа» в общей формуле (I), показанной выше, обозначает группу, в которой одна «C1-C6 алкильная группа» связана с аминогруппой, и может представлять собой, например, алкиламиногруппу с прямой или разветвленной цепью, содержащую от 1 до 6 атомов углерода, такую как метиламино, этиламино, пропиламино, изопропиламино, бутиламино, изобутиламино, втор-бутиламино, трет-бутиламино, пентиламино, изопентиламино, 2-метилбутиламино, неопентиламино, 1-этилпропиламино, гексиламино, 4-метилпентиламино, 3-метилпентиламино, 2-метилпентиламино, 1-метилпентиламино, 3,3-диметилбутиламино, 2,2-диметилбутиламино, 1,1-диметилбутиламино, 1,2-диметилбутиламино, 1,3-диметилбутиламино, 2,3-диметилбутиламино или 2-этилбутиламино группа, и представляет собой, предпочтительно, алкиламиногруппу с прямой или разветвленной цепью, содержащую от 1 до 4 атомов углерода, более предпочтительно, алкиламиногруппу с прямой или разветвленной цепью, содержащую от 1 до 3 атомов углерода, и, еще более предпочтительно, метиламиногруппу.

«Ди(C1-C6 алкил)аминогруппа» в общей формуле (I), показанной выше, обозначает группу, в которой аминогруппа замещена двумя «C1-C6 алкильными группами», и может представлять собой, например, диметиламино, метилэтиламино, диэтиламино, ди-н-пропиламино, диизопропиламино, N-(н-пропил)-N-этиламино, ди-н-бутиламино, диизобутиламино, ди-втор-бутиламино, ди-трет-бутиламино, ди-н-пентиламино, диизопентиламино, ди-2-метилбутиламино, динеопентиламино, ди-1-этилпропиламино, ди-н-гексиламино, ди-4-метилпентиламино, ди-3-метилпентиламино, ди-2-метилпентиламино, ди-1-метилпентиламино, ди-3,3-диметилбутиламино, ди-2,2-диметилбутиламино, ди-1,1-диметилбутиламино, ди-1,2-диметилбутиламино, ди-1,3-диметилбутиламино, ди-2,3-диметилбутиламино или ди-2-этилбутиламино группу, и представляет собой, предпочтительно, диметиламино, метилэтиламино или диэтиламино группу.

«C1-C6 алкоксиаминогруппа» в общей формуле (I), показанной выше, обозначает группу, в которой атом кислорода в гидроксиаминогруппе замещен указанной «C1-C6 алкильной группой», и может представлять собой, например, метоксиамино, этоксиамино, н-пропоксиамино, изопропоксиамино, н-бутоксиамино, изобутоксиамино, втор-бутоксиамино, трет-бутоксиамино, н-пентилоксиамино, изопентилоксиамино, 2-метилбутоксиамино, неопентилоксиамино, n-гексилоксиамино, 4-метилпентилоксиамино, 3-метилпентилоксиамино, 2-метилпентилоксиамино, 3,3-диметилбутоксиамино, 2,2-диметилбутоксиамино, 1,1-диметилбутоксиамино, 1,2-диметилбутоксиамино, 1,3-диметилбутоксиамино или 2,3-диметилбутоксиамино группу, и представляет собой, предпочтительно, алкоксиаминогруппу с прямой или разветвленной цепью, содержащую от 1 до 4 атомов углерода, более предпочтительно, алкоксиаминогруппу с прямой или разветвленной цепью, содержащую от 1 до 3 атомов углерода, и, еще более предпочтительно, метоксиаминогруппу.

«Сульфамоил C1-C6 алкильная группа» в общей формуле (I), показанной выше, обозначает группу, в которой указанная «C1-C6 алкильная группа» замещена сульфамоильной(ыми) группой(ами), и может представлять собой, например, сульфамоилметильную, 1-сульфамоилэтильную, 2-сульфамоилэтильную, 1-сульфамоил-2-метилэтильную, 2-сульфамоил-2-метилэтильную, 1-сульфамоилпропильную, 2-сульфамоилпропильную, 3-сульфамоилпропильную, 1-сульфамоилбутильную, 2-сульфамоилбутильную, 3-сульфамоилбутильную, 4-сульфамоилбутильную, 5-сульфамоилпентильную или 6-сульфамоилгексильную группу, и представляет собой, предпочтительно, сульфамоилалкильную группу, содержащую от 1 до 4 атомов углерода, более предпочтительно, сульфамоилалкильную группу, содержащую от 1 до 3 атомов углерода, и, еще более предпочтительно, сульфамоилметильную, 2-сульфамоилэтильную или 3-сульфамоилпропильную группу.

«Гетероциклильная группа» в общей формуле (I), показанной выше, может представлять собой, например, частично или полностью восстановленную 4-7-членную гетероциклическую группу, содержащую от 1 до 3 атомов серы, атомов кислорода и/или атомов азота, такую как морфолинильная, тиоморфолинильная, азетидинильная, пирролидинильная, пирролинильная, имидазолидинильная, имидазолинильная, пирразолидинильная, пирразолинильная, пиперидильная, пиперазинильная, гомопиперазинильная или гомопиперидинильная группа, и представляет собой, предпочтительно, 4-7-членную гетероциклильную группу, содержащую по меньшей мере один атом азота, более предпочтительно, морфолинильную, тиоморфолинильную, пирролидинильную, пирролинильную, имидазолидинильную, имидазолинильную, пирразолидинильную, пирразолинильную, пиперидильную или пиперазинильную группу и, более предпочтительно, пирролидинильную, пиперидинильную, морфолинильную, тиоморфолинильную или пиперазинильную группу.

«Гетероциклильная группа (указанная гетероциклильная группа может быть замещена от 1 до 4 оксогруппами)» в общей формуле (I), показанной выше, может представлять собой оксопиперазинильную или диоксопиперазинильную группу, в дополнение к указанной «гетероциклильной группе»; и представляет собой, предпочтительно, 2-оксо-1-пиперазино, 3-оксо-1-пиперазино или 2,5-диоксо-1-пиперазино группу; и, более предпочтительно, 2-оксо-1-пиперазино или 3-оксо-1-пиперазино группу.

Группа заместителей α в общей формуле (I), показанной выше, представляет собой, предпочтительно, группу, состоящую из карбоксигруппы, C2-C7 алкоксикарбонильной группы и группы формулы R4-CO-CR5R6-(CH2)m- (где R4 представляет собой гидроксильную группу, аминогруппу, C1-C6 алкиламиногруппу, ди(C1-C6 алкил)аминогруппу, гидроксиаминогруппу, C1-C6 алкоксиаминогруппу или С1-С6 алкоксигруппу; R5 и R6, каждый, представляет собой атом водорода; и m равно целому числу от 0 до 5), более предпочтительно, группу, состоящую из карбоксигруппы, C2-C4 алкоксикарбонильной группы и группы формулы R4-CO-CR5R6-(CH2)m- (где R4 представляет собой гидроксильную группу или C1-C3 алкоксигруппу; каждый R5 и R6 представляет собой атом водорода; и m равно целому числу от 0 до 2), и, еще более предпочтительно, группу, состоящую из карбоксигруппы, метоксикарбонильной группы, этоксикарбонильной группы, карбоксиметильной группы, метоксикарбонилметильной группы, этоксикарбонилметильной группы, 2-(карбокси)этильной группы, 2-(метоксикарбонил)этильной группы и 2-(этоксикарбонил)этильной группы.

Группа заместителей β в общей формуле (I), показанной выше, представляет собой, предпочтительно, группу, состоящую из карбоксигруппы, C2-C7 алкоксикарбонильной группы, цианогруппы, гидроксильной группы, С1-С6 алкоксигруппы и группы формулы R9-CO-(CH2)k-N(R10)- (где R9 представляет собой гидроксильную группу или С1-С6 алкоксигруппу; R10 представляет собой С1-С6 алкильную группу; и k равно целому числу от 1 до 5), более предпочтительно, группу, состоящую из карбоксигруппы, С2-C4 алкоксикарбонильной группы, гидроксильной группы и группы формулы R9-CO-(CH2)k-N(R10)- (где R9 представляет собой гидроксильную группу или C1-C3 алкоксигруппу; R10 представляет собой С1-C3 алкильную группу; и k равно целому числу от 1 до 3), и, более предпочтительно, группу, состоящую из карбоксигруппы и группы формулы R9-CO-(CH2)k-N(R10)- (где R9 представляет собой гидроксильную группу, метоксигруппу или этоксигруппу; R10 представляет собой метильную группу, этильную группу или изопропильную группу; и k равно целому числу от 1 до 3).

Соединения (I) по настоящему изобретению могут иметь оптические изомеры (включая диастереоизомеры) благодаря наличию асимметрических атомов углерода в своих структурах, и, кроме того, эти же соединения также могут иметь геометрические изомеры благодаря наличию двойной углерод-углеродной связи. Настоящее изобретение включает все эти изомеры.

Ввиду того, что в структуре некоторых соединений (I) по настоящему изобретению содержатся различные группы, такие как сульфанильная группа, карбоксигруппа, гидроксильная группа или аминогруппа, термин «его пролекарство» подразумевает производное, в котором любая из таких групп преобразована с помощью соответствующей функциональной группы, которая может отщепляться в результате биологического процесса, такого как гидролиз in vivo. В этих случаях можно определить, является ли производное «соответствующей функциональной группой, которая может быть отщеплена в результате биологического процесса, такого как гидролиз in vivo» или нет, в соответствии с тем, можно ли определить исходное соединение или его фармацевтически приемлемую соль при введении данного производного подопытному животному, такому как крыса или мышь, путем внутривенной инъекции, подкожной инъекции или путем перорального введения, и последующего измерения жидкости в организме животного.

Когда в структуре соединений (I) по настоящему изобретению имеется сульфанильная группа, то функциональная группа, используемая для образования пролекарства, конкретно не ограничивается, и может представлять собой, например, «алифатическую ацильную группу», включая алканоильную группу, такую как формильную, ацетильную, пропионильную, бутирильную, изобутирильную, пентаноильную, пивалоильную, валерильную, изовалерильную, октаноильную, нонаноильную, деканоильную, 3-метилнонаноильную, 8-метилнонаноильную, 3-этилоктаноильную, 3,7-диметилоктаноильную, ундеканоильную, додеканоильную, тридеканоильную, тетрадеканоильную, пентадеканоильную, гексадеканоильную, 1-метилпентадеканоильную, 14-метилпентадеканоильную, 13,13-диметилтетрадеканоильную, гептадеканоильную, 15-метилгексадеканоильную, октадеканоильную, 1-метилгептадеканоильную, нонадеканоильную, икосаноильную или геникосаноильную группу; алкилкарбонильную группу, замещенную карбоксигруппой, такую как сукциноильная, глутароильная или адипоильная группа; карбонильную группу, замещенную галоген низшей алкильной группой, такую как хлорацетильная, дихлорацетильная, трихлорацетильная или трифторацетильная группа; насыщенную циклическую углеводород-карбонильную группу, такую как циклопропилкарбонильная, циклобутилкарбонильная, циклопентилкарбонильная, циклогексилкарбонильная, циклогептилкарбонильная или циклооктилкарбонильная группа; алкилкарбонильную группу, замещенную низшей(ими) алкоксигруппой(ами), такую как метоксиацетильная группа; и ненасыщенную алкилкарбонильную группу, такую как (E)-2-метил-2-бутеноильная группа (предпочтительно, C1-C6 алканоильная группа); «карбонилоксиалкильную группу», включая оксодиоксоленилметильную группу, такую как (5-метил-2-оксо-1,3-диоксолен-4-ил)метильная или (5-фенил-2-оксо-1,3-диоксолен-4-ил)метильная группа; «ароматическую ацильную группу», включая арилкарбонильную группу, такую как бензоил, α-нафтоил, β-нафтоил, пиридоил, тиеноил или фуроильная группа; галогенарилкарбонильную группу, такую как 2-бромбензоил или 4-хлорбензоильная группа; арилкарбонильную группу, замещенную низшей алкильной группой(ами), такой как 2,4,6-триметилбензоил или 4-толуоильная группа; низшую алкоксилированную арилкарбонильную группу, такую как 4-анизоильная группа; арилкарбонильную группу, замещенную карбокси группой(ами), такую как 2-карбоксибензоильная, 3-карбоксибензоильная или 4-карбоксибензоильная группа; нитрированную арилкарбонильную группу, такую как 4-нитробензоильная или 2-нитробензоильная группа; арилкарбонильную группу, замещенную низшей алкоксикарбонильной группой(ами), такую как 2-(метоксикарбонил)бензоильная группа; и арилкарбонильную группу, замещенную арильной группой(ами), такую как 4-фенилбензоильная группа (предпочтительно, арилкарбонильная группа); «аралкилкарбонильную группу», включая карбонильную группу, замещенную низшей алкильной группой, которая замещена от 1 до 3 арильными группами, такую как фенилацетильная, α-нафтилпропионильная, β-нафтилбутирильная, дифенилизобутирильная, трифенилацетильная, α-нафтилдифенилизобутирильная или 9-антрилпентаноильная группа; и низшую алкилкарбонильную группу, замещенную от 1 до 3 арильными группами, в которых арильное кольцо замещено низшей алкильной группой(ами), низшей алкоксигруппой(ами), нитрогруппой(ами), атомом(ами) галогена или цианогруппой(ами), такую как 4-метилфенилацетильная, 2,4,6-триметилфенилформильная, 3,4,5-триметилфенилбутирильная, 4-метоксифенилизобутирильная, 4-метоксифенилдифенилпивалоильная, 2-нитрофенилацетильная, 4-нитрофенилпропионильная, 4-хлорфенилбутирильная, 4-бромфенилацетильная или 4-цианофенилпентаноильная группа; «тетрагидропиранильную или тетрагидротиопиранильную группу», такую как тетрагидропиран-2-ильная, 3-бромтетрагидропиран-2-ильная, 4-метокситетрагидропиран-4-ильная, тетрагидротиопиран-2-ильная или 4-метокситетрагидротиопиран-4-ильная группа; «тетрагидрофуранильную или тетрагидротиофуранильную группу», такую как тетрагидрофуран-2-ильная или тетрагидротиофуран-2-ильная группа; «алкоксиметильную группу», включая низшую алкоксиметильную группу, такую как метоксиметильная, 1,1-диметил-1-метоксиметильная, этоксиметильная, пропоксиметильная, изопропоксиметильная, бутоксиметильная или трет-бутоксиметильная группа; низшую алкоксиметильную группу, замещенную низшей(ими) алкоксигруппой(ами), такой как 2-метоксиэтоксиметильная группа; и галоген низшую алкоксиметильную группу, такую как 2,2,2-трихлорэтоксиметильная или бис(2-хлорэтокси)метильная группа; «замещенную этильную группу», включая низшую алкоксилированную этильную группу, такую как 1-этоксиэтильная или 1-(изопропокси)этильная группа; и галогенированную этильную группу, такую как 2,2,2-трихлорэтильная группа; «аралкильную группу», включая низшую алкильную группу, замещенную от 1 до 3 арильными группами, такую как бензильная, α-нафтилметильная, β-нафтилметильная, дифенилметильная, трифенилметильная, α-нафтилдифенилметильная или 9-антрилметильная группа; и низшую алкильную группу, замещенную от 1 до 3 арильными группами, в которых арильное кольцо замещено низшей алкильной группой(ами), низшей алкоксигруппой(ами), нитрогруппой(ами), атомом(ами) галогена или цианогруппой(ами), такую как 4-метилбензильная, 2,4,6-триметилбензильная, 3,4,5-триметилбензильная, 4-метоксибензильная, 4-метоксифенилдифенилметильная, 2-нитробензильная, 4-нитробензильная, 4-хлорбензильная, 4-бромбензильная или 4-цианобензильная группа; «алкоксикарбонильную группу», включая низшую алкоксикарбонильную группу, такую как метоксикарбонильная, этоксикарбонильная, трет-бутоксикарбонильная или изобутоксикарбонильная группа; и низшую алкоксикарбонильную группу, замещенную атомом(ами) галогена или три-низшей алкилсилильной группой(ами), такую как 2,2,2-трихлорэтоксикарбонильная или 2-триметилсилилэтоксикарбонильная группа; «алкенилоксикарбонильную группу», такую как винилоксикарбонильная и аллилоксикарбонильная группа; «аралкилоксикарбонильную группу», в которой арильное кольцо может быть замещено 1 или 2 заместителями, выбранными из низших алкоксигрупп(ы) или нитрогрупп(ы), такую как бензилоксикарбонильная, 4-метоксибензилоксикарбонильная, 3,4-диметоксибензилоксикарбонильная, 2-нитробензилоксикарбонильная или 4-нитробензилоксикарбонильная группа; алкилсульфанильную группу с прямой или разветвленной цепью, содержащую от 1 до 6 атомов углерода, такую как метилсульфанильная, этилсульфанильная, н-пропилсульфанильная, изопропилсульфанильная, н-бутилсульфанильная, изобутилсульфанильная, втор-бутилсульфанильная, трет-бутилсульфанильная, н-пентилсульфанильная, изопентилсульфанильная, 2-метилбутилсульфанильная, неопентилсульфанильная, 1-этилпропилсульфанильная, н-гексилсульфанильная, 4-метилпентилсульфанильная, 3-метилпентилсульфанильная, 2-метилпентилсульфанильная, 1-метилпентилсульфанильная, 3,3-диметилбутилсульфанильная, 2,2-диметилбутилсульфанильная, 1,1-диметилбутилсульфанильная, 1,2-диметилбутилсульфанильная, 1,3-диметилбутилсульфанильная, 2,3-диметилбутилсульфанильная или 2-этилбутилсульфанильная группа; или «аминоацильную группу α-аминокислоты», такую как фенилаланин, и представляет собой, предпочтительно, группу, которая образует фармацевтически приемлемый сложный эфир, такую как «алифатическая ацильная группа» или «ароматическая ацильная группа», или «C1-C6 алкилсульфанильная группа», такая как метилсульфанильная, этилсульфанильная, н-пропилсульфанильная, изопропилсульфанильная, н-бутилсульфанильная, изобутилсульфанильная, втор-бутилсульфанильная или трет-бутилсульфанильная группа; более предпочтительно, группу, которая образует фармацевтически приемлемый сложный эфир; еще более предпочтительно, «C1-C6 алканоильную группу», такую как формильная, ацетильная, пропионильная, бутирильная, изобутирильная, пентаноильная или пивалоильная группа, или «арилкарбонильную группу», такую как бензоильная группа; особенно предпочтительно, «C1-C3 алканоильную группу» или бензоильную группу; и, наиболее предпочтительно, ацетильную группу.

Когда в структуре соединений (I) по настоящему изобретению имеется карбоксигруппа, то функциональными группами, используемыми для получения пролекарства, могут быть, например, «низшие алкильные группы», такие как метильная, этильная, н-пропильная, изопропильная, н-бутильная, изобутильная, втор-бутильная, трет-бутильная, н-пентильная, изопентильная, 2-метилбутильная, неопентильная, 1-этилпропильная, н-гексильная, 4-метилпентильная, 3-метилпентильная, 2-метилпентильная, 1-метилпентильная, 3,3-диметилбутильная, 2,2-диметилбутильная, 1,1-диметилбутильная, 1,2-диметилбутильная, 1,3-диметилбутильная, 2,3-диметилбутильная или 2-этилбутильная группа (предпочтительно С1-С6 алкильная группа); «алкокси низшая алкильная группа», включая низшую алкокси низшую алкильную группу, такую как метоксиметильная, 1-этоксиэтильная, 1-метил-1-метоксиэтильная, 1-(изопропокси)этильная, 2-метоксиэтильная, 2-этоксиэтильная, 1,1-диметил-1-метоксиметильная, этоксиметильная, н-пропоксиметильная, изопропоксиметильная, н-бутоксиметильная или трет-бутоксиметильная группа; низшая алкоксилированная низшая алкокси низшая алкильная группа, такая как 2-метоксиэтоксиметильная группа; «арил»окси «низшая алкильная группа», такая как феноксиметильная группа; и галогенированная низшая алкокси низшая алкильная группа, такая как 2,2,2-трихлорэтоксиметильная или бис(2-хлорэтокси)метильная группа; «низший алкокси» карбонил «низшая алкильная группа», такая как метоксикарбонилметильная группа; циано «низшая алкильная группа», такая как цианометильная или 2-цианоэтильная группа; «низший алкил» тиометильная группа, такая как метилтиометильная или этилтиометильная группа; «арил» тиометильная группа, такая как фенилтиометильная или нафтилтиометильная группа; «низший алкил» сульфонил «низшая алкильная группа», которая может быть замещена атомом(ами) галогена, такая как 2-метансульфонилэтильная или 2-трифторметансульфонилэтильная группа; «арил» сульфонил «низшая алкильная группа», такая как 2-бензолсульфонилэтильная или 2-толуолсульфонилэтильная группа; ацилокси «низшая алкильная группа», включая «алифатическую ацил»окси «низшую алкильную группу», такую как формилоксиметильная, ацетоксиметильная, пропионилоксиметильная, бутирилоксиметильная, пивалоилоксиметильная, валерилоксиметильная, изовалерилоксиметильная, гексаноилоксиметильная, 1-формилоксиэтильная, 1-ацетоксиэтильная, 1-пропионилоксиэтильная, 1-бутирилоксиэтильная, 1-пивалоилоксиэтильная, 1-валерилоксиэтильная, 1-изовалерилоксиэтильная, 1-гексаноилоксиэтильная, 2-формилоксиэтильная, 2-ацетоксиэтильная, 2-пропионилоксиэтильная, 2-бутирилоксиэтильная, 2-пивалоилоксиэтильная, 2-валерилоксиэтильная, 2-изовалерилоксиэтильная, 2-гексаноилоксиэтильная, 1-формилоксипропильная, 1-ацетоксипропильная, 1-пропионилоксипропильная, 1-бутирилоксипропильная, 1-пивалоилоксипропильная, 1-валерилоксипропильная, 1-изовалерилоксипропильная, 1-гексаноилоксипропильная, 1-ацетоксибутильная, 1-пропионилоксибутильная, 1-бутирилоксибутильная, 1-пивалоилоксибутильная, 1-ацетоксипентильная, 1-пропионилоксипентильная, 1-бутирилоксипентильная, 1-пивалоилоксипентильная или 1-пивалоилоксигексильная группа; «циклоалкил» карбонилокси «низшая алкильная группа», такая как циклопентаноилоксиметильная, циклогексаноилоксиметильная, 1-циклопентаноилоксиэтильная, 1-циклогексаноилоксиэтильная, 1-циклопентаноилоксипропильная, 1-циклогексаноилоксипропильная, 1-циклопентаноилоксибутильная или 1-циклогексаноилоксибутильная группа; и «ароматическая ацил»окси «низшая алкильная группа», такая как бензоилоксиметильная группа; «(алкоксикарбонилокси)алкильная группа», такая как метоксикарбонилоксиметильная, этоксикарбонилоксиметильная, пропоксикарбонилоксиметильная, изопропоксикарбонилоксиметильная, бутоксикарбонилоксиметильная, изобутоксикарбонилоксиметильная, пентилоксикарбонилоксиметильная, гексилоксикарбонилоксиметильная, циклогексилоксикарбонилоксиметильная, циклогексилоксикарбонилокси(циклогексил)метильная, 1-(метоксикарбонилокси)этильная, 1-(этоксикарбонилокси)этильная, 1-пропоксикарбонилоксиэтильная, 1-(изопропоксикарбонилокси)этильная, 1-бутоксикарбонилоксиэтильная, 1-изобутоксикарбонилоксиэтильная, 1-(трет-бутоксикарбонилокси)этильная, 1-пентилоксикарбонилоксиэтильная, 1-гексилоксикарбонилоксиэтильная, 1-циклопентилоксикарбонилоксиэтильная, 1-циклопентилоксикарбонилоксипропильная, 1-циклогексилоксикарбонилоксипропильная, 1-циклопентилоксикарбонилоксибутильная, 1-циклогексилоксикарбонилоксибутильная, 1-(циклогексилоксикарбонилокси)этильная, 1-(этоксикарбонилокси)пропильная, 2-метоксикарбонилоксиэтильная, 2-этоксикарбонилоксиэтильная, 2-пропоксикарбонилоксиэтильная, 2-изопропоксикарбонилоксиэтильная, 2-бутоксикарбонилоксиэтильная, 2-изобутоксикарбонилоксиэтильная, 2-пентилоксикарбонилоксиэтильная, 2-гексилоксикарбонилоксиэтильная, 1-метоксикарбонилоксипропильная, 1-этоксикарбонилоксипропильная, 1-пропоксикарбонилоксипропильная, 1-изопропоксикарбонилоксипропильная, 1-бутоксикарбонилоксипропильная, 1-изобутоксикарбонилоксипропильная, 1-пентилоксикарбонилоксипропильная, 1-гексилоксикарбонилоксипропильная, 1-метоксикарбонилоксибутильная, 1-этоксикарбонилоксибутильная, 1-пропоксикарбонилоксибутильная, 1-изопропоксикарбонилоксибутильная, 1-бутоксикарбонилоксибутильная, 1-изобутоксикарбонилоксибутильная, 1-метоксикарбонилоксипентильная, 1-этоксикарбонилоксипентильная, 1-метоксикарбонилоксигексильная или 1-этоксикарбонилоксигексильная группа; «карбонилоксиалкильная группа», включая оксодиоксоленилметильную группу, такую как (5-фенил-2-оксо-1,3-диоксолен-4-ил)метильная, [5-(4-метилфенил)-2-оксо-1,3-диоксолен-4-ил]метильная, [5-(4-метоксифенил)-2-оксо-1,3-диоксолен-4-ил]метильная, [5-(4-фторфенил)-2-оксо-1,3-диоксолен-4-ил]метильная, [5-(4-хлорфенил)-2-оксо-1,3-диоксолен-4-ил]метильная, (2-оксо-1,3-диоксолен-4-ил)метильная, (5-метил-2-оксо-1,3-диоксолен-4-ил)метильная, (5-этил-2-оксо-1,3-диоксолен-4-ил)метильная, (5-пропил-2-оксо-1,3-диоксолен-4-ил)метильная, (5-изопропил-2-оксо-1,3-диоксолен-4-ил)метильная или (5-бутил-2-оксо-1,3-диоксолен-4-ил)метильная группа; «фталидильная группа», такая как фталидильная, диметилфталидильная или диметоксифталидильная группа; «арильная группа», такая как фенил и инданильная группа; «карбоксиалкильная группа», такая как карбоксиметильная группа; или «остаточная группа, образующая амид аминокислоты», такая как фенилаланин, и представляет собой, предпочтительно, группу, которая образует фармацевтически приемлемые сложные эфиры, такую как «алкильная группа», «алкоксиалкильная группа», «карбонилоксиалкильная группа» или (алкоксикарбонилокси)алкильная группа; более предпочтительно, «C1-C6 алкильная группа», такая как метильная, этильная, н-пропильная, изопропильная, н-бутильная, изобутильная, втор-бутильная, трет-бутильная, н-пентильная, изопентильная, 2-метилбутильная, неопентильная, 1-этилпропильная, н-гексильная, 4-метилпентильная, 3-метилпентильная, 2-метилпентильная или 1-метилпентил; и, наиболее предпочтительно, метильную или этильную группы.

Когда в структуре соединений (I) по настоящему изобретению имеется гидроксильная группу, то функциональной группой, используемой для получения пролекарства, может быть, например, «алифатическая ацильная группа», включая алкилкарбонильную группу, такую как формильная, ацетильная, пропионильная, бутирильная, изобутирильная, пентаноильная, пивалоильная, валерильная, изовалерильная, октаноильная, нонаноильная, деканоильная, 3-метилнонаноильная, 8-метилнонаноильная, 3-этилоктаноильная, 3,7-диметилоктаноильная, ундеканоильная, додеканоильная, тридеканоильная, тетрадеканоильная, пентадеканоильная, гексадеканоильная, 1-метилпентадеканоильная, 14-метилпентадеканоильная, 13,13-диметилтетрадеканоильная, гептадеканоильная, 15-метилгексадеканоильная, октадеканоильная, 1-метилгептадеканоильная, нонадеканоильная, икосаноильная или геникосаноильная группа; карбоксилированная алкилкарбонильная группа, такая как сукциноильная, глутароильная или адипиноильная группа; галоген низшая алкилкарбонильная группа, такая как хлорацетильная, дихлорацетильная, трихлорацетильная или трифторацетильная группа; низший алкокси низшая алкилкарбонильная группа, такая как метоксиацетильная группа; и ненасыщенная алкилкарбонильная группа, такая как (E)-2-метил-2-бутеноильная группа (предпочтительно, C1-C6 алканоильная группа); «ароматическая ацильная группа», включая арилкарбонильную группу, такую как бензоильная, α-нафтоильная или β-нафтоильная группа; галогенарилкарбонильная группа, такая как 2-бромбензоильная или 4-хлорбензоильная группа; низшая алкилированная арилкарбонильная группа, такая как 2,4,6-триметилбензоильная или 4-толуоильная группа; низшая алкоксилированная арилкарбонильная группа, такая как 4-анизоильная группа; карбоксилированная арилкарбонильная группа, такая как 2-карбоксибензоильная, 3-карбоксибензоильная или 4-карбоксибензоильная группа; нитрированная арилкарбонильная группа, такая как 4-нитробензоильная или 2-нитробензоильная группа; низшая алкоксикарбонилированная арилкарбонильная группа, такая как 2-(метоксикарбонил)бензоильная группа; и арилированная арилкарбонильная группа, такая как 4-фенилбензоильная группа; «карбонилоксиалкильная группа», включая ацилоксиалкильную группу, такую как этилкарбонилоксиметильная, пивалоилоксиметильная, диметиламиноацетилоксиметильная или 1-ацетоксиэтильная группа; 1-(алкоксикарбонилокси)алкильная группа, такая как 1-(метоксикарбонилокси)этильная, 1-(этоксикарбонилокси)этильная, этоксикарбонилоксиметильная, 1-(изопропоксикарбонилокси)этильная, 1-(трет-бутоксикарбонилокси)этильная, 1-(этоксикарбонилокси)пропильная или 1-(циклогексилоксикарбонилокси)этильная группа; фталидильная группа; и оксодиоксоленилметильная группа, такая как 4-метил-оксодиоксоленилметильная, 4-фенил-оксодиоксоленилметильная или оксодиоксоленилметильная группа; «остаточная группа соли полуэфира янтарной кислоты»; «остаточная группа соли эфира фосфорной кислоты»; «остаточная группа, образующая эфир аминокислоты»; карбамоильная группа; карбамоильная группа, замещенная 1 или 2 низшими алкильными группами; или «карбонилоксиалкилоксикарбонильная группа», такая как пивалоилоксиметилоксикарбонильная группа, и представляет собой, предпочтительно, группу, которая образует фармацевтически приемлемый сложный эфир, такую как «алифатическая ацильная группа» или «ароматическая ацильная группа», более предпочтительно, «C1-C6 алканоильную группу», такую как ацетильная, пропионильная, бутирильная, изобутирильная, пентаноильная или пивалоильная группа; и особенно, предпочтительно, ацетильную группу.

Когда в структуре соединений (I) по настоящему изобретению имеется аминогруппа, функциональнной группой, используемой для получения пролекарства, может быть, например, алифатическая ацильная группа, включая алканоильную группу, такую как формильная, ацетильная, пропионильная, бутирильная, изобутирильная, пентаноильная, пивалоильная, валерильная, изовалерильная, октаноильная, лауроильная, пальмитиноильная или стеароильная группа; галоген низшая алкилкарбонильная группа, такая как хлорацетильная, дихлорацетильная, трихлорацетильная или трифторацетильная группа; низший алкокси низшая алкилкарбонильная группа, такая как метоксиацетильная группа; и ненасыщенная алкилкарбонильная группа, такая как (E)-2-метил-2-бутеноильная группа (предпочтительно, C1-C6 алканоильная группа); ароматическая ацильная группа, включая арилкарбонильную группу, такую как бензоильная, α-нафтоильная или β-нафтоильная группа, галогенарилкарбонильную группу, такую как 2-бромбензоильная или 4-хлорбензоильная группа, низшую алкилированную арилкарбонильную группу, такую как 2,4,6-триметилбензоильная или 4-толуоильная группа, низшую алкоксилированную арилкарбонильную группу, такую как 4-анизоильная группа, нитрированную арилкарбонильную группу, такую как 4-нитробензоильная или 2-нитробензоильная группа, низшую алкоксикарбонилированную арилкарбонильную группу, такую как 2-(метоксикарбонил)бензоильная группа, и арилированную арилкарбонильную группу, такую как 4-фенилбензоильная группа; алкоксикарбонильная группа, включая низшую алкоксикарбонильную группу, такую как метоксикарбонильная, этоксикарбонильная, трет-бутоксикарбонильная или изобутоксикарбонильная группа, и низшая алкоксикарбонильная группа, замещенная атомом(ами) галогена или три-низшая алкилсилильная группа(ы), такая как 2,2,2-трихлорэтоксикарбонильная или 2-триметилсилилэтоксикарбонильная группа; алкенилоксикарбонильная группа, такая как винилоксикарбонильная или аллилоксикарбонильная группа; или арилоксикарбонильная група, в которой арильное кольцо может быть замещено 1 или 2 низшей алкоксигруппой(ами), нитрогруппой(ами) или атомом(ами) галогена, такими как феноксикарбонильная, 4-метоксифеноксикарбонильная, 3,4-диметоксифеноксикарбонильная, 2-нитрофеноксикарбонильная, 4-нитрофеноксикарбонильная или 4-фторфеноксикарбонильная группа, и представляет собой, предпочтительно, C1-C6 алканоильную группу.

Термин «пролекарство» для соединений, имеющих формулу (I), обозначает, предпочтительно, их фармакологически приемлемый сложный эфир, который получают преобразованием сульфанильной группы, карбоксигруппы или гидроксильной группы, содержащейся в указанных соединениях, соответственно.

Термин «их фармакологически приемлемые соли» обозначает соль, которую получают из соединений (I) по настоящему изобретению. Такая соль, предпочтительно, представляет собой соль металла, включая соль щелочного металла, такая как соль натрия, соль калия или соль лития, соль щелочноземельного металла, такая как соль кальция или соль магния, соль алюминия, соль железа, соль цинка, соль меди, соль никеля и соль кобальта; соль амина, включая неорганическую соль, такую как соль аммония, и органическую соль, такую как соль трет-октиламина, соль дибензиламина, соль морфолина, соль глюкозамина, соль фенилглицин алкильного эфира, соль этилендиамина, соль N-метилглюкамина, соль гуанидина, соль диэтиламина, соль триэтиламина, соль дициклогексиламина, соль N,N'-дибензилэтилендиамина, соль хлорпрокаина, соль прокаина, соль диэтаноламина, соль N-бензил-фенэтиламина, соль пиперазина, соль тетраметиламмония или соль трис(гидроксиметил)аминометана; соль неорганической кислоты, включая соль гидрогалогеновой кислоты, такую как гидрофторид, гидрохлорид, гидробромид или гидройодид, нитрат, перхлорат, сульфат и фосфат; соль органической кислоты, включая низший алкансульфонат, такой как метансульфонат, трифторметансульфонат или этансульфонат, арилсульфонат, такой как бензолсульфонат или п-толуолсульфонат, ацетат, малат, фумарат, сукцинат, цитрат, тартрат, оксалат, малеат и трифторацетат; или соль аминокислоты, такую как соль глицина, соль лизина, соль аргинина, соль орнитина, глютамат или аспартат, и, более предпочтительно, соль неорганической кислоты или соль органической кислоты.

Кроме того, соединения (I) по настоящему изобретению могут быть в виде гидрата или сольвата.

Предпочтительные примеры соединений общей формулы (I) могут быть конкретно представлены, в таблицах 1-6, но эти соединения не следует рассматривать как ограничивающие рамки настоящего изобретения.

Ниже указаны значения аббревиатур в следующих далее таблицах.

Ac: ацетильная группа,

Me: метильная группа,

Et: этильная группа,

iPr: изопропильная группа,

1-Pyza: пиразол-1-ильная группа,

3-Pyza: пиразол-3-ильная группа,

4-Pyza: пиразол-4-ильная группа,

5-Pyza: пиразол-5-ильная группа,

1-Triz: 1,2,3-триазол-1-ильная группа,

2-Triz: 1,2,3-триазол-2-ильная группа,

4-Triz: 1,2,3-триазол-4-ильная группа,

5-Triz: 1,2,3-триазол-5-ильная группа,

1-Tez: тетразол-1-ильная группа,

2-Tez: тетразол-2-ильная группа,

5-Tez: тетразол-5-ильная группа,

1-Pyrd: пирролидиногруппа,

1-Pip: пиперидиногруппа,

4-Pip: пиперидин-4-ильная группа,

Mor: морфолиногруппа,

Thim: тиоморфолиногруппа,

1-Piz: пиперазиногруппа и

2,5-диоксо-1-Pip: 2,5-диоксо-1-пиперидиногруппа.

(Таблица 1)
Соединение №. P1 R2 R3 X1 X2 X3
1-1 H H CH2-1-Pyza 2-F H H
1-2 Ac H CH2-1-Pyza 2-F H H
1-3 H H CH2-1-Pyza 2-F 4-F H
1-4 Ac H CH2-1-Pyza 2-F 4-F H
1-5 H H CH2-(3-CO2H-1-Pyza) 2-F H H
1-6 Ac H CH2-(3-CO2H-1-Pyza) 2-F H H
1-7 H H CH2-(3-CO2H-1-Pyza) 2-F 4-F H
1-8 Ac H CH2-(3-CO2H-1-Pyza) 2-F 4-F H
1-9 H H CH2-(3-CO2Me-1-Pyza) 2-F H H
1-10 Ac H CH2-(3-CO2Me-1-Pyza) 2-F H H
1-11 H H CH2-(3-CO2Me-1-Pyza) 2-F 4-F H
1-12 Ac H CH2-(3-CO2Me-1-Pyza) 2-F 4-F H
1-13 H H CH2-(3-CO2Et-1-Pyza) 2-F H H
1-14 Ac H CH2-(3-CO2Et-1-Pyza) 2-F H H
1-15 H H CH2-(3-CO2Et-1-Pyza) 2-F 4-F H
1-16 Ac H CH2-(3-CO2Et-1-Pyza) 2-F 4-F H
1-17 H H CH2-(4-CO2H-1-Pyza) 2-F H H
1-18 Ac H CH2-(4-CO2H-1-Pyza) 2-F H H
1-19 H H CH2-(4-CO2H-1-Pyza) 2-F 4-F H
1-20 Ac H CH2-(4-CO2H-1-Pyza) 2-F 4-F H
1-21 H H CH2-(4-CO2Me-1-Pyza) 2-F H H
1-22 Ac H CH2-(4-CO2Me-1-Pyza) 2-F H H
1-23 H H CH2-(4-CO2Me-1-Pyza) 2-F 4-F H
1-24 Ac H CH2-(4-CO2Me-1-Pyza) 2-F 4-F H
1-25 H H CH2-(4-CO2Et-1-Pyza) 2-F H H
1-26 Ac H CH2-(4-CO2Et-1-Pyza) 2-F H H
1-27 H H CH2-(4-CO2Et-1-Pyza) 2-F 4-F H
1-28 Ac H CH2-(4-CO2Et-1-Pyza) 2-F 4-F H
1-29 H H CH2-(5-CO2H-1-Pyza) 2-F H H
1-30 Ac H CH2-(5-CO2H-1-Pyza) 2-F H H
1-31 H H CH2-(5-CO2H-1-Pyza) 2-F 4-F H
1-32 Ac H CH2-(5-CO2H-1-Pyza) 2-F 4-F H
1-33 H H CH2-(5-CO2Me-1-Pyza) 2-F H H
1-34 Ac H CH2-(5-CO2Me-1-Pyza) 2-F H H
1-35 H H CH2-(5-CO2Me-1-Pyza) 2-F 4-F H
1-36 Ac H CH2-(5-CO2Me-1-Pyza) 2-F 4-F H
1-37 H H CH2-(5-CO2Et-1-Pyza) 2-F H H
1-38 Ac H CH2-(5-CO2Et-1-Pyza) 2-F H H
1-39 H H CH2-(5-CO2Et-1-Pyza) 2-F 4-F H
1-40 Ac H CH2-(5-CO2Et-1-Pyza) 2-F 4-F H
1-41 H H CH2-(3-CH2CO2H-1-Pyza) 2-F H H
1-42 Ac H CH2-(3-CH2CO2H-1-Pyza) 2-F H H
1-43 H H CH2-(3-CH2CO2H-1-Pyza) 2-F 4-F H
1-44 Ac H CH2-(3-CH2CO2H-1-Pyza) 2-F 4-F H
1-45 H H CH2-(3-CH2CO2Me-1-Pyza) 2-F H H
1-46 Ac H CH2-(3-CH2CO2Me-1-Pyza) 2-F H H
1-47 H H CH2-(3-CH2CO2Me-1-Pyza) 2-F 4-F H
1-48 Ac H CH2-(3-CH2CO2Me-1-Pyza) 2-F 4-F H
1-49 H H CH2-(3-CH2CO2Et-1-Pyza) 2-F H H
1-50 Ac H CH2-(3-CH2CO2Et-1-Pyza) 2-F H H
1-51 H H CH2-(3-CH2CO2Et-1-Pyza) 2-F 4-F H
1-52 Ac H CH2-(3-CH2CO2Et-1-Pyza) 2-F 4-F H
1-53 H H CH2-(4-CH2CO2H-1-Pyza) 2-F H H
1-54 Ac H CH2-(4-CH2CO2H-1-Pyza) 2-F H H
1-55 H H CH2-(4-CH2CO2H-1-Pyza) 2-F 4-F H
1-56 Ac H CH2-(4-CH2CO2H-1-Pyza) 2-F 4-F H
1-57 H H CH2-(4-CH2CO2Me-1-Pyza) 2-F H H
1-58 Ac H CH2-(4-CH2CO2Me-1-Pyza) 2-F H H
1-59 H H CH2-(4-CH2CO2Me-1-Pyza) 2-F 4-F H
1-60 Ac H CH2-(4-CH2CO2Me-1-Pyza) 2-F 4-F H
1-61 H H CH2-(4-CH2CO2Et-1-Pyza) 2-F H H
1-62 Ac H CH2-(4-CH2CO2Et-1-Pyza) 2-F H H
1-63 H H CH2-(4-CH2CO2Et-1-Pyza) 2-F 4-F H
1-64 Ac H CH2-(4-CH2CO2Et-1-Pyza) 2-F 4-F H
1-65 H H CH2-(5-CH2CO2H-1-Pyza) 2-F H H
1-66 Ac H CH2-(5-CH2CO2H-1-Pyza) 2-F H H
1-67 H H CH2-(5-CH2CO2H-1-Pyza) 2-F 4-F H
1-68 Ac H CH2-(5-CH2CO2H-1-Pyza) 2-F 4-F H
1-69 H H CH2-(5-CH2CO2Me-1-Pyza) 2-F H H
1-70 Ac H CH2-(5-CH2CO2Me-1-Pyza) 2-F H H
1-71 H H CH2-(5-CH2CO2Me-1-Pyza) 2-F 4-F H
1-72 Ac H CH2-(5-CH2CO2Me-1-Pyza) 2-F 4-F H
1-73 H H CH2-(5-CH2CO2Et-1-Pyza) 2-F H H
1-74 Ac H CH2-(5-CH2CO2Et-1-Pyza) 2-F H H
1-75 H H CH2-(5-CH2CO2Et-1-Pyza) 2-F 4-F H
1-76 Ac H CH2-(5-CH2CO2Et-1-Pyza) 2-F 4-F H
1-77 H H CH2-(3-CH2CH2CO2H-1-Pyza) 2-F H H
1-78 Ac H CH2-(3-CH2CH2CO2H-1-Pyza) 2-F H H
1-79 H H CH2-(3-CH2CH2CO2Me-1-Pyza) 2-F H H
1-80 Ac H CH2-(3-CH2CH2CO2Me-1-Pyza) 2-F H H
1-81 H H CH2-(3-CH2CH2CO2Et-1-Pyza) 2-F H H
1-82 Ac H CH2-(3-CH2CH2CO2Et-1-Pyza) 2-F H H
1-83 H H CH2-(4-CH2CH2CO2H-1-Pyza) 2-F H H
1-84 Ac H CH2-(4-CH2CH2CO2H-1-Pyza) 2-F H H
1-85 H H CH2-(4-CH2CH2CO2Me-1-Pyza) 2-F H H
1-86 Ac H CH2-(4-CH2CH2CO2Me-1-Pyza) 2-F H H
1-87 H H CH2-(4-CH2CH2CO2Et-1-Pyza) 2-F H H
1-88 Ac H CH2-(4-CH2CH2CO2Et-1-Pyza) 2-F H H
1-89 H H CH2-(5-CH2CH2CO2H-1-Pyza) 2-F H H
1-90 Ac H CH2-(5-CH2CH2CO2H-1-Pyza) 2-F H H
1-91 H H CH2-(5-CH2CH2CO2Me-1-Pyza) 2-F H H
1-92 Ac H CH2-(5-CH2CH2CO2Me-1-Pyza) 2-F H H
1-93 H H CH2-(5-CH2CH2CO2Et-1-Pyza) 2-F H H
1-94 Ac H CH2-(5-CH2CH2CO2Et-1-Pyza) 2-F H H
1-95 H H CH2-(3-CH2CH2CH2CO2H-1-Pyza) 2-F H H
1-96 Ac H CH2-(3-CH2CH2CH2CO2H-1-Pyza) 2-F H H
1-97 H H CH2-(3-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
1-98 Ac H CH2-(3-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
1-99 H H CH2-(3-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
1-100 Ac H CH2-(3-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
1-101 H H CH2-(4-CH2CH2CH2CO2H-1-Pyza) 2-F H H
1-102 Ac H CH2-(4-CH2CH2CH2CO2H-1-Pyza) 2-F H H
1-103 H H CH2-(4-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
1-104 Ac H CH2-(4-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
1-105 H H CH2-(4-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
1-106 Ac H CH2-(4-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
1-107 H H CH2-(5-CH2CH2CH2CO2H-1-Pyza) 2-F H H
1-108 Ac H CH2-(5-CH2CH2CH2CO2H-1-Pyza) 2-F H H
1-109 H H CH2-(5-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
1-110 Ac H CH2-(5-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
1-111 H H CH2-(5-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
1-112 Ac H CH2-(5-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
1-113 H H CH2CH2-1-Pyza 2-F H H
1-114 Ac H CH2CH2-1-Pyza 2-F H H
1-115 H H CH2CH2-(3-CO2H-1-Pyza) 2-F H H
1-116 Ac H CH2CH2-(3-CO2H-1-Pyza) 2-F H H
1-117 H H CH2CH2-(3-CO2Me-1-Pyza) 2-F H H
1-118 Ac H CH2CH2-(3-CO2Me-1-Pyza) 2-F H H
1-119 H H CH2CH2-(3-CO2Et-1-Pyza) 2-F H H
1-120 Ac H CH2CH2-(3-CO2Et-1-Pyza) 2-F H H
1-121 H H CH2CH2-(4-CO2H-1-Pyza) 2-F H H
1-122 Ac H CH2CH2-(4-CO2H-1-Pyza) 2-F H H
1-123 H H CH2CH2-(4-CO2Me-1-Pyza) 2-F H H
1-124 Ac H CH2CH2-(4-CO2Me-1-Pyza) 2-F H H
1-125 H H CH2CH2-(4-CO2Et-1-Pyza) 2-F H H
1-126 Ac H CH2CH2-(4-CO2Et-1-Pyza) 2-F H H
1-127 H H CH2CH2-(5-CO2H-1-Pyza) 2-F H H
1-128 Ac H CH2CH2-(5-CO2H-1-Pyza) 2-F H H
1-129 H H CH2CH2-(5-CO2Me-1-Pyza) 2-F H H
1-130 Ac H CH2CH2-(5-CO2Me-1-Pyza) 2-F H H
1-131 H H CH2CH2-(5-CO2Et-1-Pyza) 2-F H H
1-132 Ac H CH2CH2-(5-CO2Et-1-Pyza) 2-F H H
1-133 H H CH2CH2-(3-CH2CO2H-1-Pyza) 2-F H H
1-134 Ac H CH2CH2-(3-CH2CO2H-1-Pyza) 2-F H H
1-135 H H CH2CH2-(3-CH2CO2Me-1-Pyza) 2-F H H
1-136 Ac H CH2CH2-(3-CH2CO2Me-1-Pyza) 2-F H H
1-137 H H CH2CH2-(3-CH2CO2Et-1-Pyza) 2-F H H
1-138 Ac H CH2CH2-(3-CH2CO2Et-1-Pyza) 2-F H H
1-139 H H CH2CH2-(4-CH2CO2H-1-Pyza) 2-F H H
1-140 Ac H CH2CH2-(4-CH2CO2H-1-Pyza) 2-F H H
1-141 H H CH2CH2-(4-CH2CO2Me-1-Pyza) 2-F H H
1-142 Ac H CH2CH2-(4-CH2CO2Me-1-Pyza) 2-F H H
1-143 H H CH2CH2-(4-CH2CO2Et-1-Pyza) 2-F H H
1-144 Ac H CH2CH2-(4-CH2CO2Et-1-Pyza) 2-F H H
1-145 H H CH2CH2-(5-CH2CO2H-1-Pyza) 2-F H H
1-146 Ac H CH2CH2-(5-CH2CO2H-1-Pyza) 2-F H H
1-147 H H CH2CH2-(5-CH2CO2Me-1-Pyza) 2-F H H
1-148 Ac H CH2CH2-(5-CH2CO2Me-1-Pyza) 2-F H H
1-149 H H CH2CH2-(5-CH2CO2Et-1-Pyza) 2-F H H
1-150 Ac H CH2CH2-(5-CH2CO2Et-1-Pyza) 2-F H H
1-151 H H CH2CH2-(3-CH2CH2CO2H-1-Pyza) 2-F H H
1-152 Ac H CH2CH2-(3-CH2CH2CO2H-1-Pyza) 2-F H H
1-153 H H CH2CH2-(3-CH2CH2CO2Me-1-Pyza) 2-F H H
1-154 Ac H CH2CH2-(3-CH2CH2CO2Me-1-Pyza) 2-F H H
1-155 H H CH2CH2-(3-CH2CH2CO2Et-1-Pyza) 2-F H H
1-156 Ac H CH2CH2-(3-CH2CH2CO2Et-1-Pyza) 2-F H H
1-157 H H CH2CH2-(4-CH2CH2CO2H-1-Pyza) 2-F H H
1-158 Ac H CH2CH2-(4-CH2CH2CO2H-1-Pyza) 2-F H H
1-159 H H CH2CH2-(4-CH2CH2CO2Me-1-Pyza) 2-F H H
1-160 Ac H CH2CH2-(4-CH2CH2CO2Me-1-Pyza) 2-F H H
1-161 H H CH2CH2-(4-CH2CH2CO2Et-1-Pyza) 2-F H H
1-162 Ac H CH2CH2-(4-CH2CH2CO2Et-1-Pyza) 2-F H H
1-163 H H CH2CH2-(5-CH2CH2CO2H-1-Pyza) 2-F H H
1-164 Ac H CH2CH2-(5-CH2CH2CO2H-1-Pyza) 2-F H H
1-165 H H CH2CH2-(5-CH2CH2CO2Me-1-Pyza) 2-F H H
1-166 Ac H CH2CH2-(5-CH2CH2CO2Me-1-Pyza) 2-F H H
1-167 H H CH2CH2-(5-CH2CH2CO2Et-1-Pyza 2-F H H
1-168 Ac H CH2CH2-(5-CH2CH2CO2Et-1-Pyza) 2-F H H
1-169 H H CH2CH2-(3-CH2CH2CH2CO2H-1-Pyza) 2-F H H
1-170 Ac H CH2CH2-(3-CH2CH2CH2CO2H-1-Pyza) 2-F H H
1-171 H H CH2CH2-(3-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
1-172 Ac H CH2CH2-(3-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
1-173 H H CH2CH2-(3-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
1-174 Ac H CH2CH2-(3-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
1-175 H H CH2CH2-(4-CH2CH2CH2CO2H-1-Pyza) 2-F H H
1-176 Ac H CH2CH2-(4-CH2CH2CH2CO2H-1-Pyza) 2-F H H
1-177 H H CH2CH2-(4-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
1-178 Ac H CH2CH2-(4-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
1-179 H H CH2CH2-(4-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
1-180 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
1-181 H H CH2CH2-(5-CH2CH2CH2CO2H-1-Pyza) 2-F H H
1-182 Ac H CH2CH2-(5-CH2CH2CH2CO2H-1-Pyza) 2-F H H
1-183 H H CH2CH2-(5-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
1-184 Ac H CH2CH2-(5-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
1-185 H H CH2CH2-(5-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
1-186 Ac H CH2CH2-(5-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
1-187 H H CH2-3-Pyza 2-F H H
1-188 Ac H CH2-3-Pyza 2-F H H
1-189 H H CH2-3-Pyza 2-F 4-F H
1-190 Ac H CH2-3-Pyza 2-F 4-F H
1-191 H H CH2-(1-CO2Me-3-Pyza) 2-F H H
1-192 Ac H CH2-(1-CO2Me-3-Pyza) 2-F H H
1-193 H H CH2-(1-CO2Et-3-Pyza) 2-F H H
1-194 Ac H CH2-(1-CO2Et-3-Pyza) 2-F H H
1-195 H H CH2-(4-CO2H-3-Pyza) 2-F H H
1-196 Ac H CH2-(4-CO2H-3-Pyza) 2-F H H
1-197 H H CH2-(4-CO2Me-3-Pyza) 2-F H H
1-198 Ac H CH2-(4-CO2Me-3-Pyza) 2-F H H
1-199 H H CH2-(4-CO2Et-3-Pyza) 2-F H H
1-200 Ac H CH2-(4-CO2Et-3-Pyza) 2-F H H
1-201 H H CH2-(5-CO2H-3-Pyza) 2-F H H
1-202 Ac H CH2-(5-CO2H-3-Pyza) 2-F H H
1-203 H H CH2-(5-CO2Me-3-Pyza) 2-F H H
1-204 Ac H CH2-(5-CO2Me-3-Pyza) 2-F H H
1-205 H H CH2-(5-CO2Et-3-Pyza) 2-F H H
1-206 Ac H CH2-(5-CO2Et-3-Pyza) 2-F H H
1-207 H H CH2-(1-CH2CO2H-3-Pyza) 2-F H H
1-208 Ac H CH2-(1-CH2CO2H-3-Pyza) 2-F H H
1-209 H H CH2-(1-CH2CO2Me-3-Pyza) 2-F H H
1-210 Ac H CH2-(1-CH2CO2Me-3-Pyza) 2-F H H
1-211 H H CH2-(1-CH2CO2Et-3-Pyza) 2-F H H
1-212 Ac H CH2-(1-CH2CO2Et-3-Pyza) 2-F H H
1-213 H H CH2-(4-CH2CO2H-3-Pyza) 2-F H H
1-214 Ac H CH2-(4-CH2CO2H-3-Pyza) 2-F H H
1-215 H H CH2-(4-CH2CO2Me-3-Pyza) 2-F H H
1-216 Ac H CH2-(4-CH2CO2Me-3-Pyza) 2-F H H
1-217 H H CH2-(4-CH2CO2Et-3-Pyza) 2-F H H
1-218 Ac H CH2-(4-CH2CO2Et-3-Pyza) 2-F H H
1-219 H H CH2-(5-CH2CO2H-3-Pyza) 2-F H H
1-220 Ac H CH2-(5-CH2CO2H-3-Pyza) 2-F H H
1-221 H H CH2-(5-CH2CO2Me-3-Pyza) 2-F H H
1-222 Ac H CH2-(5-CH2CO2Me-3-Pyza) 2-F H H
1-223 H H CH2-(5-CH2CO2Et-3-Pyza) 2-F H H
1-224 Ac H CH2-(5-CH2CO2Et-3-Pyza) 2-F H H
1-225 H H CH2-(1-CH2CH2CO2H-3-Pyza) 2-F H H
1-226 Ac H CH2-(1-CH2CH2CO2H-3-Pyza) 2-F H H
1-227 H H CH2-(1-CH2CH2CO2Me-3-Pyza) 2-F H H
1-228 Ac H CH2-(1-CH2CH2CO2Me-3-Pyza) 2-F H H
1-229 H H CH2-(1-CH2CH2CO2Et-3-Pyza) 2-F H H
1-230 Ac H CH2-(1-CH2CH2CO2Et-3-Pyza) 2-F H H
1-231 H H CH2-(4-CH2CH2CO2H-3-Pyza) 2-F H H
1-232 Ac H CH2-(4-CH2CH2CO2H-3-Pyza) 2-F H H
1-233 H H CH2-(4-CH2CH2CO2Me-3-Pyza) 2-F H H
1-234 Ac H CH2-(4-CH2CH2CO2Me-3-Pyza) 2-F H H
1-235 H H CH2-(4-CH2CH2CO2Et-3-Pyza) 2-F H H
1-236 Ac H CH2-(4-CH2CH2CO2Et-3-Pyza) 2-F H H
1-237 H H CH2-(5-CH2CH2CO2H-3-Pyza) 2-F H H
1-238 Ac H CH2-(5-CH2CH2CO2H-3-Pyza) 2-F H H
1-239 H H CH2-(5-CH2CH2CO2Me-3-Pyza) 2-F H H
1-240 Ac H CH2-(5-CH2CH2CO2Me-3-Pyza) 2-F H H
1-241 H H CH2-(5-CH2CH2CO2Et-3-Pyza) 2-F H H
1-242 Ac H CH2-(5-CH2CH2CO2Et-3-Pyza) 2-F H H
1-245 H H CH2-(1-CH2CH2CH2CO2H-3-Pyza) 2-F H H
1-246 Ac H CH2-(1-CH2CH2CH2CO2H-3-Pyza) 2-F H H
1-247 H H CH2-(1-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
1-248 Ac H CH2-(1-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
1-249 H H CH2-(1-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
1-250 Ac H CH2-(1-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
1-251 H H CH2-(4-CH2CH2CH2CO2H-3-Pyza) 2-F H H
1-252 Ac H CH2-(4-CH2CH2CH2CO2H-3-Pyza) 2-F H H
1-253 H H CH2-(4-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
1-254 Ac H CH2-(4-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
1-255 H H CH2-(4-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
1-256 Ac H CH2-(4-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
1-257 H H CH2-(5-CH2CH2CH2CO2H-3-Pyza) 2-F H H
1-258 Ac H CH2-(5-CH2CH2CH2CO2H-3-Pyza) 2-F H H
1-259 H H CH2-(5-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
1-260 Ac H CH2-(5-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
1-261 H H CH2-(5-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
1-262 Ac H CH2-(5-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
1-263 H H CH2CH2-3-Pyza 2-F H H
1-264 Ac H CH2CH2-3-Pyza 2-F H H
1-265 H H CH2CH2-3-Pyza 2-F 4-F H
1-266 Ac H CH2CH2-3-Pyza 2-F 4-F H
1-267 H H CH2CH2-(1-CO2Me-3-Pyza) 2-F H H
1-268 Ac H CH2CH2-(1-CO2Me-3-Pyza) 2-F H H
1-269 H H CH2CH2-(1-CO2Et-3-Pyza) 2-F H H
1-270 Ac H CH2CH2-(1-CO2Et-3-Pyza) 2-F H H
1-271 H H CH2CH2-(4-CO2H-3-Pyza) 2-F H H
1-272 Ac H CH2CH2-(4-CO2H-3-Pyza) 2-F H H
1-273 H H CH2CH2-(4-CO2Me-3-Pyza) 2-F H H
1-274 Ac H CH2CH2-(4-CO2Me-3-Pyza) 2-F H H
1-275 H H CH2CH2-(4-CO2Et-3-Pyza) 2-F H H
1-276 Ac H CH2CH2-(4-CO2Et-3-Pyza) 2-F H H
1-277 H H CH2CH2-(5-CO2H-3-Pyza) 2-F H H
1-278 Ac H CH2CH2-(5-CO2H-3-Pyza) 2-F H H
1-279 H H CH2CH2-(5-CO2Me-3-Pyza) 2-F H H
1-280 Ac H CH2CH2-(5-CO2Me-3-Pyza) 2-F H H
1-281 H H CH2CH2-(5-CO2Et-3-Pyza) 2-F H H
1-282 Ac H CH2CH2-(5-CO2Et-3-Pyza) 2-F H H
1-283 H H CH2CH2-(1-CH2CO2H-3-Pyza) 2-F H H
1-284 Ac H CH2CH2-(1-CH2CO2H-3-Pyza) 2-F H H
1-285 H H CH2CH2-(1-CH2CO2Me-3-Pyza) 2-F H H
1-286 Ac H CH2CH2-(1-CH2CO2Me-3-Pyza) 2-F H H
1-287 H H CH2CH2-(1-CH2CO2Et-3-Pyza) 2-F H H
1-288 Ac H CH2CH2-(1-CH2CO2Et-3-Pyza) 2-F H H
1-289 H H CH2CH2-(4-CH2CO2H-3-Pyza) 2-F H H
1-290 Ac H CH2CH2-(4-CH2CO2H-3-Pyza) 2-F H H
1-291 H H CH2CH2-(4-CH2CO2Me-3-Pyza) 2-F H H
1-292 Ac H CH2CH2-(4-CH2CO2Me-3-Pyza) 2-F H H
1-293 H H CH2CH2-(4-CH2CO2Et-3-Pyza) 2-F H H
1-294 Ac H CH2CH2-(4-CH2CO2Et-3-Pyza) 2-F H H
1-295 H H CH2CH2-(5-CH2CO2H-3-Pyza) 2-F H H
1-296 Ac H CH2CH2-(5-CH2CO2H-3-Pyza) 2-F H H
1-297 H H CH2CH2-(5-CH2CO2Me-3-Pyza) 2-F H H
1-298 Ac H CH2CH2-(5-CH2CO2Me-3-Pyza) 2-F H H
1-299 H H CH2CH2-(5-CH2CO2Et-3-Pyza) 2-F H H
1-300 Ac H CH2CH2-(5-CH2CO2Et-3-Pyza) 2-F H H
1-301 H H CH2CH2-(1-CH2CH2CO2H-3-Pyza) 2-F H H
1-302 Ac H CH2CH2-(1-CH2CH2CO2H-3-Pyza) 2-F H H
1-303 H H CH2CH2-(1-CH2CH2CO2Me-3-Pyza) 2-F H H
1-304 Ac H CH2CH2-(1-CH2CH2CO2Me-3-Pyza 2-F H H
1-305 H H CH2CH2-(1-CH2CH2CO2Et-3-Pyza) 2-F H H
1-306 Ac H CH2CH2-(1-CH2CH2CO2Et-3-Pyza) 2-F H H
1-307 H H CH2CH2-(4-CH2CH2CO2H-3-Pyza) 2-F H H
1-308 Ac H CH2CH2-(4-CH2CH2CO2H-3-Pyza) 2-F H H
1-309 H H CH2CH2-(4-CH2CH2CO2Me-3-Pyza) 2-F H H
1-310 Ac H CH2CH2-(4-CH2CH2CO2Me-3-Pyza 2-F H H
1-311 H H CH2CH2-(4-CH2CH2CO2Et-3-Pyza) 2-F H H
1-312 Ac H CH2CH2-(4-CH2CH2CO2Et-3-Pyza) 2-F H H
1-313 H H CH2CH2-(5-CH2CH2CO2H-3-Pyza) 2-F H H
1-314 Ac H CH2CH2-(5-CH2CH2CO2H-3-Pyza) 2-F H H
1-315 H H CH2CH2-(5-CH2CH2CO2Me-3-Pyza) 2-F H H
1-316 Ac H CH2CH2-(5-CH2CH2CO2Me-3-Pyza) 2-F H H
1-317 H H CH2CH2-(5-CH2CH2CO2Et-3-Pyza) 2-F H H
1-318 Ac H CH2CH2-(5-CH2CH2CO2Et-3-Pyza) 2-F H H
1-319 H H CH2CH2-(1-CH2CH2CH2CO2H-3-Pyza) 2-F H H
1-320 Ac H CH2CH2-(1-CH2CH2CH2CO2H-3-Pyza) 2-F H H
1-321 H H CH2CH2-(1-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
1-322 Ac H CH2CH2-(1-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
1-323 H H CH2CH2-(1-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
1-324 Ac H CH2CH2-(1-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
1-325 H H CH2CH2-(4-CH2CH2CH2CO2H-3-Pyza) 2-F H H
1-326 Ac H CH2CH2-(4-CH2CH2CH2CO2H-3-Pyza) 2-F H H
1-327 H H CH2CH2-(4-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
1-328 Ac H CH2CH2-(4-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
1-329 H H CH2CH2-(4-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
1-330 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
1-331 H H CH2CH2-(5-CH2CH2CH2CO2H-3-Pyza) 2-F H H
1-332 Ac H CH2CH2-(5-CH2CH2CH2CO2H-3-Pyza) 2-F H H
1-333 H H CH2CH2-(5-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
1-334 Ac H CH2CH2-(5-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
1-335 H H CH2CH2-(5-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
1-336 Ac H CH2CH2-(5-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
1-337 H H CH2-4-Pyza 2-F H H
1-338 Ac H CH2-4-Pyza 2-F H H
1-339 H H CH2-4-Pyza 2-F 4-F H
1-340 Ac H CH2-4-Pyza 2-F 4-F H
1-341 H H CH2-(1-CO2Me-4-Pyza) 2-F H H
1-342 Ac H CH2-(1-CO2Me-4-Pyza) 2-F H H
1-343 H H CH2-(1-CO2Et-4-Pyza) 2-F H H
1-344 Ac H CH2-(1-CO2Et-4-Pyza) 2-F H H
1-345 H H CH2-(3-CO2H-4-Pyza) 2-F H H
1-346 Ac H CH2-(3-CO2H-4-Pyza) 2-F H H
1-347 H H CH2-(3-CO2Me-4-Pyza) 2-F H H
1-348 Ac H CH2-(3-CO2Me-4-Pyza) 2-F H H
1-349 H H CH2-(3-CO2Et-4-Pyza) 2-F H H
1-350 Ac H CH2-(3-CO2Et-4-Pyza) 2-F H H
1-351 H H CH2-(1-CH2CO2H-4-Pyza) 2-F H H
1-352 Ac H CH2-(1-CH2CO2H-4-Pyza) 2-F H H
1-353 H H CH2-(1-CH2CO2Me-4-Pyza) 2-F H H
1-354 Ac H CH2-(1-CH2CO2Me-4-Pyza) 2-F H H
1-355 H H CH2-(1-CH2CO2Et-4-Pyza) 2-F H H
1-356 Ac H CH2-(1-CH2CO2Et-4-Pyza) 2-F H H
1-357 H H CH2-(3-CH2CO2H-4-Pyza) 2-F H H
1-358 Ac H CH2-(3-CH2CO2H-4-Pyza) 2-F H H
1-359 H H CH2-(3-CH2CO2Me-4-Pyza) 2-F H H
1-360 Ac H CH2-(3-CH2CO2Me-4-Pyza) 2-F H H
1-361 H H CH2-(3-CH2CO2Et-4-Pyza) 2-F H H
1-362 Ac H CH2-(3-CH2CO2Et-4-Pyza) 2-F H H
1-363 H H CH2-(1-CH2CH2CO2H-4-Pyza) 2-F H H
1-364 Ac H CH2-(1-CH2CH2CO2H-4-Pyza) 2-F H H
1-365 H H CH2-(1-CH2CH2CO2Me-4-Pyza) 2-F H H
1-366 Ac H CH2-(1-CH2CH2CO2Me-4-Pyza) 2-F H H
1-367 H H CH2-(1-CH2CH2CO2Et-4-Pyza) 2-F H H
1-368 Ac H CH2-(1-CH2CH2CO2Et-4-Pyza) 2-F H H
1-369 H H CH2-(3-CH2CH2CO2H-4-Pyza) 2-F H H
1-370 Ac H CH2-(3-CH2CH2CO2H-4-Pyza) 2-F H H
1-371 H H CH2-(3-CH2CH2CO2Me-4-Pyza) 2-F H H
1-372 Ac H CH2-(3-CH2CH2CO2Me-4-Pyza) 2-F H H
1-373 H H CH2-(3-CH2CH2CO2Et-4-Pyza) 2-F H H
1-374 Ac H CH2-(3-CH2CH2CO2Et-4-Pyza) 2-F H H
1-375 H H CH2-(1-CH2CH2CH2CO2H-4-Pyza) 2-F H H
1-376 Ac H CH2-(1-CH2CH2CH2CO2H-4-Pyza) 2-F H H
1-377 H H CH2-(1-CH2CH2CH2CO2Me-4-Pyza) 2-F H H
1-378 Ac H CH2-(1-CH2CH2CH2CO2Me-4-Pyza) 2-F H H
1-379 H H CH2-(1-CH2CH2CH2CO2Et-4-Pyza) 2-F H H
1-380 Ac H CH2-(1-CH2CH2CH2CO2Et-4-Pyza) 2-F H H
1-381 H H CH2-(3-CH2CH2CH2CO2H-4-Pyza) 2-F H H
1-382 Ac H CH2-(3-CH2CH2CH2CO2H-4-Pyza) 2-F H H
1-383 H H CH2-(3-CH2CH2CH2CO2Me-4-Pyza) 2-F H H
1-384 Ac H CH2-(3-CH2CH2CH2CO2Me-4-Pyza) 2-F H H
1-385 H H CH2-(3-CH2CH2CH2CO2Et-4-Pyza) 2-F H H
1-386 Ac H CH2-(3-CH2CH2CH2CO2Et-4-Pyza) 2-F H H
1-387 H H CH2CH2-4-Pyza 2-F H H
1-388 Ac H CH2CH2-4-Pyza 2-F H H
1-389 H H CH2CH2-4-Pyza 2-F 4-F H
1-390 Ac H CH2CH2-4-Pyza 2-F 4-F H
1-391 H H CH2CH2-(1-CO2Me-4-Pyza) 2-F H H
1-392 Ac H CH2CH2-(1-CO2Me-4-Pyza) 2-F H H
1-393 H H CH2CH2-(1-CO2Et-4-Pyza) 2-F H H
1-394 Ac H CH2CH2-(1-CO2Et-4-Pyza) 2-F H H
1-395 H H CH2CH2-(3-CO2H-4-Pyza) 2-F H H
1-396 Ac H CH2CH2-(3-CO2H-4-Pyza) 2-F H H
1-397 H H CH2CH2-(3-CO2Me-4-Pyza) 2-F H H
1-398 Ac H CH2CH2-(3-CO2Me-4-Pyza) 2-F H H
1-399 H H CH2CH2-(3-CO2Et-4-Pyza) 2-F H H
1-400 Ac H CH2CH2-(3-CO2Et-4-Pyza) 2-F H H
1-401 H H CH2CH2-(1-CH2CO2H-4-Pyza) 2-F H H
1-402 Ac H CH2CH2-(1-CH2CO2H-4-Pyza) 2-F H H
1-403 H H CH2CH2-(1-CH2CO2Me-4-Pyza) 2-F H H
1-404 Ac H CH2CH2-(1-CH2CO2Me-4-Pyza) 2-F H H
1-405 H H CH2CH2-(1-CH2CO2Et-4-Pyza) 2-F H H
1-406 Ac H CH2CH2-(1-CH2CO2Et-4-Pyza) 2-F H H
1-407 H H CH2CH2-(3-CH2CO2H-4-Pyza) 2-F H H
1-408 Ac H CH2CH2-(3-CH2CO2H-4-Pyza) 2-F H H
1-409 H H CH2CH2-(3-CH2CO2Me-4-Pyza) 2-F H H
1-410 Ac H CH2CH2-(3-CH2CO2Me-4-Pyza) 2-F H H
1-411 H H CH2CH2-(3-CH2CO2Et-4-Pyza) 2-F H H
1-412 Ac H CH2CH2-(3-CH2CO2Et-4-Pyza) 2-F H H
1-413 H H CH2CH2-(1-CH2CH2CO2H-4-Pyza) 2-F H H
1-414 Ac H CH2CH2-(1-CH2CH2CO2H-4-Pyza) 2-F H H
1-415 H H CH2CH2-(1-CH2CH2CO2Me-4-Pyza) 2-F H H
1-416 Ac H CH2CH2-(1-CH2CH2CO2Me-4-Pyza) 2-F H H
1-417 H H CH2CH2-(1-CH2CH2CO2Et-4-Pyza) 2-F H H
1-418 Ac H CH2CH2-(1-CH2CH2CO2Et-4-Pyza) 2-F H H
1-419 H H CH2CH2-(3-CH2CH2CO2H-4-Pyza) 2-F H H
1-420 Ac H CH2CH2-(3-CH2CH2CO2H-4-Pyza) 2-F H H
1-421 H H CH2CH2-(3-CH2CH2CO2Me-4-Pyza) 2-F H H
1-422 Ac H CH2CH2-(3-CH2CH2CO2Me-4-Pyza) 2-F H H
1-423 H H CH2CH2-(3-CH2CH2CO2Et-4-Pyza) 2-F H H
1-424 Ac H CH2CH2-(3-CH2CH2CO2Et-4-Pyza) 2-F H H
1-425 H H CH2CH2-(1-CH2CH2CH2CO2H-4-Pyza) 2-F H H
1-426 Ac H CH2CH2-(1-CH2CH2CH2CO2H-4-Pyza) 2-F H H
1-427 H H CH2CH2-(1-CH2CH2CH2CO2Me-4-Pyza) 2-F H H
1-428 Ac H CH2CH2-(1-CH2CH2CH2CO2Me-4-Pyza) 2-F H H
1-429 H H CH2CH2-(1-CH2CH2CH2CO2Et-4-Pyza) 2-F H H
1-430 Ac H CH2CH2-(1-CH2CH2CH2CO2Et-4-Pyza) 2-F H H
1-431 H H CH2CH2-(3-CH2CH2CH2CO2H-4-Pyza) 2-F H H
1-432 Ac H CH2CH2-(3-CH2CH2CH2CO2H-4-Pyza) 2-F H H
1-433 H H CH2CH2-(3-CH2CH2CH2CO2Me-4-Pyza) 2-F H H
1-434 Ac H CH2CH2-(3-CH2CH2CH2CO2Me-4-Pyza) 2-F H H
1-435 H H CH2CH2-(3-CH2CH2CH2CO2Et-4-Pyza) 2-F H H
1-436 Ac H CH2CH2-(3-CH2CH2CH2CO2Et-4-Pyza) 2-F H H
1-437 H H CH2-(1-CO2Me-5-Pyza) 2-F 4-F H
1-438 Ac H CH2-(1-CO2Me-5-Pyza) 2-F 4-F H
1-439 H H CH2-(1-CO2Me-5-Pyza) 2-F H H
1-440 Ac H CH2-(1-CO2Me-5-Pyza) 2-F H H
1-441 H H CH2-(1-CO2Et-5-Pyza) 2-F H H
1-442 Ac H CH2-(1-CO2Et-5-Pyza) 2-F H H
1-443 H H CH2-(1-CH2CO2H-5-Pyza) 2-F H H
1-444 Ac H CH2-(1-CH2CO2H-5-Pyza) 2-F H H
1-445 H H CH2-(1-CH2CO2Me-5-Pyza) 2-F H H
1-446 Ac H CH2-(1-CH2CO2Me-5-Pyza) 2-F H H
1-447 H H CH2-(1-CH2CO2Et-5-Pyza) 2-F H H
1-448 Ac H CH2-(1-CH2CO2Et-5-Pyza) 2-F H H
1-449 H H CH2-(1-CH2CH2CO2H-5-Pyza) 2-F H H
1-450 Ac H CH2-(1-CH2CH2CO2H-5-Pyza) 2-F H H
1-451 H H CH2-(1-CH2CH2CO2Me-5-Pyza) 2-F H H
1-452 Ac H CH2-(1-CH2CH2CO2Me-5-Pyza) 2-F H H
1-453 H H CH2-(1-CH2CH2CO2Et-5-Pyza) 2-F H H
1-454 Ac H CH2-(1-CH2CH2CO2Et-5-Pyza) 2-F H H
1-455 H H CH2-(1-CH2CH2CH2CO2H-5-Pyza) 2-F H H
1-456 Ac H CH2-(1-CH2CH2CH2CO2H-5-Pyza) 2-F H H
1-457 H H CH2-(1-CH2CH2CH2CO2Me-5-Pyza) 2-F H H
1-458 Ac H CH2-(1-CH2CH2CH2CO2Me-5-Pyza) 2-F H H
1-459 H H CH2-(1-CH2CH2CH2CO2Et-5-Pyza) 2-F H H
1-460 Ac H CH2-(1-CH2CH2CH2CO2Et-5-Pyza) 2-F H H
1-461 H H CH2CH2-(1-CO2Me-5-Pyza) 2-F 4-F H
1-462 Ac H CH2CH2-(1-CO2Me-5-Pyza) 2-F 4-F H
1-463 H H CH2CH2-(1-CO2Me-5-Pyza) 2-F H H
1-464 Ac H CH2CH2-(1-CO2Me-5-Pyza) 2-F H H
1-465 H H CH2CH2-(1-CO2Et-5-Pyza) 2-F H H
1-466 Ac H CH2CH2-(1-CO2Et-5-Pyza) 2-F H H
1-467 H H CH2CH2-(1-CH2CO2H-5-Pyza) 2-F H H
1-468 Ac H CH2CH2-(1-CH2CO2H-5-Pyza) 2-F H H
1-469 H H CH2CH2-(1-CH2CO2Me-5-Pyza) 2-F H H
1-470 Ac H CH2CH2-(1-CH2CO2Me-5-Pyza) 2-F H H
1-471 H H CH2CH2-(1-CH2CO2Et-5-Pyza) 2-F H H
1-472 Ac H CH2CH2-(1-CH2CO2Et-5-Pyza) 2-F H H
1-473 H H CH2CH2-(1-CH2CH2CO2H-5-Pyza) 2-F H H
1-474 Ac H CH2CH2-(1-CH2CH2CO2H-5-Pyza) 2-F H H
1-475 H H CH2CH2-(1-CH2CH2CO2Me-5-Pyza) 2-F H H
1-476 Ac H CH2CH2-(1-CH2CH2CO2Me-5-Pyza) 2-F H H
1-477 H H CH2CH2-(1-CH2CH2CO2Et-5-Pyza) 2-F H H
1-478 Ac H CH2CH2-(1-CH2CH2CO2Et-5-Pyza) 2-F H H
1-479 H H CH2CH2-(1-CH2CH2CH2CO2H-5-Pyza) 2-F H H
1-480 Ac H CH2CH2-(1-CH2CH2CH2CO2H-5-Pyza) 2-F H H
1-481 H H CH2CH2-(1-CH2CH2CH2CO2Me-5-Pyza) 2-F H H
1-482 Ac H CH2CH2-(1-CH2CH2CH2CO2Me-5-Pyza) 2-F H H
1-483 H H CH2CH2-(1-CH2CH2CH2CO2Et-5-Pyza) 2-F H H
1-484 Ac H CH2CH2-(1-CH2CH2CH2CO2Et-5-Pyza) 2-F H H
1-485 H H CH2-1-Triz 2-F H H
1-486 Ac H CH2-1-Triz 2-F H H
1-487 H H CH2-(4-CO2H-1-Triz) 2-F H H
1-488 Ac H CH2-(4-CO2H-1-Triz) 2-F H H
1-489 H H CH2-(4-CO2Me-1-Triz) 2-F H H
1-490 Ac H CH2-(4-CO2Me-1-Triz) 2-F H H
1-491 H H CH2-(4-CO2Et-1-Triz) 2-F H H
1-492 Ac H CH2-(4-CO2Et-1-Triz) 2-F H H
1-493 H H CH2-(5-CO2H-1-Triz) 2-F H H
1-494 Ac H CH2-(5-CO2H-1-Triz) 2-F H H
1-495 H H CH2-(5-CO2Me-1-Triz) 2-F H H
1-496 Ac H CH2-(5-CO2Me-1-Triz) 2-F H H
1-497 H H CH2-(5-CO2Et-1-Triz) 2-F H H
1-498 Ac H CH2-(5-CO2Et-1-Triz) 2-F H H
1-499 H H CH2-(4-CH2CO2H-1-Triz) 2-F H H
1-500 Ac H CH2-(4-CH2CO2H-1-Triz) 2-F H H
1-501 H H CH2-(4-CH2CO2Me-1-Triz) 2-F H H
1-502 Ac H CH2-(4-CH2CO2Me-1-Triz) 2-F H H
1-503 H H CH2-(4-CH2CO2Et-1-Triz) 2-F H H
1-504 Ac H CH2-(4-CH2CO2Et-1-Triz) 2-F H H
1-505 H H CH2-(5-CH2CO2H-1-Triz) 2-F H H
1-506 Ac H CH2-(5-CH2CO2H-1-Triz) 2-F H H
1-507 H H CH2-(5-CH2CO2Me-1-Triz) 2-F H H
1-508 Ac H CH2-(5-CH2CO2Me-1-Triz) 2-F H H
1-509 H H CH2-(5-CH2CO2Et-1-Triz) 2-F H H
1-510 Ac H CH2-(5-CH2CO2Et-1-Triz) 2-F H H
1-511 H H CH2-(4-CH2CH2CO2H-1-Triz) 2-F H H
1-512 Ac H CH2-(4-CH2CH2CO2H-1-Triz) 2-F H H
1-513 H H CH2-(4-CH2CH2CO2Me-1-Triz) 2-F H H
1-514 Ac H CH2-(4-CH2CH2CO2Me-1-Triz) 2-F H H
1-515 H H CH2-(4-CH2CH2CO2Et-1-Triz) 2-F H H
1-516 Ac H CH2-(4-CH2CH2CO2Et-1-Triz) 2-F H H
1-517 Н Н СН2-(5-CH2CH2CO2H-1-Triz) 2-F H H
1-518 Ac Н CH2-(5-CH2CH2CO2H-1-Triz) 2-F H H
1-519 Н Н CH2-(5-CH2CH2CO2Me-1-Triz) 2-F H H
1-520 Ac Н СН2-(5-CH2CH2CO2Me-1-Triz) 2-F H H
1-521 Н Н CH2-(5-CH2CH2CO2Et-1-Triz) 2-F H H
1-522 Ac Н CH2-(5-CH2CH2CO2Et-1-Triz) 2-F H H
1-523 Н Н CH2-(4-CH2CH2CH2CO2H-1-Triz) 2-F H H
1-524 Ac Н CH2-(4-CH2CH2CH2CO2H-1-Triz) 2-F H H
1-525 Н Н CH2-(4-CH2CH2CH2CO2Me-1-Triz) 2-F H H
1-526 Ac Н СН2-(4-CH2CH2CH2CO2Me-1-Triz) 2-F H H
1-527 Н Н CH2-(4-CH2CH2CH2CO2Et-1-Triz) 2-F H H
1-528 Ac Н CH2-(4-CH2CH2CH2CO2Et-1-Triz) 2-F H H
1-529 Н Н CH2-(5-CH2CH2CH2CO2H-1-Triz) 2-F H H
1-530 Ac Н CH2-(5-CH2CH2CH2CO2H-1-Triz) 2-F H H
1-531 Н Н СН2-(5-CH2CH2CH2CO2Me-1-Triz) 2-F H H
1-532 Ac Н CH2-(5-CH2CH2CH2CO2Me-1-Triz) 2-F H H
1-533 Н Н CH2-(5-CH2CH2CH2CO2Et-1-Triz) 2-F H H
1-534 Ac Н СН2-(5-CH2CH2CH2CO2E1-1-Triz) 2-F H H
1-535 Н Н CH2CH2-1-Triz 2-F H H
1-536 Ac Н CH2CH2-1-Triz 2-F H H
1-537 Н Н CH2CH2-(4-CO2H-1-Triz) 2-F H H
1-538 Ac Н CH2CH2-(4-CO2H-1-Triz) 2-F H H
1-539 Н Н СН2СН2-(4-CO2Me-1-Triz) 2-F H H
1-540 Ac Н CH2CH2-(4-CO2Me-1-Triz) 2-F H H
1-541 Н Н CH2CH2-(4-CO2Et-1-Triz) 2-F H H
1-542 Ac Н CH2CH2-(4-CO2Et-1-Triz) 2-F H H
1-543 Н Н CH2CH2-(5-CO2H-1-Triz) 2-F H H
1-544 Ac Н CH2CH2-(5-CO2H-1-Triz) 2-F H H
1-545 Н Н CH2CH2-(5-CO2Me-1-Triz) 2-F H H
1-546 Ac Н CH2CH2-(5-CO2Me-1-Triz) 2-F H H
1-547 Н Н CH2CH2-(5-CO2Et-1-Triz) 2-F H H
1-548 Ac Н CH2CH2-(5-CO2Et-1-Triz) 2-F H H
1-549 Н Н СН2СН2-(4-CH2CO2H-1-Triz) 2-F H H
1-550 Ac Н CH2CH2-(4-CH2CO2H-1-Triz) 2-F H H
1-551 Н Н CH2CH2-(4-CH2CO2Me-1-Triz) 2-F H H
1-552 Ac Н СН2СН2-(4-CH2CO2Me-1-Triz) 2-F H H
1-553 Н Н CH2CH2-(4-CH2CO2Et-1-Triz) 2-F H H
1-554 Ac Н CH2CH2-(4-CH2CO2Et-1-Triz) 2-F H H
1-555 Н Н CH2CH2-(5-CH2CO2H-1-Triz) 2-F H H
1-556 Ac Н CH2CH2-(5-CH2CO2H-1-Triz) 2-F H H
1-557 Н Н CH2CH2-(5-CH2CO2Me-1-Triz) 2-F H H
1-558 Ac Н CH2CH2-(5-CH2CO2Me-1-Triz) 2-F H H
1-559 Н Н CH2CH2-(5-CH2CO2Et-1-Triz) 2-F H H
1-560 Ac Н CH2CH2-(5-CH2CO2Et-1-Triz) 2-F H H
1-561 Н Н CH2CH2-(4-CH2CH2CO2H-1-Triz) 2-F H H
1-562 Ac Н CH2CH2-(4-CH2CH2CO2H-1-Triz) 2-F H H
1-563 Н Н CH2CH2-(4-CH2CH2CO2Me-1-Triz) 2-F H H
1-564 Ac Н СН2СН2-(4-CH2CH2CO2Me-1-Triz) 2-F H H
1-565 Н Н CH2CH2-(4-CH2CH2CO2Et-1-Triz) 2-F H H
1-566 Ac Н CH2CH2-(4-CH2CH2CO2Et-1-Triz) 2-F H H
1-567 Н Н CH2CH2-(5-CH2CH2CO2H-1-Triz) 2-F H H
1-568 Ac Н СН2СН2-(5-CH2CH2CO2H-1-Triz) 2-F H H
1-569 Н Н CH2CH2-(5-CH2CH2CO2Me-1-Triz) 2-F H H
1-570 Ac H CH2CH2-(5-CH2CH2CO2Me-1-Triz) 2-F H H
1-571 H H CH2CH2-(5-CH2CH2CO2Et-1-Triz) 2-F H H
1-572 Ac H CH2CH2-(5-CH2CH2CO2Et-1-Triz) 2-F H H
1-573 H H CH2CH2-(4-CH2CH2CH2CO2H-1-Triz) 2-F H H
1-574 Ac H CH2CH2-(4-CH2CH2CH2CO2H-1-Triz) 2-F H H
1-575 H H CH2CH2-(4-CH2CH2CH2CO2Me-1-Triz) 2-F H H
1-576 Ac H CH2CH2-(4-CH2CH2CH2CO2Me-1-Triz) 2-F H H
1-577 H H CH2CH2-(4-CH2CH2CH2CO2Et-1-Triz) 2-F H H
1-578 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-1-Triz) 2-F H H
1-579 H H CH2CH2-(5-CH2CH2CH2CO2H-1-Triz) 2-F H H
1-580 Ac H CH2CH2-(5-CH2CH2CH2CO2H-1-Triz) 2-F H H
1-581 H H CH2CH2-(5-CH2CH2CH2CO2Me-1-Triz) 2-F H H
1-582 Ac H CH2CH2-(5-CH2CH2CH2CO2Me-1-Triz) 2-F H H
1-583 H H CH2CH2-(5-CH2CH2CH2CO2Et-1-Triz) 2-F H H
1-584 Ac H CH2CH2-(5-CH2CH2CH2CO2Et-1-Triz) 2-F H H
1-585 H H CH2-2-Triz 2-F H H
1-586 Ac H CH2-2-Triz 2-F H H
1-587 H H CH2-(4-CO2H-2-Triz) 2-F H H
1-588 Ac H CH2-(4-CO2H-2-Triz) 2-F H H
1-589 H H CH2-(4-CO2Me-2-Triz) 2-F H H
1-590 Ac H CH2-(4-CO2Me-2-Triz) 2-F H H
1-591 H H CH2-(4-CO2Et-2-Triz) 2-F H H
1-592 Ac H CH2-(4-CO2Et-2-Triz) 2-F H H
1-593 H H CH2-(4-CH2CO2H-2-Triz) 2-F H H
1-594 Ac H CH2-(4-CH2CO2H-2-Triz) 2-F H H
1-595 H H CH2-(4-CH2CO2Me-2-Triz) 2-F H H
1-596 Ac H CH2-(4-CH2CO2Me-2-Triz) 2-F H H
1-597 H H CH2-(4-CH2CO2Et-2-Triz) 2-F H H
1-598 Ac H CH2-(4-CH2CO2Et-2-Triz) 2-F H H
1-599 H H CH2-(4-CH2CH2CO2H-2-Triz) 2-F H H
1-600 Ac H CH2-(4-CH2CH2CO2H-2-Triz) 2-F H H
1-601 H H CH2-(4-CH2CH2CO2Me-2-Triz) 2-F H H
1-602 Ac H CH2-(4-CH2CH2CO2Me-2-Triz) 2-F H H
1-603 H H CH2-(4-CH2CH2CO2Et-2-Triz) 2-F H H
1-604 Ac H CH2-(4-CH2CH2CO2Et-2-Triz) 2-F H H
1-605 H H CH2-(4-CH2CH2CH2CO2H-2-Triz) 2-F H H
1-606 Ac H CH2-(4-CH2CH2CH2CO2H-2-Triz) 2-F H H
1-607 H H CH2-(4-CH2CH2CH2CO2Me-2-Triz) 2-F H H
1-608 Ac H CH2-(4-CH2CH2CH2CO2Me-2-Triz) 2-F H H
1-609 H H CH2-(4-CH2CH2CH2CO2Et-2-Triz) 2-F H H
1-610 Ac H CH2-(4-CH2CH2CH2CO2Et-2-Triz) 2-F H H
1-611 H H CH2CH2-2-Triz 2-F H H
1-612 Ac H CH2CH2-2-Triz 2-F H H
1-613 H H CH2CH2-(4-CO2H-2-Triz) 2-F H H
1-614 Ac H CH2CH2-(4-CO2H-2-Triz) 2-F H H
1-615 H H CH2CH2-(4-CO2Me-2-Triz) 2-F H H
1-616 Ac H CH2CH2-(4-CO2Me-2-Triz) 2-F H H
1-617 H H CH2CH2-(4-CO2Et-2-Triz) 2-F H H
1-618 Ac H CH2CH2-(4-CO2Et-2-Triz) 2-F H H
1-619 H H CH2CH2-(4-CH2CO2H-2-Triz) 2-F H H
1-620 Ac H CH2CH2-(4-CH2CO2H-2-Triz) 2-F H H
1-621 H H CH2CH2-(4-CH2CO2Me-2-Triz) 2-F H H
1-622 Ac H CH2CH2-(4-CH2CO2Me-2-Triz) 2-F H H
1-623 H H CH2CH2-(4-CH2CO2Et-2-Triz) 2-F H H
1-624 Ac H CH2CH2-(4-CH2CO2Et-2-Triz) 2-F H H
1-625 H H CH2CH2-(4-CH2CH2CO2H-2-Triz) 2-F H H
1-626 Ac H CH2CH2-(4-CH2CH2CO2H-2-Triz) 2-F H H
1-627 H H CH2CH2-(4-CH2CH2CO2Me-2-Triz) 2-F H H
1-628 Ac H CH2CH2-(4-CH2CH2CO2Me-2-Triz) 2-F H H
1-629 H H CH2CH2-(4-CH2CH2CO2Et-2-Triz) 2-F H H
1-630 Ac H CH2CH2-(4-CH2CH2CO2Et-2-Triz) 2-F H H
1-631 H H CH2CH2-(4-CH2CH2CH2CO2H-2-Triz) 2-F H H
1-632 Ac H CH2CH2-(4-CH2CH2CH2CO2H-2-Triz) 2-F H H
1-633 H H CH2CH2-(4-CH2CH2CH2CO2Me-2-Triz) 2-F H H
1-634 Ac H CH2CH2-(4-CH2CH2CH2CO2Me-2-Triz) 2-F H H
1-635 H H CH2CH2-(4-CH2CH2CH2CO2Et-2-Triz) 2-F H H
1-636 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-2-Triz) 2-F H H
1-637 H H CH2-4-Triz 2-F H H
1-638 Ac H CH2-4-Triz 2-F H H
1-639 H H CH2-4-Triz 2-F 4-F H
1-640 Ac H CH2-4-Triz 2-F 4-F H
1-641 H H CH2-(1-CO2Me-4-Triz) 2-F H H
1-642 Ac H CH2-(1-CO2Me-4-Triz) 2-F H H
1-643 H H CH2-(1-CO2Et-4-Triz) 2-F H H
1-644 Ac H CH2-(1-CO2Et-4-Triz) 2-F H H
1-645 H H CH2-(5-CO2H-4-Triz) 2-F H H
1-646 Ac H CH2-(5-CO2H-4-Triz) 2-F H H
1-647 H H CH2-(5-CO2Me-4-Triz) 2-F H H
1-648 Ac H CH2-(5-CO2Me-4-Triz) 2-F H H
1-649 H H CH2-(5-CO2Et-4-Triz) 2-F H H
1-650 Ac H CH2-(5-CO2Et-4-Triz) 2-F H H
1-651 H H CH2-(1-CH2CO2H-4-Triz) 2-F H H
1-652 Ac H CH2-(1-CH2CO2H-4-Triz) 2-F H H
1-653 H H CH2-(1-CH2CO2Me-4-Triz) 2-F H H
1-654 Ac H CH2-(1-CH2CO2Me-4-Triz) 2-F H H
1-655 H H CH2-(1-CH2CO2Et-4-Triz) 2-F H H
1-656 Ac H CH2-(1-CH2CO2Et-4-Triz) 2-F H H
1-657 H H CH2-(5-CH2CO2H-4-Triz) 2-F H H
1-658 Ac H CH2-(5-CH2CO2H-4-Triz) 2-F H H
1-659 H H CH2-(5-CH2CO2Me-4-Triz) 2-F H H
1-660 Ac H CH2-(5-CH2CO2Me-4-Triz) 2-F H H
1-661 H H CH2-(5-CH2CO2Et-4-Triz) 2-F H H
1-662 Ac H CH2-(5-CH2CO2Et-4-Triz) 2-F H H
1-663 H H CH2-(1-CH2CH2CO2H-4-Triz) 2-F H H
1-664 Ac H CH2-(1-CH2CH2CO2H-4-Triz) 2-F H H
1-665 H H CH2-(1-CH2CH2CO2Me-4-Triz) 2-F H H
1-666 Ac H CH2-(1-CH2CH2CO2Me-4-Triz) 2-F H H
1-667 H H CH2-(1-CH2CH2CO2Et-4-Triz) 2-F H H
1-668 Ac H CH2-(1-CH2CH2CO2Et-4-Triz) 2-F H H
1-669 H H CH2-(5-CH2CH2CO2H-4-Triz) 2-F H H
1-670 Ac H CH2-(5-CH2CH2CO2H-4-Triz) 2-F H H
1-671 H H CH2-(5-CH2CH2CO2Me-4-Triz) 2-F H H
1-672 Ac H CH2-(5-CH2CH2CO2Me-4-Triz) 2-F H H
1-673 H H CH2-(5-CH2CH2CO2Et-4-Triz) 2-F H H
1-674 Ac H CH2-(5-CH2CH2CO2Et-4-Triz) 2-F H H
1-675 H H CH2-(1-CH2CH2CH2CO2H-4-Triz) 2-F H H
1-676 Ac H CH2-(1-CH2CH2CH2CO2H-4-Triz) 2-F H H
1-677 H H CH2-(1-CH2CH2CH2CO2Me-4-Triz) 2-F H H
1-678 Ac H CH2-(1-CH2CH2CH2CO2Me-4-Triz) 2-F H H
1-679 H H CH2-(1-CH2CH2CH2CO2Et-4-Triz) 2-F H H
1-680 Ac H CH2-(1-CH2CH2CH2CO2Et-4-Triz) 2-F H H
1-681 H H CH2-(5-CH2CH2CH2CO2H-4-Triz) 2-F H H
1-682 Ac H CH2-(5-CH2CH2CH2CO2H-4-Triz) 2-F H H
1-683 H H CH2-(5-CH2CH2CH2CO2Me-4-Triz) 2-F H H
1-684 Ac H CH2-(5-CH2CH2CH2CO2Me-4-Triz) 2-F H H
1-685 H H CH2-(5-CH2CH2CH2CO2Et-4-Triz) 2-F H H
1-686 Ac H CH2-(5-CH2CH2CH2CO2Et-4-Triz) 2-F H H
1-687 H H CH2CH2-4-Triz 2-F H H
1-688 Ac H CH2CH2-4-Triz 2-F H H
1-689 H H CH2CH2-4-Triz 2-F 4-F H
1-690 Ac H CH2CH2-4-Triz 2-F 4-F H
1-691 H H CH2CH2-(1-CO2Me-4-Triz) 2-F H H
1-692 Ac H CH2CH2-(1-CO2Me-4-Triz) 2-F H H
1-693 H H CH2CH2-(1-CO2Et-4-Triz) 2-F H H
1-694 Ac H CH2CH2-(1-CO2Et-4-Triz) 2-F H H
1-695 H H CH2CH2-(5-CO2H-4-Triz) 2-F H H
1-696 Ac H CH2CH2-(5-CO2H-4-Triz) 2-F H H
1-697 H H CH2CH2-(5-CO2Me-4-Triz) 2-F H H
1-698 Ac H CH2CH2-(5-CO2Me-4-Triz) 2-F H H
1-699 H H CH2CH2-(5-CO2Et-4-Triz) 2-F H H
1-700 Ac H CH2CH2-(5-CO2Et-4-Triz) 2-F H H
1-701 H H CH2CH2-(1-CH2CO2H-4-Triz) 2-F H H
1-702 Ac H CH2CH2-(1-CH2CO2H-4-Triz) 2-F H H
1-703 H H CH2CH2-(1-CH2CO2Me-4-Triz) 2-F H H
1-704 Ac H CH2CH2-(1-CH2CO2Me-4-Triz) 2-F H H
1-705 H H CH2CH2-(1-CH2CO2Et-4-Triz) 2-F H H
1-706 Ac H CH2CH2-(1-CH2CO2Et-4-Triz) 2-F H H
1-707 H H CH2CH2-(5-CH2CO2H-4-Triz) 2-F H H
1-708 Ac H CH2CH2-(5-CH2CO2H-4-Triz) 2-F H H
1-709 H H CH2CH2-(5-CH2CO2Me-4-Triz) 2-F H H
1-710 Ac H CH2CH2-(5-CH2CO2Me-4-Triz) 2-F H H
1-711 H H CH2CH2-(5-CH2CO2Et-4-Triz) 2-F H H
1-712 Ac H CH2CH2-(5-CH2CO2Et-4-Triz) 2-F H H
1-713 H H CH2CH2-(1-CH2CH2CO2H-4-Triz) 2-F H H
1-714 Ac H CH2CH2-(1-CH2CH2CO2H-4-Triz) 2-F H H
1-715 H H CH2CH2-(1-CH2CH2CO2Me-4-Triz) 2-F H H
1-716 Ac H CH2CH2-(1-CH2CH2CO2Me-4-Triz) 2-F H H
1-717 H H CH2CH2-(1-CH2CH2CO2Et-4-Triz) 2-F H H
1-718 Ac H CH2CH2-(1-CH2CH2CO2Et-4-Triz) 2-F H H
1-719 H H CH2CH2-(5-CH2CH2CO2H-4-Triz) 2-F H H
1-720 Ac H CH2CH2-(5-CH2CH2CO2H-4-Triz) 2-F H H
1-721 H H CH2CH2-(5-CH2CH2CO2Me-4-Triz) 2-F H H
1-722 Ac H CH2CH2-(5-CH2CH2CO2Me-4-Triz) 2-F H H
1-723 H H CH2CH2-(5-CH2CH2CO2Et-4-Triz) 2-F H H
1-724 Ac H CH2CH2-(5-CH2CH2CO2Et-4-Triz) 2-F H H
1-725 H H CH2CH2-(1-CH2CH2CH2CO2H-4-Triz) 2-F H H
1-726 Ac H CH2CH2-(1-CH2CH2CH2CO2H-4-Triz) 2-F H H
1-727 H H CH2CH2-(1-CH2CH2CH2CO2Me-4-Triz) 2-F H H
1-728 Ac H CH2CH2-(1-CH2CH2CH2CO2Me-4-Triz) 2-F H H
1-729 H H CH2CH2-(1-CH2CH2CH2CO2Et-4-Triz) 2-F H H
1-730 Ac H CH2CH2-(1-CH2CH2CH2CO2Et-4-Triz) 2-F H H
1-731 H H CH2CH2-(5-CH2CH2CH2CO2H-4-Triz) 2-F H H
1-732 Ac H CH2CH2-(5-CH2CH2CH2CO2H-4-Triz) 2-F H H
1-733 H H CH2CH2-(5-CH2CH2CH2CO2Me-4-Triz) 2-F H H
1-734 Ac H CH2CH2-(5-CH2CH2CH2CO2Me-4-Triz) 2-F H H
1-735 H H CH2CH2-(5-CH2CH2CH2CO2Et-4-Triz) 2-F H H
1-736 Ac H CH2CH2-(5-CH2CH2CH2CO2Et-4-Triz) 2-F H H
1-737 H H CH2-(1-CO2Me-5-Triz) 2-F 4-F H
1-738 Ac H CH2-(1-CO2Me-5-Triz) 2-F 4-F H
1-739 H H CH2-(1-CO2Me-5-Triz) 2-F H H
1-740 Ac H CH2-(1-CO2Me-5-Triz) 2-F H H
1-741 H H CH2-(1-CO2Et-5-Triz) 2-F H H
1-742 Ac H CH2-(1-CO2Et-5-Triz) 2-F H H
1-743 H H CH2-(1-CH2CO2H-5-Triz) 2-F H H
1-744 Ac H CH2-(1-CH2CO2H-5-Triz) 2-F H H
1-745 H H CH2-(1-CH2CO2Me-5-Triz) 2-F H H
1-746 Ac H CH2-(1-CH2CO2Me-5-Triz) 2-F H H
1-747 H H CH2-(1-CH2CO2Et-5-Triz) 2-F H H
1-748 Ac H CH2-(1-CH2CO2Et-5-Triz) 2-F H H
1-749 H H CH2-(1-CH2CH2CO2H-5-Triz) 2-F H H
1-750 Ac H CH2-(1-CH2CH2CO2H-5-Triz) 2-F H H
1-751 H H CH2-(1-CH2CH2CO2Me-5-Triz) 2-F H H
1-752 Ac H CH2-(1-CH2CH2CO2Me-5-Triz) 2-F H H
1-753 H H CH2-(1-CH2CH2CO2Et-5-Triz) 2-F H H
1-754 Ac H CH2-(1-CH2CH2CO2Et-5-Triz) 2-F H H
1-755 H H CH2-(1-CH2CH2CH2CO2H-5-Triz) 2-F H H
1-756 Ac H CH2-(1-CH2CH2CH2CO2H-5-Triz) 2-F H H
1-757 H H CH2-(1-CH2CH2CH2CO2Me-5-Triz) 2-F H H
1-758 Ac H CH2-(1-CH2CH2CH2CO2Me-5-Triz) 2-F H H
1-759 H H CH2-(1-CH2CH2CH2CO2Et-5-Triz) 2-F H H
1-760 Ac H CH2-(1-CH2CH2CH2CO2Et-5-Triz) 2-F H H
1-761 H H CH2-1-Tez 2-F H H
1-762 Ac H CH2-1-Tez 2-F H H
1-763 H H CH2-(5-CO2H-1-Tez) 2-F H H
1-764 Ac H CH2-(5-CO2H-1-Tez) 2-F H H
1-765 H H CH2-(5-CO2Me-1-Tez) 2-F H H
1-766 Ac H CH2-(5-CO2Me-1-Tez) 2-F H H
1-767 H H CH2-(5-CO2Et-1-Tez) 2-F H H
1-768 Ac H CH2-(5-CO2Et-1-Tez) 2-F H H
1-769 H H CH2-(5-CH2CO2H-1-Tez) 2-F H H
1-770 Ac H CH2-(5-CH2CO2H-1-Tez) 2-F H H
1-771 H H CH2-(5-CH2CO2Me-1-Tez) 2-F H H
1-772 Ac H CH2-(5-CH2CO2Me-1-Tez) 2-F H H
1-773 H H CH2-(5-CH2CO2Et-1-Tez) 2-F H H
1-774 Ac H CH2-(5-CH2CO2Et-1-Tez) 2-F H H
1-775 H H CH2-(5-CH2CH2CO2H-1-Tez) 2-F H H
1-776 Ac H CH2-(5-CH2CH2CO2H-1-Tez) 2-F H H
1-777 H H CH2-(5-CH2CH2CO2Me-1-Tez) 2-F H H
1-778 Ac H CH2-(5-CH2CH2CO2Me-1-Tez) 2-F H H
1-779 H H CH2-(5-CH2CH2CO2Et-1-Tez) 2-F H H
1-780 Ac H CH2-(5-CH2CH2CO2Et-1-Tez) 2-F H H
1-781 H H CH2-(5-CH2CH2CH2CO2H-1-Tez) 2-F H H
1-782 Ac H CH2-(5-CH2CH2CH2CO2H-1-Tez) 2-F H H
1-783 H H CH2-(5-CH2CH2CH2CO2Me-1-Tez) 2-F H H
1-784 Ac H CH2-(5-CH2CH2CH2CO2Me-1-Tez) 2-F H H
1-785 H H CH2-(5-CH2CH2CH2CO2Et-1-Tez) 2-F H H
1-786 Ac H CH2-(5-CH2CH2CH2CO2Et-1-Tez) 2-F H H
1-787 H H CH2CH2-1-Tez 2-F H H
1-788 Ac H CH2CH2-1-Tez 2-F H H
1-789 H H CH2CH2-(5-CO2H-1-Tez) 2-F H H
1-790 Ac H CH2CH2-(5-CO2H-1-Tez) 2-F H H
1-791 H H CH2CH2-(5-CO2Me-1-Tez) 2-F H H
1-792 Ac H CH2CH2-(5-CO2Me-1-Tez) 2-F H H
1-793 H H CH2CH2-(5-CO2Et-1-Tez) 2-F H H
1-794 Ac H CH2CH2-(5-CO2Et-1-Tez) 2-F H H
1-795 H H CH2CH2-(5-CH2CO2H-1-Tez) 2-F H H
1-796 Ac H CH2CH2-(5-CH2CO2H-1-Tez) 2-F H H
1-797 H H CH2CH2-(5-CH2CO2Me-1-Tez) 2-F H H
1-798 Ac H CH2CH2-(5-CH2CO2Me-1-Tez) 2-F H H
1-799 H H CH2CH2-(5-CH2CO2Et-1-Tez) 2-F H H
1-800 Ac H CH2CH2-(5-CH2CO2Et-1-Tez) 2-F H H
1-801 H H CH2CH2-(5-CH2CH2CO2H-1-Tez) 2-F H H
1-802 Ac H CH2CH2-(5-CH2CH2CO2H-1-Tez) 2-F H H
1-803 H H CH2CH2-(5-CH2CH2CO2Me-1-Tez) 2-F H H
1-804 Ac H CH2CH2-(5-CH2CH2CO2Me-1-Tez) 2-F H H
1-805 H H CH2CH2-(5-CH2CH2CO2Et-1-Tez) 2-F H H
1-806 Ac H CH2CH2-(5-CH2CH2CO2Et-1-Tez) 2-F H H
1-807 H H CH2CH2-(5-CH2CH2CH2CO2H-1-Tez) 2-F H H
1-808 Ac H CH2CH2-(5-CH2CH2CH2CO2H-1-Tez) 2-F H H
1-809 H H CH2CH2-(5-CH2CH2CH2CO2Me-1-Tez) 2-F H H
1-810 Ac H CH2CH2-(5-CH2CH2CH2CO2Me-1-Tez) 2-F H H
1-811 H H CH2CH2-(5-CH2CH2CH2CO2Et-1-Tez) 2-F H H
1-812 Ac H CH2CH2-(5-CH2CH2CH2CO2Et-1-Tez) 2-F H H
1-813 H H CH2-2-Tez 2-F H H
1-814 Ac H CH2-2-Tez 2-F H H
1-815 H H CH2-(5-CO2H-2-Tez) 2-F H H
1-816 Ac H CH2-(5-CO2H-2-Tez) 2-F H H
1-817 H H CH2-(5-CO2Me-2-Tez) 2-F H H
1-818 Ac H CH2-(5-CO2Me-2-Tez) 2-F H H
1-819 H H CH2-(5-CO2Et-2-Tez) 2-F H H
1-820 Ac H CH2-(5-CO2Et-2-Tez) 2-F H H
1-821 H H CH2-(5-CH2CO2H-2-Tez) 2-F H H
1-822 Ac H CH2-(5-CH2CO2H-2-Tez) 2-F H H
1-823 H H CH2-(5-CH2CO2Me-2-Tez) 2-F H H
1-824 Ac H CH2-(5-CH2CO2Me-2-Tez) 2-F H H
1-825 H H CH2-(5-CH2CO2Et-2-Tez) 2-F H H
1-826 Ac H CH2-(5-CH2CO2Et-2-Tez) 2-F H H
1-827 H H CH2-(5-CH2CH2CO2H-2-Tez) 2-F H H
1-828 Ac H CH2-(5-CH2CH2CO2H-2-Tez) 2-F H H
1-829 H H CH2-(5-CH2CH2CO2Me-2-Tez) 2-F H H
1-830 Ac H CH2-(5-CH2CH2CO2Me-2-Tez) 2-F H H
1-831 H H CH2-(5-CH2CH2CO2Et-2-Tez) 2-F H H
1-832 Ac H CH2-(5-CH2CH2CO2Et-2-Tez) 2-F H H
1-833 H H CH2-(5-CH2CH2CH2CO2H-2-Tez) 2-F H H
1-834 Ac H CH2-(5-CH2CH2CH2CO2H-2-Tez) 2-F H H
1-835 H H CH2-(5-CH2CH2CH2CO2Me-2-Tez) 2-F H H
1-836 Ac H CH2-(5-CH2CH2CH2CO2Me-2-Tez) 2-F H H
1-837 H H CH2-(5-CH2CH2CH2CO2Et-2-Tez) 2-F H H
1-838 Ac H CH2-(5-CH2CH2CH2CO2Et-2-Tez) 2-F H H
1-839 H H CH2CH2-2-Tez 2-F H H
1-840 Ac H CH2CH2-2-Tez 2-F H H
1-841 H H CH2CH2-(5-CO2H-2-Tez) 2-F H H
1-842 Ac H CH2CH2-(5-CO2H-2-Tez) 2-F H H
1-843 H H CH2CH2-(5-CO2Me-2-Tez) 2-F H H
1-844 Ac H CH2CH2-(5-CO2Me-2-Tez) 2-F H H
1-845 H H CH2CH2-(5-CO2Et-2-Tez) 2-F H H
1-846 Ac H CH2CH2-(5-CO2Et-2-Tez) 2-F H H
1-847 H H CH2CH2-(5-CH2CO2H-2-Tez) 2-F H H
1-848 Ac H CH2CH2-(5-CH2CO2H-2-Tez) 2-F H H
1-849 H H CH2CH2-(5-CH2CO2Me-2-Tez) 2-F H H
1-850 Ac H CH2CH2-(5-CH2CO2Me-2-Tez) 2-F H H
1-851 H H CH2CH2-(5-CH2CO2Et-2-Tez) 2-F H H
1-852 Ac H CH2CH2-(5-CH2CO2Et-2-Tez) 2-F H H
1-853 H H CH2CH2-(5-CH2CH2CO2H-2-Tez) 2-F H H
1-854 Ac H CH2CH2-(5-CH2CH2CO2H-2-Tez) 2-F H H
1-855 H H CH2CH2-(5-CH2CH2CO2Me-2-Tez) 2-F H H
1-856 Ac H CH2CH2-(5-CH2CH2CO2Me-2-Tez) 2-F H H
1-857 H H CH2CH2-(5-CH2CH2CO2Et-2-Tez) 2-F H H
1-858 Ac H CH2CH2-(5-CH2CH2CO2Et-2-Tez) 2-F H H
1-859 H H CH2CH2-(5-CH2CH2CH2CO2H-2-Tez) 2-F H H
1-860 Ac H CH2CH2-(5-CH2CH2CH2CO2H-2-Tez) 2-F H H
1-861 H H CH2CH2-(5-CH2CH2CH2CO2Me-2-Tez) 2-F H H
1-862 Ac H CH2CH2-(5-CH2CH2CH2CO2Me-2-Tez) 2-F H H
1-863 H H CH2CH2-(5-CH2CH2CH2CO2Et-2-Tez) 2-F H H
1-864 Ac H CH2CH2-(5-CH2CH2CH2CO2Et-2-Tez) 2-F H H
1-865 H H CH2-5-Tez 2-F H H
1-866 Ac H CH2-5-Tez 2-F H H
1-867 H H CH2-5-Tez 2-F 4-F H
1-868 Ac H CH2-5-Tez 2-F 4-F H
1-869 H H CH2-(1-CO2Me-5-Tez) 2-F H H
1-870 Ac H CH2-(1-CO2Me-5-Tez) 2-F H H
1-871 H H CH2-(1-CO2Et-5-Tez) 2-F H H
1-872 Ac H CH2-(1-CO2Et-5-Tez) 2-F H H
1-873 H H CH2-(2-CO2Me-5-Tez) 2-F 4-F H
1-874 Ac H CH2-(2-CO2Me-5-Tez) 2-F 4-F H
1-875 H H CH2-(2-CO2Me-5-Tez) 2-F H H
1-876 Ac H CH2-(2-CO2Me-5-Tez) 2-F H H
1-877 H H CH2-(2-CO2Et-5-Tez) 2-F H H
1-878 Ac H CH2-(2-CO2Et-5-Tez) 2-F H H
1-879 H H CH2-(1-CH2CO2H-5-Tez) 2-F H H
1-880 Ac H CH2-(1-CH2CO2H-5-Tez) 2-F H H
1-881 H H CH2-(1-CH2CO2Me-5-Tez) 2-F H H
1-882 Ac H CH2-(1-CH2CO2Me-5-Tez) 2-F H H
1-883 H H CH2-(1-CH2CO2Et-5-Tez) 2-F H H
1-884 Ac H CH2-(1-CH2CO2Et-5-Tez) 2-F H H
1-885 H H CH2-(2-CH2CO2H-5-Tez) 2-F H H
1-886 Ac H CH2-(2-CH2CO2H-5-Tez) 2-F H H
1-887 H H CH2-(2-CH2CO2Me-5-Tez) 2-F H H
1-888 Ac H CH2-(2-CH2CO2Me-5-Tez) 2-F H H
1-889 H H CH2-(2-CH2CO2Et-5-Tez) 2-F H H
1-890 Ac H CH2-(2-CH2CO2Et-5-Tez) 2-F H H
1-891 H H CH2-(1-CH2CH2CO2H-5-Tez) 2-F H H
1-892 Ac H CH2-(1-CH2CH2CO2H-5-Tez) 2-F H H
1-893 H H CH2-(1-CH2CH2CO2Me-5-Tez) 2-F H H
1-894 Ac H CH2-(1-CH2CH2CO2Me-5-Tez) 2-F H H
1-895 H H CH2-(1-CH2CH2CO2Et-5-Tez) 2-F H H
1-896 Ac H CH2-(1-CH2CH2CO2Et-5-Tez) 2-F H H
1-897 H H CH2-(2-CH2CH2CO2H-5-Tez) 2-F H H
1-898 Ac H CH2-(2-CH2CH2CO2H-5-Tez) 2-F H H
1-899 H H CH2-(2-CH2CH2CO2Me-5-Tez) 2-F H H
1-900 Ac H CH2-(2-CH2CH2CO2Me-5-Tez) 2-F H H
1-901 H H CH2-(2-CH2CH2CO2Et-5-Tez) 2-F H H
1-902 Ac H CH2-(2-CH2CH2CO2Et-5-Tez) 2-F H H
1-903 H H CH2-(1-CH2CH2CH2CO2H-5-Tez) 2-F H H
1-904 Ac H CH2-(1-CH2CH2CH2CO2H-5-Tez) 2-F H H
1-905 H H CH2-(1-CH2CH2CH2CO2Me-5-Tez) 2-F H H
1-906 Ac H CH2-(1-CH2CH2CH2CO2Me-5-Tez) 2-F H H
1-907 H H CH2-(1-CH2CH2CH2CO2Et-5-Tez) 2-F H H
1-908 Ac H CH2-(1-CH2CH2CH2CO2Et-5-Tez) 2-F H H
1-909 H H CH2-(2-CH2CH2CH2CO2H-5-Tez) 2-F H H
1-910 Ac H CH2-(2-CH2CH2CH2CO2H-5-Tez) 2-F H H
1-911 H H CH2-(2-CH2CH2CH2CO2Me-5-Tez) 2-F H H
1-912 Ac H CH2-(2-CH2CH2CH2CO2Me-5-Tez) 2-F H H
1-913 H H CH2-(2-CH2CH2CH2CO2Et-5-Tez) 2-F H H
1-914 Ac H CH2-(2-CH2CH2CH2CO2Et-5-Tez) 2-F H H
1-915 H H CH2CH2-5-Tez 2-F H H
1-916 Ac H CH2CH2-5-Tez 2-F H H
1-917 H H CH2CH2-5-Tez 2-F 4-F H
1-918 Ac H CH2CH2-5-Tez 2-F 4-F H
1-919 H H CH2CH2-(1-CO2Me-5-Tez) 2-F H H
1-920 Ac H CH2CH2-(1-CO2Me-5-Tez) 2-F H H
1-921 H H CH2CH2-(1-CO2Et-5-Tez) 2-F H H
1-922 Ac H CH2CH2-(1-CO2Et-5-Tez) 2-F H H
1-923 H H CH2CH2-(2-CO2Me-5-Tez) 2-F 4-F H
1-924 Ac H CH2CH2-(2-CO2Me-5-Tez) 2-F 4-F H
1-925 H H CH2CH2-(2-CO2Me-5-Tez) 2-F H H
1-926 Ac H CH2CH2-(2-CO2Me-5-Tez) 2-F H H
1-927 H H CH2CH2-(2-CO2Et-5-Tez) 2-F H H
1-928 Ac H CH2CH2-(2-CO2Et-5-Tez) 2-F H H
1-929 H H CH2CH2-(1-CH2CO2H-5-Tez) 2-F H H
1-930 Ac H CH2CH2-(1-CH2CO2H-5-Tez) 2-F H H
1-931 H H CH2CH2-(1-CH2CO2Me-5-Tez) 2-F H H
1-932 Ac H CH2CH2-(1-CH2CO2Me-5-Tez) 2-F H H
1-933 H H CH2CH2-(1-CH2CO2Et-5-Tez) 2-F H H
1-934 Ac H CH2CH2-(1-CH2CO2Et-5-Tez) 2-F H H
1-935 H H CH2CH2-(2-CH2CO2H-5-Tez) 2-F H H
1-936 Ac H CH2CH2-(2-CH2CO2H-5-Tez) 2-F H H
1-937 H H CH2CH2-(2-CH2CO2Me-5-Tez) 2-F H H
1-938 Ac H CH2CH2-(2-CH2CO2Me-5-Tez) 2-F H H
1-939 H H CH2CH2-(2-CH2CO2Et-5-Tez) 2-F H H
1-940 Ac H CH2CH2-(2-CH2CO2Et-5-Tez) 2-F H H
1-941 H H CH2CH2-(1-CH2CH2CO2H-5-Tez) 2-F H H
1-942 Ac H CH2CH2-(1-CH2CH2CO2H-5-Tez) 2-F H H
1-943 H H CH2CH2-(1-CH2CH2CO2Me-5-Tez) 2-F H H
1-944 Ac H CH2CH2-(1-CH2CH2CO2Me-5-Tez) 2-F H H
1-945 H H CH2CH2-(1-CH2CH2CO2Et-5-Tez) 2-F H H
1-946 Ac H CH2CH2-(1-CH2CH2CO2Et-5-Tez) 2-F H H
1-947 H H CH2CH2-(2-CH2CH2CO2H-5-Tez) 2-F H H
1-948 Ac H CH2CH2-(2-CH2CH2CO2H-5-Tez) 2-F H H
1-949 H H CH2CH2-(2-CH2CH2CO2Me-5-Tez) 2-F H H
1-950 Ac H CH2CH2-(2-CH2CH2CO2Me-5-Tez) 2-F H H
1-951 H H CH2CH2-(2-CH2CH2CO2Et-5-Tez) 2-F H H
1-952 Ac H CH2CH2-(2-CH2CH2CO2Et-5-Tez) 2-F H H
1-953 H H CH2CH2-(1-CH2CH2CH2CO2H-5-Tez) 2-F H H
1-954 Ac H CH2CH2-(1-CH2CH2CH2CO2H-5-Tez) 2-F H H
1-955 H H CH2CH2-(1-CH2CH2CH2CO2Me-5-Tez) 2-F H H
1-956 Ac H CH2CH2-(1-CH2CH2CH2CO2Me-5-Tez) 2-F H H
1-957 H H CH2CH2-(1-CH2CH2CH2CO2Et-5-Tez) 2-F H H
1-958 Ac H CH2CH2-(1-CH2CH2CH2CO2Et-5-Tez) 2-F H H
1-959 H H CH2CH2-(2-CH2CH2CH2CO2H-5-Tez) 2-F H H
1-960 Ac H CH2CH2-(2-CH2CH2CH2CO2H-5-Tez) 2-F H H
1-961 H H CH2CH2-(2-CH2CH2CH2CO2Me-5-Tez) 2-F H H
1-962 Ac H CH2CH2-(2-CH2CH2CH2CO2Me-5-Tez) 2-F H H
1-963 H H CH2CH2-(2-CH2CH2CH2CO2Et-5-Tez) 2-F H H
1-964 Ac H CH2CH2-(2-CH2CH2CH2CO2Et-5-Tez) 2-F H H
1-965 H Me CH2-1-Pyza 2-F H H
1-966 Ac Me CH2-1-Pyza 2-F H H
1-967 H Me CH2-(3-CO2H-1-Pyza) 2-F H H
1-968 Ac Me CH2-(3-CO2H-1-Pyza) 2-F H H
1-969 H Me CH2-(3-CO2Me-1-Pyza) 2-F H H
1-970 Ac Me CH2-(3-CO2Me-1-Pyza) 2-F H H
1-971 H Me CH2-(3-CO2Et-1-Pyza) 2-F H H
1-972 Ac Me CH2-(3-CO2Et-1-Pyza) 2-F H H
1-973 H Me CH2-(4-CO2H-1-Pyza) 2-F H H
1-974 Ac Me CH2-(4-CO2H-1-Pyza) 2-F H H
1-975 H Me CH2-(4-CO2Me-1-Pyza) 2-F H H
1-976 Ac Me CH2-(4-CO2Me-1-Pyza) 2-F H H
1-977 H Me CH2-(4-CO2Et-1-Pyza) 2-F H H
1-978 Ac Me CH2-(4-CO2Et-1-Pyza) 2-F H H
1-979 H Me CH2-(3-CH2CO2H-1-Pyza) 2-F H H
1-980 Ac Me CH2-(3-CH2CO2H-1-Pyza) 2-F H H
1-981 H Me CH2-(3-CH2CO2Me-1-Pyza) 2-F H H
1-982 Ac Me CH2-(3-CH2CO2Me-1-Pyza) 2-F H H
1-983 H Me CH2-(3-CH2CO2Et-1-Pyza) 2-F H H
1-984 Ac Me CH2-(3-CH2CO2Et-1-Pyza) 2-F H H
1-985 H Me CH2-(4-CH2CO2H-1-Pyza) 2-F H H
1-986 Ac Me CH2-(4-CH2CO2H-1-Pyza) 2-F H H
1-987 H Me CH2-(4-CH2CO2Me-1-Pyza) 2-F H H
1-988 Ac Me CH2-(4-CH2CO2Me-1-Pyza) 2-F H H
1-989 H Me CH2-(4-CH2CO2Et-1-Pyza) 2-F H H
1-990 Ac Me CH2-(4-CH2CO2Et-1-Pyza) 2-F H H
1-991 H Me CH2-(3-CH2CH2CO2H-1-Pyza) 2-F H H
1-992 Ac Me CH2-(3-CH2CH2CO2H-1-Pyza) 2-F H H
1-993 H Me CH2-(3-CH2CH2CO2Me-1-Pyza) 2-F H H
1-994 Ac Me CH2-(3-CH2CH2CO2Me-1-Pyza) 2-F H H
1-995 H Me CH2-(3-CH2CH2CO2Et-1-Pyza) 2-F H H
1-996 Ac Me CH2-(3-CH2CH2CO2Et-1-Pyza) 2-F H H
1-997 H Me CH2-(4-CH2CH2CO2H-1-Pyza) 2-F H H
1-998 Ac Me CH2-(4-CH2CH2CO2H-1-Pyza) 2-F H H
1-999 H Me CH2-(4-CH2CH2CO2Me-1-Pyza) 2-F H H
1-1000 Ac Me CH2-(4-CH2CH2CO2Me-1-Pyza) 2-F H H
1-1001 H Me CH2-(4-CH2CH2CO2Et-1-Pyza) 2-F H H
1-1002 Ac Me CH2-(4-CH2CH2CO2Et-1-Pyza) 2-F H H
1-1003 H Me CH2CH2-1-Pyza 2-F H H
1-1004 Ac Me CH2CH2-1-Pyza 2-F H H
1-1005 H Me CH2CH2-(3-CO2H-1-Pyza) 2-F H H
1-1006 Ac Me CH2CH2-(3-CO2H-1-Pyza) 2-F H H
1-1007 H Me CH2CH2-(3-CO2Me-1-Pyza) 2-F H H
1-1008 Ac Me CH2CH2-(3-CO2Me-1-Pyza) 2-F H H
1-1009 H Me CH2CH2-(3-CO2Et-1-Pyza) 2-F H H
1-1010 Ac Me CH2CH2-(3-CO2Et-1-Pyza) 2-F H H
1-1011 H Me CH2CH2-(4-CO2H-1-Pyza) 2-F H H
1-1012 Ac Me CH2CH2-(4-CO2H-1-Pyza) 2-F H H
1-1013 H Me CH2CH2-(4-CO2Me-1-Pyza) 2-F H H
1-1014 Ac Me CH2CH2-(4-CO2Me-1-Pyza) 2-F H H
1-1015 H Me CH2CH2-(4-CO2Et-1-Pyza) 2-F H H
1-1016 Ac Me CH2CH2-(4-CO2Et-1-Pyza) 2-F H H
1-1017 H Me CH2CH2-(3-CH2CO2H-1-Pyza) 2-F H H
1-1018 Ac Me CH2CH2-(3-CH2CO2H-1-Pyza) 2-F H H
1-1019 H Me CH2CH2-(3-CH2CO2Me-1-Pyza) 2-F H H
1-1020 Ac Me CH2CH2-(3-CH2CO2Me-1-Pyza) 2-F H H
1-1021 H Me CH2CH2-(3-CH2CO2Et-1-Pyza) 2-F H H
1-1022 Ac Me CH2CH2-(3-CH2CO2Et-1-Pyza) 2-F H H
1-1023 H Me CH2CH2-(4-CH2CO2H-1-Pyza) 2-F H H
1-1024 Ac Me CH2CH2-(4-CH2CO2H-1-Pyza) 2-F H H
1-1025 H Me CH2CH2-(4-CH2CO2Me-1-Pyza) 2-F H H
1-1026 Ac Me CH2CH2-(4-CH2CO2Me-1-Pyza) 2-F H H
1-1027 H Me CH2CH2-(4-CH2CO2Et-1-Pyza) 2-F H H
1-1028 Ac Me CH2CH2-(4-CH2CO2Et-1-Pyza) 2-F H H
1-1029 H Me CH2CH2-(3-CH2CH2CO2H-1-Pyza) 2-F H H
1-1030 Ac Me CH2CH2-(3-CH2CH2CO2H-1-Pyza) 2-F H H
1-1031 H Me CH2CH2-(3-CH2CH2CO2Me-1-Pyza) 2-F H H
1-1032 Ac Me CH2CH2-(3-CH2CH2CO2Me-1-Pyza) 2-F H H
1-1033 H Me CH2CH2-(3-CH2CH2CO2Et-1-Pyza) 2-F H H
1-1034 Ac Me CH2CH2-(3-CH2CH2CO2Et-1-Pyza) 2-F H H
1-1035 H Me CH2CH2-(4-CH2CH2CO2H-1-Pyza) 2-F H H
1-1036 Ac Me CH2CH2-(4-CH2CH2CO2H-1-Pyza) 2-F H H
1-1037 H Me CH2CH2-(4-CH2CH2CO2Me-1-Pyza) 2-F H H
1-1038 Ac Me CH2CH2-(4-CH2CH2CO2Me-1-Pyza) 2-F H H
1-1039 H Me CH2CH2-(4-CH2CH2CO2Et-1-Pyza) 2-F H H
1-1040 Ac Me CH2CH2-(4-CH2CH2CO2Et-1-Pyza) 2-F H H
1-1041 H H CH2-(2-CO2Me-4-Triz) 2-F H H
1-1042 Ac H CH2-(2-CO2Me-4-Triz) 2-F H H
1-1043 H H CH2-(2-CO2Et-4-Triz) 2-F H H
1-1044 Ac H CH2-(2-CO2Et-4-Triz) 2-F H H
1-1045 H H CH2-(2-CH2CO2H-4-Triz) 2-F H H
1-1046 Ac H CH2-(2-CH2CO2H-4-Triz) 2-F H H
1-1047 H H CH2-(2-CH2CO2Me-4-Triz) 2-F H H
1-1048 Ac H CH2-(2-CH2CO2Me-4-Triz) 2-F H H
1-1049 H H CH2-(2-CH2CO2Et-4-Triz) 2-F H H
1-1050 Ac H CH2-(2-CH2CO2Et-4-Triz) 2-F H H
1-1051 H H CH2-(2-CH2CH2CO2H-4-Triz) 2-F H H
1-1052 Ac H CH2-(2-CH2CH2CO2H-4-Triz) 2-F H H
1-1053 H H CH2-(2-CH2CH2CO2Me-4-Triz) 2-F H H
1-1054 Ac H CH2-(2-CH2CH2CO2Me-4-Triz) 2-F H H
1-1055 H H CH2-(2-CH2CH2CO2Et-4-Triz) 2-F H H
1-1056 Ac H CH2-(2-CH2CH2CO2Et-4-Triz) 2-F H H
1-1057 H H CH2-(2-CH2CH2CH2CO2H-4-Triz) 2-F H H
1-1058 Ac H CH2-(2-CH2CH2CH2CO2H-4-Triz) 2-F H H
1-1059 H H CH2-(2-CH2CH2CH2CO2Me-4-Triz) 2-F H H
1-1060 Ac H CH2-(2-CH2CH2CH2CO2Me-4-Triz) 2-F H H
1-1061 H H CH2-(2-CH2CH2CH2CO2Et-4-Triz) 2-F H H
1-1062 Ac H CH2-(2-CH2CH2CH2CO2Et-4-Triz) 2-F H H
1-1063 H H CH2CH2-(2-CO2Me-4-Triz) 2-F H H
1-1064 Ac H CH2CH2-(2-CO2Me-4-Triz) 2-F H H
1-1065 H H CH2CH2-(2-CO2Et-4-Triz) 2-F H H
1-1066 Ac H CH2CH2-(2-CO2Et-4-Triz) 2-F H H
1-1067 H H CH2CH2-(2-CH2CO2H-4-Triz) 2-F H H
1-1068 Ac H CH2CH2-(2-CH2CO2H-4-Triz) 2-F H H
1-1069 H H CH2CH2-(2-CH2CO2Me-4-Triz) 2-F H H
1-1070 Ac H CH2CH2-(2-CH2CO2Me-4-Triz) 2-F H H
1-1071 H H CH2CH2-(2-CH2CO2Et-4-Triz) 2-F H H
1-1072 Ac H CH2CH2-(2-CH2CO2Et-4-Triz) 2-F H H
1-1073 H H CH2CH2-(2-CH2CH2CO2H-4-Triz) 2-F H H
1-1074 Ac H CH2CH2-(2-CH2CH2CO2H-4-Triz) 2-F H H
1-1075 H H CH2CH2-(2-CH2CH2CO2Me-4-Triz) 2-F H H
1-1076 Ac H CH2CH2-(2-CH2CH2CO2Me-4-Triz) 2-F H H
1-1077 H H CH2CH2-(2-CH2CH2CO2Et-4-Triz) 2-F H H
1-1078 Ac H CH2CH2-(2-CH2CH2CO2Et-4-Triz) 2-F H H
1-1079 H H CH2CH2-(2-CH2CH2CH2CO2H-4-Triz) 2-F H H
1-1080 Ac H CH2CH2-(2-CH2CH2CH2CO2H-4-Triz) 2-F H H
1-1081 H H CH2CH2-(2-CH2CH2CH2CO2Me-4-Triz) 2-F H H
1-1082 Ac H CH2CH2-(2-CH2CH2CH2CO2Me-4-Triz) 2-F H H
1-1083 H H CH2CH2-(2-CH2CH2CH2CO2Et-4-Triz) 2-F H H
1-1084 Ac H CH2CH2-(2-CH2CH2CH2CO2Et-4-Triz) 2-F H H
(Таблица 2)
Соединение № P1 R2 R3 X1 X2 X3
2-1 H H CH2-1-Pyza 2-F H H
2-2 Ac H CH2-1-Pyza 2-F H H
2-3 H H CH2-1-Pyza 2-F 4-F H
2-4 Ac H CH2-1-Pyza 2-F 4-F H
2-5 H H CH2-(3-CO2H-1-Pyza) 2-F H H
2-6 Ac H CH2-(3-CO2H-1-Pyza) 2-F H H
2-7 H H CH2-(3-CO2H-1-Pyza) 2-F 4-F H
2-8 Ac H CH2-(3-CO2H-1-Pyza) 2-F 4-F H
2-9 H H CH2-(3-CO2Me-1-Pyza) 2-F H H
2-10 Ac H CH2-(3-CO2Me-1-Pyza) 2-F H H
2-11 H H CH2-(3-CO2Me-1-Pyza) 2-F 4-F H
2-12 Ac H CH2-(3-CO2Me-1-Pyza) 2-F 4-F H
2-13 H H CH2-(3-CO2Et-1-Pyza) 2-F H H
2-14 Ac H CH2-(3-CO2Et-1-Pyza) 2-F H H
2-15 H H CH2-(3-CO2Et-1-Pyza) 2-F 4-F H
2-16 Ac H CH2-(3-CO2Et-1-Pyza) 2-F 4-F H
2-17 H H CH2-(4-CO2H-1-Pyza) 2-F H H
2-18 Ac H CH2-(4-CO2H-1-Pyza) 2-F H H
2-19 H H CH2-(4-CO2H-1-Pyza) 2-F 4-F H
2-20 Ac H CH2-(4-CO2H-1-Pyza) 2-F 4-F H
2-21 H H CH2-(4-CO2Me-1-Pyza) 2-F H H
2-22 Ac H CH2-(4-CO2Me-1-Pyza) 2-F H H
2-23 H H CH2-(4-CO2Me-1-Pyza) 2-F 4-F H
2-24 Ac H CH2-(4-CO2Me-1-Pyza) 2-F 4-F H
2-25 H H CH2-(4-CO2Et-1-Pyza) 2-F H H
2-26 Ac H CH2-(4-CO2Et-1-Pyza) 2-F H H
2-27 H H CH2-(4-CO2Et-1-Pyza) 2-F 4-F H
2-28 Ac H CH2-(4-CO2Et-1-Pyza) 2-F 4-F H
2-29 H H CH2-(5-CO2H-1-Pyza) 2-F H H
2-30 Ac H CH2-(5-CO2H-1-Pyza) 2-F H H
2-31 H H CH2-(5-CO2H-1-Pyza) 2-F 4-F H
2-32 Ac H CH2-(5-CO2H-1-Pyza) 2-F 4-F H
2-33 H H CH2-(5-CO2Me-1-Pyza) 2-F H H
2-34 Ac H CH2-(5-CO2Me-1-Pyza) 2-F H H
2-35 H H CH2-(5-CO2Me-1-Pyza) 2-F 4-F H
2-36 Ac H CH2-(5-CO2Me-1-Pyza) 2-F 4-F H
2-37 H H CH2-(5-CO2Et-1-Pyza) 2-F H H
2-38 Ac H CH2-(5-CO2Et-1-Pyza) 2-F H H
2-39 H H CH2-(5-CO2Et-1-Pyza) 2-F 4-F H
2-40 Ac H CH2-(5-CO2Et-1-Pyza) 2-F 4-F H
2-41 H H CH2-(3-CH2CO2H-1-Pyza) 2-F H H
2-42 Ac H CH2-(3-CH2CO2H-1-Pyza) 2-F H H
2-43 H H CH2-(3-CH2CO2H-1-Pyza) 2-F 4-F H
2-44 Ac H CH2-(3-CH2CO2H-1-Pyza) 2-F 4-F H
2-45 H H CH2-(3-CH2CO2Me-1-Pyza) 2-F H H
2-46 Ac H CH2-(3-CH2CO2Me-1-Pyza) 2-F H H
2-47 H H CH2-(3-CH2CO2Me-1-Pyza) 2-F 4-F H
2-48 Ac H CH2-(3-CH2CO2Me-1-Pyza) 2-F 4-F H
2-49 H H CH2-(3-CH2CO2Et-1-Pyza) 2-F H H
2-50 Ac H CH2-(3-CH2CO2Et-1-Pyza) 2-F H H
2-51 H H CH2-(3-CH2CO2Et-1-Pyza) 2-F 4-F H
2-52 Ac H CH2-(3-CH2CO2Et-1-Pyza) 2-F 4-F H
2-53 H H CH2-(4-CH2CO2H-1-Pyza) 2-F H H
2-54 Ac H CH2-(4-CH2CO2H-1-Pyza) 2-F H H
2-55 H H CH2-(4-CH2CO2H-1-Pyza) 2-F 4-F H
2-56 Ac H CH2-(4-CH2CO2H-1-Pyza) 2-F 4-F H
2-57 H H CH2-(4-CH2CO2Me-1-Pyza) 2-F H H
2-58 Ac H CH2-(4-CH2CO2Me-1-Pyza) 2-F H H
2-59 H H CH2-(4-CH2CO2Me-1-Pyza) 2-F 4-F H
2-60 Ac H CH2-(4-CH2CO2Me-1-Pyza) 2-F 4-F H
2-61 H H CH2-(4-CH2CO2Et-1-Pyza) 2-F H H
2-62 Ac H CH2-(4-CH2CO2Et-1-Pyza) 2-F H H
2-63 H H CH2-(4-CH2CO2Et-1-Pyza) 2-F 4-F H
2-64 Ac H CH2-(4-CH2CO2Et-1-Pyza) 2-F 4-F H
2-65 H H CH2-(5-CH2CO2H-1-Pyza) 2-F H H
2-66 Ac H CH2-(5-CH2CO2H-1-Pyza) 2-F H H
2-67 H H CH2-(5-CH2CO2H-1-Pyza) 2-F 4-F H
2-68 Ac H CH2-(5-CH2CO2H-1-Pyza) 2-F 4-F H
2-69 H H CH2-(5-CH2CO2Me-1-Pyza) 2-F H H
2-70 Ac H CH2-(5-CH2CO2Me-1-Pyza) 2-F H H
2-71 H H CH2-(5-CH2CO2Me-1-Pyza) 2-F 4-F H
2-72 Ac H CH2-(5-CH2CO2Me-1-Pyza) 2-F 4-F H
2-73 H H CH2-(5-CH2CO2Et-1-Pyza) 2-F H H
2-74 Ac H CH2-(5-CH2CO2Et-1-Pyza) 2-F H H
2-75 H H CH2-(5-CH2CO2Et-1-Pyza) 2-F 4-F H
2-76 Ac H CH2-(5-CH2CO2Et-1-Pyza) 2-F 4-F H
2-77 H H CH2-(3-CH2CH2CO2H-1-Pyza) 2-F H H
2-78 Ac H CH2-(3-CH2CH2CO2H-1-Pyza) 2-F H H
2-79 H H CH2-(3-CH2CH2CO2Me-1-Pyza) 2-F H H
2-80 Ac H CH2-(3-CH2CH2CO2Me-1-Pyza) 2-F H H
2-81 H H CH2-(3-CH2CH2CO2Et-1-Pyza) 2-F H H
2-82 Ac H CH2-(3-CH2CH2CO2Et-1-Pyza) 2-F H H
2-83 H H CH2-(4-CH2CH2CO2H-1-Pyza) 2-F H H
2-84 Ac H CH2-(4-CH2CH2CO2H-1-Pyza) 2-F H H
2-85 H H CH2-(4-CH2CH2CO2Me-1-Pyza) 2-F H H
2-86 Ac H CH2-(4-CH2CH2CO2Me-1-Pyza) 2-F H H
2-87 H H CH2-(4-CH2CH2CO2Et-1-Pyza) 2-F H H
2-88 Ac H CH2-(4-CH2CH2CO2Et-1-Pyza) 2-F H H
2-89 H H CH2-(5-CH2CH2CO2H-1-Pyza) 2-F H H
2-90 Ac H CH2-(5-CH2CH2CO2H-1-Pyza) 2-F H H
2-91 H H CH2-(5-CH2CH2CO2Me-1-Pyza) 2-F H H
2-92 Ac H CH2-(5-CH2CH2CO2Me-1-Pyza) 2-F H H
2-93 H H CH2-(5-CH2CH2CO2Et-1-Pyza) 2-F H H
2-94 Ac H CH2-(5-CH2CH2CO2Et-1-Pyza) 2-F H H
2-95 H H CH2-(3-CH2CH2CH2CO2H-1-Pyza) 2-F H H
2-96 Ac H CH2-(3-CH2CH2CH2CO2H-1-Pyza) 2-F H H
2-97 H H CH2-(3-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
2-98 Ac H CH2-(3-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
2-99 H H CH2-(3-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
2-100 Ac H CH2-(3-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
2-101 H H CH2-(4-CH2CH2CH2CO2H-1-Pyza) 2-F H H
2-102 Ac H CH2-(4-CH2CH2CH2CO2H-1-Pyza) 2-F H H
2-103 H H CH2-(4-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
2-104 Ac H CH2-(4-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
2-105 H H CH2-(4-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
2-106 Ac H CH2-(4-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
2-107 H H CH2-(5-CH2CH2CH2CO2H-1-Pyza) 2-F H H
2-108 Ac H CH2-(5-CH2CH2CH2CO2H-1-Pyza) 2-F H H
2-109 H H CH2-(5-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
2-110 Ac H CH2-(5-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
2-111 H H CH2-(5-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
2-112 Ac H CH2-(5-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
2-113 H H CH2CH2-1-Pyza 2-F H H
2-114 Ac H CH2CH2-1-Pyza 2-F H H
2-115 H H CH2CH2-(3-CO2H-1-Pyza) 2-F H H
2-116 Ac H CH2CH2-(3-CO2H-1-Pyza) 2-F H H
2-117 H H CH2CH2-(3-CO2Me-1-Pyza) 2-F H H
2-118 Ac H CH2CH2-(3-CO2Me-1-Pyza) 2-F H H
2-119 H H CH2CH2-(3-CO2Et-1-Pyza) 2-F H H
2-120 Ac H CH2CH2-(3-CO2Et-1-Pyza) 2-F H H
2-121 H H CH2CH2-(4-CO2H-1-Pyza) 2-F H H
2-122 Ac H CH2CH2-(4-CO2H-1-Pyza) 2-F H H
2-123 H H CH2CH2-(4-CO2Me-1-Pyza) 2-F H H
2-124 Ac H CH2CH2-(4-CO2Me-1-Pyza) 2-F H H
2-125 H H CH2CH2-(4-CO2Et-1-Pyza) 2-F H H
2-126 Ac H CH2CH2-(4-CO2Et-1-Pyza) 2-F H H
2-127 H H CH2CH2-(5-CO2H-1-Pyza) 2-F H H
2-128 Ac H CH2CH2-(5-CO2H-1-Pyza) 2-F H H
2-129 H H CH2CH2-(5-CO2Me-1-Pyza) 2-F H H
2-130 Ac H CH2CH2-(5-CO2Me-1-Pyza) 2-F H H
2-131 H H CH2CH2-(5-CO2Et-1-Pyza) 2-F H H
2-132 Ac H CH2CH2-(5-CO2Et-1-Pyza) 2-F H H
2-133 H H CH2CH2-(3-CH2CO2H-1-Pyza) 2-F H H
2-134 Ac H CH2CH2-(3-CH2CO2H-1-Pyza) 2-F H H
2-135 H H CH2CH2-(3-CH2CO2Me-1-Pyza) 2-F H H
2-136 Ac H CH2CH2-(3-CH2CO2Me-1-Pyza) 2-F H H
2-137 H H CH2CH2-(3-CH2CO2Et-1-Pyza) 2-F H H
2-138 Ac H CH2CH2-(3-CH2CO2Et-1-Pyza) 2-F H H
2-139 H H CH2CH2-(4-CH2CO2H-1-Pyza) 2-F H H
2-140 Ac H CH2CH2-(4-CH2CO2H-1-Pyza) 2-F H H
2-141 H H CH2CH2-(4-CH2CO2Me-1-Pyza) 2-F H H
2-142 Ac H CH2CH2-(4-CH2CO2Me-1-Pyza) 2-F H H
2-143 H H CH2CH2-(4-CH2CO2Et-1-Pyza) 2-F H H
2-144 Ac H CH2CH2-(4-CH2CO2Et-1-Pyza) 2-F H H
2-145 H H CH2CH2-(5-CH2CO2H-1-Pyza) 2-F H H
2-146 Ac H CH2CH2-(5-CH2CO2H-1-Pyza) 2-F H H
2-147 H H CH2CH2-(5-CH2CO2Me-1-Pyza) 2-F H H
2-148 Ac H CH2CH2-(5-CH2CO2Me-1-Pyza) 2-F H H
2-149 H H CH2CH2-(5-CH2CO2Et-1-Pyza) 2-F H H
2-150 Ac H CH2CH2-(5-CH2CO2Et-1-Pyza) 2-F H H
2-151 H H CH2CH2-(3-CH2CH2CO2H-1-Pyza) 2-F H H
2-152 Ac H CH2CH2-(3-CH2CH2CO2H-1-Pyza) 2-F H H
2-153 H H CH2CH2-(3-CH2CH2CO2Me-1-Pyza) 2-F H H
2-154 Ac H CH2CH2-(3-CH2CH2CO2Me-1-Pyza) 2-F H H
2-155 H H CH2CH2-(3-CH2CH2CO2Et-1-Pyza) 2-F H H
2-156 Ac H CH2CH2-(3-CH2CH2CO2Et-1-Pyza) 2-F H H
2-157 H H CH2CH2-(4-CH2CH2CO2H-1-Pyza) 2-F H H
2-158 Ac H CH2CH2-(4-CH2CH2CO2H-1-Pyza) 2-F H H
2-159 H H CH2CH2-(4-CH2CH2CO2Me-1-Pyza) 2-F H H
2-160 Ac H CH2CH2-(4-CH2CH2CO2Me-1-Pyza) 2-F H H
2-161 H H CH2CH2-(4-CH2CH2CO2Et-1-Pyza) 2-F H H
2-162 Ac H CH2CH2-(4-CH2CH2CO2Et-1-Pyza) 2-F H H
2-163 H H CH2CH2-(5-CH2CH2CO2H-1-Pyza) 2-F H H
2-164 Ac H CH2CH2-(5-CH2CH2CO2H-1-Pyza) 2-F H H
2-165 H H CH2CH2-(5-CH2CH2CO2Me-1-Pyza) 2-F H H
2-166 Ac H CH2CH2-(5-CH2CH2CO2Me-1-Pyza) 2-F H H
2-167 H H CH2CH2-(5-CH2CH2CO2Et-1-Pyza) 2-F H H
2-168 Ac H CH2CH2-(5-CH2CH2CO2Et-1-Pyza) 2-F H H
2-169 H H CH2CH2-(3-CH2CH2CH2CO2H-1-Pyza) 2-F H H
2-170 Ac H CH2CH2-(3-CH2CH2CH2CO2H-1-Pyza) 2-F H H
2-171 H H CH2CH2-(3-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
2-172 Ac H CH2CH2-(3-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
2-173 H H CH2CH2-(3-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
2-174 Ac H CH2CH2-(3-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
2-175 H H CH2CH2-(4-CH2CH2CH2CO2H-1-Pyza) 2-F H H
2-176 Ac H CH2CH2-(4-CH2CH2CH2CO2H-1-Pyza) 2-F H H
2-177 H H CH2CH2-(4-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
2-178 Ac H CH2CH2-(4-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
2-179 H H CH2CH2-(4-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
2-180 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
2-181 H H CH2CH2-(5-CH2CH2CH2CO2H-1-Pyza) 2-F H H
2-182 Ac H CH2CH2-(5-CH2CH2CH2CO2H-1-Pyza) 2-F H H
2-183 H H CH2CH2-(5-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
2-184 Ac H CH2CH2-(5-CH2CH2CH2CO2Me-1-Pyza) 2-F H H
2-185 H H CH2CH2-(5-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
2-186 Ac H CH2CH2-(5-CH2CH2CH2CO2Et-1-Pyza) 2-F H H
2-187 H H CH2-3-Pyza 2-F H H
2-188 Ac H CH2-3-Pyza 2-F H H
2-189 H H CH2-3-Pyza 2-F 4-F H
2-190 Ac H CH2-3-Pyza 2-F 4-F H
2-191 H H CH2-(1-CO2Me-3-Pyza) 2-F H H
2-192 Ac H CH2-(1-CO2Me-3-Pyza) 2-F H H
2-193 H H CH2-(1-CO2Et-3-Pyza) 2-F H H
2-194 Ac H CH2-(1-CO2Et-3-Pyza) 2-F H H
2-195 H H CH2-(4-CO2H-3-Pyza) 2-F H H
2-196 Ac H CH2-(4-CO2H-3-Pyza) 2-F H H
2-197 H H CH2-(4-CO2Me-3-Pyza) 2-F H H
2-198 Ac H CH2-(4-CO2Me-3-Pyza) 2-F H H
2-199 H H CH2-(4-CO2Et-3-Pyza) 2-F H H
2-200 Ac H CH2-(4-CO2Et-3-Pyza) 2-F H H
2-201 H H CH2-(5-CO2H-3-Pyza) 2-F H H
2-202 Ac H CH2-(5-CO2H-3-Pyza) 2-F H H
2-203 H H CH2-(5-CO2Me-3-Pyza) 2-F H H
2-204 Ac H CH2-(5-CO2Me-3-Pyza) 2-F H H
2-205 H H CH2-(5-CO2Et-3-Pyza) 2-F H H
2-206 Ac H CH2-(5-CO2Et-3-Pyza) 2-F H H
2-207 H H CH2-(1-CH2CO2H-3-Pyza) 2-F H H
2-208 Ac H CH2-(1-CH2CO2H-3-Pyza) 2-F H H
2-209 H H CH2-(1-CH2CO2Me-3-Pyza) 2-F H H
2-210 Ac H CH2-(1-CH2CO2Me-3-Pyza) 2-F H H
2-211 H H CH2-(1-CH2CO2Et-3-Pyza) 2-F H H
2-212 Ac H CH2-(1-CH2CO2Et-3-Pyza) 2-F H H
2-213 H H CH2-(4-CH2CO2H-3-Pyza) 2-F H H
2-214 Ac H CH2-(4-CH2CO2H-3-Pyza) 2-F H H
2-215 H H CH2-(4-CH2CO2Me-3-Pyza) 2-F H H
2-216 Ac H CH2-(4-CH2CO2Me-3-Pyza) 2-F H H
2-217 H H CH2-(4-CH2CO2Et-3-Pyza) 2-F H H
2-218 Ac H CH2-(4-CH2CO2Et-3-Pyza) 2-F H H
2-219 H H CH2-(5-CH2CO2H-3-Pyza) 2-F H H
2-220 Ac H CH2-(5-CH2CO2H-3-Pyza) 2-F H H
2-221 H H CH2-(5-CH2CO2Me-3-Pyza) 2-F H H
2-222 Ac H CH2-(5-CH2CO2Me-3-Pyza) 2-F H H
2-223 H H CH2-(5-CH2CO2Et-3-Pyza) 2-F H H
2-224 Ac H CH2-(5-CH2CO2Et-3-Pyza) 2-F H H
2-225 H H CH2-(1-CH2CH2CO2H-3-Pyza) 2-F H H
2-226 Ac H CH2-(1-CH2CH2CO2H-3-Pyza) 2-F H H
2-227 H H CH2-(1-CH2CH2CO2Me-3-Pyza) 2-F H H
2-228 Ac H CH2-(1-CH2CH2CO2Me-3-Pyza) 2-F H H
2-229 H H CH2-(1-CH2CH2CO2Et-3-Pyza) 2-F H H
2-230 Ac H CH2-(1-CH2CH2CO2Et-3-Pyza) 2-F H H
2-231 H H CH2-(4-CH2CH2CO2H-3-Pyza) 2-F H H
2-232 Ac H CH2-(4-CH2CH2CO2H-3-Pyza) 2-F H H
2-233 H H CH2-(4-CH2CH2CO2Me-3-Pyza) 2-F H H
2-234 Ac H CH2-(4-CH2CH2CO2Me-3-Pyza) 2-F H H
2-235 H H CH2-(4-CH2CH2CO2Et-3-Pyza) 2-F H H
2-236 Ac H CH2-(4-CH2CH2CO2Et-3-Pyza) 2-F H H
2-237 H H CH2-(5-CH2CH2CO2H-3-Pyza) 2-F H H
2-238 Ac H CH2-(5-CH2CH2CO2H-3-Pyza) 2-F H H
2-239 H H CH2-(5-CH2CH2CO2Me-3-Pyza) 2-F H H
2-240 Ac H CH2-(5-CH2CH2CO2Me-3-Pyza) 2-F H H
2-241 H H CH2-(5-CH2CH2CO2Et-3-Pyza) 2-F H H
2-242 Ac H CH2-(5-CH2CH2CO2Et-3-Pyza) 2-F H H
2-245 H H CH2-(1-CH2CH2CH2CO2H-3-Pyza) 2-F H H
2-246 Ac H CH2-(1-CH2CH2CH2CO2H-3-Pyza) 2-F H H
2-247 H H CH2-(1-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
2-248 Ac H CH2-(1-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
2-249 H H CH2-(1-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
2-250 Ac H CH2-(1-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
2-251 H H CH2-(4-CH2CH2CH2CO2H-3-Pyza) 2-F H H
2-252 Ac H CH2-(4-CH2CH2CH2CO2H-3-Pyza) 2-F H H
2-253 H H CH2-(4-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
2-254 Ac H CH2-(4-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
2-255 H H CH2-(4-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
2-256 Ac H CH2-(4-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
2-257 H H CH2-(5-CH2CH2CH2CO2H-3-Pyza) 2-F H H
2-258 Ac H CH2-(5-CH2CH2CH2CO2H-3-Pyza) 2-F H H
2-259 H H CH2-(5-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
2-260 Ac H CH2-(5-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
2-261 H H CH2-(5-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
2-262 Ac H CH2-(5-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
2-263 H H CH2CH2-3-Pyza 2-F H H
2-264 Ac H CH2CH2-3-Pyza 2-F H H
2-265 H H CH2CH2-3-Pyza 2-F 4-F H
2-266 Ac H CH2CH2-3-Pyza 2-F 4-F H
2-267 H H CH2CH2-(1-CO2Me-3-Pyza) 2-F H H
2-268 Ac H CH2CH2-(1-CO2Me-3-Pyza) 2-F H H
2-269 H H CH2CH2-(1-CO2Et-3-Pyza) 2-F H H
2-270 Ac H CH2CH2-(1-CO2Et-3-Pyza) 2-F H H
2-271 H H CH2CH2-(4-CO2H-3-Pyza) 2-F H H
2-272 Ac H CH2CH2-(4-CO2H-3-Pyza) 2-F H H
2-273 H H CH2CH2-(4-CO2Me-3-Pyza) 2-F H H
2-274 Ac H CH2CH2-(4-CO2Me-3-Pyza) 2-F H H
2-275 H H CH2CH2-(4-CO2Et-3-Pyza) 2-F H H
2-276 Ac H CH2CH2-(4-CO2Et-3-Pyza) 2-F H H
2-277 H H CH2CH2-(5-CO2H-3-Pyza) 2-F H H
2-278 Ac H CH2CH2-(5-CO2H-3-Pyza) 2-F H H
2-279 H H CH2CH2-(5-CO2Me-3-Pyza) 2-F H H
2-280 Ac H CH2CH2-(5-CO2Me-3-Pyza) 2-F H H
2-281 H H CH2CH2-(5-CO2Et-3-Pyza) 2-F H H
2-282 Ac H CH2CH2-(5-CO2Et-3-Pyza) 2-F H H
2-283 H H CH2CH2-(1-CH2CO2H-3-Pyza) 2-F H H
2-284 Ac H CH2CH2-(1-CH2CO2H-3-Pyza) 2-F H H
2-285 H H CH2CH2-(1-CH2CO2Me-3-Pyza) 2-F H H
2-286 Ac H CH2CH2-(1-CH2CO2Me-3-Pyza) 2-F H H
2-287 H H CH2CH2-(1-CH2CO2Et-3-Pyza) 2-F H H
2-288 Ac H CH2CH2-(1-CH2CO2Et-3-Pyza) 2-F H H
2-289 H H CH2CH2-(4-CH2CO2H-3-Pyza) 2-F H H
2-290 Ac H CH2CH2-(4-CH2CO2H-3-Pyza) 2-F H H
2-291 H H CH2CH2-(4-CH2CO2Me-3-Pyza) 2-F H H
2-292 Ac H CH2CH2-(4-CH2CO2Me-3-Pyza) 2-F H H
2-293 H H CH2CH2-(4-CH2CO2Et-3-Pyza) 2-F H H
2-294 Ac H CH2CH2-(4-CH2CO2Et-3-Pyza) 2-F H H
2-295 H H CH2CH2-(5-CH2CO2H-3-Pyza) 2-F H H
2-296 Ac H CH2CH2-(5-CH2CO2H-3-Pyza) 2-F H H
2-297 H H CH2CH2-(5-CH2CO2Me-3-Pyza) 2-F H H
2-298 Ac H CH2CH2-(5-CH2CO2Me-3-Pyza) 2-F H H
2-299 H H CH2CH2-(5-CH2CO2Et-3-Pyza) 2-F H H
2-300 Ac H CH2CH2-(5-CH2CO2Et-3-Pyza) 2-F H H
2-301 H H CH2CH2-(1-CH2CH2CO2H-3-Pyza) 2-F H H
2-302 Ac H CH2CH2-(1-CH2CH2CO2H-3-Pyza) 2-F H H
2-303 H H CH2CH2-(1-CH2CH2CO2Me-3-Pyza) 2-F H H
2-304 Ac H CH2CH2-(1-CH2CH2CO2Me-3-Pyza) 2-F H H
2-305 H H CH2CH2-(1-CH2CH2CO2Et-3-Pyza) 2-F H H
2-306 Ac H CH2CH2-(1-CH2CH2CO2Et-3-Pyza) 2-F H H
2-307 H H CH2CH2-(4-CH2CH2CO2H-3-Pyza) 2-F H H
2-308 Ac H CH2CH2-(4-CH2CH2CO2H-3-Pyza) 2-F H H
2-309 H H CH2CH2-(4-CH2CH2CO2Me-3-Pyza) 2-F H H
2-310 Ac H CH2CH2-(4-CH2CH2CO2Me-3-Pyza) 2-F H H
2-311 H H CH2CH2-(4-CH2CH2CO2Et-3-Pyza) 2-F H H
2-312 Ac H CH2CH2-(4-CH2CH2CO2Et-3-Pyza) 2-F H H
2-313 H H CH2CH2-(5-CH2CH2CO2H-3-Pyza) 2-F H H
2-314 Ac H CH2CH2-(5-CH2CH2CO2H-3-Pyza) 2-F H H
2-315 H H CH2CH2-(5-CH2CH2CO2Me-3-Pyza) 2-F H H
2-316 Ac H CH2CH2-(5-CH2CH2CO2Me-3-Pyza) 2-F H H
2-317 H H CH2CH2-(5-CH2CH2CO2Et-3-Pyza) 2-F H H
2-318 Ac H CH2CH2-(5-CH2CH2CO2Et-3-Pyza) 2-F H H
2-319 H H CH2CH2-(1-CH2CH2CH2CO2H-3-Pyza) 2-F H H
2-320 Ac H CH2CH2-(1-CH2CH2CH2CO2H-3-Pyza) 2-F H H
2-321 H H CH2CH2-(1-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
2-322 Ac H CH2CH2-(1-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
2-323 H H CH2CH2-(1-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
2-324 Ac H CH2CH2-(1-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
2-325 H H CH2CH2-(4-CH2CH2CH2CO2H-3-Pyza) 2-F H H
2-326 Ac H CH2CH2-(4-CH2CH2CH2CO2H-3-Pyza) 2-F H H
2-327 H H CH2CH2-(4-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
2-328 Ac H CH2CH2-(4-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
2-329 H H CH2CH2-(4-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
2-330 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
2-331 H H CH2CH2-(5-CH2CH2CH2CO2H-3-Pyza) 2-F H H
2-332 Ac H CH2CH2-(5-CH2CH2CH2CO2H-3-Pyza) 2-F H H
2-333 H H CH2CH2-(5-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
2-334 Ac H CH2CH2-(5-CH2CH2CH2CO2Me-3-Pyza) 2-F H H
2-335 H H CH2CH2-(5-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
2-336 Ac H CH2CH2-(5-CH2CH2CH2CO2Et-3-Pyza) 2-F H H
2-337 H H CH2-4-Pyza 2-F H H
2-338 Ac H CH2-4-Pyza 2-F H H
2-339 H H CH2-4-Pyza 2-F 4-F H
2-340 Ac H CH2-4-Pyza 2-F 4-F H
2-341 H H CH2-(1-CO2Me-4-Pyza) 2-F H H
2-342 Ac H CH2-(1-CO2Me-4-Pyza) 2-F H H
2-343 H H CH2-(1-CO2Et-4-Pyza) 2-F H H
2-344 Ac H CH2-(1-CO2Et-4-Pyza) 2-F H H
2-345 H H CH2-(3-CO2H-4-Pyza) 2-F H H
2-346 Ac H CH2-(3-CO2H-4-Pyza) 2-F H H
2-347 H H CH2-(3-CO2Me-4-Pyza) 2-F H H
2-348 Ac H CH2-(3-CO2Me-4-Pyza) 2-F H H
2-349 H H CH2-(3-CO2Et-4-Pyza) 2-F H H
2-350 Ac H CH2-(3-CO2Et-4-Pyza) 2-F H H
2-351 H H CH2-(1-CH2CO2H-4-Pyza) 2-F H H
2-352 Ac H CH2-(1-CH2CO2H-4-Pyza) 2-F H H
2-353 H H CH2-(1-CH2CO2Me-4-Pyza) 2-F H H
2-354 Ac H CH2-(1-CH2CO2Me-4-Pyza) 2-F H H
2-355 H H CH2-(1-CH2CO2Et-4-Pyza) 2-F H H
2-356 Ac H CH2-(1-CH2CO2Et-4-Pyza) 2-F H H
2-357 H H CH2-(3-CH2CO2H-4-Pyza) 2-F H H
2-358 Ac H CH2-(3-CH2CO2H-4-Pyza) 2-F H H
2-359 H H CH2-(3-CH2CO2Me-4-Pyza) 2-F H H
2-360 Ac H CH2-(3-CH2CO2Me-4-Pyza) 2-F H H
2-361 H H CH2-(3-CH2CO2Et-4-Pyza) 2-F H H
2-362 Ac H CH2-(3-CH2CO2Et-4-Pyza) 2-F H H
2-363 H H CH2-(1-CH2CH2CO2H-4-Pyza) 2-F H H
2-364 Ac H CH2-(1-CH2CH2CO2H-4-Pyza) 2-F H H
2-365 H H CH2-(1-CH2CH2CO2Me-4-Pyza) 2-F H H
2-366 Ac H CH2-(1-CH2CH2CO2Me-4-Pyza) 2-F H H
2-367 H H CH2-(1-CH2CH2CO2Et-4-Pyza) 2-F H H
2-368 Ac H CH2-(1-CH2CH2CO2Et-4-Pyza) 2-F H H
2-369 H H CH2-(3-CH2CH2CO2H-4-Pyza) 2-F H H
2-370 Ac H CH2-(3-CH2CH2CO2H-4-Pyza) 2-F H H
2-371 H H CH2-(3-CH2CH2CO2Me-4-Pyza) 2-F H H
2-372 Ac H CH2-(3-CH2CH2CO2Me-4-Pyza) 2-F H H
2-373 H H CH2-(3-CH2CH2CO2Et-4-Pyza) 2-F H H
2-374 Ac H CH2-(3-CH2CH2CO2Et-4-Pyza) 2-F H H
2-375 H H CH2-(1-CH2CH2CH2CO2H-4-Pyza) 2-F H H
2-376 Ac H CH2-(1-CH2CH2CH2CO2H-4-Pyza) 2-F H H
2-377 H H CH2-(1-CH2CH2CH2CO2Me-4-Pyza) 2-F H H
2-378 Ac H CH2-(1-CH2CH2CH2CO2Me-4-Pyza) 2-F H H
2-379 H H CH2-(1-CH2CH2CH2CO2Et-4-Pyza) 2-F H H
2-380 Ac H CH2-(1-CH2CH2CH2CO2Et-4-Pyza) 2-F H H
2-381 H H CH2-(3-CH2CH2CH2CO2H-4-Pyza) 2-F H H
2-382 Ac H CH2-(3-CH2CH2CH2CO2H-4-Pyza) 2-F H H
2-383 H H CH2-(3-CH2CH2CH2CO2Me-4-Pyza) 2-F H H
2-384 Ac H CH2-(3-CH2CH2CH2CO2Me-4-Pyza) 2-F H H
2-385 H H CH2-(3-CH2CH2CH2CO2Et-4-Pyza) 2-F H H
2-386 Ac H CH2-(3-CH2CH2CH2CO2Et-4-Pyza) 2-F H H
2-387 H H CH2CH2-4-Pyza 2-F H H
2-388 Ac H CH2CH2-4-Pyza 2-F H H
2-389 H H CH2CH2-4-Pyza 2-F 4-F H
2-390 Ac H CH2CH2-4-Pyza 2-F 4-F H
2-391 H H CH2CH2-(1-CO2Me-4-Pyza) 2-F H H
2-392 Ac H CH2CH2-(1-CO2Me-4-Pyza) 2-F H H
2-393 H H CH2CH2-(1-CO2Et-4-Pyza) 2-F H H
2-394 Ac H CH2CH2-(1-CO2Et-4-Pyza) 2-F H H
2-395 H H CH2CH2-(3-CO2H-4-Pyza) 2-F H H
2-396 Ac H CH2CH2-(3-CO2H-4-Pyza) 2-F H H
2-397 H H CH2CH2-(3-CO2Me-4-Pyza) 2-F H H
2-398 Ac H CH2CH2-(3-CO2Me-4-Pyza) 2-F H H
2-399 H H CH2CH2-(3-CO2Et-4-Pyza) 2-F H H
2-400 Ac H CH2CH2-(3-CO2Et-4-Pyza) 2-F H H
2-401 H H CH2CH2-(1-CH2CO2H-4-Pyza) 2-F H H
2-402 Ac H CH2CH2-(1-CH2CO2H-4-Pyza) 2-F H H
2-403 H H CH2CH2-(1-CH2CO2Me-4-Pyza) 2-F H H
2-404 Ac H CH2CH2-(1-CH2CO2Me-4-Pyza) 2-F H H
2-405 H H CH2CH2-(1-CH2CO2Et-4-Pyza) 2-F H H
2-406 Ac H CH2CH2-(1-CH2CO2Et-4-Pyza) 2-F H H
2-407 H H CH2CH2-(3-CH2CO2H-4-Pyza) 2-F H H
2-408 Ac H CH2CH2-(3-CH2CO2H-4-Pyza) 2-F H H
2-409 H H CH2CH2-(3-CH2CO2Me-4-Pyza) 2-F H H
2-410 Ac H CH2CH2-(3-CH2CO2Me-4-Pyza) 2-F H H
2-411 H H CH2CH2-(3-CH2CO2Et-4-Pyza) 2-F H H
2-412 Ac H CH2CH2-(3-CH2CO2Et-4-Pyza) 2-F H H
2-413 H H CH2CH2-(1-CH2CH2CO2H-4-Pyza) 2-F H H
2-414 Ac H CH2CH2-(1-CH2CH2CO2H-4-Pyza) 2-F H H
2-415 H H CH2CH2-(1-CH2CH2CO2Me-4-Pyza) 2-F H H
2-416 Ac H CH2CH2-(1-CH2CH2CO2Me-4-Pyza) 2-F H H
2-417 H H CH2CH2-(1-CH2CH2CO2Et-4-Pyza) 2-F H H
2-418 Ac H CH2CH2-(1-CH2CH2CO2Et-4-Pyza) 2-F H H
2-419 H H CH2CH2-(3-CH2CH2CO2H-4-Pyza) 2-F H H
2-420 Ac H CH2CH2-(3-CH2CH2CO2H-4-Pyza) 2-F H H
2-421 H H CH2CH2-(3-CH2CH2CO2Me-4-Pyza) 2-F H H
2-422 Ac H CH2CH2-(3-CH2CH2CO2Me-4-Pyza) 2-F H H
2-423 H H CH2CH2-(3-CH2CH2CO2Et-4-Pyza) 2-F H H
2-424 Ac H CH2CH2-(3-CH2CH2CO2Et-4-Pyza) 2-F H H
2-425 H H CH2CH2-(1-CH2CH2CH2CO2H-4-Pyza) 2-F H H
2-426 Ac H CH2CH2-(1-CH2CH2CH2CO2H-4-Pyza) 2-F H H
2-427 H H CH2CH2-(1-CH2CH2CH2CO2Me-4-Pyza) 2-F H H
2-428 Ac H CH2CH2-(1-CH2CH2CH2CO2Me-4-Pyza) 2-F H H
2-429 H H CH2CH2-(1-CH2CH2CH2CO2Et-4-Pyza) 2-F H H
2-430 Ac H CH2CH2-(1-CH2CH2CH2CO2Et-4-Pyza) 2-F H H
2-431 H H CH2CH2-(3-CH2CH2CH2CO2H-4-Pyza) 2-F H H
2-432 Ac H CH2CH2-(3-CH2CH2CH2CO2H-4-Pyza) 2-F H H
2-433 H H CH2CH2-(3-CH2CH2CH2CO2Me-4-Pyza) 2-F H H
2-434 Ac H CH2CH2-(3-CH2CH2CH2CO2Me-4-Pyza) 2-F H H
2-435 H H CH2CH2-(3-CH2CH2CH2CO2Et-4-Pyza) 2-F H H
2-436 Ac H CH2CH2-(3-CH2CH2CH2CO2Et-4-Pyza) 2-F H H
2-437 H H CH2-(1-CO2Me-5-Pyza) 2-F 4-F H
2-438 Ac H CH2-(1-CO2Me-5-Pyza) 2-F 4-F H
2-439 H H CH2-(1-CO2Me-5-Pyza) 2-F H H
2-440 Ac H CH2-(1-CO2Me-5-Pyza) 2-F H H
2-441 H H CH2-(1-CO2Et-5-Pyza) 2-F H H
2-442 Ac H CH2-(1-CO2Et-5-Pyza) 2-F H H
2-443 H H CH2-(1-CH2CO2H-5-Pyza) 2-F H H
2-444 Ac H CH2-(1-CH2CO2H-5-Pyza) 2-F H H
2-445 H H CH2-(1-CH2CO2Me-5-Pyza) 2-F H H
2-446 Ac H CH2-(1-CH2CO2Me-5-Pyza) 2-F H H
2-447 H H CH2-(1-CH2CO2Et-5-Pyza) 2-F H H
2-448 Ac H CH2-(1-CH2CO2Et-5-Pyza) 2-F H H
2-449 H H CH2-(1-CH2CH2CO2H-5-Pyza) 2-F H H
2-450 Ac H CH2-(1-CH2CH2CO2H-5-Pyza) 2-F H H
2-451 H H CH2-(1-CH2CH2CO2Me-5-Pyza) 2-F H H
2-452 Ac H CH2-(1-CH2CH2CO2Me-5-Pyza) 2-F H H
2-453 H H CH2-(1-CH2CH2CO2Et-5-Pyza) 2-F H H
2-454 Ac H CH2-(1-CH2CH2CO2Et-5-Pyza) 2-F H H
2-455 H H CH2-(1-CH2CH2CH2CO2H-5-Pyza) 2-F H H
2-456 Ac H CH2-(1-CH2CH2CH2CO2H-5-Pyza) 2-F H H
2-457 H H CH2-(1-CH2CH2CH2CO2Me-5-Pyza) 2-F H H
2-458 Ac H CH2-(1-CH2CH2CH2CO2Me-5-Pyza) 2-F H H
2-459 H H CH2-(1-CH2CH2CH2CO2Et-5-Pyza) 2-F H H
2-460 Ac H CH2-(1-CH2CH2CH2CO2Et-5-Pyza) 2-F H H
2-461 H H CH2CH2-(1-CO2Me-5-Pyza) 2-F 4-F H
2-462 Ac H CH2CH2-(1-CO2Me-5-Pyza) 2-F 4-F H
2-463 H H CH2CH2-(1-CO2Me-5-Pyza) 2-F H H
2-464 Ac H CH2CH2-(1-CO2Me-5-Pyza) 2-F H H
2-465 H H CH2CH2-(1-CO2Et-5-Pyza) 2-F H H
2-466 Ac H CH2CH2-(1-CO2Et-5-Pyza) 2-F H H
2-467 H H CH2CH2-(1-CH2CO2H-5-Pyza) 2-F H H
2-468 Ac H CH2CH2-(1-CH2CO2H-5-Pyza) 2-F H H
2-469 H H CH2CH2-(1-CH2CO2Me-5-Pyza) 2-F H H
2-470 Ac H CH2CH2-(1-CH2CO2Me-5-Pyza) 2-F H H
2-471 H H CH2CH2-(1-CH2CO2Et-5-Pyza) 2-F H H
2-472 Ac H CH2CH2-(1-CH2CO2Et-5-Pyza) 2-F H H
2-473 H H CH2CH2-(1-CH2CH2CO2H-5-Pyza) 2-F H H
2-474 Ac H CH2CH2-(1-CH2CH2CO2H-5-Pyza) 2-F H H
2-475 H H CH2CH2-(1-CH2CH2CO2Me-5-Pyza) 2-F H H
2-476 Ac H CH2CH2-(1-CH2CH2CO2Me-5-Pyza) 2-F H H
2-477 H H CH2CH2-(1-CH2CH2CO2Et-5-Pyza) 2-F H H
2-478 Ac H CH2CH2-(1-CH2CH2CO2Et-5-Pyza) 2-F H H
2-479 H H CH2CH2-(1-CH2CH2CH2CO2H-5-Pyza) 2-F H H
2-480 Ac H CH2CH2-(1-CH2CH2CH2CO2H-5-Pyza) 2-F H H
2-481 H H CH2CH2-(1-CH2CH2CH2CO2Me-5-Pyza) 2-F H H
2-482 Ac H CH2CH2-(1-CH2CH2CH2CO2Me-5-Pyza) 2-F H H
2-483 H H CH2CH2-(1-CH2CH2CH2CO2Et-5-Pyza) 2-F H H
2-484 Ac H CH2CH2-(1-CH2CH2CH2CO2Et-5-Pyza) 2-F H H
2-485 H H CH2-1-Triz 2-F H H
2-486 Ac H CH2-1-Triz 2-F H H
2-487 H H CH2-(4-CO2H-1-Triz) 2-F H H
2-488 Ac H CH2-(4-CO2H-1-Triz) 2-F H H
2-489 H H CH2-(4-CO2Me-1-Triz) 2-F H H
2-490 Ac H CH2-(4-CO2Me-1-Triz) 2-F H H
2-491 H H CH2-(4-CO2Et-1-Triz) 2-F H H
2-492 Ac H CH2-(4-CO2Et-1-Triz) 2-F H H
2-493 H H CH2-(5-CO2H-1-Triz) 2-F H H
2-494 Ac H CH2-(5-CO2H-1-Triz) 2-F H H
2-495 H H CH2-(5-CO2Me-1-Triz) 2-F H H
2-496 Ac H CH2-(5-CO2Me-1-Triz) 2-F H H
2-497 H H CH2-(5-CO2Et-1-Triz) 2-F H H
2-498 Ac H CH2-(5-CO2Et-1-Triz) 2-F H H
2-499 H H CH2-(4-CH2CO2H-1-Triz) 2-F H H
2-500 Ac H CH2-(4-CH2CO2H-1-Triz) 2-F H H
2-501 H H CH2-(4-CH2CO2Me-1-Triz) 2-F H H
2-502 Ac H CH2-(4-CH2CO2Me-1-Triz) 2-F H H
2-503 H H CH2-(4-CH2CO2Et-1-Triz) 2-F H H
2-504 Ac H CH2-(4-CH2CO2Et-1-Triz) 2-F H H
2-505 H H CH2-(5-CH2CO2H-1-Triz) 2-F H H
2-506 Ac H CH2-(5-CH2CO2H-1-Triz) 2-F H H
2-507 H H CH2-(5-CH2CO2Me-1-Triz) 2-F H H
2-508 Ac H CH2-(5-CH2CO2Me-1-Triz) 2-F H H
2-509 H H CH2-(5-CH2CO2Et-1-Triz) 2-F H H
2-510 Ac H CH2-(5-CH2CO2Et-1-Triz) 2-F H H
2-511 H H CH2-(4-CH2CH2CO2H-1-Triz) 2-F H H
2-512 Ac H CH2-(4-CH2CH2CO2H-1-Triz) 2-F H H
2-513 H H CH2-(4-CH2CH2CO2Me-1-Triz) 2-F H H
2-514 Ac H CH2-(4-CH2CH2CO2Me-1-Triz) 2-F H H
2-515 H H CH2-(4-CH2CH2CO2Et-1-Triz) 2-F H H
2-516 Ac H CH2-(4-CH2CH2CO2Et-1-Triz) 2-F H H
2-517 H H CH2-(5-CH2CH2CO2H-1-Triz) 2-F H H
2-518 Ac H CH2-(5-CH2CH2CO2H-1-Triz) 2-F H H
2-519 H H CH2-(5-CH2CH2CO2Me-1-Triz) 2-F H H
2-520 Ac H CH2-(5-CH2CH2CO2Me-1-Triz) 2-F H H
2-521 H H CH2-(5-CH2CH2CO2Et-1-Triz) 2-F H H
2-522 Ac H CH2-(5-CH2CH2CO2Et-1-Triz) 2-F H H
2-523 H H CH2-(4-CH2CH2CH2CO2H-1-Triz) 2-F H H
2-524 Ac H CH2-(4-CH2CH2CH2CO2H-1-Triz) 2-F H H
2-525 H H CH2-(4-CH2CH2CH2CO2Me-1-Triz) 2-F H H
2-526 Ac H CH2-(4-CH2CH2CH2CO2Me-1-Triz) 2-F H H
2-527 H H CH2-(4-CH2CH2CH2CO2Et-1-Triz) 2-F H H
2-528 Ac H CH2-(4-CH2CH2CH2CO2Et-1-Triz) 2-F H H
2-529 H H CH2-(5-CH2CH2CH2CO2H-1-Triz) 2-F H H
2-530 Ac H CH2-(5-CH2CH2CH2CO2H-1-Triz) 2-F H H
2-531 H H CH2-(5-CH2CH2CH2CO2Me-1-Triz) 2-F H H
2-532 Ac H CH2-(5-CH2CH2CH2CO2Me-1-Triz) 2-F H H
2-533 H H CH2-(5-CH2CH2CH2CO2Et-1-Triz) 2-F H H
2-534 Ac H CH2-(5-CH2CH2CH2CO2Et-1-Triz) 2-F H H
2-535 H H CH2CH2-1-Triz 2-F H H
2-536 Ac H CH2CH2-1-Triz 2-F H H
2-537 H H СН2СН2-(4-СО2Н-1-Triz) 2-F H H
2-538 Ac H CH2CH2-(4-CO2H-1-Triz) 2-F H H
2-539 H H CH2CH2-(4-CO2Me-1-Triz) 2-F H H
2-540 Ac H CH2CH2-(4-CO2Me-1-Triz) 2-F H H
2-541 H H CH2CH2-(4-CO2Et-1-Triz) 2-F H H
2-542 Ac H CH2CH2-(4-CO2Et-1-Triz) 2-F H H
2-543 H H CH2CH2-(5-CO2H-1-Triz) 2-F H H
2-544 Ac H CH2CH2-(5-CO2H-1-Triz) 2-F H H
2-545 H H CH2CH2-(5-CO2Me-1-Triz) 2-F H H
2-546 Ac H CH2CH2-(5-CO2Me-1-Triz) 2-F H H
2-547 H H CH2CH2-(5-CO2Et-1-Triz) 2-F H H
2-548 Ac H CH2CH2-(5-CO2Et-1-Triz) 2-F H H
2-549 H H CH2CH2-(4-CH2CO2H-1-Triz) 2-F H H
2-550 Ac H СН2СН2-(4-CH2CO2H-1-Triz) 2-F H H
2-551 H H CH2CH2-(4-CH2CO2Me-1-Triz) 2-F H H
2-552 Ac H CH2CH2-(4-CH2CO2Me-1-Triz) 2-F H H
2-553 H H CH2CH2-(4-CH2CO2Et-1-Triz) 2-F H H
2-554 Ac H CH2CH2-(4-CH2CO2Et-1-Triz) 2-F H H
2-555 H H CH2CH2-(5-CH2CO2H-1-Triz) 2-F H H
2-556 Ac H CH2CH2-(5-CH2CO2H-1-Triz) 2-F H H
2-557 H H СН2СН2-(5-CH2CO2Me-1-Triz) 2-F H H
2-558 Ac H CH2CH2-(5-CH2CO2Me-1-Triz) 2-F H H
2-559 H H CH2CH2-(5-CH2CO2Et-1-Triz) 2-F H H
2-560 Ac H CH2CH2-(5-CH2CO2Et-1-Triz) 2-F H H
2-561 H H CH2CH2-(4-CH2CH2CO2H-1-Triz) 2-F H H
2-562 Ac H CH2CH2-(4-CH2CH2CO2H-1-Triz) 2-F H H
2-563 H H СН2СН2-(4-CH2CH2CO2Me-1-Triz) 2-F H H
2-564 Ac H СН2СН2-(4-CH2CH2CO2Me-1-Triz) 2-F H H
2-565 H H CH2CH2-(4-CH2CH2CO2Et-1-Triz) 2-F H H
2-566 Ac H CH2CH2-(4-CH2CH2CO2Et-1-Triz) 2-F H H
2-567 H H CH2CH2-(5-CH2CH2CO2H-1-Triz) 2-F H H
2-568 Ac H СН2СН2-(5-CH2CH2CO2H-1-Triz) 2-F H H
2-569 H H СН2СН2-(5-CH2CH2CO2Me-1-Triz) 2-F H H
2-570 Ac H СН2СН2-(5-CH2CH2CO2Me-1-Triz) 2-F H H
2-571 H H CH2CH2-(5-CH2CH2CO2Et-1-Triz) 2-F H H
2-572 Ac H CH2CH2-(5-CH2CH2CO2Et-1-Triz) 2-F H H
2-573 H H CH2CH2-(4-CH2CH2CH2CO2H-1-Triz) 2-F H H
2-574 Ac H CH2CH2-(4-CH2CH2CH2CO2H-1-Triz) 2-F H H
2-575 H H CH2CH2-(4-CH2CH2CH2CO2Me-1-Triz) 2-F H H
2-576 Ac H СН2СН2-(4-CH2CH2CH2CO2Me-1-Triz) 2-F H H
2-577 H H CH2CH2-(4-CH2CH2CH2CO2Et-1-Triz) 2-F H H
2-578 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-1-Triz) 2-F H H
2-579 H H CH2CH2-(5-CH2CH2CH2CO2H-1-Triz) 2-F H H
2-580 Ac H СН2СН2-(5-CH2CH2CH2CO2H-1-Triz) 2-F H H
2-581 H H CH2CH2-(5-CH2CH2CH2CO2Me-1-Triz) 2-F H H
2-582 Ac H СН2СН2-(5-CH2CH2CH2CO2Me-1-Triz) 2-F H H
2-583 H H СН2СН2-(5-CH2CH2CH2CO2Et-1-Triz) 2-F H H
2-584 Ac H CH2CH2-(5-CH2CH2CH2CO2Et-1-Triz) 2-F H H
2-585 H H CH2-2-Triz 2-F H H
2-586 Ac H CH2-2-Triz 2-F H H
2-587 H H CH2-(4-CO2H-2-Triz) 2-F H H
2-588 Ac H CH2-(4-CO2H-2-Triz) 2-F H H
2-589 H H CH2-(4-CO2Me-2-Triz) 2-F H H
2-590 Ac H CH2-(4-CO2Me-2-Triz) 2-F H H
2-591 H H CH2-(4-CO2Et-2-Triz) 2-F H H
2-592 Ac H CH2-(4-CO2Et-2-Triz) 2-F H H
2-593 H H CH2-(4-CH2CO2H-2-Triz) 2-F H H
2-594 Ac H CH2-(4-CH2CO2H-2-Triz) 2-F H H
2-595 H H CH2-(4-CH2CO2Me-2-Triz) 2-F H H
2-596 Ac H CH2-(4-CH2CO2Me-2-Triz) 2-F H H
2-597 H H CH2-(4-CH2CO2Et-2-Triz) 2-F H H
2-598 Ac H CH2-(4-CH2CO2Et-2-Triz) 2-F H H
2-599 H H CH2-(4-CH2CH2CO2H-2-Triz) 2-F H H
2-600 Ac H CH2-(4-CH2CH2CO2H-2-Triz) 2-F H H
2-601 H H CH2-(4-CH2CH2CO2Me-2-Triz) 2-F H H
2-602 Ac H CH2-(4-CH2CH2CO2Me-2-Triz) 2-F H H
2-603 H H CH2-(4-CH2CH2CO2Et-2-Triz) 2-F H H
2-604 Ac H CH2-(4-CH2CH2CO2Et-2-Triz) 2-F H H
2-605 H H CH2-(4-CH2CH2CH2CO2H-2-Triz) 2-F H H
2-606 Ac H CH2-(4-CH2CH2CH2CO2H-2-Triz) 2-F H H
2-607 H H CH2-(4-CH2CH2CH2CO2Me-2-Triz) 2-F H H
2-608 Ac H CH2-(4-CH2CH2CH2CO2Me-2-Triz) 2-F H H
2-609 H H CH2-(4-CH2CH2CH2CO2Et-2-Triz) 2-F H H
2-610 Ac H CH2-(4-CH2CH2CH2CO2Et-2-Triz) 2-F H H
2-611 H H CH2CH2-2-Triz 2-F H H
2-612 Ac H CH2CH2-2-Triz 2-F H H
2-613 H H CH2CH2-(4-CO2H-2-Triz) 2-F H H
2-614 Ac H CH2CH2-(4-CO2H-2-Triz) 2-F H H
2-615 H H CH2CH2-(4-CO2Me-2-Triz) 2-F H H
2-616 Ac H CH2CH2-(4-CO2Me-2-Triz) 2-F H H
2-617 H H CH2CH2-(4-CO2Et-2-Triz) 2-F H H
2-618 Ac H CH2CH2-(4-CO2Et-2-Triz) 2-F H H
2-619 H H CH2CH2-(4-CH2CO2H-2-Triz) 2-F H H
2-620 Ac H CH2CH2-(4-CH2CO2H-2-Triz) 2-F H H
2-621 H H CH2CH2-(4-CH2CO2Me-2-Triz) 2-F H H
2-622 Ac H CH2CH2-(4-CH2CO2Me-2-Triz) 2-F H H
2-623 H H CH2CH2-(4-CH2CO2Et-2-Triz) 2-F H H
2-624 Ac H CH2CH2-(4-CH2CO2Et-2-Triz) 2-F H H
2-625 H H CH2CH2-(4-CH2CH2CO2H-2-Triz) 2-F H H
2-626 Ac H CH2CH2-(4-CH2CH2CO2H-2-Triz) 2-F H H
2-627 H H CH2CH2-(4-CH2CH2CO2Me-2-Triz) 2-F H H
2-628 Ac H CH2CH2-(4-CH2CH2CO2Me-2-Triz) 2-F H H
2-629 H H CH2CH2-(4-CH2CH2CO2Et-2-Triz) 2-F H H
2-630 Ac H CH2CH2-(4-CH2CH2CO2Et-2-Triz) 2-F H H
2-631 H H CH2CH2-(4-CH2CH2CH2CO2H-2-Triz) 2-F H H
2-632 Ac H CH2CH2-(4-CH2CH2CH2CO2H-2-Triz) 2-F H H
2-633 H H CH2CH2-(4-CH2CH2CH2CO2Me-2-Triz) 2-F H H
2-634 Ac H CH2CH2-(4-CH2CH2CH2CO2Me-2-Triz) 2-F H H
2-635 H H CH2CH2-(4-CH2CH2CH2CO2Et-2-Triz) 2-F H H
2-636 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-2-Triz) 2-F H H
2-637 H H CH2-4-Triz 2-F H H
2-638 Ac H CH2-4-Triz 2-F H H
2-639 H H CH2-4-Triz 2-F 4-F H
2-640 Ac H CH2-4-Triz 2-F 4-F H
2-641 H H CH2-(1-CO2Me-4-Triz) 2-F H H
2-642 Ac H CH2-(1-CO2Me-4-Triz) 2-F H H
2-643 H H CH2-(1-CO2Et-4-Triz) 2-F H H
2-644 Ac H CH2-(1-CO2Et-4-Triz) 2-F H H
2-645 H H CH2-(5-CO2H-4-Triz) 2-F H H
2-646 Ac H CH2-(5-CO2H-4-Triz) 2-F H H
2-647 H H CH2-(5-CO2Me-4-Triz) 2-F H H
2-648 Ac H CH2-(5-CO2Me-4-Triz) 2-F H H
2-649 H H CH2-(5-CO2Et-4-Triz) 2-F H H
2-650 Ac H CH2-(5-CO2Et-4-Triz) 2-F H H
2-651 H H CH2-(1-CH2CO2H-4-Triz) 2-F H H
2-652 Ac H CH2-(1-CH2CO2H-4-Triz) 2-F H H
2-653 H H CH2-(1-CH2CO2Me-4-Triz) 2-F H H
2-654 Ac H CH2-(1-CH2CO2Me-4-Triz) 2-F H H
2-655 H H CH2-(1-CH2CO2Et-4-Triz) 2-F H H
2-656 Ac H CH2-(1-CH2CO2Et-4-Triz) 2-F H H
2-657 H H CH2-(5-CH2CO2H-4-Triz) 2-F H H
2-658 Ac H CH2-(5-CH2CO2H-4-Triz) 2-F H H
2-659 H H CH2-(5-CH2CO2Me-4-Triz) 2-F H H
2-660 Ac H CH2-(5-CH2CO2Me-4-Triz) 2-F H H
2-661 H H CH2-(5-CH2CO2Et-4-Triz) 2-F H H
2-662 Ac H CH2-(5-CH2CO2Et-4-Triz) 2-F H H
2-663 H H CH2-(1-CH2CH2CO2H-4-Triz) 2-F H H
2-664 Ac H CH2-(1-CH2CH2CO2H-4-Triz) 2-F H H
2-665 H H CH2-(1-CH2CH2CO2Me-4-Triz) 2-F H H
2-666 Ac H CH2-(1-CH2CH2CO2Me-4-Triz) 2-F H H
2-667 H H CH2-(1-CH2CH2CO2Et-4-Triz) 2-F H H
2-668 Ac H CH2-(1-CH2CH2CO2Et-4-Triz) 2-F H H
2-669 H H CH2-(5-CH2CH2CO2H-4-Triz) 2-F H H
2-670 Ac H CH2-(5-CH2CH2CO2H-4-Triz) 2-F H H
2-671 H H CH2-(5-CH2CH2CO2Me-4-Triz) 2-F H H
2-672 Ac H CH2-(5-CH2CH2CO2Me-4-Triz) 2-F H H
2-673 H H CH2-(5-CH2CH2CO2Et-4-Triz) 2-F H H
2-674 Ac H CH2-(5-CH2CH2CO2Et-4-Triz) 2-F H H
2-675 H H CH2-(1-CH2CH2CH2CO2H-4-Triz) 2-F H H
2-676 Ac H CH2-(1-CH2CH2CH2CO2H-4-Triz) 2-F H H
2-677 H H CH2-(1-CH2CH2CH2CO2Me-4-Triz) 2-F H H
2-678 Ac H CH2-(1-CH2CH2CH2CO2Me-4-Triz) 2-F H H
2-679 H H CH2-(1-CH2CH2CH2CO2Et-4-Triz) 2-F H H
2-680 Ac H CH2-(1-CH2CH2CH2CO2Et-4-Triz) 2-F H H
2-681 H H CH2-(5-CH2CH2CH2CO2H-4-Triz) 2-F H H
2-682 Ac H CH2-(5-CH2CH2CH2CO2H-4-Triz) 2-F H H
2-683 H H CH2-(5-CH2CH2CH2CO2Me-4-Triz) 2-F H H
2-684 Ac H CH2-(5-CH2CH2CH2CO2Me-4-Triz) 2-F H H
2-685 H H CH2-(5-CH2CH2CH2CO2Et-4-Triz) 2-F H H
2-686 Ac H CH2-(5-CH2CH2CH2CO2Et-4-Triz) 2-F H H
2-687 H H CH2CH2-4-Triz 2-F H H
2-688 Ac H CH2CH2-4-Triz 2-F H H
2-689 H H CH2CH2-4-Triz 2-F 4-F H
2-690 Ac H CH2CH2-4-Triz 2-F 4-F H
2-691 H H CH2CH2-(1-CO2Me-4-Triz) 2-F H H
2-692 Ac H CH2CH2-(1-CO2Me-4-Triz) 2-F H H
2-693 H H CH2CH2-(1-CO2Et-4-Triz) 2-F H H
2-694 Ac H CH2CH2-(1-CO2Et-4-Triz) 2-F H H
2-695 H H CH2CH2-(5-CO2H-4-Triz) 2-F H H
2-696 Ac H CH2CH2-(5-CO2H-4-Triz) 2-F H H
2-697 H H CH2CH2-(5-CO2Me-4-Triz) 2-F H H
2-698 Ac H CH2CH2-(5-CO2Me-4-Triz) 2-F H H
2-699 H H CH2CH2-(5-CO2Et-4-Triz) 2-F H H
2-700 Ac H CH2CH2-(5-CO2Et-4-Triz) 2-F H H
2-701 H H CH2CH2-(1-CH2CO2H-4-Triz) 2-F H H
2-702 Ac H CH2CH2-(1-CH2CO2H-4-Triz) 2-F H H
2-703 H H CH2CH2-(1-CH2CO2Me-4-Triz) 2-F H H
2-704 Ac H CH2CH2-(1-CH2CO2Me-4-Triz) 2-F H H
2-705 H H CH2CH2-(1-CH2CO2Et-4-Triz) 2-F H H
2-706 Ac H CH2CH2-(1-CH2CO2Et-4-Triz) 2-F H H
2-707 H H CH2CH2-(5-CH2CO2H-4-Triz) 2-F H H
2-708 Ac H CH2CH2-(5-CH2CO2H-4-Triz) 2-F H H
2-709 H H CH2CH2-(5-CH2CO2Me-4-Triz) 2-F H H
2-710 Ac H CH2CH2-(5-CH2CO2Me-4-Triz) 2-F H H
2-711 H H CH2CH2-(5-CH2CO2Et-4-Triz) 2-F H H
2-712 Ac H CH2CH2-(5-CH2CO2Et-4-Triz) 2-F H H
2-713 H H CH2CH2-(1-CH2CH2CO2H-4-Triz) 2-F H H
2-714 Ac H CH2CH2-(1-CH2CH2CO2H-4-Triz) 2-F H H
2-715 H H CH2CH2-(1-CH2CH2CO2Me-4-Triz) 2-F H H
2-716 Ac H CH2CH2-(1-CH2CH2CO2Me-4-Triz) 2-F H H
2-717 H H CH2CH2-(1-CH2CH2CO2Et-4-Triz) 2-F H H
2-718 Ac H CH2CH2-(1-CH2CH2CO2Et-4-Triz) 2-F H H
2-719 H H CH2CH2-(5-CH2CH2CO2H-4-Triz) 2-F H H
2-720 Ac H CH2CH2-(5-CH2CH2CO2H-4-Triz) 2-F H H
2-721 H H CH2CH2-(5-CH2CH2CO2Me-4-Triz) 2-F H H
2-722 Ac H CH2CH2-(5-CH2CH2CO2Me-4-Triz) 2-F H H
2-723 H H CH2CH2-(5-CH2CH2CO2Et-4-Triz) 2-F H H
2-724 Ac H CH2CH2-(5-CH2CH2CO2Et-4-Triz) 2-F H H
2-725 H H CH2CH2-(1-CH2CH2CH2CO2H-4-Triz) 2-F H H
2-726 Ac H CH2CH2-(1-CH2CH2CH2CO2H-4-Triz) 2-F H H
2-727 H H CH2CH2-(1-CH2CH2CH2CO2Me-4-Triz) 2-F H H
2-728 Ac H CH2CH2-(1-CH2CH2CH2CO2Me-4-Triz) 2-F H H
2-729 H H CH2CH2-(1-CH2CH2CH2CO2Et-4-Triz) 2-F H H
2-730 Ac H CH2CH2-(1-CH2CH2CH2CO2Et-4-Triz) 2-F H H
2-731 H H CH2CH2-(5-CH2CH2CH2CO2H-4-Triz) 2-F H H
2-732 Ac H CH2CH2-(5-CH2CH2CH2CO2H-4-Triz) 2-F H H
2-733 H H CH2CH2-(5-CH2CH2CH2CO2Me-4-Triz) 2-F H H
2-734 Ac H CH2CH2-(5-CH2CH2CH2CO2Me-4-Triz) 2-F H H
2-735 H H CH2CH2-(5-CH2CH2CH2CO2Et-4-Triz) 2-F H H
2-736 Ac H CH2CH2-(5-CH2CH2CH2CO2Et-4-Triz) 2-F H H
2-737 H H CH2-(1-CO2Me-5-Triz) 2-F 4-F H
2-738 Ac H CH2-(1-CO2Me-5-Triz) 2-F 4-F H
2-739 H H CH2-(1-CO2Me-5-Triz) 2-F H H
2-740 Ac H CH2-(1-CO2Me-5-Triz) 2-F H H
2-741 H H CH2-(1-CO2Et-5-Triz) 2-F H H
2-742 Ac H CH2-(1-CO2Et-5-Triz) 2-F H H
2-743 H H CH2-(1-CH2CO2H-5-Triz) 2-F H H
2-744 Ac H CH2-(1-CH2CO2H-5-Triz) 2-F H H
2-745 H H CH2-(1-CH2CO2Me-5-Triz) 2-F H H
2-746 Ac H CH2-(1-CH2CO2Me-5-Triz) 2-F H H
2-747 H H CH2-(1-CH2CO2Et-5-Triz) 2-F H H
2-748 Ac H CH2-(1-CH2CO2Et-5-Triz) 2-F H H
2-749 H H CH2-(1-CH2CH2CO2H-5-Triz) 2-F H H
2-750 Ac H CH2-(1-CH2CH2CO2H-5-Triz) 2-F H H
2-751 H H CH2-(1-CH2CH2CO2Me-5-Triz) 2-F H H
2-752 Ac H CH2-(1-CH2CH2CO2Me-5-Triz) 2-F H H
2-753 H H CH2-(1-CH2CH2CO2Et-5-Triz) 2-F H H
2-754 Ac H CH2-(1-CH2CH2CO2Et-5-Triz) 2-F H H
2-755 H H CH2-(1-CH2CH2CH2CO2H-5-Triz) 2-F H H
2-756 Ac H CH2-(1-CH2CH2CH2CO2H-5-Triz) 2-F H H
2-757 H H CH2-(1-CH2CH2CH2CO2Me-5-Triz) 2-F H H
2-758 Ac H CH2-(1-CH2CH2CH2CO2Me-5-Triz) 2-F H H
2-759 H H CH2-(1-CH2CH2CH2CO2Et-5-Triz) 2-F H H
2-760 Ac H CH2-(1-CH2CH2CH2CO2Et-5-Triz) 2-F H H
2-761 H H CH2-1-Tez 2-F H H
2-762 Ac H CH2-1-Tez 2-F H H
2-763 H H CH2-(5-CO2H-1-Tez) 2-F H H
2-764 Ac H CH2-(5-CO2H-1-Tez) 2-F H H
2-765 H H CH2-(5-CO2Me-1-Tez) 2-F H H
2-766 Ac H CH2-(5-CO2Me-1-Tez) 2-F H H
2-767 H H CH2-(5-CO2Et-1-Tez) 2-F H H
2-768 Ac H CH2-(5-CO2Et-1-Tez) 2-F H H
2-769 H H CH2-(5-CH2CO2H-1-Tez) 2-F H H
2-770 Ac H CH2-(5-CH2CO2H-1-Tez) 2-F H H
2-771 H H CH2-(5-CH2CO2Me-1-Tez) 2-F H H
2-772 Ac H CH2-(5-CH2CO2Me-1-Tez) 2-F H H
2-773 H H CH2-(5-CH2CO2Et-1-Tez) 2-F H H
2-774 Ac H CH2-(5-CH2CO2Et-1-Tez) 2-F H H
2-775 H H CH2-(5-CH2CH2CO2H-1-Tez) 2-F H H
2-776 Ac H CH2-(5-CH2CH2CO2H-1-Tez) 2-F H H
2-777 H H CH2-(5-CH2CH2CO2Me-1-Tez) 2-F H H
2-778 Ac H CH2-(5-CH2CH2CO2Me-1-Tez) 2-F H H
2-779 H H CH2-(5-CH2CH2CO2Et-1-Tez) 2-F H H
2-780 Ac H CH2-(5-CH2CH2CO2Et-1-Tez) 2-F H H
2-781 H H CH2-(5-CH2CH2CH2CO2H-1-Tez) 2-F H H
2-782 Ac H CH2-(5-CH2CH2CH2CO2H-1-Tez) 2-F H H
2-783 H H CH2-(5-CH2CH2CH2CO2Me-1-Tez) 2-F H H
2-784 Ac H CH2-(5-CH2CH2CH2CO2Me-1-Tez) 2-F H H
2-785 H H CH2-(5-CH2CH2CH2CO2Et-1-Tez) 2-F H H
2-786 Ac H CH2-(5-CH2CH2CH2CO2Et-1-Tez) 2-F H H
2-787 H H CH2CH2-1-Tez 2-F H H
2-788 Ac H CH2CH2-1-Tez 2-F H H
2-789 H H CH2CH2-(5-CO2H-1-Tez) 2-F H H
2-790 Ac H CH2CH2-(5-CO2H-1-Tez) 2-F H H
2-791 H H CH2CH2-(5-CO2Me-1-Tez) 2-F H H
2-792 Ac H CH2CH2-(5-CO2Me-1-Tez) 2-F H H
2-793 H H CH2CH2-(5-CO2Et-1-Tez) 2-F H H
2-794 Ac H CH2CH2-(5-CO2Et-1-Tez) 2-F H H
2-795 H H CH2CH2-(5-CH2CO2H-1-Tez) 2-F H H
2-796 Ac H CH2CH2-(5-CH2CO2H-1-Tez) 2-F H H
2-797 H H CH2CH2-(5-CH2CO2Me-1-Tez) 2-F H H
2-798 Ac H CH2CH2-(5-CH2CO2Me-1-Tez) 2-F H H
2-799 H H CH2CH2-(5-CH2CO2Et-1-Tez) 2-F H H
2-800 Ac H CH2CH2-(5-CH2CO2Et-1-Tez) 2-F H H
2-801 H H CH2CH2-(5-CH2CH2CO2H-1-Tez) 2-F H H
2-802 Ac H CH2CH2-(5-CH2CH2CO2H-1-Tez) 2-F H H
2-803 H H CH2CH2-(5-CH2CH2CO2Me-1-Tez) 2-F H H
2-804 Ac H CH2CH2-(5-CH2CH2CO2Me-1-Tez) 2-F H H
2-805 H H CH2CH2-(5-CH2CH2CO2Et-1-Tez) 2-F H H
2-806 Ac H CH2CH2-(5-CH2CH2CO2Et-1-Tez) 2-F H H
2-807 H H CH2CH2-(5-CH2CH2CH2CO2H-1-Tez) 2-F H H
2-808 Ac H CH2CH2-(5-CH2CH2CH2CO2H-1-Tez) 2-F H H
2-809 H H CH2CH2-(5-CH2CH2CH2CO2Me-1-Tez) 2-F H H
2-810 Ac H CH2CH2-(5-CH2CH2CH2CO2Me-1-Tez) 2-F H H
2-811 H H CH2CH2-(5-CH2CH2CH2CO2Et-1-Tez) 2-F H H
2-812 Ac H CH2CH2-(5-CH2CH2CH2CO2Et-1-Tez) 2-F H H
2-813 H H CH2-2-Tez 2-F H H
2-814 Ac H CH2-2-Tez 2-F H H
2-815 H H CH2-(5-CO2H-2-Tez) 2-F H H
2-816 Ac H CH2-(5-CO2H-2-Tez) 2-F H H
2-817 H H CH2-(5-CO2Me-2-Tez) 2-F H H
2-818 Ac H CH2-(5-CO2Me-2-Tez) 2-F H H
2-819 H H CH2-(5-CO2Et-2-Tez) 2-F H H
2-820 Ac H CH2-(5-CO2Et-2-Tez) 2-F H H
2-821 H H CH2-(5-CH2CO2H-2-Tez) 2-F H H
2-822 Ac H CH2-(5-CH2CO2H-2-Tez) 2-F H H
2-823 H H CH2-(5-CH2CO2Me-2-Tez) 2-F H H
2-824 Ac H CH2-(5-CH2CO2Me-2-Tez) 2-F H H
2-825 H H CH2-(5-CH2CO2Et-2-Tez) 2-F H H
2-826 Ac H CH2-(5-CH2CO2Et-2-Tez) 2-F H H
2-827 H H CH2-(5-CH2CH2CO2H-2-Tez) 2-F H H
2-828 Ac H CH2-(5-CH2CH2CO2H-2-Tez) 2-F H H
2-829 H H CH2-(5-CH2CH2CO2Me-2-Tez) 2-F H H
2-830 Ac H CH2-(5-CH2CH2CO2Me-2-Tez) 2-F H H
2-831 H H CH2-(5-CH2CH2CO2Et-2-Tez) 2-F H H
2-832 Ac H CH2-(5-CH2CH2CO2Et-2-Tez) 2-F H H
2-833 H H CH2-(5-CH2CH2CH2CO2H-2-Tez) 2-F H H
2-834 Ac H CH2-(5-CH2CH2CH2CO2H-2-Tez) 2-F H H
2-835 H H CH2-(5-CH2CH2CH2CO2Me-2-Tez) 2-F H H
2-836 Ac H CH2-(5-CH2CH2CH2CO2Me-2-Tez) 2-F H H
2-837 H H CH2-(5-CH2CH2CH2CO2Et-2-Tez) 2-F H H
2-838 Ac H CH2-(5-CH2CH2CH2CO2Et-2-Tez) 2-F H H
2-839 H H CH2CH2-2-Tez 2-F H H
2-840 Ac H CH2CH2-2-Tez 2-F H H
2-841 H H CH2CH2-(5-CO2H-2-Tez) 2-F H H
2-842 Ac H CH2CH2-(5-CO2H-2-Tez) 2-F H H
2-843 H H CH2CH2-(5-CO2Me-2-Tez) 2-F H H
2-844 Ac H CH2CH2-(5-CO2Me-2-Tez) 2-F H H
2-845 H H CH2CH2-(5-CO2Et-2-Tez) 2-F H H
2-846 Ac H CH2CH2-(5-CO2Et-2-Tez) 2-F H H
2-847 H H CH2CH2-(5-CH2CO2H-2-Tez) 2-F H H
2-848 Ac H CH2CH2-(5-CH2CO2H-2-Tez) 2-F H H
2-849 H H CH2CH2-(5-CH2CO2Me-2-Tez) 2-F H H
2-850 Ac H CH2CH2-(5-CH2CO2Me-2-Tez) 2-F H H
2-851 H H CH2CH2-(5-CH2CO2Et-2-Tez) 2-F H H
2-852 Ac H CH2CH2-(5-CH2CO2Et-2-Tez) 2-F H H
2-853 H H CH2CH2-(5-CH2CH2CO2H-2-Tez) 2-F H H
2-854 Ac H CH2CH2-(5-CH2CH2CO2H-2-Tez) 2-F H H
2-855 H H CH2CH2-(5-CH2CH2CO2Me-2-Tez) 2-F H H
2-856 Ac H CH2CH2-(5-CH2CH2CO2Me-2-Tez) 2-F H H
2-857 H H CH2CH2-(5-CH2CH2CO2Et-2-Tez) 2-F H H
2-858 Ac H CH2CH2-(5-CH2CH2CO2Et-2-Tez) 2-F H H
2-859 H H CH2CH2-(5-CH2CH2CH2CO2H-2-Tez) 2-F H H
2-860 Ac H CH2CH2-(5-CH2CH2CH2CO2H-2-Tez) 2-F H H
2-861 H H CH2CH2-(5-CH2CH2CH2CO2Me-2-Tez) 2-F H H
2-862 Ac H CH2CH2-(5-CH2CH2CH2CO2Me-2-Tez) 2-F H H
2-863 H H CH2CH2-(5-CH2CH2CH2CO2Et-2-Tez) 2-F H H
2-864 Ac H CH2CH2-(5-CH2CH2CH2CO2Et-2-Tez) 2-F H H
2-865 H H CH2-5-Tez 2-F H H
2-866 Ac H CH2-5-Tez 2-F H H
2-867 H H CH2-5-Tez 2-F 4-F H
2-868 Ac H CH2-5-Tez 2-F 4-F H
2-869 H H CH2-(1-CO2Me-5-Tez) 2-F H H
2-870 Ac H CH2-(1-CO2Me-5-Tez) 2-F H H
2-871 H H CH2-(1-CO2Et-5-Tez) 2-F H H
2-872 Ac H CH2-(1-CO2Et-5-Tez) 2-F H H
2-873 H H CH2-(2-CO2Me-5-Tez) 2-F 4-F H
2-874 Ac H CH2-(2-CO2Me-5-Tez) 2-F 4-F H
2-875 H H CH2-(2-CO2Me-5-Tez) 2-F H H
2-876 Ac H CH2-(2-CO2Me-5-Tez) 2-F H H
2-877 H H CH2-(2-CO2Et-5-Tez) 2-F H H
2-878 Ac H CH2-(2-CO2Et-5-Tez) 2-F H H
2-879 H H CH2-(1-CH2CO2H-5-Tez) 2-F H H
2-880 Ac H CH2-(1-CH2CO2H-5-Tez) 2-F H H
2-881 H H CH2-(1-CH2CO2Me-5-Tez) 2-F H H
2-882 Ac H CH2-(1-CH2CO2Me-5-Tez) 2-F H H
2-883 H H CH2-(1-CH2CO2Et-5-Tez) 2-F H H
2-884 Ac H CH2-(1-CH2CO2Et-5-Tez) 2-F H H
2-885 H H CH2-(2-CH2CO2H-5-Tez) 2-F H H
2-886 Ac H CH2-(2-CH2CO2H-5-Tez) 2-F H H
2-887 H H CH2-(2-CH2CO2Me-5-Tez) 2-F H H
2-888 Ac H CH2-(2-CH2CO2Me-5-Tez) 2-F H H
2-889 H H CH2-(2-CH2CO2Et-5-Tez) 2-F H H
2-890 Ac H CH2-(2-CH2CO2Et-5-Tez) 2-F H H
2-891 H H CH2-(1-CH2CH2CO2H-5-Tez) 2-F H H
2-892 Ac H CH2-(1-CH2CH2CO2H-5-Tez) 2-F H H
2-893 H H CH2-(1-CH2CH2CO2Me-5-Tez) 2-F H H
2-894 Ac H CH2-(1-CH2CH2CO2Me-5-Tez) 2-F H H
2-895 H H CH2-(1-CH2CH2CO2Et-5-Tez) 2-F H H
2-896 Ac H CH2-(1-CH2CH2CO2Et-5-Tez) 2-F H H
2-897 H H CH2-(2-CH2CH2CO2H-5-Tez) 2-F H H
2-898 Ac H CH2-(2-CH2CH2CO2H-5-Tez) 2-F H H
2-899 H H CH2-(2-CH2CH2CO2Me-5-Tez) 2-F H H
2-900 Ac H CH2-(2-CH2CH2CO2Me-5-Tez) 2-F H H
2-901 H H CH2-(2-CH2CH2CO2Et-5-Tez) 2-F H H
2-902 Ac H CH2-(2-CH2CH2CO2Et-5-Tez) 2-F H H
2-903 H H CH2-(1-CH2CH2CH2CO2H-5-Tez) 2-F H H
2-904 Ac H CH2-(1-CH2CH2CH2CO2H-5-Tez) 2-F H H
2-905 H H CH2-(1-CH2CH2CH2CO2Me-5-Tez) 2-F H H
2-906 Ac H CH2-(1-CH2CH2CH2CO2Me-5-Tez) 2-F H H
2-907 H H CH2-(1-CH2CH2CH2CO2Et-5-Tez) 2-F H H
2-908 Ac H CH2-(1-CH2CH2CH2CO2Et-5-Tez) 2-F H H
2-909 H H CH2-(2-CH2CH2CH2CO2H-5-Tez) 2-F H H
2-910 Ac H CH2-(2-CH2CH2CH2CO2H-5-Tez) 2-F H H
2-911 H H CH2-(2-CH2CH2CH2CO2Me-5-Tez) 2-F H H
2-912 Ac H CH2-(2-CH2CH2CH2CO2Me-5-Tez) 2-F H H
2-913 H H CH2-(2-CH2CH2CH2CO2Et-5-Tez) 2-F H H
2-914 Ac H CH2-(2-CH2CH2CH2CO2Et-5-Tez) 2-F H H
2-915 H H CH2CH2-5-Tez 2-F H H
2-916 Ac H CH2CH2-5-Tez 2-F H H
2-917 H H CH2CH2-5-Tez 2-F 4-F H
2-918 Ac H CH2CH2-5-Tez 2-F 4-F H
2-919 H H CH2CH2-(1-CO2Me-5-Tez) 2-F H H
2-920 Ac H CH2CH2-(1-CO2Me-5-Tez) 2-F H H
2-921 H H CH2CH2-(1-CO2Et-5-Tez) 2-F H H
2-922 Ac H CH2CH2-(1-CO2Et-5-Tez) 2-F H H
2-923 H H CH2CH2-(2-CO2Me-5-Tez) 2-F H H
2-924 Ac H CH2CH2-(2-CO2Me-5-Tez) 2-F H H
2-925 H H CH2CH2-(2-CO2Me-5-Tez) 2-F H H
2-926 Ac H CH2CH2-(2-CO2Me-5-Tez) 2-F H H
2-927 H H CH2CH2-(2-CO2Et-5-Tez) 2-F H H
2-928 Ac H CH2CH2-(2-CO2Et-5-Tez) 2-F H H
2-929 H H CH2CH2-(1-CH2CO2H-5-Tez) 2-F H H
2-930 Ac H CH2CH2-(1-CH2CO2H-5-Tez) 2-F H H
2-931 H H CH2CH2-(1-CH2CO2Me-5-Tez) 2-F H H
2-932 Ac H CH2CH2-(1-CH2CO2Me-5-Tez) 2-F H H
2-933 H H CH2CH2-(1-CH2CO2Et-5-Tez) 2-F H H
2-934 Ac H CH2CH2-(1-CH2CO2Et-5-Tez) 2-F H H
2-935 H H CH2CH2-(2-CH2CO2H-5-Tez) 2-F H H
2-936 Ac H CH2CH2-(2-CH2CO2H-5-Tez) 2-F H H
2-937 H H CH2CH2-(2-CH2CO2Me-5-Tez) 2-F H H
2-938 Ac H CH2CH2-(2-CH2CO2Me-5-Tez) 2-F H H
2-939 H H CH2CH2-(2-CH2CO2Et-5-Tez) 2-F H H
2-940 Ac H CH2CH2-(2-CH2CO2Et-5-Tez) 2-F H H
2-941 H H CH2CH2-(1-CH2CH2CO2H-5-Tez) 2-F H H
2-942 Ac H CH2CH2-(1-CH2CH2CO2H-5-Tez) 2-F H H
2-943 H H CH2CH2-(1-CH2CH2CO2Me-5-Tez) 2-F H H
2-944 Ac H CH2CH2-(1-CH2CH2CO2Me-5-Tez) 2-F H H
2-945 H H CH2CH2-(1-CH2CH2CO2Et-5-Tez) 2-F H H
2-946 Ac H CH2CH2-(1-CH2CH2CO2Et-5-Tez) 2-F H H
2-947 H H CH2CH2-(2-CH2CH2CO2H-5-Tez) 2-F H H
2-948 Ac H CH2CH2-(2-CH2CH2CO2H-5-Tez) 2-F H H
2-949 H H CH2CH2-(2-CH2CH2CO2Me-5-Tez) 2-F H H
2-950 Ac H CH2CH2-(2-CH2CH2CO2Me-5-Tez) 2-F H H
2-951 H H CH2CH2-(2-CH2CH2CO2Et-5-Tez) 2-F H H
2-952 Ac H CH2CH2-(2-CH2CH2CO2Et-5-Tez) 2-F H H
2-953 H H CH2CH2-(1-CH2CH2CH2CO2H-5-Tez) 2-F H H
2-954 Ac H CH2CH2-(1-CH2CH2CH2CO2H-5-Tez) 2-F H H
2-955 H H CH2CH2-(1-CH2CH2CH2CO2Me-5-Tez) 2-F H H
2-956 Ac H CH2CH2-(1-CH2CH2CH2CO2Me-5-Tez) 2-F H H
2-957 H H CH2CH2-(1-CH2CH2CH2CO2Et-5-Tez) 2-F H H
2-958 Ac H CH2CH2-(1-CH2CH2CH2CO2Et-5-Tez) 2-F H H
2-959 H H CH2CH2-(2-CH2CH2CH2CO2H-5-Tez) 2-F H H
2-960 Ac H CH2CH2-(2-CH2CH2CH2CO2H-5-Tez) 2-F H H
2-961 H H CH2CH2-(2-CH2CH2CH2CO2Me-5-Tez) 2-F H H
2-962 Ac H CH2CH2-(2-CH2CH2CH2CO2Me-5-Tez) 2-F H H
2-963 H H CH2CH2-(2-CH2CH2CH2CO2Et-5-Tez) 2-F H H
2-964 Ac H CH2CH2-(2-CH2CH2CH2CO2Et-5-Tez) 2-F H H
2-965 H Me CH2-1-Pyza 2-F H H
2-966 Ac Me CH2-1-Pyza 2-F H H
2-967 H Me CH2-(3-CO2H-1-Pyza) 2-F H H
2-968 Ac Me CH2-(3-CO2H-1-Pyza) 2-F H H
2-969 H Me CH2-(3-CO2Me-1-Pyza) 2-F H H
2-970 Ac Me CH2-(3-CO2Me-1-Pyza) 2-F H H
2-971 H Me CH2-(3-CO2Et-1-Pyza) 2-F H H
2-972 Ac Me CH2-(3-CO2Et-1-Pyza) 2-F H H
2-973 H Me CH2-(4-CO2H-1-Pyza) 2-F H H
2-974 Ac Me CH2-(4-CO2H-1-Pyza) 2-F H H
2-975 H Me CH2-(4-CO2Me-1-Pyza) 2-F H H
2-976 Ac Me CH2-(4-CO2Me-1-Pyza) 2-F H H
2-977 H Me CH2-(4-CO2Et-1-Pyza) 2-F H H
2-978 Ac Me CH2-(4-CO2Et-1-Pyza) 2-F H H
2-979 H Me CH2-(3-CH2CO2H-1-Pyza) 2-F H H
2-980 Ac Me CH2-(3-CH2CO2H-1-Pyza) 2-F H H
2-981 H Me CH2-(3-CH2CO2Me-1-Pyza) 2-F H H
2-982 Ac Me CH2-(3-CH2CO2Me-1-Pyza) 2-F H H
2-983 H Me CH2-(3-CH2CO2Et-1-Pyza) 2-F H H
2-984 Ac Me CH2-(3-CH2CO2Et-1-Pyza) 2-F H H
2-985 H Me CH2-(4-CH2CO2H-1-Pyza) 2-F H H
2-986 Ac Me CH2-(4-CH2CO2H-1-Pyza) 2-F H H
2-987 H Me CH2-(4-CH2CO2Me-1-Pyza) 2-F H H
2-988 Ac Me CH2-(4-CH2CO2Me-1-Pyza) 2-F H H
2-989 H Me CH2-(4-CH2CO2Et-1-Pyza) 2-F H H
2-990 Ac Me CH2-(4-CH2CO2Et-1-Pyza) 2-F H H
2-991 H Me CH2-(3-CH2CH2CO2H-1-Pyza) 2-F H H
2-992 Ac Me CH2-(3-CH2CH2CO2H-1-Pyza) 2-F H H
2-993 H Me CH2-(3-CH2CH2CO2Me-1-Pyza) 2-F H H
2-994 Ac Me CH2-(3-CH2CH2CO2Me-1-Pyza) 2-F H H
2-995 H Me CH2-(3-CH2CH2CO2Et-1-Pyza) 2-F H H
2-996 Ac Me CH2-(3-CH2CH2CO2Et-1-Pyza) 2-F H H
2-997 H Me CH2-(4-CH2CH2CO2H-1-Pyza) 2-F H H
2-998 Ac Me CH2-(4-CH2CH2CO2H-1-Pyza) 2-F H H
2-999 H Me CH2-(4-CH2CH2CO2Me-1-Pyza) 2-F H H
2-1000 Ac Me CH2-(4-CH2CH2CO2Me-1-Pyza) 2-F H H
2-1001 H Me CH2-(4-CH2CH2CO2Et-1-Pyza) 2-F H H
2-1002 Ac Me CH2-(4-CH2CH2CO2Et-1-Pyza) 2-F H H
2-1003 H Me CH2CH2-1-Pyza 2-F H H
2-1004 Ac Me CH2CH2-1-Pyza 2-F H H
2-1005 H Me CH2CH2-(3-CO2H-1-Pyza) 2-F H H
2-1006 Ac Me CH2CH2-(3-CO2H-1-Pyza) 2-F H H
2-1007 H Me CH2CH2-(3-CO2Me-1-Pyza) 2-F H H
2-1008 Ac Me CH2CH2-(3-CO2Me-1-Pyza) 2-F H H
2-1009 H Me CH2CH2-(3-CO2Et-1-Pyza) 2-F H H
2-1010 Ac Me CH2CH2-(3-CO2Et-1-Pyza) 2-F H H
2-1011 H Me CH2CH2-(4-CO2H-1-Pyza) 2-F H H
2-1012 Ac Me CH2CH2-(4-CO2H-1-Pyza) 2-F H H
2-1013 H Me CH2CH2-(4-CO2Me-1-Pyza) 2-F H H
2-1014 Ac Me CH2CH2-(4-CO2Me-1-Pyza) 2-F H H
2-1015 H Me CH2CH2-(4-CO2Et-1-Pyza) 2-F H H
2-1016 Ac Me CH2CH2-(4-CO2Et-1-Pyza) 2-F H H
2-1017 H Me CH2CH2-(3-CH2CO2H-1-Pyza) 2-F H H
2-1018 Ac Me CH2CH2-(3-CH2CO2H-1-Pyza) 2-F H H
2-1019 H Me CH2CH2-(3-CH2CO2Me-1-Pyza) 2-F H H
2-1020 Ac Me CH2CH2-(3-CH2CO2Me-1-Pyza) 2-F H H
2-1021 H Me CH2CH2-(3-CH2CO2Et-1-Pyza) 2-F H H
2-1022 Ac Me CH2CH2-(3-CH2CO2Et-1-Pyza) 2-F H H
2-1023 H Me CH2CH2-(4-CH2CO2H-1-Pyza) 2-F H H
2-1024 Ac Me CH2CH2-(4-CH2CO2H-1-Pyza) 2-F H H
2-1025 H Me CH2CH2-(4-CH2CO2Me-1-Pyza) 2-F H H
2-1026 Ac Me CH2CH2-(4-CH2CO2Me-1-Pyza) 2-F H H
2-1027 H Me CH2CH2-(4-CH2CO2Et-1-Pyza) 2-F H H
2-1028 Ac Me CH2CH2-(4-CH2CO2Et-1-Pyza) 2-F H H
2-1029 H Me CH2CH2-(3-CH2CH2CO2H-1-Pyza) 2-F H H
2-1030 Ac Me CH2CH2-(3-CH2CH2CO2H-1-Pyza) 2-F H H
2-1031 H Me CH2CH2-(3-CH2CH2CO2Me-1-Pyza) 2-F H H
2-1032 Ac Me CH2CH2-(3-CH2CH2CO2Me-1-Pyza) 2-F H H
2-1033 H Me CH2CH2-(3-CH2CH2CO2Et-1-Pyza) 2-F H H
2-1034 Ac Me CH2CH2-(3-CH2CH2CO2Et-1-Pyza) 2-F H H
2-1035 H Me CH2CH2-(4-CH2CH2CO2H-1-Pyza) 2-F H H
2-1036 Ac Me CH2CH2-(4-CH2CH2CO2H-1-Pyza) 2-F H H
2-1037 H Me CH2CH2-(4-CH2CH2CO2Me-1-Pyza) 2-F H H
2-1038 Ac Me CH2CH2-(4-CH2CH2CO2Me-1-Pyza) 2-F H H
2-1039 H Me CH2CH2-(4-CH2CH2CO2Et-1-Pyza) 2-F H H
2-1040 Ac Me CH2CH2-(4-CH2CH2CO2Et-1-Pyza) 2-F H H
2-1041 H H CH2-(2-CO2Me-4-Triz) 2-F H H
2-1042 Ac H CH2-(2-CO2Me-4-Triz) 2-F H H
2-1043 H H CH2-(2-CO2Et-4-Triz) 2-F H H
2-1044 Ac H CH2-(2-CO2Et-4-Triz) 2-F H H
2-1045 H H CH2-(2-CH2CO2H-4-Triz) 2-F H H
2-1046 Ac H CH2-(2-CH2CO2H-4-Triz) 2-F H H
2-1047 H H CH2-(2-CH2CO2Me-4-Triz) 2-F H H
2-1048 Ac H CH2-(2-CH2CO2Me-4-Triz) 2-F H H
2-1049 H H CH2-(2-CH2CO2Et-4-Triz) 2-F H H
2-1050 Ac H CH2-(2-CH2CO2Et-4-Triz) 2-F H H
2-1051 H H CH2-(2-CH2CH2CO2H-4-Triz) 2-F H H
2-1052 Ac H CH2-(2-CH2CH2CO2H-4-Triz) 2-F H H
2-1053 H H CH2-(2-CH2CH2CO2Me-4-Triz) 2-F H H
2-1054 Ac H CH2-(2-CH2CH2CO2Me-4-Triz) 2-F H H
2-1055 H H CH2-(2-CH2CH2CO2Et-4-Triz) 2-F H H
2-1056 Ac H CH2-(2-CH2CH2CO2Et-4-Triz) 2-F H H
2-1057 H H CH2-(2-CH2CH2CH2CO2H-4-Triz) 2-F H H
2-1058 Ac H CH2-(2-CH2CH2CH2CO2H-4-Triz) 2-F H H
2-1059 H H CH2-(2-CH2CH2CH2CO2Me-4-Triz) 2-F H H
2-1060 Ac H CH2-(2-CH2CH2CH2CO2Me-4-Triz) 2-F H H
2-1061 H H CH2-(2-CH2CH2CH2CO2Et-4-Triz) 2-F H H
2-1062 Ac H CH2-(2-CH2CH2CH2CO2Et-4-Triz) 2-F H H
2-1063 H H CH2CH2-(2-CO2Me-4-Triz) 2-F H H
2-1064 Ac H CH2CH2-(2-CO2Me-4-Triz) 2-F H H
2-1065 H H CH2CH2-(2-CO2Et-4-Triz) 2-F H H
2-1066 Ac H CH2CH2-(2-CO2Et-4-Triz) 2-F H H
2-1067 H H CH2CH2-(2-CH2CO2H-4-Triz) 2-F H H
2-1068 Ac H CH2CH2-(2-CH2CO2H-4-Triz) 2-F H H
2-1069 H H CH2CH2-(2-CH2CO2Me-4-Triz) 2-F H H
2-1070 Ac H CH2CH2-(2-CH2CO2Me-4-Triz) 2-F H H
2-1071 H H CH2CH2-(2-CH2CO2Et-4-Triz) 2-F H H
2-1072 Ac H CH2CH2-(2-CH2CO2Et-4-Triz) 2-F H H
2-1073 H H CH2CH2-(2-CH2CH2CO2H-4-Triz) 2-F H H
2-1074 Ac H CH2CH2-(2-CH2CH2CO2H-4-Triz) 2-F H H
2-1075 H H CH2CH2-(2-CH2CH2CO2Me-4-Triz) 2-F H H
2-1076 Ac H CH2CH2-(2-CH2CH2CO2Me-4-Triz) 2-F H H
2-1077 H H CH2CH2-(2-CH2CH2CO2Et-4-Triz) 2-F H H
2-1078 Ac H CH2CH2-(2-CH2CH2CO2Et-4-Triz) 2-F H H
2-1079 H H CH2CH2-(2-CH2CH2CH2CO2H-4-Triz) 2-F H H
2-1080 Ac H CH2CH2-(2-CH2CH2CH2CO2H-4-Triz) 2-F H H
2-1081 H H CH2CH2-(2-CH2CH2CH2CO2Me-4-Triz) 2-F H H
2-1082 Ac H CH2CH2-(2-CH2CH2CH2CO2Me-4-Triz) 2-F H H
2-1083 H H CH2CH2-(2-CH2CH2CH2CO2Et-4-Triz) 2-F H H
2-1084 Ac H CH2CH2-(2-CH2CH2CH2CO2Et-4-Triz) 2-F H H
(Таблица 3)
Соединение № P1 R2 R3 X1 X2 X3
3-1 H H CH2OH 2-F H H
3-2 Ac H CH2OH 2-F H H
3-3 H H CH2CH2OH 2-F H H
3-4 Ac H CH2CH2OH 2-F H H
3-5 H H CH2OMe 2-F H H
3-6 Ac H CH2OMe 2-F H H
3-7 H H CH2CH2OMe 2-F H H
3-8 Ac H CH2CH2OMe 2-F H H
3-9 H H CH2OEt 2-F H H
3-10 Ac H CH2OEt 2-F H H
3-11 H H CH2CH2OEt 2-F H H
3-12 Ac H CH2CH2OEt 2-F H H
3-13 H H CH2CO2H 2-F H H
3-14 Ac H CH2CO2H 2-F H H
3-15 H H CH2CO2Me 2-F H H
3-16 Ac H CH2CO2Me 2-F H H
3-17 H H CH2CO2Et 2-F H H
3-18 Ac H CH2CO2Et 2-F H H
3-19 H H 4-Pip 2-F H H
3-20 Ac H 4-Pip 2-F H H
3-21 H H 4-Pip 2-F 4-F H
3-22 Ac H 4-Pip 2-F 4-F H
3-23 H H 1-CO2Me-4-Pip 2-F H H
3-24 Ac H 1-CO2Me-4-Pip 2-F H H
3-25 H H 1-CO2Et-4-Pip 2-F H H
3-26 Ac H 1-CO2Et-4-Pip 2-F H H
3-27 H H 1-CH2CO2H-4-Pip 2-F H H
3-28 Ac H 1-CH2CO2H-4-Pip 2-F H H
3-29 H H 1-CH2CO2Me-4-Pip 2-F H H
3-30 Ac H 1-CH2CO2Me-4-Pip 2-F H H
3-31 H H 1-CH2CO2Et-4-Pip 2-F H H
3-32 Ac H 1-CH2CO2Et-4-Pip 2-F H H
3-33 H H 1-CH2CH2CO2H-4-Pip 2-F H H
3-34 Ac H 1-CH2CH2CO2H-4-Pip 2-F H H
3-35 H H 1-CH2CH2CO2Me-4-Pip 2-F H H
3-36 Ac H 1-CH2CH2CO2Me-4-Pip 2-F H H
3-37 H H 1-CH2CH2CO2Et-4-Pip 2-F H H
3-38 Ac H 1-CH2CH2CO2Et-4-Pip 2-F H H
3-39 Ac H 1-CH2CH2CO2Et-4-Pip 2-F 4-F H
3-40 H H 1-CH2CH2CH2CO2H-4-Pip 2-F H H
3-41 Ac H 1-CH2CH2CH2CO2H-4-Pip 2-F H H
3-42 H H 1-CH2CH2CH2CO2Me-4-Pip 2-F H H
3-43 Ac H 1-CH2CH2CH2CO2Me-4-Pip 2-F H H
3-44 H H 1-CH2CH2CH2CO2Et-4-Pip 2-F H H
3-45 Ac H 1-CH2CH2CH2CO2Et-4-Pip 2-F H H
3-46 H H CH2CN 2-F H H
3-47 Ac H CH2CN 2-F H H
3-48 H H CH2CH2CN 2-F H H
3-49 Ac H CH2CH2CN 2-F H H
3-50 H H CH2N(Me)CH2CO2H 2-F H H
3-51 Ac H CH2N(Me)CH2CO2H 2-F H H
3-52 H H CH2N(Me)CH2CO2Me 2-F H H
3-53 Ac H CH2N(Me)CH2CO2Me 2-F H H
3-54 H H CH2N(Me)CH2CO2Et 2-F H H
3-55 Ac H CH2N(Me)CH2CO2Et 2-F H H
3-56 H H CH2N(Me)CH2CH2CO2H 2-F H H
3-57 Ac H CH2N(Me)CH2CH2CO2H 2-F H H
3-58 H H CH2N(Me)CH2CH2CO2Me 2-F H H
3-59 Ac H CH2N(Me)CH2CH2CO2Me 2-F H H
3-60 H H CH2N(Me)CH2CH2CO2Et 2-F H H
3-61 Ac H CH2N(Me)CH2CH2CO2Et 2-F H H
3-62 H H CH2N(Me)CH2CH2CH2CO2H 2-F H H
3-63 Ac H CH2N(Me)CH2CH2CH2CO2H 2-F H H
3-64 H H CH2N(Me)CH2CH2CH2CO2Me 2-F H H
3-65 Ac H CH2N(Me)CH2CH2CH2CO2Me 2-F H H
3-66 H H CH2N(Me)CH2CH2CH2CO2Et 2-F H H
3-67 Ac H CH2N(Me)CH2CH2CH2CO2Et 2-F H H
3-68 H H CH2N(Et)CH2CO2H 2-F H H
3-69 Ac H CH2N(Et)CH2CO2H 2-F H H
3-70 H H CH2N(Et)CH2CO2Me 2-F H H
3-71 Ac H CH2N(Et)CH2CO2Me 2-F H H
3-72 H H CH2N(Et)CH2CO2Et 2-F H H
3-73 Ac H CH2N(Et)CH2CO2Et 2-F H H
3-74 H H CH2N(iPr)CH2CO2H 2-F H H
3-75 Ac H CH2N(iPr)CH2CO2H 2-F H H
3-76 H H CH2N(iPr)CH2CO2Me 2-F H H
3-77 Ac H CH2N(iPr)CH2CO2Me 2-F H H
3-78 H H CH2N(iPr)CH2CO2Et 2-F H H
3-79 Ac H CH2N(iPr)CH2CO2Et 2-F H H
(Таблица 4)
Соединение No. P1 R2 R3 X1 X2 X3
4-1 H H CH2OH 2-F H H
4-2 Ac H CH2OH 2-F H H
4-3 H H CH2CH2OH 2-F H H
4-4 Ac H CH2CH2OH 2-F H H
4-5 H H CH2OMe 2-F H H
4-6 Ac H CH2OMe 2-F H H
4-7 H H CH2CH2OMe 2-F H H
4-8 Ac H CH2CH2OMe 2-F H H
4-9 H H CH2OEt 2-F H H
4-10 Ac H CH2OEt 2-F H H
4-11 H H CH2CH2OEt 2-F H H
4-12 Ac H CH2CH2OEt 2-F H H
4-13 H H CH2CO2H 2-F H H
4-14 Ac H CH2CO2H 2-F H H
4-15 H H CH2CO2Me 2-F H H
4-16 Ac H CH2CO2Me 2-F H H
4-17 H H CH2CO2Et 2-F H H
4-18 Ac H CH2CO2Et 2-F H H
4-19 H H 4-Pip 2-F H H
4-20 Ac H 4-Pip 2-F H H
4-21 H H 4-Pip 2-F 4-F H
4-22 Ac H 4-Pip 2-F 4-F H
4-23 H H 1-CO2Me-4-Pip 2-F H H
4-24 Ac H 1-CO2Me-4-Pip 2-F H H
4-25 H H 1-CO2Et-4-Pip 2-F H H
4-26 Ac H 1-CO2Et-4-Pip 2-F H H
4-27 H H 1-CH2CO2H-4-Pip 2-F H H
4-28 Ac H 1-CH2CO2H-4-Pip 2-F H H
4-29 H H 1-CH2CO2Me-4-Pip 2-F H H
4-30 Ac H 1-CH2CO2Me-4-Pip 2-F H H
4-31 H H 1-CH2CO2Et-4-Pip 2-F H H
4-32 Ac H 1-CH2CO2Et-4-Pip 2-F H H
4-33 H H 1-CH2CH2CO2H-4-Pip 2-F H H
4-34 Ac H 1-CH2CH2CO2H-4-Pip 2-F H H
4-35 H H 1-CH2CH2CO2Me-4-Pip 2-F H H
4-36 Ac H 1-CH2CH2CO2Me-4-Pip 2-F H H
4-37 H H 1-CH2CH2CO2Et-4-Pip 2-F H H
4-38 Ac H 1-CH2CH2CO2Et-4-Pip 2-F H H
4-39 Ac H 1-CH2CH2CO2Et-4-Pip 2-F 4-F H
4-40 H H 1-CH2CH2CH2CO2H-4-Pip 2-F H H
4-41 Ac H 1-CH2CH2CH2CO2H-4-Pip 2-F H H
4-42 H H 1-CH2CH2CH2CO2Me-4-Pip 2-F H H
4-43 Ac H 1-CH2CH2CH2CO2Me-4-Pip 2-F H H
4-44 H H 1-CH2CH2CH2CO2Et-4-Pip 2-F H H
4-45 Ac H 1-CH2CH2CH2CO2Et-4-Pip 2-F H H
4-46 H H CH2CN 2-F H H
4-47 Ac H CH2CN 2-F H H
4-48 H H CH2CH2CN 2-F H H
4-49 Ac H CH2CH2CN 2-F H H
4-50 H H CH2N(Me)CH2CO2H 2-F H H
4-51 Ac H CH2N(Me)CH2CO2H 2-F H H
4-52 H H CH2N(Me)CH2CO2Me 2-F H H
4-53 Ac H CH2N(Me)CH2CO2Me 2-F H H
4-54 H H CH2N(Me)CH2CO2Et 2-F H H
4-55 Ac H CH2N(Me)CH2CO2Et 2-F H H
4-56 H H CH2N(Me)CH2CH2CO2H 2-F H H
4-57 Ac H CH2N(Me)CH2CH2CO2H 2-F H H
4-58 H H CH2N(Me)CH2CH2CO2Me 2-F H H
4-59 Ac H CH2N(Me)CH2CH2CO2Me 2-F H H
4-60 H H CH2N(Me)CH2CH2CO2Et 2-F H H
4-61 Ac H CH2N(Me)CH2CH2CO2Et 2-F H H
4-62 H H CH2N(Me)CH2CH2CH2CO2H 2-F H H
4-63 Ac H CH2N(Me)CH2CH2CH2CO2H 2-F H H
4-64 H H CH2N(Me)CH2CH2CH2CO2Me 2-F H H
4-65 Ac H CH2N(Me)CH2CH2CH2CO2Me 2-F H H
4-66 H H CH2N(Me)CH2CH2CH2CO2Et 2-F H H
4-67 Ac H CH2N(Me)CH2CH2CH2CO2Et 2-F H H
4-68 H H CH2N(Et)CH2CO2H 2-F H H
4-69 Ac H CH2N(Et)CH2CO2H 2-F H H
4-70 H H CH2N(Et)CH2CO2Me 2-F H H
4-71 Ac H CH2N(Et)CH2CO2Me 2-F H H
4-72 H H CH2N(Et)CH2CO2Et 2-F H H
4-73 Ac H CH2N(Et)CH2CO2Et 2-F H H
4-74 H H CH2N(iPr)CH2CO2H 2-F H H
4-75 Ac H CH2N(iPr)CH2CO2H 2-F H H
4-76 H H CH2N(iPr)CH2CO2Me 2-F H H
4-77 Ac H CH2N(iPr)CH2CO2Me 2-F H H
4-78 H H CH2N(iPr)CH2CO2Et 2-F H H
4-79 Ac H CH2N(iPr)CH2CO2Et 2-F H H
(Таблица 5)
Соединение № P1 R2 R3 X1 X2 X3
5-1 H H CH2-1-Pip 2-F H H
5-2 Ac H CH2-1-Pip 2-F H H
5-3 H H CH2-(4-CO2H-1-Pip) 2-F H H
5-4 Ac H CH2-(4-CO2H-1-Pip) 2-F H H
5-5 H H CH2-(4-CO2Me-1-Pip) 2-F H H
5-6 Ac H CH2-(4-CO2Me-1-Pip) 2-F H H
5-7 H H CH2-(4-CO2Et-1-Pip) 2-F H H
5-8 Ac H CH2-(4-CO2Et-1-Pip) 2-F H H
5-9 H H CH2-(4-CH2CO2H-1-Pip) 2-F H H
5-10 Ac H CH2-(4-CH2CO2H-1-Pip) 2-F H H
5-11 H H CH2-(4-CH2CO2Me-1-Pip) 2-F H H
5-12 Ac H CH2-(4-CH2CO2Me-1-Pip) 2-F H H
5-13 H H CH2-(4-CH2CO2Et-1-Pip) 2-F H H
5-14 Ac H CH2-(4-CH2CO2Et-1-Pip) 2-F H H
5-15 H H CH2-(4-CH2CH2CO2H-1-Pip) 2-F H H
5-16 Ac H CH2-(4-CH2CH2CO2H-1-Pip) 2-F H H
5-17 H H CH2-(4-CH2CH2CO2Me-1-Pip) 2-F H H
5-18 Ac H CH2-(4-CH2CH2CO2Me-1-Pip) 2-F H H
5-19 H H CH2-(4-CH2CH2CO2Et-1-Pip) 2-F H H
5-20 Ac H CH2-(4-CH2CH2CO2Et-1-Pip) 2-F H H
5-21 H H CH2-(4-CH2CH2CH2CO2H-1-Pip) 2-F H H
5-22 Ac H CH2-(4-CH2CH2CH2CO2H-1-Pip) 2-F H H
5-23 H H CH2-(4-CH2CH2CH2CO2Me-1-Pip) 2-F H H
5-24 Ac H CH2-(4-CH2CH2CH2CO2Me-1-Pip) 2-F H H
5-25 H H CH2-(4-CH2CH2CH2CO2Et-1-Pip) 2-F H H
5-26 Ac H CH2-(4-CH2CH2CH2CO2Et-1-Pip) 2-F H H
5-27 H H CH2-Mor 2-F H H
5-28 Ac H CH2-Mor 2-F H H
5-29 H H CH2-Thim 2-F H H
5-30 Ac H CH2-Thim 2-F H H
5-31 H H CH2-1-Piz 2-F H H
5-32 Ac H CH2-1-Piz 2-F H H
5-33 H H CH2-(4-Ac-1-Piz) 2-F H H
5-34 Ac H CH2-(4-Ac-1-Piz) 2-F H H
5-35 H H CH2-(4-Ac-1-Piz) 2-F 4-F H
5-36 Ac H CH2-(4-Ac-1-Piz) 2-F 4-F H
5-37 H H CH2-(4-CO2Me-1-Piz) 2-F H H
5-38 Ac H CH2-(4-CO2Me-1-Piz) 2-F H H
5-39 H H CH2-(4-CO2Et-1-Piz) 2-F H H
5-40 Ac H CH2-(4-CO2Et-1-Piz) 2-F H H
5-41 H H CH2-(4-CH2CO2H-1-Piz) 2-F H H
5-42 Ac H CH2-(4-CH2CO2H-1-Piz) 2-F H H
5-43 H H CH2-(4-CH2CO2Me-1-Piz) 2-F H H
5-44 Ac H CH2-(4-CH2CO2Me-1-Piz) 2-F H H
5-45 H H CH2-(4-CH2CO2Et-1-Piz) 2-F H H
5-46 Ac H CH2-(4-CH2CO2Et-1-Piz) 2-F H H
5-47 H H CH2-(4-CH2CH2CO2H-1-Piz) 2-F H H
5-48 Ac H CH2-(4-CH2CH2CO2H-1-Piz) 2-F H H
5-49 H H CH2-(4-CH2CH2CO2Me-1-Piz) 2-F H H
5-50 Ac H CH2-(4-CH2CH2CO2Me-1-Piz) 2-F H H
5-51 H H CH2-(4-CH2CH2CO2Et-1-Piz) 2-F H H
5-52 Ac H CH2-(4-CH2CH2CO2Et-1-Piz) 2-F H H
5-53 H H CH2-(4-CH2CH2CH2CO2H-1-Piz) 2-F H H
5-54 Ac H CH2-(4-CH2CH2CH2CO2H-1-Piz) 2-F H H
5-55 H H CH2-(4-CH2CH2CH2CO2Me-1-Piz) 2-F H H
5-56 Ac H CH2-(4-CH2CH2CH2CO2Me-1-Piz) 2-F H H
5-57 H H CH2-(4-CH2CH2CH2CO2Et-1-Piz) 2-F H H
5-58 Ac H CH2-(4-CH2CH2CH2CO2Et-1-Piz) 2-F H H
5-59 H H CH2-(2-оксо-1-Piz) 2-F H H
5-60 Ac H CH2-(2-оксо-1-Piz) 2-F H H
5-61 H H CH2-(4-Ac-2-оксо-1-Piz) 2-F H H
5-62 Ac H CH2-(4-Ac-2-оксо-1-Piz) 2-F H H
5-63 H H CH2-(4-Ac-2-оксо-1-Piz) 2-F 4-F H
5-64 Ac H CH2-(4-Ac-2-оксо-1-Piz) 2-F 4-F H
5-65 H H CH2-(4-CO2Me-2-оксо-1-Piz) 2-F H H
5-66 Ac H CH2-(4-CO2Me-2-оксо-1-Piz) 2-F H H
5-67 H H CH2-(4-CO2Et-2-оксо-1-Piz) 2-F H H
5-68 Ac H CH2-(4-CO2Et-2-оксо-1-Piz) 2-F H H
5-69 H H CH2-(4-CH2CO2H-2-оксо-1-Piz) 2-F H H
5-70 Ac H CH2-(4-CH2CO2H-2-оксо-1-Piz) 2-F H H
5-71 H H CH2-(4-CH2CO2Me-2-оксо-1-Piz) 2-F H H
5-72 Ac H CH2-(4-CH2CO2Me-2-оксо-1-Piz) 2-F H H
5-73 H H CH2-(4-CH2CO2Et-2-оксо-1-Piz) 2-F H H
5-74 Ac H CH2-(4-CH2CO2Et-2-оксо-1-Piz) 2-F H H
5-75 H H CH2-(4-CH2CH2CO2H-2-оксо-1-Piz) 2-F H H
5-76 Ac H CH2-(4-CH2CH2CO2H-2-оксо-1-Piz) 2-F H H
5-77 H H CH2-(4-CH2CH2CO2Me-2-оксо-1-Piz) 2-F H H
5-78 Ac H CH2-(4-CH2CH2CO2Me-2-оксо-1-Piz) 2-F H H
5-79 H H CH2-(4-CH2CH2CO2Et-2-оксо-1-Piz) 2-F H H
5-80 Ac H CH2-(4-CH2CH2CO2Et-2-оксо-1-Piz) 2-F H H
5-81 H H CH2-(4-CH2CH2CH2CO2H-2-оксо-1-Piz) 2-F H H
5-82 Ac H CH2-(4-CH2CH2CH2CO2H-2-оксо-1-Piz) 2-F H H
5-83 H H CH2-(4-CH2CH2CH2CO2Me-2-оксо-1-Piz) 2-F H H
5-84 Ac H CH2-(4-CH2CH2CH2CO2Me-2-оксо-1-Piz) 2-F H H
5-85 H H CH2-(4-CH2CH2CH2CO2Et-2-оксо-1-Piz) 2-F H H
5-86 Ac H CH2-(4-CH2CH2CH2CO2Et-2-оксо-1-Piz) 2-F H H
5-87 H H CH2-(3-оксо-1-Piz) 2-F H H
5-88 Ac H CH2-(3-оксо-1-Piz) 2-F H H
5-89 H H CH2-(4-Ac-3-оксо-1-Piz) 2-F H H
5-90 Ac H CH2-(4-Ac-3-оксо-1-Piz) 2-F H H
5-91 H H CH2-(4-Ac-3-оксо-1-Piz) 2-F 4-F H
5-92 Ac H CH2-(4-Ac-3-оксо-1-Piz) 2-F 4-F H
5-93 H H CH2-(4-CO2Me-3-оксо-1-Piz) 2-F H H
5-94 Ac H CH2-(4-CO2Me-3-оксо-1-Piz) 2-F H H
5-95 H H CH2-(4-CO2Et-3-оксо-1-Piz) 2-F H H
5-96 Ac H CH2-(4-CO2Et-3-оксо-1-Piz) 2-F H H
5-97 H H CH2-(4-CH2CO2H-3-оксо-1-Piz) 2-F H H
5-98 Ac H CH2-(4-CH2CO2H-3-оксо-1-Piz) 2-F H H
5-99 H H CH2-(4-CH2CO2Me-3-оксо-1-Piz) 2-F H H
5-100 Ac H CH2-(4-CH2CO2Me-3-оксо-1-Piz) 2-F H H
5-101 H H CH2-(4-CH2CO2Et-3-оксо-1-Piz) 2-F H H
5-102 Ac H CH2-(4-CH2CO2Et-3-оксо-1-Piz) 2-F H H
5-103 H H CH2-(4-CH2CH2CO2H-3-оксо-1-Piz) 2-F H H
5-104 Ac H CH2-(4-CH2CH2CO2H-3-оксо-1-Piz) 2-F H H
5-105 H H CH2-(4-CH2CH2CO2Me-3-оксо-1-Piz) 2-F H H
5-106 Ac H CH2-(4-CH2CH2CO2Me-3-оксо-1-Piz) 2-F H H
5-107 H H CH2-(4-CH2CH2CO2Et-3-оксо-1-Piz) 2-F H H
5-108 Ac H CH2-(4-CH2CH2CO2Et-3-оксо-1-Piz) 2-F H H
5-109 H H CH2-(4-CH2CH2CH2CO2H-3-оксо-1-Piz) 2-F H H
5-110 Ac H CH2-(4-CH2CH2CH2CO2H-3-оксо-1-Piz) 2-F H H
5-111 H H CH2-(4-CH2CH2CH2CO2Me-3-оксо-1-Piz) 2-F H H
5-112 Ac H CH2-(4-CH2CH2CH2CO2Me-3-оксо-1-Piz) 2-F H H
5-113 H H CH2-(4-CH2CH2CH2CO2Et-3-оксо-1-Piz) 2-F H H
5-114 Ac H CH2-(4-CH2CH2CH2CO2Et-3-оксо-1-Piz) 2-F H H
5-115 H H CH2-(2,5-диоксо-1-Piz) 2-F H H
5-116 Ac H CH2-(2,5-диоксо-1-Piz) 2-F H H
5-117 H H CH2-(4-Ac-2,5-диоксо-1-Piz) 2-F H H
5-118 Ac H CH2-(4-Ac-2,5-диоксо-1-Piz) 2-F H H
5-119 H H CH2-(4-Ac-2,5-диоксо-1-Piz) 2-F 4-F H
5-120 Ac H CH2-(4-Ac-2,5-диоксо-1-Piz) 2-F 4-F H
5-121 H H CH2-(4-CO2Me-2,5-диоксо-1-Piz) 2-F H H
5-122 Ac H CH2-(4-CO2Me-2,5-диоксо-1-Piz) 2-F H H
5-123 H H CH2-(4-CO2Et-2,5-диоксо-1-Piz) 2-F H H
5-124 Ac H CH2-(4-CO2Et-2,5-диоксо-1-Piz) 2-F H H
5-125 H H CH2-(4-CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
5-126 Ac H CH2-(4-CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
5-127 H H CH2-(4-CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
5-128 Ac H CH2-(4-CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
5-129 H H CH2-(4-CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
5-130 Ac H CH2-(4-CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
5-131 H H CH2-(4-CH2CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
5-132 Ac H CH2-(4-CH2CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
5-133 H H CH2-(4-CH2CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
5-134 Ac H CH2-(4-CH2CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
5-135 H H CH2-(4-CH2CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
5-136 Ac H CH2-(4-CH2CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
5-137 H H CH2-(4-CH2CH2CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
5-138 Ac H CH2-(4-CH2CH2CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
5-139 H H CH2-(4-CH2CH2CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
5-140 Ac H CH2-(4-CH2CH2CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
5-141 H H CH2-(4-CH2CH2CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
5-142 Ac H CH2-(4-CH2CH2CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
5-143 H H CH2-1-Pyrd 2-F H H
5-144 Ac H CH2-1-Pyrd 2-F H H
5-145 H H CH2-(2-CO2H-1-Pyrd) 2-F H H
5-146 Ac H CH2-(2-CO2H-1-Pyrd) 2-F H H
5-147 H H CH2-(2-CO2Me-1-Pyrd) 2-F H H
5-148 Ac H CH2-(2-CO2Me-1-Pyrd) 2-F H H
5-149 H H CH2-(2-CO2Et-1-Pyrd) 2-F H H
5-150 Ac H CH2-(2-CO2Et-1-Pyrd) 2-F H H
5-151 H H CH2-(2-CH2CO2H-1-Pyrd) 2-F H H
5-152 Ac H CH2-(2-CH2CO2H-1-Pyrd) 2-F H H
5-153 H H CH2-(2-CH2CO2Me-1-Pyrd) 2-F H H
5-154 Ac H CH2-(2-CH2CO2Me-1-Pyrd) 2-F H H
5-155 H H CH2-(2-CH2CO2Et-1-Pyrd) 2-F H H
5-156 Ac H CH2-(2-CH2CO2Et-1-Pyrd) 2-F H H
5-157 H H CH2-(2-CH2CH2CO2H-1-Pyrd) 2-F H H
5-158 Ac H CH2-(2-CH2CH2CO2H-1-Pyrd) 2-F H H
5-159 H H CH2-(2-CH2CH2CO2Me-1-Pyrd) 2-F H H
5-160 Ac H CH2-(2-CH2CH2CO2Me-1-Pyrd) 2-F H H
5-161 H H CH2-(2-CH2CH2CO2Et-1-Pyrd) 2-F H H
5-162 Ac H CH2-(2-CH2CH2CO2Et-1-Pyrd) 2-F H H
5-163 H H CH2-(2-CH2CH2CH2CO2H-1-Pyrd) 2-F H H
5-164 Ac H CH2-(2-CH2CH2CH2CO2H-1-Pyrd) 2-F H H
5-165 H H CH2-(2-CH2CH2CH2CO2Me-1-Pyrd) 2-F H H
5-166 Ac H CH2-(2-CH2CH2CH2CO2Me-1-Pyrd) 2-F H H
5-167 H H CH2-(2-CH2CH2CH2CO2Et-1-Pyrd) 2-F H H
5-168 Ac H CH2-(2-CH2CH2CH2CO2Et-1-Pyrd) 2-F H H
5-169 H H CH2CH2-1-Pip 2-F H H
5-170 Ac H CH2CH2-1-Pip 2-F H H
5-171 H H CH2CH2-(4-CO2H-1-Pip) 2-F H H
5-172 Ac H CH2CH2-(4-CO2H-1-Pip) 2-F H H
5-173 H H CH2CH2-(4-CO2Me-1-Pip) 2-F H H
5-174 Ac H CH2CH2-(4-CO2Me-1-Pip) 2-F H H
5-175 H H CH2CH2-(4-CO2Et-1-Pip) 2-F H H
5-176 Ac H CH2CH2-(4-CO2Et-1-Pip) 2-F H H
5-177 H H CH2CH2-(4-CH2CO2H-1-Pip) 2-F H H
5-178 Ac H CH2CH2-(4-CH2CO2H-1-Pip) 2-F H H
5-179 H H CH2CH2-(4-CH2CO2Me-1-Pip) 2-F H H
5-180 Ac H CH2CH2-(4-CH2CO2Me-1-Pip) 2-F H H
5-181 H H CH2CH2-(4-CH2CO2Et-1-Pip) 2-F H H
5-182 Ac H CH2CH2-(4-CH2CO2Et-1-Pip) 2-F H H
5-183 H H CH2CH2-(4-CH2CH2CO2H-1-Pip) 2-F H H
5-184 Ac H CH2CH2-(4-CH2CH2CO2H-1-Pip) 2-F H H
5-185 H H CH2CH2-(4-CH2CH2CO2Me-1-Pip) 2-F H H
5-186 Ac H CH2CH2-(4-CH2CH2CO2Me-1-Pip) 2-F H H
5-187 H H CH2CH2-(4-CH2CH2CO2Et-1-Pip) 2-F H H
5-188 Ac H CH2CH2-(4-CH2CH2CO2Et-1-Pip) 2-F H H
5-189 H H CH2CH2-(4-CH2CH2CH2CO2H-1-Pip) 2-F H H
5-190 Ac H CH2CH2-(4-CH2CH2CH2CO2H-1-Pip) 2-F H H
5-191 H H CH2CH2-(4-CH2CH2CH2CO2Me-1-Pip) 2-F H H
5-192 Ac H CH2CH2-(4-CH2CH2CH2CO2Me-1-Pip) 2-F H H
5-193 H H CH2CH2-(4-CH2CH2CH2CO2Et-1-Pip) 2-F H H
5-194 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-1-Pip) 2-F H H
5-195 H H CH2CH2-Mor 2-F H H
5-196 Ac H CH2CH2-Mor 2-F H H
5-197 H H CH2CH2-Thim 2-F H H
5-198 Ac H CH2CH2-Thim 2-F H H
5-199 H H CH2CH2-1-Piz 2-F H H
5-200 Ac H CH2CH2-1-Piz 2-F H H
5-201 H H CH2CH2-(4-Ac-1-Piz) 2-F H H
5-202 Ac H CH2CH2-(4-Ac-1-Piz) 2-F H H
5-203 H H CH2CH2-(4-Ac-1-Piz) 2-F 4-F H
5-204 Ac H CH2CH2-(4-Ac-1-Piz) 2-F 4-F H
5-205 H H CH2CH2-(4-CO2Me-1-Piz) 2-F H H
5-206 Ac H CH2CH2-(4-CO2Me-1-Piz) 2-F H H
5-207 H H CH2CH2-(4-CO2Et-1-Piz) 2-F H H
5-208 Ac H CH2CH2-(4-CO2Et-1-Piz) 2-F H H
5-209 H H CH2CH2-(4-CH2CO2H-1-Piz) 2-F H H
5-210 Ac H CH2CH2-(4-CH2CO2H-1-Piz) 2-F H H
5-211 H H CH2CH2-(4-CH2CO2Me-1-Piz) 2-F H H
5-212 Ac H CH2CH2-(4-CH2CO2Me-1-Piz) 2-F H H
5-213 H H CH2CH2-(4-CH2CO2Et-1-Piz) 2-F H H
5-214 Ac H CH2CH2-(4-CH2CO2Et-1-Piz) 2-F H H
5-215 H H CH2CH2-(4-CH2CH2CO2H-1-Piz) 2-F H H
5-216 Ac H CH2CH2-(4-CH2CH2CO2H-1-Piz) 2-F H H
5-217 H H CH2CH2-(4-CH2CH2CO2Me-1-Piz) 2-F H H
5-218 Ac H CH2CH2-(4-CH2CH2CO2Me-1-Piz) 2-F H H
5-219 H H CH2CH2-(4-CH2CH2CO2Et-1-Piz) 2-F H H
5-220 Ac H CH2CH2-(4-CH2CH2CO2Et-1-Piz) 2-F H H
5-221 H H CH2CH2-(4-CH2CH2CH2CO2H-1-Piz) 2-F H H
5-222 Ac H CH2CH2-(4-CH2CH2CH2CO2H-1-Piz) 2-F H H
5-223 H H CH2CH2-(4-CH2CH2CH2CO2Me-1-Piz) 2-F H H
5-224 Ac H CH2CH2-(4-CH2CH2CH2CO2Me-1-Piz) 2-F H H
5-225 H H CH2CH2-(4-CH2CH2CH2CO2Et-1-Piz) 2-F H H
5-226 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-1-Piz) 2-F H H
5-227 H H CH2CH2-(2-оксо-1-Piz) 2-F H H
5-228 Ac H CH2CH2-(2-оксо-1-Piz) 2-F H H
5-229 H H CH2CH2-(4-Ac-2-оксо-1-Piz) 2-F H H
5-230 Ac H CH2CH2-(4-Ac-2-оксо-1-Piz) 2-F H H
5-231 H H CH2CH2-(4-Ac-2-оксо-1-Piz) 2-F 4-F H
5-232 Ac H CH2CH2-(4-Ac-2-оксо-1-Piz) 2-F 4-F H
5-233 H H CH2CH2-(4-CO2Me-2-оксо-1-Piz) 2-F H H
5-234 Ac H CH2CH2-(4-CO2Me-2-оксо-1-Piz) 2-F H H
5-235 H H CH2CH2-(4-CO2Et-2-оксо-1-Piz) 2-F H H
5-236 Ac H CH2CH2-(4-CO2Et-2-оксо-1-Piz) 2-F H H
5-237 H H CH2CH2-(4-CH2CO2H-2-оксо-1-Piz) 2-F H H
5-238 Ac H CH2CH2-(4-CH2CO2H-2-оксо-1-Piz) 2-F H H
5-239 H H CH2CH2-(4-CH2CO2Me-2-оксо-1-Piz) 2-F H H
5-240 Ac H CH2CH2-(4-CH2CO2Me-2-оксо-1-Piz) 2-F H H
5-241 H H CH2CH2-(4-CH2CO2Et-2-оксо-1-Piz) 2-F H H
5-242 Ac H CH2CH2-(4-CH2CO2Et-2-оксо-1-Piz) 2-F H H
5-243 H H CH2CH2-(4-CH2CH2CO2H-2-оксо-1-Piz) 2-F H H
5-244 Ac H CH2CH2-(4-CH2CH2CO2H-2-оксо-1-Piz) 2-F H H
5-245 H H CH2CH2-(4-CH2CH2CO2Me-2-оксо-1-Piz) 2-F H H
5-246 Ac H CH2CH2-(4-CH2CH2CO2Me-2-оксо-1-Piz) 2-F H H
5-247 H H CH2CH2-(4-CH2CH2CO2Et-2-оксо-1-Piz) 2-F H H
5-248 Ac H CH2CH2-(4-CH2CH2CO2Et-2-оксо-1-Piz) 2-F H H
5-249 H H CH2CH2-(4-CH2CH2CH2CO2H-2-оксо-1-Piz) 2-F H H
5-250 Ac H CH2CH2-(4-CH2CH2CH2CO2H-2-оксо-1-Piz) 2-F H H
5-251 H H CH2CH2-(4-CH2CH2CH2CO2Me-2-оксо-1-Piz) 2-F H H
5-252 Ac H CH2CH2-(4-CH2CH2CH2CO2Me-2-оксо-1-Piz) 2-F H H
5-253 H H CH2CH2-(4-CH2CH2CH2CO2Et-2-оксо-1-Piz) 2-F H H
5-254 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-2-оксо-1-Piz) 2-F H H
5-255 H H CH2CH2-(3-оксо-1-Piz) 2-F H H
5-256 Ac H CH2CH2-(3-оксо-1-Piz) 2-F H H
5-257 H H CH2CH2-(4-Ac-3-оксо-1-Piz) 2-F H H
5-258 Ac H CH2CH2-(4-Ac-3-оксо-1-Piz) 2-F H H
5-259 H H CH2CH2-(4-Ac-3-оксо-1-Piz) 2-F 4-F H
5-260 Ac H CH2CH2-(4-Ac-3-оксо-1-Piz) 2-F 4-F H
5-261 H H CH2CH2-(4-CO2Me-3-оксо-1-Piz) 2-F H H
5-262 Ac H CH2CH2-(4-CO2Me-3-оксо-1-Piz) 2-F H H
5-263 H H CH2CH2-(4-CO2Et-3-оксо-1-Piz) 2-F H H
5-264 Ac H CH2CH2-(4-CO2Et-3-оксо-1-Piz) 2-F H H
5-265 H H CH2CH2-(4-CH2CO2H-3-оксо-1-Piz) 2-F H H
5-266 Ac H CH2CH2-(4-CH2CO2H-3-оксо-1-Piz) 2-F H H
5-267 H H CH2CH2-(4-CH2CO2Me-3-оксо-1-Piz) 2-F H H
5-268 Ac H CH2CH2-(4-CH2CO2Me-3-оксо-1-Piz) 2-F H H
5-269 H H CH2CH2-(4-CH2CO2Et-3-оксо-1-Piz) 2-F H H
5-270 Ac H CH2CH2-(4-CH2CO2Et-3-оксо-1-Piz) 2-F H H
5-271 H H CH2CH2-(4-CH2CH2CO2H-3-оксо-1-Piz) 2-F H H
5-272 Ac H CH2CH2-(4-CH2CH2CO2H-3-оксо-1-Piz) 2-F H H
5-273 H H CH2CH2-(4-CH2CH2CO2Me-3-оксо-1-Piz) 2-F H H
5-274 Ac H CH2CH2-(4-CH2CH2CO2Me-3-оксо-1-Piz) 2-F H H
5-275 H H CH2CH2-(4-CH2CH2CO2Et-3-оксо-1-Piz) 2-F H H
5-276 Ac H CH2CH2-(4-CH2CH2CO2Et-3-оксо-1-Piz) 2-F H H
5-277 H H CH2CH2-(4-CH2CH2CH2CO2H-3-оксо-1-Piz) 2-F H H
5-278 Ac H CH2CH2-(4-CH2CH2CH2CO2H-3-оксо-1-Piz) 2-F H H
5-279 H H CH2CH2-(4-CH2CH2CH2CO2Me-3-оксо-1-Piz) 2-F H H
5-280 Ac H CH2CH2-(4-CH2CH2CH2CO2Me-3-оксо-1-Piz) 2-F H H
5-281 H H CH2CH2-(4-CH2CH2CH2CO2Et-3-оксо-1-Piz) 2-F H H
5-282 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-3-оксо-1-Piz) 2-F H H
5-283 H H CH2CH2-(2,5-диоксо-1-Piz) 2-F H H
5-284 Ac H CH2CH2-(2,5-диоксо-1-Piz) 2-F H H
5-285 H H CH2CH2-(4-Ac-2,5-диоксо-1-Piz) 2-F H H
5-286 Ac H CH2CH2-(4-Ac-2,5-диоксо-1-Piz) 2-F H H
5-287 H H CH2CH2-(4-Ac-2,5-диоксо-1-Piz) 2-F 4-F H
5-288 Ac H CH2CH2-(4-Ac-2,5-диоксо-1-Piz) 2-F 4-F H
5-289 H H CH2CH2-(4-CO2Me-2,5-диоксо-1-Piz) 2-F H H
5-290 Ac H CH2CH2-(4-CO2Me-2,5-диоксо-1-Piz) 2-F H H
5-291 H H CH2CH2-(4-CO2Et-2,5-диоксо-1-Piz) 2-F H H
5-292 Ac H CH2CH2-(4-CO2Et-2,5-диоксо-1-Piz) 2-F H H
5-293 H H CH2CH2-(4-CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
5-294 Ac H CH2CH2-(4-CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
5-295 H H CH2CH2-(4-CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
5-296 Ac H CH2CH2-(4-CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
5-297 H H CH2CH2-(4-CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
5-298 Ac H CH2CH2-(4-CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
5-299 H H CH2CH2-(4-CH2CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
5-300 Ac H CH2CH2-(4-CH2CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
5-301 H H CH2CH2-(4-CH2CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
5-302 Ac H CH2CH2-(4-CH2CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
5-303 H H CH2CH2-(4-CH2CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
5-304 Ac H CH2CH2-(4-CH2CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
5-305 H H CH2CH2-(4-CH2CH2CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
5-306 Ac H CH2CH2-(4-CH2CH2CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
5-307 H H CH2CH2-(4-CH2CH2CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
5-308 Ac H CH2CH2-(4-CH2CH2CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
5-309 H H CH2CH2-(4-CH2CH2CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
5-310 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
5-311 H H CH2CH2-1-Pyrd 2-F H H
5-312 Ac H CH2CH2-1-Pyrd 2-F H H
5-313 H H CH2CH2-(2-CO2H-1-Pyrd) 2-F H H
5-314 Ac H CH2CH2-(2-CO2H-1-Pyrd) 2-F H H
5-315 H H CH2CH2-(2-CO2Me-1-Pyrd) 2-F H H
5-316 Ac H CH2CH2-(2-CO2Me-1-Pyrd) 2-F H H
5-317 H H CH2CH2-(2-CO2Et-1-Pyrd) 2-F H H
5-318 Ac H CH2CH2-(2-CO2Et-1-Pyrd) 2-F H H
5-319 H H CH2CH2-(2-CH2CO2H-1-Pyrd) 2-F H H
5-320 Ac H CH2CH2-(2-CH2CO2H-1-Pyrd) 2-F H H
5-321 H H CH2CH2-(2-CH2CO2Me-1-Pyrd) 2-F H H
5-322 Ac H CH2CH2-(2-CH2CO2Me-1-Pyrd) 2-F H H
5-323 H H CH2CH2-(2-CH2CO2Et-1-Pyrd) 2-F H H
5-324 Ac H CH2CH2-(2-CH2CO2Et-1-Pyrd) 2-F H H
5-325 H H CH2CH2-(2-CH2CH2CO2H-1-Pyrd) 2-F H H
5-326 Ac H CH2CH2-(2-CH2CH2CO2H-1-Pyrd) 2-F H H
5-327 H H CH2CH2-(2-CH2CH2CO2Me-1-Pyrd) 2-F H H
5-328 Ac H CH2CH2-(2-CH2CH2CO2Me-1-Pyrd) 2-F H H
5-329 H H CH2CH2-(2-CH2CH2CO2Et-1-Pyrd) 2-F H H
5-330 Ac H CH2CH2-(2-CH2CH2CO2Et-1-Pyrd) 2-F H H
5-331 H H CH2CH2-(2-CH2CH2CH2CO2H-1-Pyrd) 2-F H H
5-332 Ac H CH2CH2-(2-CH2CH2CH2CO2H-1-Pyrd) 2-F H H
5-333 H H CH2CH2-(2-CH2CH2CH2CO2Me-1-Pyrd) 2-F H H
5-334 Ac H CH2CH2-(2-CH2CH2CH2CO2Me-1-Pyrd) 2-F H H
5-335 H H CH2CH2-(2-CH2CH2CH2CO2Et-1-Pyrd) 2-F H H
5-336 Ac H CH2CH2-(2-CH2CH2CH2CO2Et-1-Pyrd) 2-F H H
5-337 H H CH2-(3-CO2H-1-Pip) 2-F H H
5-338 Ac H CH2-(3-CO2H-1-Pip) 2-F H H
5-339 H H CH2-(3-CO2Me-1-Pip) 2-F H H
5-340 Ac H CH2-(3-CO2Me-1-Pip) 2-F H H
5-341 H H CH2-(3-CO2Et-1-Pip) 2-F H H
5-342 Ac H CH2-(3-CO2Et-1-Pip) 2-F H H
5-343 H H CH2-(3-CH2CO2H-1-Pip) 2-F H H
5-344 Ac H CH2-(3-CH2CO2H-1-Pip) 2-F H H
5-345 H H CH2-(3-CH2CO2Me-1-Pip) 2-F H H
5-346 Ac H CH2-(3-CH2CO2Me-1-Pip) 2-F H H
5-347 H H CH2-(3-CH2CO2Et-1-Pip) 2-F H H
5-348 Ac H CH2-(3-CH2CO2Et-1-Pip) 2-F H H
5-349 H H CH2-(3-CH2CH2CO2H-1-Pip) 2-F H H
5-350 Ac H CH2-(3-CH2CH2CO2H-1-Pip) 2-F H H
5-351 H H CH2-(3-CH2CH2CO2Me-1-Pip) 2-F H H
5-352 Ac H CH2-(3-CH2CH2CO2Me-1-Pip) 2-F H H
5-353 H H CH2-(3-CH2CH2CO2Et-1-Pip) 2-F H H
5-354 Ac H CH2-(3-CH2CH2CO2Et-1-Pip) 2-F H H
5-355 H H CH2-(3-CH2CH2CH2CO2H-1-Pip) 2-F H H
5-356 Ac H CH2-(3-CH2CH2CH2CO2H-1-Pip) 2-F H H
5-357 H H CH2-(3-CH2CH2CH2CO2Me-1-Pip) 2-F H H
5-358 Ac H CH2-(3-CH2CH2CH2CO2Me-1-Pip) 2-F H H
5-359 H H CH2-(3-CH2CH2CH2CO2Et-1-Pip) 2-F H H
5-360 Ac H CH2-(3-CH2CH2CH2CO2Et-1-Pip) 2-F H H
5-361 H H CH2CH2-(3-CO2H-1-Pip) 2-F H H
5-362 Ac H CH2CH2-(3-CO2H-1-Pip) 2-F H H
5-363 H H CH2CH2-(3-CO2Me-1-Pip) 2-F H H
5-364 Ac H CH2CH2-(3-CO2Me-1-Pip) 2-F H H
5-365 H H CH2CH2-(3-CO2Et-1-Pip) 2-F H H
5-366 Ac H CH2CH2-(3-CO2Et-1-Pip) 2-F H H
5-367 H H CH2CH2-(3-CH2CO2H-1-Pip) 2-F H H
5-368 Ac H CH2CH2-(3-CH2CO2H-1-Pip) 2-F H H
5-369 H H CH2CH2-(3-CH2CO2Me-1-Pip) 2-F H H
5-370 Ac H CH2CH2-(3-CH2CO2Me-1-Pip) 2-F H H
5-371 H H CH2CH2-(3-CH2CO2Et-1-Pip) 2-F H H
5-372 Ac H CH2CH2-(3-CH2CO2Et-1-Pip) 2-F H H
5-373 H H CH2CH2-(3-CH2CH2CO2H-1-Pip) 2-F H H
5-374 Ac H CH2CH2-(3-CH2CH2CO2H-1-Pip) 2-F H H
5-375 H H CH2CH2-(3-CH2CH2CO2Me-1-Pip) 2-F H H
5-376 Ac H CH2CH2-(3-CH2CH2CO2Me-1-Pip) 2-F H H
5-377 H H CH2CH2-(3-CH2CH2CO2Et-1-Pip) 2-F H H
5-378 Ac H CH2CH2-(3-CH2CH2CO2Et-1-Pip) 2-F H H
5-379 H H CH2CH2-(3-CH2CH2CH2CO2H-1-Pip) 2-F H H
5-380 Ac H CH2CH2-(3-CH2CH2CH2CO2H-1-Pip) 2-F H H
5-381 H H CH2CH2-(3-CH2CH2CH2CO2Me-1-Pip) 2-F H H
5-382 Ac H CH2CH2-(3-CH2CH2CH2CO2Me-1-Pip) 2-F H H
5-383 H H CH2CH2-(3-CH2CH2CH2CO2Et-1-Pip) 2-F H H
5-384 Ac H CH2CH2-(3-CH2CH2CH2CO2Et-1-Pip) 2-F H H
5-385 H H CH2-(4-OH-2-CO2H-1-Pyrd) 2-F H H
5-386 Ac H CH2-(4-OH-2-CO2H-1-Pyrd) 2-F H H
5-387 H H CH2-(4-OH-2-CO2Me-1-Pyrd) 2-F H H
5-388 Ac H CH2-(4-OH-2-CO2Me-1-Pyrd) 2-F H H
5-389 H H CH2-(4-OH-2-CO2Et-1-Pyrd) 2-F H H
5-390 Ac H CH2-(4-OH-2-CO2Et-1-Pyrd) 2-F H H
(Таблица 6)
Соединение № P1 R2 R3 X1 X2 X3
6-1 H H CH2-1-Pip 2-F H H
6-2 Ac H CH2-1-Pip 2-F H H
6-3 H H CH2-(4-CO2H-1-Pip) 2-F H H
6-4 Ac H CH2-(4-CO2H-1-Pip) 2-F H H
6-5 H H CH2-(4-CO2Me-1-Pip) 2-F H H
6-6 Ac H CH2-(4-CO2Me-1-Pip) 2-F H H
6-7 H H CH2-(4-CO2Et-1-Pip) 2-F H H
6-8 Ac H CH2-(4-CO2Et-1-Pip) 2-F H H
6-9 H H CH2-(4-CH2CO2H-1-Pip) 2-F H H
6-10 Ac H CH2-(4-CH2CO2H-1-Pip) 2-F H H
6-11 H H CH2-(4-CH2CO2Me-1-Pip) 2-F H H
6-12 Ac H CH2-(4-CH2CO2Me-1-Pip) 2-F H H
6-13 H H CH2-(4-CH2CO2Et-1-Pip) 2-F H H
6-14 Ac H CH2-(4-CH2CO2Et-1-Pip) 2-F H H
6-15 H H CH2-(4-CH2CH2CO2H-1-Pip) 2-F H H
6-16 Ac H CH2-(4-CH2CH2CO2H-1-Pip) 2-F H H
6-17 H H CH2-(4-CH2CH2CO2Me-1-Pip) 2-F H H
6-18 Ac H CH2-(4-CH2CH2CO2Me-1-Pip) 2-F H H
6-19 H H CH2-(4-CH2CH2CO2Et-1-Pip) 2-F H H
6-20 Ac H CH2-(4-CH2CH2CO2Et-1-Pip) 2-F H H
6-21 H H CH2-(4-CH2CH2CH2CO2H-1-Pip) 2-F H H
6-22 Ac H CH2-(4-CH2CH2CH2CO2H-1-Pip) 2-F H H
6-23 H H CH2-(4-CH2CH2CH2CO2Me-1-Pip) 2-F H H
6-24 Ac H CH2-(4-CH2CH2CH2CO2Me-1-Pip) 2-F H H
6-25 H H CH2-(4-CH2CH2CH2CO2Et-1-Pip) 2-F H H
6-26 Ac H CH2-(4-CH2CH2CH2CO2Et-1-Pip) 2-F H H
6-27 H H CH2-Mor 2-F H H
6-28 Ac H CH2-Mor 2-F H H
6-29 H H CH2-Thim 2-F H H
6-30 Ac H CH2-Thim 2-F H H
6-31 H H CH2-1-Piz 2-F H H
6-32 Ac H CH2-1-Piz 2-F H H
6-33 H H CH2-(4-Ac-1-Piz) 2-F H H
6-34 Ac H CH2-(4-Ac-1-Piz) 2-F H H
6-35 H H CH2-(4-Ac-1-Piz) 2-F 4-F H
6-36 Ac H CH2-(4-Ac-1-Piz) 2-F 4-F H
6-37 H H CH2-(4-CO2Me-1-Piz) 2-F H H
6-38 Ac H CH2-(4-CO2Me-1-Piz) 2-F H H
6-39 H H CH2-(4-CO2Et-1-Piz) 2-F H H
6-40 Ac H CH2-(4-CO2Et-1-Piz) 2-F H H
6-41 H H CH2-(4-CH2CO2H-1-Piz) 2-F H H
6-42 Ac H CH2-(4-CH2CO2H-1-Piz) 2-F H H
6-43 H H CH2-(4-CH2CO2Me-1-Piz) 2-F H H
6-44 Ac H CH2-(4-CH2CO2Me-1-Piz) 2-F H H
6-45 H H CH2-(4-CH2CO2Et-1-Piz) 2-F H H
6-46 Ac H CH2-(4-CH2CO2Et-1-Piz) 2-F H H
6-47 H H CH2-(4-CH2CH2CO2H-1-Piz) 2-F H H
6-48 Ac H CH2-(4-CH2CH2CO2H-1-Piz) 2-F H H
6-49 H H CH2-(4-CH2CH2CO2Me-1-Piz) 2-F H H
6-50 Ac H CH2-(4-CH2CH2CO2Me-1-Piz) 2-F H H
6-51 H H CH2-(4-CH2CH2CO2Et-1-Piz) 2-F H H
6-52 Ac H CH2-(4-CH2CH2CO2Et-1-Piz) 2-F H H
6-53 H H CH2-(4-CH2CH2CH2CO2H-1-Piz) 2-F H H
6-54 Ac H CH2-(4-CH2CH2CH2CO2H-1-Piz) 2-F H H
6-55 H H CH2-(4-CH2CH2CH2CO2Me-1-Piz) 2-F H H
6-56 Ac H CH2-(4-CH2CH2CH2CO2Me-1-Piz) 2-F H H
6-57 H H CH2-(4-CH2CH2CH2CO2Et-1-Piz) 2-F H H
6-58 Ac H CH2-(4-CH2CH2CH2CO2Et-1-Piz) 2-F H H
6-59 H H CH2-(2-оксо-1-Piz) 2-F H H
6-60 Ac H CH2-(2-оксо-1-Piz) 2-F H H
6-61 H H CH2-(4-Ac-2-оксо-1-Piz) 2-F H H
6-62 Ac H CH2-(4-Ac-2-оксо-1-Piz) 2-F H H
6-63 H H CH2-(4-Ac-2-оксо-1-Piz) 2-F 4-F H
6-64 Ac H CH2-(4-Ac-2-оксо-1-Piz) 2-F 4-F H
6-65 H H CH2-(4-CO2Me-2-оксо-1-Piz) 2-F H H
6-66 Ac H CH2-(4-CO2Me-2-оксо-1-Piz) 2-F H H
6-67 H H CH2-(4-CO2Et-2-оксо-1-Piz) 2-F H H
6-68 Ac H CH2-(4-CO2Et-2-оксо-1-Piz) 2-F H H
6-69 H H CH2-(4-CH2CO2H-2-оксо-1-Piz) 2-F H H
6-70 Ac H CH2-(4-CH2CO2H-2-оксо-1-Piz) 2-F H H
6-71 H H CH2-(4-CH2CO2Me-2-оксо-1-Piz) 2-F H H
6-72 Ac H CH2-(4-CH2CO2Me-2-оксо-1-Piz) 2-F H H
6-73 H H CH2-(4-CH2CO2Et-2-оксо-1-Piz) 2-F H H
6-74 Ac H CH2-(4-CH2CO2Et-2-оксо-1-Piz) 2-F H H
6-75 H H CH2-(4-CH2CH2CO2H-2-оксо-1-Piz) 2-F H H
6-76 Ac H CH2-(4-CH2CH2CO2H-2-оксо-1-Piz) 2-F H H
6-77 H H CH2-(4-CH2CH2CO2Me-2-оксо-1-Piz) 2-F H H
6-78 Ac H CH2-(4-CH2CH2CO2Me-2-оксо-1-Piz) 2-F H H
6-79 H H CH2-(4-CH2CH2CO2Et-2-оксо-1-Piz) 2-F H H
6-80 Ac H CH2-(4-CH2CH2CO2Et-2-оксо-1-Piz) 2-F H H
6-81 H H CH2-(4-CH2CH2CH2CO2H-2-оксо-1-Piz) 2-F H H
6-82 Ac H CH2-(4-CH2CH2CH2CO2H-2-оксо-1-Piz) 2-F H H
6-83 H H CH2-(4-CH2CH2CH2CO2Me-2-оксо-1-Piz) 2-F H H
6-84 Ac H CH2-(4-CH2CH2CH2CO2Me-2-оксо-1-Piz) 2-F H H
6-85 H H CH2-(4-CH2CH2CH2CO2Et-2-оксо-1-Piz) 2-F H H
6-86 Ac H CH2-(4-CH2CH2CH2CO2Et-2-оксо-1-Piz) 2-F H H
6-87 H H CH2-(3-оксо-1-Piz) 2-F H H
6-88 Ac H CH2-(3-оксо-1-Piz) 2-F H H
6-89 H H CH2-(4-Ac-3-оксо-1-Piz) 2-F H H
6-90 Ac H CH2-(4-Ac-3-оксо-1-Piz) 2-F H H
6-91 H H CH2-(4-Ac-3-оксо-1-Piz) 2-F 4-F H
6-92 Ac H CH2-(4-Ac-3-оксо-1-Piz) 2-F 4-F H
6-93 H H CH2-(4-CO2Me-3-оксо-1-Piz) 2-F H H
6-94 Ac H CH2-(4-CO2Me-3-оксо-1-Piz) 2-F H H
6-95 H H CH2-(4-CO2Et-3-оксо-1-Piz) 2-F H H
6-96 Ac H CH2-(4-CO2Et-3-оксо-1-Piz) 2-F H H
6-97 H H CH2-(4-CH2CO2H-3-оксо-1-Piz) 2-F H H
6-98 Ac H CH2-(4-CH2CO2H-3-оксо-1-Piz) 2-F H H
6-99 H H CH2-(4-CH2CO2Me-3-оксо-1-Piz) 2-F H H
6-100 Ac H CH2-(4-CH2CO2Me-3-оксо-1-Piz) 2-F H H
6-101 H H CH2-(4-CH2CO2Et-3-оксо-1-Piz) 2-F H H
6-102 Ac H CH2-(4-CH2CO2Et-3-оксо-1-Piz) 2-F H H
6-103 H H CH2-(4-CH2CH2CO2H-3-оксо-1-Piz) 2-F H H
6-104 Ac H CH2-(4-CH2CH2CO2H-3-оксо-1-Piz) 2-F H H
6-105 H H CH2-(4-CH2CH2CO2Me-3-оксо-1-Piz) 2-F H H
6-106 Ac H CH2-(4-CH2CH2CO2Me-3-оксо-1-Piz) 2-F H H
6-107 H H CH2-(4-CH2CH2CO2Et-3-оксо-1-Piz) 2-F H H
6-108 Ac H CH2-(4-CH2CH2CO2Et-3-оксо-1-Piz) 2-F H H
6-109 H H CH2-(4-CH2CH2CH2CO2H-3-оксо-1-Piz) 2-F H H
6-110 Ac H CH2-(4-CH2CH2CH2CO2H-3-оксо-1-Piz) 2-F H H
6-111 H H CH2-(4-CH2CH2CH2CO2Me-3-оксо-1-Piz) 2-F H H
6-112 Ac H CH2-(4-CH2CH2CH2CO2Me-3-оксо-1-Piz) 2-F H H
6-113 H H CH2-(4-CH2CH2CH2CO2Et-3-оксо-1-Piz) 2-F H H
6-114 Ac H CH2-(4-CH2CH2CH2CO2Et-3-оксо-1-Piz) 2-F H H
6-115 H H CH2-(2,5-диоксо-1-Piz) 2-F H H
6-116 Ac H CH2-(2,5-диоксо-1-Piz) 2-F H H
6-117 H H CH2-(4-Ac-2,5-диоксо-1-Piz) 2-F H H
6-118 Ac H CH2-(4-Ac-2,5-диоксо-1-Piz) 2-F H H
6-119 H H CH2-(4-Ac-2,5-диоксо-1-Piz) 2-F 4-F H
6-120 Ac H CH2-(4-Ac-2,5-диоксо-1-Piz) 2-F 4-F H
6-121 H H CH2-(4-CO2Me-2,5-диоксо-1-Piz) 2-F H H
6-122 Ac H CH2-(4-CO2Me-2,5-диоксо-1-Piz) 2-F H H
6-123 H H CH2-(4-CO2Et-2,5-диоксо-1-Piz) 2-F H H
6-124 Ac H CH2-(4-CO2Et-2,5-диоксо-1-Piz) 2-F H H
6-125 H H CH2-(4-CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
6-126 Ac H CH2-(4-CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
6-127 H H CH2-(4-CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
6-128 Ac H CH2-(4-CH2CO2Me-2,5-диоксо-1-Piz 2-F H H
6-130 Ac H CH2-(4-CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
6-131 H H CH2-(4-CH2CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
6-132 Ac H CH2-(4-CH2CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
6-133 H H CH2-(4-CH2CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
6-134 Ac H CH2-(4-CH2CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
6-135 H H CH2-(4-CH2CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
6-136 Ac H CH2-(4-CH2CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
6-137 H H CH2-(4-CH2CH2CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
6-138 Ac H CH2-(4-CH2CH2CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
6-139 H H CH2-(4-CH2CH2CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
5-140 Ac H CH2-(4-CH2CH2CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
6-141 H H CH2-(4-CH2CH2CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
6-142 Ac H CH2-(4-CH2CH2CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
6-143 H H CH2-1-Pyrd 2-F H H
6-144 Ac H CH2-1-Pyrd 2-F H H
6-145 H H CH2-(2-CO2H-1-Pyrd) 2-F H H
6-146 Ac H CH2-(2-CO2H-1-Pyrd) 2-F H H
6-147 H H CH2-(2-CO2Me-1-Pyrd) 2-F H H
6-148 Ac H CH2-(2-CO2Me-1-Pyrd) 2-F H H
6-149 H H CH2-(2-CO2Et-1-Pyrd) 2-F H H
6-150 Ac H CH2-(2-CO2Et-1-Pyrd) 2-F H H
6-151 H H CH2-(2-CH2CO2H-1-Pyrd) 2-F H H
6-152 Ac H CH2-(2-CH2CO2H-1-Pyrd) 2-F H H
6-153 H H CH2-(2-CH2CO2Me-1-Pyrd) 2-F H H
6-154 Ac H CH2-(2-CH2CO2Me-1-Pyrd) 2-F H H
6-155 H H CH2-(2-CH2CO2Et-1-Pyrd) 2-F H H
6-156 Ac H CH2-(2-CH2CO2Et-1-Pyrd) 2-F H H
6-157 H H CH2-(2-CH2CH2CO2H-1-Pyrd) 2-F H H
6-158 Ac H CH2-(2-CH2CH2CO2H-1-Pyrd) 2-F H H
6-159 H H CH2-(2-CH2CH2CO2Me-1-Pyrd) 2-F H H
6-160 Ac H CH2-(2-CH2CH2CO2Me-1-Pyrd) 2-F H H
6-161 H H CH2-(2-CH2CH2CO2Et-1-Pyrd) 2-F H H
6-162 Ac H CH2-(2-CH2CH2CO2Et-1-Pyrd) 2-F H H
6-163 H H CH2-(2-CH2CH2CH2CO2H-1-Pyrd) 2-F H H
6-164 Ac H CH2-(2-CH2CH2CH2CO2H-1-Pyrd) 2-F H H
6-165 H H CH2-(2-CH2CH2CH2CO2Me-1-Pyrd) 2-F H H
6-166 Ac H CH2-(2-CH2CH2CH2CO2Me-1-Pyrd) 2-F H H
6-167 H H CH2-(2-CH2CH2CH2CO2Et-1-Pyrd) 2-F H H
6-168 Ac H CH2-(2-CH2CH2CH2CO2Et-1-Pyrd) 2-F H H
6-169 H H CH2CH2-1-Pip 2-F H H
6-170 Ac H CH2CH2-1-Pip 2-F H H
6-171 H H CH2CH2-(4-CO2H-1-Pip) 2-F H H
6-172 Ac H CH2CH2-(4-CO2H-1-Pip) 2-F H H
6-173 H H CH2CH2-(4-CO2Me-1-Pip) 2-F H H
6-174 Ac H CH2CH2-(4-CO2Me-1-Pip) 2-F H H
6-175 H H CH2CH2-(4-CO2Et-1-Pip) 2-F H H
6-176 Ac H CH2CH2-(4-CO2Et-1-Pip) 2-F H H
6-177 H H CH2CH2-(4-CH2CO2H-1-Pip) 2-F H H
6-178 Ac H CH2CH2-(4-CH2CO2H-1-Pip) 2-F H H
6-179 H H CH2CH2-(4-CH2CO2Me-1-Pip) 2-F H H
6-180 Ac H CH2CH2-(4-CH2CO2Me-1-Pip) 2-F H H
6-181 H H CH2CH2-(4-CH2CO2Et-1-Pip) 2-F H H
6-182 Ac H CH2CH2-(4-CH2CO2Et-1-Pip) 2-F H H
6-183 H H CH2CH2-(4-CH2CH2CO2H-1-Pip) 2-F H H
6-184 Ac H CH2CH2-(4-CH2CH2CO2H-1-Pip) 2-F H H
6-185 H H CH2CH2-(4-CH2CH2CO2Me-1-Pip) 2-F H H
6-186 Ac H CH2CH2-(4-CH2CH2CO2Me-1-Pip) 2-F H H
6-187 H H CH2CH2-(4-CH2CH2CO2Et-1-Pip) 2-F H H
6-188 Ac H CH2CH2-(4-CH2CH2CO2Et-1-Pip) 2-F H H
6-189 H H CH2CH2-(4-CH2CH2CH2CO2H-1-Pip) 2-F H H
6-190 Ac H CH2CH2-(4-CH2CH2CH2CO2H-1-Pip) 2-F H H
6-191 H H CH2CH2-(4-CH2CH2CH2CO2Me-1-Pip) 2-F H H
6-192 Ac H CH2CH2-(4-CH2CH2CH2CO2Me-1-Pip) 2-F H H
6-193 H H CH2CH2-(4-CH2CH2CH2CO2Et-1-Pip) 2-F H H
6-194 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-1-Pip) 2-F H H
6-195 H H CH2CH2-Mor 2-F H H
6-196 Ac H CH2CH2-Mor 2-F H H
6-197 H H CH2CH2-Thim 2-F H H
6-198 Ac H CH2CH2-Thim 2-F H H
6-199 H H CH2CH2-1-Piz 2-F H H
6-200 Ac H CH2CH2-1-Piz 2-F H H
6-201 H H CH2CH2-(4-Ac-1-Piz) 2-F H H
6-202 Ac H CH2CH2-(4-Ac-1-Piz) 2-F H H
6-203 H H CH2CH2-(4-Ac-1-Piz) 2-F 4-F H
6-204 Ac H CH2CH2-(4-Ac-1-Piz) 2-F 4-F H
6-205 H H CH2CH2-(4-CO2Me-1-Piz) 2-F H H
6-206 Ac H CH2CH2-(4-CO2Me-1-Piz) 2-F H H
6-207 H H CH2CH2-(4-CO2Et-1-Piz) 2-F H H
6-208 Ac H CH2CH2-(4-CO2Et-1-Piz) 2-F H H
6-209 H H CH2CH2-(4-CH2CO2H-1-Piz) 2-F H H
6-210 Ac H CH2CH2-(4-CH2CO2H-1-Piz) 2-F H H
6-211 H H CH2CH2-(4-CH2CO2Me-1-Piz) 2-F H H
6-212 Ac H CH2CH2-(4-CH2CO2Me-1-Piz) 2-F H H
6-213 H H CH2CH2-(4-CH2CO2Et-1-Piz) 2-F H H
6-214 Ac H CH2CH2-(4-CH2CO2Et-1-Piz) 2-F H H
6-215 H H CH2CH2-(4-CH2CH2CO2H-1-Piz) 2-F H H
6-216 Ac H CH2CH2-(4-CH2CH2CO2H-1-Piz) 2-F H H
6-217 H H CH2CH2-(4-CH2CH2CO2Me-1-Piz) 2-F H H
6-218 Ac H CH2CH2-(4-CH2CH2CO2Me-1-Piz) 2-F H H
6-219 H H CH2CH2-(4-CH2CH2CO2Et-1-Piz) 2-F H H
6-220 Ac H CH2CH2-(4-CH2CH2CO2Et-1-Piz) 2-F H H
6-221 H H CH2CH2-(4-CH2CH2CH2CO2H-1-Piz) 2-F H H
6-222 Ac H CH2CH2-(4-CH2CH2CH2CO2H-1-Piz) 2-F H H
6-223 H H CH2CH2-(4-CH2CH2CH2CO2Me-1-Piz) 2-F H H
6-224 Ac H CH2CH2-(4-CH2CH2CH2CO2Me-1-Piz) 2-F H H
6-225 H H CH2CH2-(4-CH2CH2CH2CO2Et-1-Piz) 2-F H H
6-226 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-1-Piz) 2-F H H
6-227 H H CH2CH2-(2-оксо-1-Piz) 2-F H H
6-228 Ac H CH2CH2-(2-оксо-1-Piz) 2-F H H
6-229 H H CH2CH2-(4-Ac-2-оксо-1-Piz) 2-F H H
6-230 Ac H CH2CH2-(4-Ac-2-оксо-1-Piz) 2-F H H
6-231 H H CH2CH2-(4-Ac-2-оксо-1-Piz) 2-F 4-F H
6-232 Ac H CH2CH2-(4-Ac-2-оксо-1-Piz) 2-F 4-F H
6-233 H H CH2CH2-(4-CO2Me-2-оксо-1-Piz) 2-F H H
6-234 Ac H CH2CH2-(4-CO2Me-2-оксо-1-Piz) 2-F H H
6-235 H H CH2CH2-(4-CO2Et-2-оксо-1-Piz) 2-F H H
6-236 Ac H CH2CH2-(4-CO2Et-2-оксо-1-Piz) 2-F H H
6-237 H H CH2CH2-(4-CH2CO2H-2-оксо-1-Piz) 2-F H H
6-238 Ac H CH2CH2-(4-CH2CO2H-2-оксо-1-Piz) 2-F H H
6-239 H H CH2CH2-(4-CH2CO2Me-2-оксо-1-Piz) 2-F H H
6-240 Ac H CH2CH2-(4-CH2CO2Me-2-оксо-1-Piz) 2-F H H
6-241 H H CH2CH2-(4-CH2CO2Et-2-оксо-1-Piz) 2-F H H
6-242 Ac H CH2CH2-(4-CH2CO2Et-2-оксо-1-Piz) 2-F H H
6-243 H H CH2CH2-(4-CH2CH2CO2H-2-оксо-1-Piz) 2-F H H
6-244 Ac H CH2CH2-(4-CH2CH2CO2H-2-оксо-1-Piz) 2-F H H
6-245 H H CH2CH2-(4-CH2CH2CO2Me-2-оксо-1-Piz) 2-F H H
6-246 Ac H CH2CH2-(4-CH2CH2CO2Me-2-оксо-1-Piz) 2-F H H
6-247 H H CH2CH2-(4-CH2CH2CO2Et-2-оксо-1-Piz) 2-F H H
6-248 Ac H CH2CH2-(4-CH2CH2CO2Et-2-оксо-1-Piz) 2-F H H
6-249 H H CH2CH2-(4-CH2CH2CH2CO2H-2-оксо-1-Piz) 2-F H H
6-250 Ac H CH2CH2-(4-CH2CH2CH2CO2H-2-оксо-1-Piz) 2-F H H
6-251 H H CH2CH2-(4-CH2CH2CH2CO2Me-2-оксо-1-Piz) 2-F H H
6-252 Ac H CH2CH2-(4-CH2CH2CH2CO2Me-2-оксо-1-Piz) 2-F H H
6-253 H H CH2CH2-(4-CH2CH2CH2CO2Et-2-оксо-1-Piz) 2-F H H
6-254 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-2-оксо-1-Piz) 2-F H H
6-255 H H CH2CH2-(3-оксо-1-Piz) 2-F H H
6-256 Ac H CH2CH2-(3-оксо-1-Piz) 2-F H H
6-257 H H CH2CH2-(4-Ac-3-оксо-1-Piz) 2-F H H
6-258 Ac H CH2CH2-(4-Ac-3-оксо-1-Piz) 2-F H H
6-259 H H CH2CH2-(4-Ac-3-оксо-1-Piz) 2-F 4-F H
6-260 Ac H CH2CH2-(4-Ac-3-оксо-1-Piz) 2-F 4-F H
6-261 H H CH2CH2-(4-CO2Me-3-оксо-1-Piz) 2-F H H
6-262 Ac H CH2CH2-(4-CO2Me-3-оксо-1-Piz) 2-F H H
6-263 H H CH2CH2-(4-CO2Et-3-оксо-1-Piz) 2-F H H
6-264 Ac H CH2CH2-(4-CO2Et-3-оксо-1-Piz) 2-F H H
6-265 H H CH2CH2-(4-CH2CO2H-3-оксо-1-Piz) 2-F H H
6-266 Ac H CH2CH2-(4-CH2CO2H-3-оксо-1-Piz) 2-F H H
6-267 H H CH2CH2-(4-CH2CO2Me-3-оксо-1-Piz) 2-F H H
6-268 Ac H CH2CH2-(4-CH2CO2Me-3-оксо-1-Piz) 2-F H H
6-269 H H CH2CH2-(4-CH2CO2Et-3-оксо-1-Piz) 2-F H H
6-270 Ac H CH2CH2-(4-CH2CO2Et-3-оксо-1-Piz) 2-F H H
6-271 H H CH2CH2-(4-CH2CH2CO2H-3-оксо-1-Piz) 2-F H H
6-272 Ac H CH2CH2-(4-CH2CH2CO2H-3-оксо-1-Piz) 2-F H H
6-273 H H CH2CH2-(4-CH2CH2CO2Me-3-оксо-1-Piz) 2-F H H
6-274 Ac H CH2CH2-(4-CH2CH2CO2Me-3-оксо-1-Piz) 2-F H H
6-275 H H CH2CH2-(4-CH2CH2CO2Et-3-оксо-1-Piz) 2-F H H
6-276 Ac H CH2CH2-(4-CH2CH2CO2Et-3-оксо-1-Piz) 2-F H H
6-277 H H CH2CH2-(4-CH2CH2CH2CO2H-3-оксо-1-Piz) 2-F H H
6-278 Ac H CH2CH2-(4-CH2CH2CH2CO2H-3-оксо-1-Piz) 2-F H H
6-279 H H CH2CH2-(4-CH2CH2CH2CO2Me-3-оксо-1-Piz) 2-F H H
6-280 Ac H CH2CH2-(4-CH2CH2CH2CO2Me-3-оксо-1-Piz) 2-F H H
6-281 H H CH2CH2-(4-CH2CH2CH2CO2Et-3-оксо-1-Piz) 2-F H H
6-282 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-3-оксо-1-Piz) 2-F H H
6-283 H H CH2CH2-(2,5-диоксо-1-Piz) 2-F H H
6-284 Ac H CH2CH2-(2,5-диоксо-1-Piz) 2-F H H
6-285 H H CH2CH2-(4-Ac-2,5-диоксо-1-Piz) 2-F H H
6-286 Ac H CH2CH2-(4-Ac-2,5-диоксо-1-Piz) 2-F H H
6-287 H H CH2CH2-(4-Ac-2,5-диоксо-1-Piz) 2-F 4-F H
6-288 Ac H CH2CH2-(4-Ac-2,5-диоксо-1-Piz) 2-F 4-F H
6-289 H H CH2CH2-(4-CO2Me-2,5-диоксо-1-Piz) 2-F H H
6-290 Ac H CH2CH2-(4-CO2Me-2,5-диоксо-1-Piz) 2-F H H
6-291 H H CH2CH2-(4-CO2Et-2,5-диоксо-1-Piz) 2-F H H
6-292 Ac H CH2CH2-(4-CO2Et-2,5-диоксо-1-Piz) 2-F H H
6-293 H H CH2CH2-(4-CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
6-294 Ac H CH2CH2-(4-CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
6-295 H H CH2CH2-(4-CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
6-296 Ac H CH2CH2-(4-CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
6-297 H H CH2CH2-(4-CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
6-298 Ac H CH2CH2-(4-CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
6-299 H H CH2CH2-(4-CH2CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
6-300 Ac H CH2CH2-(4-CH2CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
6-301 H H CH2CH2-(4-CH2CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
6-302 Ac H CH2CH2-(4-CH2CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
6-303 H H CH2CH2-(4-CH2CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
6-304 Ac H CH2CH2-(4-CH2CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
6-305 H H CH2CH2-(4-CH2CH2CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
6-306 Ac H CH2CH2-(4-CH2CH2CH2CO2H-2,5-диоксо-1-Piz) 2-F H H
6-307 H H CH2CH2-(4-CH2CH2CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
6-308 Ac H CH2CH2-(4-CH2CH2CH2CO2Me-2,5-диоксо-1-Piz) 2-F H H
6-309 H H CH2CH2-(4-CH2CH2CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
6-310 Ac H CH2CH2-(4-CH2CH2CH2CO2Et-2,5-диоксо-1-Piz) 2-F H H
6-311 H H CH2CH2-1-Pyrd 2-F H H
6-312 Ac H CH2CH2-1-Pyrd 2-F H H
6-313 H H CH2CH2-(2-CO2H-1-Pyrd) 2-F H H
6-314 Ac H CH2CH2-(2-CO2H-1-Pyrd) 2-F H H
6-315 H H CH2CH2-(2-CO2Me-1-Pyrd) 2-F H H
6-316 Ac H CH2CH2-(2-CO2Me-1-Pyrd) 2-F H H
6-317 H H CH2CH2-(2-CO2Et-1-Pyrd) 2-F H H
6-318 Ac H CH2CH2-(2-CO2Et-1-Pyrd) 2-F H H
6-319 H H CH2CH2-(2-CH2CO2H-1-Pyrd) 2-F H H
6-320 Ac H CH2CH2-(2-CH2CO2H-1-Pyrd) 2-F H H
6-321 H H CH2CH2-(2-CH2CO2Me-1-Pyrd) 2-F H H
6-322 Ac H CH2CH2-(2-CH2CO2Me-1-Pyrd) 2-F H H
6-323 H H CH2CH2-(2-CH2CO2Et-1-Pyrd) 2-F H H
6-324 Ac H CH2CH2-(2-CH2CO2Et-1-Pyrd) 2-F H H
6-325 H H CH2CH2-(2-CH2CH2CO2H-1-Pyrd) 2-F H H
6-326 Ac H CH2CH2-(2-CH2CH2CO2H-1-Pyrd) 2-F H H
6-327 H H CH2CH2-(2-CH2CH2CO2Me-1-Pyrd) 2-F H H
6-328 Ac H CH2CH2-(2-CH2CH2CO2Me-1-Pyrd) 2-F H H
6-329 H H CH2CH2-(2-CH2CH2CO2Et-1-Pyrd) 2-F H H
6-330 Ac H CH2CH2-(2-CH2CH2CO2Et-1-Pyrd) 2-F H H
6-331 H H CH2CH2-(2-CH2CH2CH2CO2H-1-Pyrd) 2-F H H
6-332 Ac H CH2CH2-(2-CH2CH2CH2CO2H-1-Pyrd) 2-F H H
6-333 H H CH2CH2-(2-CH2CH2CH2CO2Me-1-Pyrd) 2-F H H
6-334 Ac H CH2CH2-(2-CH2CH2CH2CO2Me-1-Pyrd) 2-F H H
6-335 H H CH2CH2-(2-CH2CH2CH2CO2Et-1-Pyrd) 2-F H H
6-336 Ac H CH2CH2-(2-CH2CH2CH2CO2Et-1-Pyrd) 2-F H H
6-337 H H CH2-(3-CO2H-1-Pip) 2-F H H
6-338 Ac H CH2-(3-CO2H-1-Pip) 2-F H H
6-339 H H CH2-(3-CO2Me-1-Pip) 2-F H H
6-340 Ac H CH2-(3-CO2Me-1-Pip) 2-F H H
6-341 H H CH2-(3-CO2Et-1-Pip) 2-F H H
6-342 Ac H CH2-(3-CO2Et-1-Pip) 2-F H H
6-343 H H CH2-(3-CH2CO2H-1-Pip) 2-F H H
6-344 Ac H CH2-(3-CH2CO2H-1-Pip) 2-F H H
6-345 H H CH2-(3-CH2CO2Me-1-Pip) 2-F H H
6-346 Ac H CH2-(3-CH2CO2Me-1-Pip) 2-F H H
6-347 H H CH2-(3-CH2CO2Et-1-Pip) 2-F H H
6-348 Ac H CH2-(3-CH2CO2Et-1-Pip) 2-F H H
6-349 H H CH2-(3-CH2CH2CO2H-1-Pip) 2-F H H
6-350 Ac H CH2-(3-CH2CH2CO2H-1-Pip) 2-F H H
6-351 H H CH2-(3-CH2CH2CO2Me-1-Pip) 2-F H H
6-352 Ac H CH2-(3-CH2CH2CO2Me-1-Pip) 2-F H H
6-353 H H CH2-(3-CH2CH2CO2Et-1-Pip) 2-F H H
6-354 Ac H CH2-(3-CH2CH2CO2Et-1-Pip) 2-F H H
6-355 H H CH2-(3-CH2CH2CH2CO2H-1-Pip) 2-F H H
6-356 Ac H CH2-(3-CH2CH2CH2CO2H-1-Pip) 2-F H H
6-357 H H CH2-(3-CH2CH2CH2CO2Me-1-Pip) 2-F H H
6-358 Ac H CH2-(3-CH2CH2CH2CO2Me-1-Pip) 2-F H H
6-359 H H CH2-(3-CH2CH2CH2CO2Et-1-Pip) 2-F H H
6-360 Ac H CH2-(3-CH2CH2CH2CO2Et-1-Pip) 2-F H H
6-361 H H CH2CH2-(3-CO2H-1-Pip) 2-F H H
6-362 Ac H CH2CH2-(3-CO2H-1-Pip) 2-F H H
6-363 H H CH2CH2-(3-CO2Me-1-Pip) 2-F H H
6-364 Ac H CH2CH2-(3-CO2Me-1-Pip) 2-F H H
6-365 H H CH2CH2-(3-CO2Et-1-Pip) 2-F H H
6-366 Ac H CH2CH2-(3-CO2Et-1-Pip) 2-F H H
6-367 H H CH2CH2-(3-CH2CO2H-1-Pip) 2-F H H
6-368 Ac H CH2CH2-(3-CH2CO2H-1-Pip) 2-F H H
6-369 H H CH2CH2-(3-CH2CO2Me-1-Pip) 2-F H H
6-370 Ac H CH2CH2-(3-CH2CO2Me-1-Pip) 2-F H H
6-371 H H CH2CH2-(3-CH2CO2Et-1-Pip) 2-F H H
6-372 Ac H CH2CH2-(3-CH2CO2Et-1-Pip) 2-F H H
6-373 H H CH2CH2-(3-CH2CH2CO2H-1-Pip) 2-F H H
6-374 Ac H CH2CH2-(3-CH2CH2CO2H-1-Pip) 2-F H H
6-375 H H CH2CH2-(3-CH2CH2CO2Me-1-Pip) 2-F H H
6-376 Ac H CH2CH2-(3-CH2CH2CO2Me-1-Pip) 2-F H H
6-377 H H CH2CH2-(3-CH2CH2CO2Et-1-Pip) 2-F H H
6-378 Ac H CH2CH2-(3-CH2CH2CO2Et-1-Pip) 2-F H H
6-379 H H CH2CH2-(3-CH2CH2CH2CO2H-1-Pip) 2-F H H
6-380 Ac H CH2CH2-(3-CH2CH2CH2CO2H-1-Pip) 2-F H H
6-381 H H CH2CH2-(3-CH2CH2CH2CO2Me-1-Pip) 2-F H H
6-382 Ac H CH2CH2-(3-CH2CH2CH2CO2Me-1-Pip) 2-F H H
6-383 H H CH2CH2-(3-CH2CH2CH2CO2Et-1-Pip) 2-F H H
6-384 Ac H CH2CH2-(3-CH2CH2CH2CO2Et-1-Pip) 2-F H H
6-385 H H CH2-(4-OH-2-CO2H-1-Pyrd) 2-F H H
6-386 Ac H CH2-(4-OH-2-CO2H-1-Pyrd) 2-F H H
6-387 H H CH2-(4-OH-2-CO2Me-1-Pyrd) 2-F H H
6-388 Ac H CH2-(4-OH-2-CO2Me-1-Pyrd) 2-F H H
6-389 H H CH2-(4-OH-2-CO2Et-1-Pyrd) 2-F H H
6-390 Ac H CH2-(4-OH-2-CO2Et-1-Pyrd) 2-F H H

Номерами иллюстративных соединений из соединений, полученных замещением циклопропильной группы на метоксигруппу в соединениях, представленных иллюстративными соединениями № от 1-1 до 1-1084, от 2-1 до 2-1084, от 3-1 до 3-79, от 4-1 до 4-79, от 5-1 до 5-390 и от 6-1 до 6-390 в таблицах 1-6, являются, соответственно, от 7-1 до 7-1084, от 8-1 до 8-1084, от 9-1 до 9-79, от 10-1 до 10-79, от 11-1 до 11-390 и от 12-1 до 12-390. Например, соединение, полученное замещением циклопропильной группы метоксигруппой в соединении иллюстративного соединения № 5-103 в таблице 7, представляет собой соединение иллюстративного соединения № 11-103.

В числе вышеуказанных соединений, предпочтительными соединениями являются соединения иллюстративных соединений № 1-1, 1-2, 1-5, 1-6, 1-9, 1-10, 1-13, 1-14, 1-17, 1-18, 1-21, 1-22, 1-25, 1-26, 1-29, 1-30, 1-33, 1-34, 1-37, 1-38, 1-41, 1-42, 1-45, 1-46, 1-49, 1-50, 1-53, 1-54, 1-57, 1-58, 1-61, 1-62, 1-87, 1-88, 1-115, 1-116, 1-121, 1-122, 1-127, 1-128, 1-133, 1-134, 1-139, 1-140, 1-187, 1-188, 1-207, 1-208, 1-209, 1-210, 1-211, 1-212, 1-337, 1-338, 1-351, 1-352, 1-353, 1-354, 1-355, 1-356, 1-443, 1-444, 1-445, 1-446, 1-447, 1-448, 1-485, 1-486, 1-487, 1-488, 1-489, 1-490, 1-491, 1-492, 1-493, 1-494, 1-495, 1-496, 1-497, 1-498, 1-499, 1-500, 1-501, 1-502, 1-503, 1-504, 1-537, 1-538, 1-549, 1-550, 1-585, 1-586, 1-587, 1-588, 1-589, 1-590, 1-591, 1-592, 1-593, 1-594, 1-595, 1-596, 1-597, 1-598, 1-613, 1-614, 1-619, 1-620, 1-637, 1-638, 1-651, 1-652, 1-653, 1-654, 1-655, 1-656, 1-663, 1-664, 1-665, 1-666, 1-667, 1-668, 1-743, 1-744, 1-745, 1-746, 1-747, 1-748, 1-749, 1-750, 1-751, 1-752, 1-753, 1-754, 1-761, 1-762, 1-763, 1-764, 1-765, 1-766, 1-767, 1-768, 1-789, 1-790, 1-813, 1-814, 1-815, 1-816, 1-817, 1-818, 1-819, 1-820, 1-841, 1-842, 1-865, 1-866, 1-879, 1-880, 1-881, 1-882, 1-883, 1-884, 1-885, 1-886, 1-887, 1-888, 1-889, 1-890, 1-965, 1-966, 1-967, 1-968, 1-969, 1-970, 1-971, 1-972, 1-973, 1-974, 1-975, 1-976, 1-977, 1-978, 1-979, 1-980, 1-981, 1-982, 1-983, 1-984, 1-985, 1-986, 1-987, 1-988, 1-989, 1-990, 1-1005, 1-1006, 1-1011, 1-1012, 1-1017, 1-1018, 1-1023, 1-1024, 1-1045, 1-1046, 1-1047, 1-1048, 1-1049, 1-1050, 2-1, 2-2, 2-5, 2-6, 2-9, 2-10, 2-13, 2-14, 2-17, 2-18, 2-21, 2-22, 2-25, 2-26, 2-29, 2-30, 2-33, 2-34, 2-37, 2-38, 2-41, 2-42, 2-45, 2-46, 2-49, 2-50, 2-53, 2-54, 2-57, 2-58, 2-61, 2-62, 2-87, 2-88, 2-115, 2-116, 2-121, 2-122, 2-127, 2-128, 2-133, 2-134, 2-139, 2-140, 2-187, 2-188, 2-207, 2-208, 2-209, 2-210, 2-211, 2-212, 2-337, 2-338, 2-351, 2-352, 2-353, 2-354, 2-355, 2-356, 2-443, 2-444, 2-445, 2-446, 2-447, 2-448, 2-485, 2-486, 2-487, 2-488, 2-489, 2-490, 2-491, 2-492, 2-493, 2-494, 2-495, 2-496, 2-497, 2-498, 2-499, 2-500, 2-501, 2-502, 2-503, 2-504, 2-537, 2-538, 2-549, 2-550, 2-585, 2-586, 2-587, 2-588, 2-589, 2-590, 2-591, 2-592, 2-593, 2-594, 2-595, 2-596, 2-597, 2-598, 2-613, 2-614, 2-619, 2-620, 2-637, 2-638, 2-651, 2-652, 2-653, 2-654, 2-655, 2-656, 2-663, 2-664, 2-665, 2-666, 2-667, 2-668, 2-743, 2-744, 2-745, 2-746, 2-747, 2-748, 2-749, 2-750, 2-751, 2-752, 2-753, 2-754, 2-761, 2-762, 2-763, 2-764, 2-765, 2-766, 2-767, 2-768, 2-789, 2-790, 2-813, 2-814, 2-815, 2-816, 2-817, 2-818, 2-819, 2-820, 2-841, 2-842, 2-865, 2-866, 2-879, 2-880, 2-881, 2-882, 2-883, 2-884, 2-885, 2-886, 2-887, 2-888, 2-889, 2-890, 2-965, 2-966, 2-967, 2-968, 2-969, 2-970, 2-971, 2-972, 2-973, 2-974, 2-975, 2-976, 2-977, 2-978, 2-979, 2-980, 2-981, 2-982, 2-983, 2-984, 2-985, 2-986, 2-987, 2-988, 2-989, 2-990, 2-1005, 2-1006, 2-1011, 2-1012, 2-1017, 2-1018, 2-1023, 2-1024, 2-1045, 2-1046, 2-1047, 2-1048, 2-1049, 2-1050, 3-1, 3-2, 3-5, 3-6, 3-13, 3-14, 3-15, 3-16, 3-17, 3-18, 3-27, 3-28, 3-29, 3-30, 3-31, 3-32, 3-33, 3-34, 3-35, 3-36, 3-37, 3-38, 3-39, 3-46, 3-47, 3-50, 3-51, 3-52, 3-53, 3-54, 3-55, 3-56, 3-57, 3-58, 3-59, 3-60, 3-61, 3-62, 3-63, 3-64, 3-65, 3-66, 3-67, 3-68, 3-69, 3-70, 3-71, 3-72, 3-73, 3-74, 3-75, 3-76, 3-77, 3-78, 3-79, 4-1, 4-2, 4-5, 4-6, 4-13, 4-14, 4-15, 4-16, 4-17, 4-18, 4-27, 4-28, 4-29, 4-30, 4-31, 4-32, 4-33, 4-34, 4-35, 4-36, 4-37, 4-38, 4-39, 4-46, 4-47, 4-50, 4-51, 4-52, 4-53, 4-54, 4-55, 4-56, 4-57, 4-58, 4-59, 4-60, 4-61, 4-62, 4-63, 4-64, 4-65, 4-66, 4-67, 4-68, 4-69, 4-70, 4-71, 4-72, 4-73, 4-74, 4-75, 4-76, 4-77, 4-78, 4-79, 5-1, 5-2, 5-3, 5-4, 5-5, 5-6, 5-7, 5-8, 5-9, 5-10, 5-11, 5-12, 5-13, 5-14, 5-27, 5-28, 5-29, 5-30, 5-31, 5-32, 5-33, 5-34, 5-41, 5-42, 5-43, 5-44, 5-45, 5-46, 5-59, 5-60, 5-61, 5-62, 5-69, 5-70, 5-71, 5-72, 5-73, 5-74, 5-75, 5-76, 5-77, 5-78, 5-79, 5-80, 5-81, 5-82, 5-85, 5-86, 5-87, 5-88, 5-89, 5-90, 5-93, 5-94, 5-95, 5-96, 5-97, 5-98, 5-99, 5-100, 5-101, 5-102, 5-103, 5-104, 5-105, 5-106, 5-107, 5-108, 5-115, 5-116, 5-117, 5-118, 5-125, 5-126, 5-127, 5-128, 5-129, 5-130, 5-131, 5-132, 5-133, 5-134, 5-135, 5-136, 5-143, 5-144, 5-145, 5-146, 5-147, 5-148, 5-149, 5-150, 5-151, 5-152, 5-153, 5-154, 5-155, 5-156, 5-171, 5-172, 5-177, 5-178, 5-209, 5-210, 5-237, 5-238, 5-265, 5-266, 5-293, 5-294, 5-313, 5-314, 5-319, 5-320, 5-337, 5-338, 5-339, 5-340, 5-341, 5-342, 5-343, 5-344, 5-345, 5-346, 5-347, 5-348, 5-361, 5-362, 5-367, 5-368, 5-385, 5-386, 5-387, 5-388, 6-1, 6-2, 6-3, 6-4, 6-5, 6-6, 6-7, 6-8, 6-9, 6-10, 6-11, 6-12, 6-13, 6-14, 6-27, 6-28, 6-29, 6-30, 6-31, 6-32, 6-33, 6-34, 6-41, 6-42, 6-43, 6-44, 6-45, 6-46, 6-59, 6-60, 6-61, 6-62, 6-69, 6-70, 6-71, 6-72, 6-73, 6-74, 6-75, 6-76, 6-77, 6-78, 6-79, 6-80, 6-81, 6-82, 6-85, 6-86, 6-87, 6-88, 6-89, 6-90, 6-93, 6-94, 6-95, 6-96, 6-97, 6-98, 6-99, 6-100, 6-101, 6-102, 6-103, 6-104, 6-105, 6-106, 6-107, 6-108, 6-115, 6-116, 6-117, 6-118, 6-125, 6-126, 6-127, 6-128, 6-129, 6-130, 6-131, 6-132, 6-133, 6-134, 6-135, 6-136, 6-143, 6-144, 6-145, 6-146, 6-147, 6-148, 6-149, 6-150, 6-151, 6-152, 6-153, 6-154, 6-155, 6-156, 6-171, 6-172, 6-177, 6-178, 6-209, 6-210, 6-237, 6-238, 6-265, 6-266, 6-293, 6-294, 6-313, 6-314, 6-319, 6-320, 6-337, 6-338, 6-339, 6-340, 6-341, 6-342, 6-343, 6-344, 6-345, 6-346, 6-347, 6-348, 6-361, 6-362, 6-367, 6-368, 6-385, 6-386, 6-387 и 6-388,

более предпочтительными соединениями являются соединения иллюстративного соединения № 1-1, 1-2, 1-5, 1-6, 1-17, 1-18, 1-21, 1-22, 1-25, 1-26, 1-53, 1-54, 1-207, 1-208, 1-351, 1-352, 1-443, 1-444, 1-485, 1-486, 1-487, 1-488, 1-489, 1-490, 1-491, 1-492, 1-493, 1-494, 1-587, 1-588, 1-589, 1-590, 1-591, 1-592, 1-651, 1-652, 1-743, 1-744, 1-763, 1-764, 1-815, 1-816, 1-967, 1-968, 1-973, 1-974, 1-975, 1-976, 1-977, 1-978, 2-1, 2-2, 2-5, 2-6, 2-17, 2-18, 2-21, 2-22, 2-25, 2-26, 2-53, 2-54, 2-207, 2-208, 2-351, 2-352, 2-443, 2-444, 2-485, 2-486, 2-487, 2-488, 2-489, 2-490, 2-491, 2-492, 2-493, 2-494, 2-587, 2-588, 2-589, 2-590, 2-591, 2-592, 2-651, 2-652, 2-743, 2-744, 2-763, 2-764, 2-815, 2-816, 2-967, 2-968, 2-973, 2-974, 2-975, 2-976, 2-977, 2-978, 3-1, 3-2, 3-13, 3-14, 3-15, 3-16, 3-17, 3-18, 3-27, 3-28, 3-29, 3-30, 3-31, 3-32, 3-50, 3-51, 3-54, 3-55, 3-62, 3-63, 3-66, 3-67, 4-1, 4-2, 4-13, 4-14, 4-15, 4-16, 4-17, 4-18, 4-27, 4-28, 4-29, 4-30, 4-31, 4-32, 4-50, 4-51, 4-54, 4-55, 4-62, 4-63, 4-66, 4-67, 5-3, 5-4, 5-5, 5-6, 5-7, 5-8, 5-9, 5-10, 5-11, 5-12, 5-13, 5-14, 5-27, 5-28, 5-29, 5-30, 5-33, 5-34, 5-69, 5-70, 5-71, 5-72, 5-73, 5-74, 5-75, 5-76, 5-77, 5-78, 5-79, 5-80, 5-81, 5-82, 5-85, 5-86, 5-87, 5-88, 5-89, 5-90, 5-93, 5-94, 5-95, 5-96, 5-97, 5-98, 5-99, 5-100, 5-101, 5-102, 5-103, 5-104, 5-105, 5-106, 5-107, 5-108, 5-145, 5-146, 5-147, 5-148, 5-149, 5-150, 5-151, 5-152, 5-153, 5-154, 5-155, 5-156, 5-337, 5-338, 5-339, 5-340, 5-341, 5-342, 5-343, 5-344, 5-345, 5-346, 5-347, 5-348, 5-387, 5-388, 6-3, 6-4, 6-5, 6-6, 6-7, 6-8, 6-9, 6-10, 6-11, 6-12, 6-13, 6-14, 6-27, 6-28, 6-29, 6-30, 6-33, 6-34, 6-69, 6-70, 6-71, 6-72, 6-73, 6-74, 6-75, 6-76, 6-77, 6-78, 6-79, 6-80, 6-81, 6-82, 6-85, 6-86, 6-87, 6-88, 6-89, 6-90, 6-93, 6-94, 6-95, 6-96, 6-97, 6-98, 6-99, 6-100, 6-101, 6-102, 6-103, 6-104, 6-105, 6-106, 6-107, 6-108, 6-145, 6-146, 6-147, 6-148, 6-149, 6-150, 6-151, 6-152, 6-153, 6-154, 6-155, 6-156, 6-337, 6-338, 6-339, 6-340, 6-341, 6-342, 6-343, 6-344, 6-345, 6-346, 6-347, 6-348, 6-387 и 6-388,

еще более предпочтительными соединениями являются соединения иллюстративных соединений № 1-17, 1-18, 1-53, 1-54, 1-487, 1-488, 1-489, 1-490, 1-491, 1-492, 1-587, 1-588, 1-589, 1-590, 1-591, 1-592, 1-973, 1-974, 2-17, 2-18, 2-53, 2-54, 2-487, 2-488, 2-489, 2-490, 2-491, 2-492, 2-587, 2-588, 2-589, 2-590, 2-591, 2-592, 2-973, 2-974, 3-1, 3-2, 3-13, 3-14, 3-31, 3-32, 3-50, 3-51, 3-54, 3-55, 3-62, 3-63, 3-66, 3-67, 4-1, 4-2, 4-13, 4-14, 4-31, 4-32, 4-50, 4-51, 4-54, 4-55, 4-62, 4-63, 4-66, 4-67, 5-3, 5-4, 5-5, 5-6, 5-7, 5-8, 5-75, 5-76, 5-77, 5-78, 5-79, 5-80, 5-81, 5-82, 5-89, 5-90, 5-93, 5-94, 5-95, 5-96, 5-97, 5-98, 5-99, 5-100, 5-101, 5-102, 5-103, 5-104, 5-105, 5-106, 5-107, 5-108, 5-145, 5-146, 5-147, 5-148, 5-149, 5-150, 5-151, 5-152, 5-153, 5-154, 5-155, 5-156, 5-337, 5-338, 5-339, 5-340, 5-341, 5-342, 5-387, 5-388, 6-3, 6-4, 6-5, 6-6, 6-7, 6-8, 6-75, 6-76, 6-77, 6-78, 6-79, 6-80, 6-81, 6-82, 6-89, 6-90, 6-93, 6-94, 6-95, 6-96, 6-97, 6-98, 6-99, 6-100, 6-101, 6-102, 6-103, 6-104, 6-105, 6-106, 6-107, 6-108, 6-145, 6-146, 6-147, 6-148, 6-149, 6-150, 6-151, 6-152, 6-153, 6-154, 6-155, 6-156, 6-337, 6-338, 6-339, 6-340, 6-341, 6-342, 6-387 и 6-388, и

наиболее предпочтительными соединениями являются

Иллюстративное соединение № 1-17:

(E)-3-[2-(4-карбокси-1H-пиразол-1-ил)этилиден]-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидин,

Иллюстративное соединение № 1-53:

(E)-3-{2-[4-(карбоксиметил)-1H-пиразол-1-ил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидин,

Иллюстративное соединение № 1-487:

(E)-3-[2-(4-карбокси-1H-1,2,3-триазол-1-ил)этилиден]-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидин,

Иллюстративное соединение № 1-587:

(E)-3-[2-(4-карбокси-2H-1,2,3-триазол-2-ил)этилиден]-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидин

Иллюстративное соединение № 1-973:

(E)-3-{[2-(4-карбокси-1H-пиразол-1-ил)-1-метил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидин,

Иллюстративное соединение № 3-1:

(E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-гидроксиэтилиден)-4-сульфанилпиперидин,

Иллюстративное соединение № 3-13:

(E)-3-(2-карбоксиэтилиден)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидин,

Иллюстративное соединение № 3-31:

(E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{[1-(этоксикарбонилметил)пиперидин-4-ил]метилиден}-4-сульфанилпиперидин,

Иллюстративное соединение № 3-50:

(E)-3-{2-[N-(карбоксиметил)-N-метиламино]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидин,

Иллюстративное соединение № 3-54:

(E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[N-(этоксикарбонилметил)-N-метиламино]этилиден}-4-сульфанилпиперидин,

Иллюстративное соединение № 3-62:

(E)-3-(2-{N-[3-(карбокси)пропил]-N-метиламино}этилиден)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидин,

Иллюстративное соединение № 3-66:

(E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{N-[3-(этоксикарбонил)пропил]-N-метиламино}этилиден)-4-сульфанилпиперидин,

Иллюстративное соединение № 5-3:

(E)-3-{2-[4-(карбоксипиперидин)-1-ил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидин,

Иллюстративное соединение № 5-7:

(E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонил)пиперидин-1-ил]этилиден}-4-сульфанилпиперидин,

Иллюстративное соединение № 5-75:

(E)-3-(2-{4-[2-(карбоксиэтил)]-2-оксопиперазин-1-ил}этилиден)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидин,

Иллюстративное соединение № 5-79:

(E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{4-[2-(этоксикарбонил)этил]-2-оксопиперазин-1-ил}этилиден)-4-сульфанилпиперидин,

Иллюстративное соединение № 5-81:

(E)-3-(2-{4-[3-(карбоксипропил)]-2-оксопиперазин-1-ил}этилиден)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидин,

Иллюстративное соединение № 5-97:

(E)-3-{2-[4-(карбоксиметил)-3-оксопиперазин-1-ил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидин,

Иллюстративное соединение № 5-101:

(E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонилметил)-3-оксопиперазин-1-ил]этилиден}-4-сульфанилпиперидин,

Иллюстративное соединение № 5-103:

(E)-3-(2-{4-[2-(карбоксиэтил)]-3-оксопиперазин-1-ил}этилиден)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидин,

Иллюстративное соединение № 5-105:

(E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{4-[2-(метоксикарбонил)этил]-3-оксопиперазин-1-ил}этилиден)-4-сульфанилпиперидин,

Иллюстративное соединение № 5-107:

(E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{4-[2-(этоксикарбонил)этил]-3-оксопиперазин-1-ил}этилиден)-4-сульфанилпиперидин,

Иллюстративное соединение № 5-147:

(E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[(2S)-(метоксикарбонил)пирролидин-1-ил]этилиден}-4-сульфанилпиперидин,

Иллюстративное соединение № 5-151:

(E)-3-{2-[(2S)-(карбоксиметил)пирролидин-1-ил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидин,

Иллюстративное соединение № 5-153:

(E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[(2S)-(метоксикарбонилметил)пирролидин-1-ил]этилиден}-4-сульфанилпиперидин,

Иллюстративное соединение № 5-337:

(E)-3-{2-[3-(карбоксипиперидин)-1-ил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидин,

Иллюстративное соединение № 5-387:

(E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[(2S,4R)-4-гидрокси-2-(метоксикарбонил)пирролидин-1-ил]этилиден}-4-сульфанилпиперидин, и

их S-ацетил производные (соединение №: 1-18, 1-54, 1-488, 1-588, 1-974, 3-2, 3-14, 3-32, 3-51, 3-55, 3-63, 3-67, 5-4, 5-8, 5-76, 5-80, 5-82, 5-98, 5-102, 5-104, 5-106, 5-108, 5-148, 5-152, 5-154, 5-338 и 5-388) или их геометрические изомеры ((Z)-изомеры, соединение №: 2-17, 2-18, 2-53, 2-54, 2-487, 2-488, 2-587, 2-588, 2-973, 2-974, 4-1, 4-2, 4-13, 4-14, 4-31, 4-32, 4-50, 4-51, 4-54, 4-55, 4-62, 4-63, 4-66, 4-67, 6-3, 6-4, 6-7, 6-8, 6-75, 6-76, 6-79, 6-80, 6-81, 6-82, 6-97, 6-98, 6-101, 6-102, 6-103, 6-104, 6-105, 6-106, 6-107, 6-108, 6-147, 6-148, 6-151, 6-152, 6-153, 6-154, 6-337, 6-338, 6-387 и 6-388).

Положительный эффект изобретения

Соединения по настоящему изобретению являются химически стабильными и оказывают превосходное антикоагулянтное действия на тромбоциты и проявляют ингибирующую активность в отношении тромбообразования. Кроме того, соединения по настоящему изобретению оказывают указанное действие с небольшими временными задержками и демонстрируют низкую токсичность. Таким образом, соединения по настоящему изобретению могут применяться при профилактике, предотвращении рецидива и при терапевтических воздействиях (особенно последнее) заболеваний, вызванных активацией тромбоцитов, таких как тромбообразование и коагуляция тромбоцитов, и для снижения ответной реакции тромбоцитов, например, при чрезкожных вмешательствах на коронарных артериях (PCI), ангиопластике, эндартерэктомии, при рестенозе после установки стента; острой ишемической болезни, стабильной или нестабильной стенокардии, инфаркте миокарда, мерцании предсердий, церебральном ишемическом инсульте, церебральном инфаркте и атеросклерозе и заболеваниях, вызванных тромбообразованием или образованием эмбола, которые связаны с сахарным диабетом, заболевании периферических артерий, гепарин-вызываемой тромбоцитопении (HIT), тромботической тромбоцитопенической пурпуре (TTP), антифосфолипидном синдроме, венозном тромбозе и пиемии.

Наилучший вариант осуществления изобретения

Соединение (I) по настоящему изобретению может быть получено описанным ниже способом A или способом B.

В вышеуказанной схеме R1-R3 и X1-X5 имеют такие же значения, как определено выше; R2a и R3a представляют собой описанные выше R2 и R3 или группу, с помощью которой аминогруппа или гидроксильная группа в R2 и R3, если необходимо, может быть защищена защитной для аминогруппы или гидроксильной группы группой; Pro1 представляет собой защитную группу для сульфанильной группы; и Lv представляет собой уходящую группу.

Защитная группа для сульфанильной группы, представленная Pro1, может быть такой же группой, которая описана как защитная группа для сульфанильной группы вышеописанного «пролекарства» и представляет собой, предпочтительно, ацетильную группу.

Для защитной группы для аминогруппы R2a и R3a не имеется особых ограничений, при условии, что она обычно может защищать аминогруппу в химических реакциях, и, в частности, обозначает защитную группу, которая может быть отделена химическим способом, таким как гидрогенолиз, гидролиз, электролиз и фотолиз. Такой защитной группой может быть, например, вышеуказанная «алифатическая ацильная группа»; вышеуказанная «ароматическая ацильная группа»; вышеуказанная «алкоксикарбонильная группа»; вышеуказанная «аралкилоксикарбонильная группа»; вышеуказанная «силильная группа»; вышеуказанная «аралкильная группа»; «замещенная метиленовая группа», которая может образовать основание Шиффа, такая как N,N-диметиламинометиленовая, бензилиденовая, 4-метоксибензилиденовая, 4-нитробензилиденовая, салицилиденовая, 5-хлорсалицилиденовая, дифенилметиленовая или (5-хлор-2-гидроксифенил)фенилметиленовая группа; «ароматическая сульфонильная группа», состоящая из: арилсульфонильной группы, такой как бензолсульфонильная группа, и арилсульфонильной группы, замещенной низшим алкилом или низшей алкокси группой(ами), такая как п-толуолсульфонильная, пентаметилбензолсульфонильная, п-метоксибензолсульфонильная, 2,4,6-триметоксибензолсульфонильная или 3-метокси-4-трет-бутилбензолсульфонильная группа; и «алифатическая сульфонильная группа», включая алкилсульфонильную группу, такую как метансульфонильная или трет-бутилсульфонильная группа, и алкилсульфонильную группу, замещенную атомом(ами) галогена, силильной(ыми) группой(ы) или арильной(ыми) группой(ы), такую как трифторметилсульфонильная, трисилилэтансульфонильная или бензилсульфонильная группа.

Для защитной группы для гидроксильной группы R2a и R3a не имеется особых ограничений, при условии, что она обычно может защищать гидроксильную группу в химических реакциях, и, в частности, обозначает защитную группу, которая может быть отделена химическим способом, таким как гидрирование, гидролиз, электролиз и фотолиз. Такой защитной группой может быть, например, вышеуказанная «алифатическая ацильная группа»; вышеуказанная «ароматическая ацильная группа»; вышеуказанная «карбонилоксиалкильная группа»; вышеуказанная «остаточная группа полуэфира соли янтарной кислоты»; вышеуказанная «остаточная группа эфира соли фосфорной кислоты»; вышеуказанная «остаточная группа, образующая эфир аминокислоты»; карбамоильная группа; карбамоильная группа, замещенная 1 или 2 низшими алкильными группами; вышеуказанная «карбонилоксиалкилоксикарбонильная группа»; или вышеуказанная «силильная группа», и представляет собой, предпочтительно, группу, которая образует фармацевтически приемлемый сложный эфир, такую как «алифатическая ацильная группа», «ароматическая ацильная группа» или «силильная группа», более предпочтительно, «C1-C6 алканоильная группа», такая как ацетильная, пропионильная, бутирильная, изобутирильная, пентаноильная или пивалоильная группа или «силильная группа», такая как трет-бутилдиметилсилильная или трет-бутилдифенилсилильная группа, и, особенно предпочтительно, ацетильная группа, трет-бутилдиметилсилильная группа или трет-бутилдифенилсилильная группа.

Для удаляемой группа Lv не имеется особых ограничений, при условии, что эта группа является функциональной группой, которая позволяет осуществить реакцию замещения путем взаимодействия с нуклеофильным заместителем, и может представлять собой, например, вышеуказанный «атом галогена»; «низшую алкилсульфонилоксигруппу», такую как метансульфонилокси или этансульфонилоксигруппу; «галогенированную низшую алкилсульфонилоксигруппу», такую как трифторметансульфонилоксигруппу; или «ароматическую сульфонилоксигруппу» включая арилсульфонилоксигруппу, такую как бензолсульфонилоксигруппа, низшая алкилированная арилсульфонилоксигруппа, такая как п-толуолсульфонилоксигруппа, галогенированную арилсульфонилоксигруппу, такую как п-хлорбензолсульфонилоксигруппа и нитрированную арилсульфонилоксигруппу, такую как п-нитробензолсульфонилоксигруппа.

Каждая стадия способа A и способа B подробно описана ниже.

(Способ A)

Способ A представляет собой стадию получения соединения (I) путем проведения реакции нуклеофильного замещения в присутствии основания, используя соединение (II), полученное способом C, и соединение (III), которое хорошо известно или легко получить из известных соединений (A-1). Кроме того, при необходимости, некоторые реакции, такие как удаление защитной группы у сульфанильной группы (A-2), введение заместителя в сульфанильную группу (A-3), гидролиз группы сложного эфира (A-4), преобразование карбоксигруппы в амидную группу (A-5), преобразование карбоксигруппы в группу сложного эфира (A-6), удаление защитной группы у аминогруппы (A-7), преобразование карбоксигруппы в гидроксиаминогруппу (A-8) и преобразование группы R3a, включая гидроксильную группу, в группу R3 (A-9), также могут быть выполнены. Стадии A-2-A-9 могут быть осуществлены или до или после стадии A-1, и порядок проведения этих стадий может быть легко выбран, в зависимости от обстоятельств, специалистом, имеющим обычный уровень знаний в данной области.

(A-1)

Используемым растворителем может быть, например, ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; простой эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля; кетон, такой как ацетон, метилэтилкетон, метилизобутилкетон, изофорон или циклогексанон; нитрил, такой как ацетонитрил или изобутиронитрил; амид, такой как формамид, N,N-диметилформамид, N,N-диметилацетамид, N-метил-2-пирролидинон или триамид гексаметилфосфора; или сульфоксид, такой как диметилсульфоксид или сульфолан, и он представляет собой, предпочтительно, галогенированный углеводород, нитрил или амид, и, более предпочтительно, N,N-диметилформамид, N,N-диметилацетамид, ацетонитрил или дихлорметан.

Используемым основанием может быть, например, неорганическое основание, включая карбонат щелочного металла, такой как карбонат натрия, карбонат калия или карбонат лития; гидрокарбонат щелочного металла, такой как гидрокарбонат натрия, гидрокарбонат калия или гидрокарбонат лития; гидрид щелочного металла, такой как гидрид лития, гидрид натрия или гидрид калия; гидроксид щелочного металла, такой как гидроксид натрия, гидроксид калия или гидроксид лития; и фторид щелочного металла, такой как фторид натрия или фторид калия; алкоксид щелочного металла, такой как метоксид натрия, этоксид натрия, метоксид калия, этоксид калия, трет-бутоксид калия или метоксид лития; меркаптан щелочного металла, такой как метилмеркаптан натрия или этилмеркаптан натрия; или органическое основание, такое как N-метилморфолин, триэтиламин, трипропиламин, трибутиламин, диизопропилэтиламин, дициклогексиламин, N-метилпиперидин, пиридин, 4-пирролидинопиридин, пиколин, 4-(N,N-диметиламино)пиридин, 2,6-ди(трет-бутил)-4-метилпиридин, хинолин, N,N-диметиланилин, N,N-диэтиланилин, 1,5-диазабицикло[4,3,0]нон-5-ен (DBN), 1,4-диазабицикло[2,2,2]октан (DABCO) или 1,8-диазабицикло[5,4,0]ундец-7-ен (DBU), и представляет собой, предпочтительно, карбонат щелочного металла или органическое основание, и, более предпочтительно, карбонат калия или триэтиламин.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -50°C и 100°C, и, предпочтительно, между 0°C и 50°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 30 минут до 48 часов, и, предпочтительно, от 1 часа до 24 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

(A-2)

Эта стадия представляет собой стадию удаления защитной группы у сульфанильной группы и может легко быть осуществлена в соответствии со способами, хорошо известными специалисту в данной области (например, способ, описанный в Protective Groups in Organic Synthesis, Third Edition, T. W. Green, et al., John Wiley & Sons, Inc. (1999)), и, предпочтительно, выполняется способом удаления защитной группы в присутствии кислоты (A-2a) или способом удаления защитной группы в присутствии основания (A-2b).

(A-2a)

Используемым растворителем может быть, например, ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; сложный эфир, такой как этилформиат, этилацетат, пропилацетат, бутилацетат или диэтилкарбонат; простой эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля; спирт, такой как метанол, этанол, н-пропанол, изопропанол, н-бутанол, изобутанол, трет-бутанол, изоамиловый спирт, диэтиленгликоль, глицерин, октанол, циклогексанол или 2-метоксиэтанол; амид, такой как формамид, N,N-диметилформамид, N,N-диметилацетамид, N-метил-2-пирролидинон или триамид гексаметилфосфора; сульфоксид, такой как диметилсульфоксид или сульфолан; или смесь вышеуказанных растворителей, и представляет собой, предпочтительно, спирт или смешанный растворитель, состоящий из галогенированного углеводорода и спирта, и, более предпочтительно, метанол, этанол или смешанный растворитель, состоящий из дихлорметана и метанола или этанола.

Для используемой кислоты не имеется конкретных ограничений, при условии, что она может быть использована в основных реакциях, и она может представлять собой, предпочтительно, неорганическую кислоту, такую как соляная кислота, хлористый водород, бромистоводородная кислота, серная кислота, перхлорная кислота или фосфорная кислота; или органическую кислоту, такую как уксусная кислота, муравьиная кислота, щавелевая кислота, метансульфоновая кислота, п-толуолсульфоновая кислота, камфорсульфоновая кислота, трифторуксусная кислота или трифторметансульфоновая кислота, и она представляет собой, предпочтительно, неорганическую кислоту и, более предпочтительно, хлористый водород или соляную кислоту.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -50°C и 100°C, и, предпочтительно, между 0°C и 50°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 30 минут до 48 часов, и, предпочтительно, от 1 часа до 24 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси; добавлением к смеси органического растворителя, не смешивающегося с водой, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

(A-2b)

Используемым растворителем может быть, например, ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; простой эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля; спирт, такой как метанол, этанол, н-пропанол, изопропанол, н-бутанол, изобутанол, трет-бутанол, изоамиловый спирт, диэтиленгликоль, глицерин, октанол, циклогексанол или 2-метоксиэтанол; амид, такой как формамид, N,N-диметилформамид, N,N-диметилацетамид, N-метил-2-пирролидинон или триамид гексаметилфосфора; сульфоксид, такой как диметилсульфоксид или сульфолан; вода; или смесь вышеуказанных растворителей, и представляет собой, предпочтительно, спирт или смешанный растворитель, состоящий из спирта и воды, и, более предпочтительно, метанол, этанол, метанол, содержащий воду или этанол, содержащий воду.

Используемым основанием может быть, например, неорганическое основание, включая карбонат щелочного металла, такой как карбонат натрия, карбонат калия или карбонат лития; гидрокарбонат щелочного металла, такой как гидрокарбонат натрия, гидрокарбонат калия или гидрокарбонат лития; гидрид щелочного металла, такой как гидрид лития, гидрид натрия или гидрид калия; гидроксид щелочного металла, такой как гидроксид натрия, гидроксид калия или гидроксид лития; и фторид щелочного металла, такой как фторид натрия или фторид калия; алкоксид щелочного металла, такой как метоксид натрия, этоксид натрия, метоксид калия, этоксид калия, трет-бутоксид калия или метоксид лития; меркаптан щелочного металла, такой как метилмеркаптан натрия или этилмеркаптан натрия; или органическое основание, такое как N-метилморфолин, триэтиламин, трипропиламин, трибутиламин, диизопропилэтиламин, дициклогексиламин, N-метилпиперидин, пиридин, 4-пирролидинопиридин, пиколин, 4-(N,N-диметиламино)пиридин, 2,6-ди(трет-бутил)-4-метилпиридин, хинолин, N,N-диметиланилин, N,N-диэтиланилин, 1,5-диазабицикло[4,3,0]нон-5-ен (DBN), 1,4-диазабицикло[2,2,2]октан (DABCO) или 1,8-диазабицикло[5,4,0]ундец-7-ен (DBU), и оно представляет собой, предпочтительно, карбонат щелочного металла или гидроксид щелочного металла, и, более предпочтительно, карбонат калия или гидроксид натрия.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -50°C и 100°C, и, предпочтительно, между -20°C и 50°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 1 минуты до 24 часов, и, предпочтительно, от 5 минут до 5 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или тому подобным способом, и затем упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

(A-3)

Эта стадия представляет собой стадию введения заместителя в сульфанильную группу в присутствии основания или тому подобное. Когда в качестве реагента используют хлорангидрид кислоты, ангидрид кислоты, сульфанил галогенид или активный сложный эфир, эту стадию осуществляют в присутствии основания (A-3a), когда используют карбоновую кислоту, эту стадию осуществляют в присутствии конденсирующего агента (A-3b), и когда используют тиол, эту стадию осуществляют в присутствии йода или основания (A-3c).

(A-3a)

Используемым растворителем может быть, например, ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; сложный эфир, такой как этилформиат, этилацетат, пропилацетат, бутилацетат или диэтилкарбонат; простой эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля; кетон, такой как ацетон, метилэтилкетон, метилизобутилкетон, изофорон или циклогексанон; амид, такой как формамид, N,N-диметилформамид, N,N-диметилацетамид, N-метил-2-пирролидинон или триамид гексаметилфосфора; или сульфоксид, такой как диметилсульфоксид или сульфолан, и представляет собой, предпочтительно, галогенированный углеводород, кетон или амид, и, более предпочтительно, N,N-диметилформамид, N,N-диметилацетамид, дихлорметан или ацетон.

Используемым основанием может быть, например, неорганическое основание, включая карбонат щелочного металла, такой как карбонат натрия, карбонат калия или карбонат лития; гидрокарбонат щелочного металла, такой как гидрокарбонат натрия, гидрокарбонат калия или гидрокарбонат лития; гидрид щелочного металла, такой как гидрид лития, гидрид натрия или гидрид калия; гидроксид щелочного металла, такой как гидроксид натрия, гидроксид калия или гидроксид лития; и фторид щелочного металла, такой как фторид натрия или фторид калия; алкоксид щелочного металла, такой как метоксид натрия, этоксид натрия, метоксид калия, этоксид калия, трет-бутоксид калия или метоксид лития; меркаптан щелочного металла, такой как метилмеркаптан натрия или этилмеркаптан натрия; или органическое основание, такое как N-метилморфолин, триэтиламин, трипропиламин, трибутиламин, диизопропилэтиламин, дициклогексиламин, N-метилпиперидин, пиридин, 4-пирролидинопиридин, пиколин, 4-(N,N-диметиламино)пиридин, 2,6-ди(трет-бутил)-4-метилпиридин, хинолин, N,N-диметиланилин, N,N-диэтиланилин, 1,5-диазабицикло[4,3,0]нон-5-ен (DBN), 1,4-диазабицикло[2,2,2]октан (DABCO) или 1,8-диазабицикло[5,4,0]ундец-7-ен (DBU), и представляет собой, предпочтительно, карбонат щелочного металла, гидрид щелочного металла, или органическое основание, и, более предпочтительно, гидрид натрия, карбонат калия или триэтиламин.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -30°C и 100°C, и, предпочтительно, между -10°C и 50°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 5 минут до 24 часов, и, предпочтительно, от 15 минут до 10 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

(A-3b)

Используемым растворителем может быть, например, ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; сложный эфир, такой как этилформиат, этилацетат, пропилацетат, бутилацетат или диэтилкарбонат; простой эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля; кетон, такой как ацетон, метилэтилкетон, метилизобутилкетон, изофорон или циклогексанон; амид, такой как формамид, N,N-диметилформамид, N,N-диметилацетамид, N-метил-2-пирролидинон или триамид гексаметилфосфора; или сульфоксид, такой как диметилсульфоксид или сульфолан, и представляет собой, предпочтительно, галогенированный углеводород или амид, и, более предпочтительно, N,N-диметилформамид, N,N-диметилацетамид или дихлорметан.

Используемым «конденсирующим агентом» может быть,

(i) сочетание фосфатного сложного эфира, такого как диэтилфосфорил цианид, дифенилфосфорилазид или диэтилцианофосфонат, и основания, описанного ниже;

(ii) карбодиимид, такой как 1,3-дициклогексилкарбодиимид (DCC), 1,3-диизопропилкарбодиимид или 1-(3-диметиламинопропил)-3-этилкарбодиимид (WSC); сочетание указанного карбодиимида и основания, описанного ниже; сочетание указанного карбодиимида и N-гидроксиимида, такого как N-гидроксисукцинимид, 1-гидроксибензотриазол или N-гидрокси-5-норборнен-2,3-дикарбоксиимид; и сочетание указанного карбодиимида, указанного N-гидроксиимида и основания, описанного ниже;

(iii) сочетание дисульфида, такого как 2,2'-дипиридилдисульфид или 2,2'-дибензотиазолилдисульфид, и фосфина, такого как трифенилфосфин или трибутилфосфин;

(iv) карбонат, такой как N,N'-дисукцинимидилкарбонат, диэтилпирокарбонат (DEPC), ди-2-пиридилкарбонат или S,S'-бис(1-фенил-1H-тетразол-5-ил)дитиокарбонат;

(v) хлорангидрид фосфиновой кислоты, такой как хлорангидрид N,N'-бис(2-оксо-3-оксазолидинил)фосфиновой кислоты;

(vi) оксалат, такой как N,N'-дисукцинимидилоксалат, N,N'-дифталимидоксалат, N,N'-бис(5-норборнен-2,3-дикарбоксиимидил) оксалат, 1,1'-бис(бензотриазолил)оксалат, 1,1'-бис(6-хлорбензотриазолил)оксалат или 1,1'-бис(6-трифторметилбензотриазолил)оксалат;

(vii) сочетание указанного фосфина и азодикарбоксилата или азодикарбоксиамида, такого как диэтилазодикарбоксилат или 1,1'-(азодикарбонил)дипиперидин;

(viii) N-низший алкил-5-арилизоксазолий-3'-сульфонат, такой как N-этил-5-фенилизоксазолий-3'-сульфонат;

(ix) ди-гетероарилдиселенид, такой как ди-2-пиридилдиселенид;

(x) арилсульфонилтриазолид, такой как п-нитробензолсульфонилтриазолид;

(xi) 2-галоген-1-низший алкилпиридиний галогенид, такой как 2-хлор-1-метилпиридиний йодид;

(xii) имидазол, такой как 1,1'-оксалилдиимидазол или N,N'-карбонилдиимидазол (CDI);

(xiii) 3-низший алкил-2-галоген-бензотиазолий фторборат, такой как 3-этил-2-хлор-бензотиазолий фторборат;

(xiv) 3-низший алкил-бензотиазол-2-селон, такой как 3-метил-бензотиазол-2-селон;

(xv) фосфат, такой как фенилдихлорфосфат или полифосфатный сложный эфир;

(xvi) галогенсульфонилизоцианат, такой как хлорсульфонилизоцианат;

(xvii) галогенсилан, такой как триметилсилилхлорид или триэтилсилилхлорид;

(xviii) сочетание низшего алкансульфонилгалогенида, такого как метансульфонилхлорид, и основания, описанного ниже;

(xix) хлорид N,N,N',N'-тетра-низший алкилгалогенформамидий, такой как хлорид N,N,N',N'-тетраметилхлороформамидий; или

(xx) сочетание соли пиридиния (реагент Микаяма (Mukaiyama)), такой как хлорид 1-метил-2-хлорпиридиния или хлорид 1-этил-2-бромпиридиния, и основания, описанного ниже,

и представляет собой, предпочтительно, карбодиимид, и, более предпочтительно, 1-(3-диметиламинопропил)-3-этилкарбодиимид или 1,3-дициклогексилкарбодиимид.

Используемым основанием может быть, например, органическое основание, такое как пирролидин, пиперидин, морфолен, N-метилморфолин, триэтиламин, трибутиламин, диизопропилэтиламин, дициклогексиламин, N-метилпиперидин, пиридин, 4-пирролидинопиридин, пиколин, 4-(N,N-диметиламино)пиридин, 2,6-ди(трет-бутил)-4-метилпиридин, хинолин, N,N-диметиланилин или N,N-диэтиланилин.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -30°C и 100°C, и, предпочтительно, между -10°C и 50°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 5 минут до 24 часов, и, предпочтительно, от 30 минут до 10 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси; добавлением к смеси органического растворителя, не смешивающегося с водой, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученное соединение, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

(A-3c)

Используемым растворителем может быть, например, ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; сложный эфир, такой как этилформиат, этилацетат, пропилацетат, бутилацетат или диэтилкарбонат; простой эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля; кетон, такой как ацетон, метилэтилкетон, метилизобутилкетон, изофорон или циклогексанон; амид, такой как формамид, N,N-диметилформамид, N,N-диметилацетамид, N-метил-2-пирролидинон или триамид гексаметилфосфора; или сульфоксид, такой как диметилсульфоксид или сульфолан, и представляет собой, предпочтительно, эфир, и, более предпочтительно, тетрагидрофуран.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -30°C и 100°C, и, предпочтительно, между -10°C и 50°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 1 минуты до 5 часов, и, предпочтительно, от 5 минут до 1 часа.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси; добавлением к смеси органического растворителя, не смешивающегося с водой, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

(A-4)

Эту стадию осуществляют гидролизом группы сложного эфира (A-4).

Эту стадию осуществляют способом, аналогичным описанному в настоящем документе выше (A-2).

(A-5)

Эту стадию осуществляют преобразованием карбоксигруппы, полученной на стадии A-4, в активный сложный эфир, с последующим взаимодействием указанного активного сложного эфира с желаемым амино соединением.

Используемым растворителем может быть, например, ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; сложный эфир, такой как этилформиат, этилацетат, пропилацетат, бутилацетат или диэтилкарбонат; простой эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля; кетон, такой как ацетон, метилэтилкетон, метилизобутилкетон, изофорон или циклогексанон; амид, такой как формамид, N,N-диметилформамид, N,N-диметилацетамид, N-метил-2-пирролидинон или триамид гексаметилфосфора; или сульфоксид, такой как диметилсульфоксид или сульфолан, и представляет собой, предпочтительно, галогенированный углеводород или амид, и, более предпочтительно, N,N-диметилформамид, N,N-диметилацетамид или дихлорметан.

Для используемого реагента нет особых ограничений, при условии, что он используется для образования активного сложного эфира, и, например, может представлять собой изобутилхлорформиат.

Используемым основанием может быть, например, неорганическое основание, включая карбонат щелочного металла, такой как карбонат натрия, карбонат калия или карбонат лития; гидрокарбонат щелочного металла, такой как гидрокарбонат натрия, гидрокарбонат калия или гидрокарбонат лития; гидрид щелочного металла, такой как гидрид лития, гидрид натрия или гидрид калия; гидроксид щелочного металла, такой как гидроксид натрия, гидроксид калия или гидроксид лития; и фторид щелочного металла, такой как фторид натрия или фторид калия; алкоксид щелочного металла, такой как метоксид натрия, этоксид натрия, метоксид калия, этоксид калия, трет-бутоксид калия или метоксид лития; меркаптан щелочного металла, такой как метилмеркаптан натрия или этилмеркаптан натрия; или органическое основание, такое как N-метилморфолин, триэтиламин, трипропиламин, трибутиламин, диизопропилэтиламин, дициклогексиламин, N-метилпиперидин, пиридин, 4-пирролидинопиридин, пиколин, 4-(N,N-диметиламино)пиридин, 2,6-ди(трет-бутил)-4-метилпиридин, хинолин, N,N-диметиланилин, N,N-диэтиланилин, 1,5-диазабицикло[4,3,0]нон-5-ен (DBN), 1,4-диазабицикло[2,2,2]октан (DABCO) или 1,8-диазабицикло[5,4,0]ундец-7-ен (DBU), и представляет собой, предпочтительно, карбонат щелочного металла или органическое основание, и, более предпочтительно, карбонат калия или триэтиламин.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -30°C и 100°C, и, предпочтительно, между -10°C и 50°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 10 минут до 24 часов, и, предпочтительно, от 30 минут до 10 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение; высушиванием органического слоя над безводным сульфатом магния или подобным способом; и последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

(A-6)

Эту стадию осуществляют проведением реакции дегидратирующей конденсации между карбоновой кислотой, полученной на стадии A-4, и спиртом (A-6a), или проведением реакции сложноэфирного обмена, используя сложный эфир в присутствии кислоты или основания непосредственно без осуществления способа стадии A-4 (A-6b).

(A-6a)

Используемым растворителем может быть, например, ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; простой эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля; спирт, такой как метанол, этанол, н-пропанол, изопропанол, н-бутанол, изобутанол, трет-бутанол, изоамиловый спирт, диэтиленгликоль, глицерин, октанол, циклогексанол или 2-метоксиэтанол; амид, такой как формамид, N,N-диметилформамид, N,N-диметилацетамид, N-метил-2-пирролидинон или гексаметилфосфортриамид; сульфоксид, такой как диметилсульфоксид или сульфолан; или смешанный растворитель, состоящий из спирта и вышеуказанного растворителя. Тем не менее, когда в качестве растворителя в вышеописанной реакции используется спирт, добавлять спирт в качестве реагента не требуется.

Используемой кислотой могут быть, например, неорганические кислоты, такие как хлористоводородная кислота, хлористый водород, бромистоводородная кислота, серная кислота, перхлорная кислота или фосфорная кислота; или сульфоновая кислота, такая как метансульфоновая кислота, п-толуолсульфоновая кислота или камфорсульфоновая кислота, и она представляет собой, предпочтительно, неорганическую кислоту, и, более предпочтительно, хлористый водород.

Температура реакции изменяется в зависимости от исходного вещества и реагента, находится между -30°C и 100°C, и, предпочтительно, между -10°C и 50°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 10 минут до 24 часов, и, предпочтительно, от 30 минут до 10 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение; высушиванием органического слоя над безводным сульфатом магния или подобным способом; и последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

Эту стадию осуществляют способом, аналогичным описанному в настоящем документе выше in (A-3b).

(A-6b)

На этой стадии в качестве растворителя используется спирт, соответствующий желаемой алкоксигруппе. Когда используется кислота, то такой используемой кислотой может быть, например, неорганическая кислота, такая как хлористоводородная кислота, хлористый водород, бромистоводородная кислота, серная кислота, перхлорная кислота или фосфорная кислота; или сульфоновая кислота, такая как метансульфоновая кислота, п-толуолсульфоновая кислота или камфорсульфоновая кислота, и она представляет собой, предпочтительно, неорганическую кислоту и, более предпочтительно, хлористый водород.

Когда используется основание, таким используемым основанием может быть, например, неорганическое основание, включая карбонат щелочного металла, такой как карбонат натрия, карбонат калия или карбонат лития; гидрокарбонат щелочного металла, такой как гидрокарбонат натрия, гидрокарбонат калия или гидрокарбонат лития; гидрид щелочного металла, такой как гидрид лития, гидрид натрия или гидрид калия; гидроксид щелочного металла, такой как гидроксид натрия, гидроксид калия или гидроксид лития; или фторид щелочного металла, такой как фторид натрия или фторид калия, и оно представляет собой, предпочтительно, карбонат щелочного металла, и, более предпочтительно, карбонат калия.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -30°C и 100°C, и, предпочтительно, между -10°C и 50°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 10 минут до 24 часов, и, предпочтительно, от 30 минут до 10 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученное соединение, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

(A-7)

Эту стадию осуществляют способом, аналогичным описанному в настоящем документе выше для стадии A-2. Когда используется кислота, в качестве особенно предпочтительного реагента используется трифторуксусная кислота или хлористый водород.

Когда желаемое соединение получают в виде его геометрического изомера, желаемое соединение может быть получено осуществлением реакции фотоизомеризации, описанной ниже.

Используемым растворителем может быть, например, сложный эфир, такой как этилформиат, этилацетат, пропилацетат, бутилацетат или диэтилкарбонат; простой эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля; спирт, такой как метанол, этанол, н-пропанол, изопропанол, н-бутанол, изобутанол, трет-бутанол, изоамиловый спирт, диэтиленгликоль, глицерин, октанол, циклогексанол или метилцеллозолы; нитрил, такой как ацетонитрил или изобутиронитрил; амид, такой как формамид, N,N-диметилформамид, N,N-диметилацетамид, N-метил-2-пирроридон, N-метилпирролидинон или гексаметилфосфортриамид; сульфоксид, такой как диметилсульфоксид или сульфолан; вода; или смесь этих растворителей, и представляет собой, предпочтительно, воду, спирт, нитрил или смесь этих растворителей.

Используемым источником света является ртутная лампа низкого давления (мощностью от 20 Вт до 100 Вт, предпочтительно, 32 Вт).

Используемым сенсибилизатором может быть, например, бензофенон, флуоренон или антрахинон.

Эта реакция, для увеличения скорости реакции, может быть осуществлена добавлением органического соединения серы, такого как диметилдисульфид, диэтилдисульфид или дифенилдисульфид.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -20°C и 100°C, и, предпочтительно, между 0°C и 50°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 5 минут до 8 часов, и, предпочтительно, от 10 минут до 3 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

(A-8)

Эта стадия представляет собой стадию преобразования карбоксигруппы в гидроксиламиногруппу, и может легко быть осуществлена способами, хорошо известными специалисту, обладающему средним уровнем знаний в данной области (например, способами, описанными в A. Sekar Reddy, M. Suresh Kumar and G. Rabindra Reddy: Tetrahedron Letters, (2000), 41, 6285-6288).

(A-9)

Эта стадия может быть осуществлена в соответствии с реакцией Мицунобу, используя амин в инертном растворителе, или преобразованием гидроксильной группы в удаляемую группу с последующим проведением реакции замещения, используя амин, и осуществлена способом, аналогичным описанному ниже (C-2e).

(Способ B)

Способ B представляет собой стадии, включающие получение соединения (V) путем реакции нуклеофильного замещения в присутствии основания, используя соединение (III), которое хорошо известно, или может быть легко получено из хорошо известных соединений, и соединений (IV), полученных способом C, описанным в настоящем документе ниже (B-1), и получение соединения (I) преобразованием гидроксильной группы соединения (V) (B-2). Кроме того, при необходимости, в способе B также может быть выполнено снятие защитной группы у сульфанильной группы (B-3), введение заместителя в сульфанильную группу (B-4), гидролиз сложноэфирной группы (B-5), преобразование карбоксигруппы в амидную группу(B-6), преобразование карбоксигруппы в сложноэфирную группу (B-7), снятие защитной группы у аминогруппы (B-8) и преобразование карбоксигруппы в гидроксиаминогруппу (B-9). Стадии B-3-B-9 могут быть выполнены либо до, либо после стадий B-1 и B-2, и порядок выполнения этих стадий может быть выбран, в зависимости от обстоятельств, специалистом, имеющим обычный уровень знаний в данной области.

(B-1)

Используемым растворителем может быть, например, ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; сложный эфир, такой как этилформиат, этилацетат, пропилацетат, бутилацетат или диэтилкарбонат; простой эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля; кетон, такой как ацетон, метилэтилкетон, метилизобутилкетон, изофорон или циклогексанон; амид, такой как формамид, N,N-диметилформамид, N,N-диметилацетамид, N-метил-2-пирролидинон или триамид гексаметилфосфора; или сульфоксид, такой как диметилсульфоксид или сульфолан, и он представляет собой, предпочтительно, галогенированный углеводород или амид, и, более предпочтительно, N,N-диметилформамид, N,N-диметилацетамид или дихлорметан.

Используемым основанием может быть, например, неорганическое основание, включая карбонат щелочного металла, такой как карбонат натрия, карбонат калия или карбонат лития; гидрокарбонат щелочного металла, такой как гидрокарбонат натрия, гидрокарбонат калия или гидрокарбонат лития; гидрид щелочного металла, такой как гидрид лития, гидрид натрия или гидрид калия; гидроксид щелочного металла, такой как гидроксид натрия, гидроксид калия или гидроксид лития; и фторид щелочного металла, такой как фторид натрия или фторид калия; алкоксид щелочного металла, такой как метоксид натрия, этоксид натрия, метоксид калия, этоксид калия, трет-бутоксид калия или метоксид лития; меркаптан щелочного металла, такой как метилмеркаптан натрия или этилмеркаптан натрия; или органическое основание, такое как N-метилморфолин, триэтиламин, трипропиламин, трибутиламин, диизопропилэтиламин, дициклогексиламин, N-метилпиперидин, пиридин, 4-пирролидинопиридин, пиколин, 4-(N,N-диметиламино)пиридин, 2,6-ди-(трет-бутил)-4-метилпиридин, хинолин, N,N-диметиланилин, N,N-диэтиланилин, 1,5-диазабицикло[4,3,0]нон-5-ен (DBN), 1,4-диазабицикло[2,2,2]октан (DABCO) или 1,8-диазабицикло[5,4,0]ундец-7-ен (DBU), и оно представляет собой, предпочтительно, карбонат щелочного металла или органическое основание, и, более предпочтительно, карбонат калия или триэтиламин.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -30°C и 100°C, и, предпочтительно, между -10°C и 50°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 10 минут до 48 часов, и, предпочтительно, от 30 минут до 24 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

(B-2)

Эту стадию осуществляют реакцией Мицунобу в инертном растворителе (B-2a) путем проведения реакции в присутствии амид-ацетального реагента (B-2b), преобразованием гидроксильной группы в удаляемую группу и проведением реакции замещения, используя Pro1-SM (M представляет собой щелочной металл, предпочтительно, калий) (B-2c), или преобразованием гидроксильной группы в удаляемую группу и осуществлением реакции замещения, используя Pro1-SM в присутствии палладиевого катализатора и фосфина (B-2d).

(B-2a)

Используемым растворителем может быть, например, ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; или эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля, и он представляет собой, предпочтительно, галогенированный углеводород или эфир, и, более предпочтительно, дихлорметан или тетрагидрофуран.

Для используемого реагента в реакции Мицунобу нет особых ограничений, при условии, что он может быть обычно использован для реакции Мицунобу и, например, представляет собой, предпочтительно, сочетание азосоединения, включая ди-низший алкил азодикарбоксилат, такой как диэтил азодикарбоксилат или диизопропил азодикарбоксилат, или гетероциклильный азодикарбонил, такой как 1,1'-(азодикарбонил)дипиперидин, и фосфин, включая триарилфосфин, такой как трифенилфосфин или три-низший-алкилфосфин, такой как три-н-бутилфосфин, и, более предпочтительно, сочетание ди-низший-алкил азодикарбоксилата и триарилфосфина, и, наиболее предпочтительно, сочетание диэтил азодикарбоксилата или диизопропил азодикарбоксилата и трифенилфосфина.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -50°C и 100°C, и, предпочтительно, между -10°C и 60°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 10 минут до 48 часов, и, предпочтительно, от 30 минут до 24 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

(B-2b)

Используемым растворителем может быть, например, ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; простой эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля; или амид, такой как формамид, N,N-диметилформамид, N,N-диметилацетамид, N-метил-2-пирролидинон или триамид гексаметилфосфора, и представляет собой, предпочтительно, ароматический углеводород, и, более предпочтительно, толуол.

Используемым амид-ацетальным реагентом может быть, например, соединение общей формулы (CH3)2NCH(OR')2 (где R' представляет собой С1-С6 алкильную группу или C7-C15 аралкильную группу), и он представляет собой, предпочтительно, N,N-диметилформамид динеопентилацеталя.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -50°C и 150°C, и, предпочтительно, между -10°C и 120°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 1 минуты до 24 часов, и, предпочтительно, от 5 минут до 5 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

(B-2c)

Используемым растворителем для реакции преобразования гидроксильной группы в удаляемую группу может быть, например, галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; или эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля, и представляет собой, предпочтительно, галогенированный углеводород, и, более предпочтительно, дихлорметан.

Используемым основанием может быть, например, органическое основание, такое как пирролидин, пиперидин, морфолин, N-метилморфолин, триэтиламин, трипропиламин, трибутиламин, диизопропилэтиламин, дициклогексиламин, N-метилпиперидин, пиридин, 4-пирролидинопиридин, пиколин, 4-(N,N-диметиламино)пиридин, 2,6-ди(трет-бутил)-4-метилпиридин, хинолин, N,N-диметиланилин, N,N-диэтиланилин, 1,5-диазабицикло[4,3,0]нон-5-ен (DBN), 1,4-диазабицикло[2,2,2]октан (DABCO) или 1,8-диазабицикло[5,4,0]ундец-7-ен (DBU), и оно представляет собой, предпочтительно, 1,8-диазабицикло[5,4,0]ундец-7-ен (DBU).

Для используемого реагента нет особых ограничений, при условии, что он образует удаляемую группу взаимодействием с гидроксильной группой, и преобразование в удаляемую группу выполняется добавлением агента галогенирования, агента сульфонилирования или агента ацилирования. Используемым агентом галогенирования может быть тетрагалогенид углерода, такой как тетрабромид углерода или четыреххлористый углерод, и, в этих случаях, в качестве реагента используется фосфин. Таким фосфином может быть, например, три-C1-C6 алкилфосфин, такой как триметилфосфин, триэтилфосфин, трипропилфосфин, трибутилфосфин, трипентилфосфин или тригексилфосфин; три-C6-C10 арилфосфин, такой как трифенилфосфин, триинденилфосфин или тринафтилфосфин; или три-C6-C10 арилфосфин, который может иметь C1-C4 алкильную(ые) группу(ы) в качестве заместителя(ей), такой как толилдифенилфосфин, тритолилфосфин, тримезитилфосфин, трибутилфенилфосфин или три-6-этил-2-нафтилфосфин, и представляет собой, предпочтительно, три-C1-C6 алкилфосфин (в частности, триметилфосфин, триэтилфосфин, трипропилфосфин или трибутилфосфин) или три-C610арилфосфин (в частности, трифенилфосфин, триинденилфосфин или тринафтилфосфин), и, более предпочтительно, три-C610арилфосфин (в частности, трифенилфосфин). Используемым агентом сульфонилирования может быть, например, сульфонилгалогенид, такой как метансульфонилхлорид, этансульфонилхлорид или тозилхлорид, и он представляет собой, предпочтительно, метансульфонилхлорид. Используемым агентом ацилирования может быть, например, ацетилхлорид, уксусный ангидрид, трифторуксусный ангидрид или тому подобное.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -50°C и 100°C, и, предпочтительно, между -20°C и 80°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 30 минут до 24 часов, и, предпочтительно, от 1 часа до 10 часов.

Используемым растворителем в реакции замещения Pro1-SM может быть, например, ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; сложный эфир, такой как этилформиат, этилацетат, пропилацетат, бутилацетат или диэтилкарбонат; простой эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля; кетон, такой как ацетон, метилэтилкетон, метилизобутилкетон, изофорон или циклогексанон; нитросоединение, такое как нитроэтан или нитробензол; нитрил, такой как ацетонитрил или изобутиронитрил; амид, такой как формамид, N,N-диметилформамид, N,N-диметилацетамид, N-метил-2-пирролидинон или триамид гексаметилфосфора; или сульфоксид, такой как диметилсульфоксид или сульфолан, и он представляет собой, предпочтительно, галогенированный углеводород, амид или сульфоксид, и, более предпочтительно, N,N-диметилформамид, N,N-диметилацетамид, дихлорметан или диметилсульфоксид.

Используемым основанием может быть, например, неорганическое основание, содержащее карбонат щелочного металла, такой как карбонат натрия, карбонат калия или карбонат лития; гидрокарбонат щелочного металла, такой как гидрокарбонат натрия, гидрокарбонат калия или гидрокарбонат лития; гидрид щелочного металла, такой как гидрид лития, гидрид натрия или гидрид калия; гидроксид щелочного металла, такой как гидроксид натрия, гидроксид калия или гидроксид лития; и фторид щелочного металла, такой как фторид натрия или фторид калия; алкоксид щелочного металла, такой как метоксид натрия, этоксид натрия, метоксид калия, этоксид калия, трет-бутоксид калия или метоксид лития; меркаптан щелочного металла, такой как метилмеркаптан натрия или этилмеркаптан натрия; или органическое основание, такое как N-метилморфолин, триэтиламин, трипропиламин, трибутиламин, диизопропилэтиламин, дициклогексиламин, N-метилпиперидин, пиридин, 4-пирролидинопиридин, пиколин, 4-(N,N-диметиламино)пиридин, 2,6-ди-(трет-бутил)-4-метилпиридин, хинолин, N,N-диметиланилин, N,N-диэтиланилин, 1,5-диазабицикло[4,3,0]нон-5-ен (DBN), 1,4-диазабицикло[2,2,2]октан (DABCO) или 1,8-диазабицикло[5,4,0]ундец-7-ен (DBU), и оно представляет собой, предпочтительно, карбонат щелочного металла или органическое основание, и, более предпочтительно, карбонат калия или триэтиламин.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -50°C и 100°C, и, предпочтительно, между -20°C и 80°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 30 минут до 24 часов, и, предпочтительно, от 1 часа до 10 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

(B-2d)

Реакция преобразования гидроксильной группы в удаляемую группу может быть осуществлена способом, аналогичным способу (B-2c).

Используемым растворителем последующей реакции замещения может быть, например, алифатический углеводород, такой как гексан, циклогексан, гептан, лигроин, или петролейный эфир; ароматический углеводород, такой как бензол, толуол, или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол, или дихлорбензол; простой эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан, или диметиловый эфир диэтиленгликоля; нитрил, такой как ацетонитрил или изобутиронитрил; или смесь воды и вышеуказанных растворителей, и он представляет собой, предпочтительно, смесь воды и диоксана.

Используемым палладиевым катализатором может быть, например, хлорид палладия, ацетат палладия, аддукт трис(дибензилиденацетон)дипалладий-хлороформ, трис(дибензилиденацетон)дипалладий, бис(дибензилиденацетон)палладий, димер хлорида π-аллилпалладия, тетракис(трифенилфосфин)палладий, дихлорид 1,1'-бис(дифенилфосфино)ферроценпалладия, хлорид бис(трифенилфосфин)палладия, ацетат бис(трифенилфосфин)палладия, дихлор(1,5-циклооктадиен)палладий, дихлорбис(ацетонитрил)палладий, дихлорид бис(трициклогексилфосфин)палладия, бис(трициклогексилфосфин)палладий или дихлорид бис(три-O-толилфосфин)палладия, и он представляет собой, предпочтительно, хлорид палладия, ацетат палладия, аддукт трис(дибензилиденацетон)дипалладий-хлороформ или трис(дибензилиденацетон)дипалладий.

Используемым фосфином может быть, например, три-C1-C6 алкилфосфин, такой как триметилфосфин, триэтилфосфин, трипропилфосфин, трибутилфосфин, трипентилфосфин или тригексилфосфин; три-C6-C10 арилфосфин, такой как трифенилфосфин, триинденилфосфин или тринафтилфосфин; три-C6-C10 арилфосфин, который может быть замещен C1-C4 алкильной группой, такой как толилдифенилфосфин, тритолилфосфин, тримезитилфосфин, трибутилфенилфосфин или три-6-этил-2-нафтилфосфин; бис(дифенилфосфино)C1-C6 алкан, такой как бис(дифенилфосфино)метан, 1,2-бис(дифенилфосфино)этан, 1,3-бис(дифенилфосфино)пропан, 1,4-бис(дифенилфосфино)бутан, 1,5-бис(дифенилфосфино)пентан или 1,6-бис(дифенилфосфино)гексан; или бис(дифенилфосфино)ацетилен, 1,2-бис(дифенилфосфино)бензол, (R)-(+)-2,2'-бис(дифенилфосфино)-1,1'-бинафтил, 2,2'-бис(дифенилфосфино)-1,1'-бинафтил, (S)-(-)-2,2'-бис(дифенилфосфино)-1,1'-бинафтил, 1,1'-бис(дифенилфосфино)ферроцен, 1,1-бис(дифенилфосфино)этилен или 4,5-бис(дифенилфосфино)-9,9-диметилксантен, и он представляет собой, предпочтительно, 1,1'-бис(дифенилфосфино)ферроцен, (R)-(+)-2,2'-бис(дифенилфосфино)-1,1'-бинафтил, 2,2'-бис(дифенилфосфино)-1,1'-бинафтил или (S)-(-)-2,2'-бис(дифенилфосфино)-1,1'-бинафтил.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между 0°C и 150°C, и, предпочтительно, между 50°C и 120°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 1 часа до 24 часов, и, предпочтительно, от 6 часов до 20 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

(B-3)-(B-9)

Каждая из этих стадий выполняется способом, аналогичным описанному в (A-2)-(A-8) в настоящем документе выше, соответственно.

(Способ C)

На вышеуказанной схеме Pro1, R2a, R3a и n имеют значения, аналогичные указанным в настоящем документе выше; R2b и R3b представляют собой группы, аналогичные указанным для R2a и R3a, которые описаны в настоящем документе выше; и Pro2 представляет собой защитную группу для аминогруппы.

Защитная группа для аминогруппы, обозначенная как Pro2, представляет собой группу, аналогичную указанной для R2a и R3a.

Способ C описан подробно в настоящем документе ниже.

(C-1)

Эта стадия представляет собой стадию получения соединения (VII) путем взаимодействия соединения (VI), которое хорошо известно или может быть легко получено из известных соединений, с соединением, имеющим формулу R2b-C(=O)-R3b, которое хорошо известно или может быть легко получено из известных соединений, и выполняется путем енаминирования (C-1a) или с помощью перекрестной альдольной реакции (C-1b).

(C-1a)

Используемым основанием может быть, например, органическое основание, такое как пирролидин, пиперидин, морфолин, N-метилморфолин, триэтиламин, трипропиламин, трибутиламин, диизопропилэтиламин, дициклогексиламин, N-метилпиперидин, пиридин, 4-пирролидинопиридин, пиколин, 4-(N,N-диметиламино)пиридин, 2,6-ди-(трет-бутил)-4-метилпиридин, хинолин, N,N-диметиланилин, N,N-диэтиланилин, 1,5-диазабицикло[4,3,0]нон-5-ен (DBN), 1,4-диазабицикло[2,2,2]октан (DABCO) или 1,8-диазабицикло[5,4,0]ундец-7-ен (DBU), и оно представляет собой, предпочтительно, пирролидин, пиперидин или морфолин.

Используемым растворителем может быть, например, ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; спирт, такой как метанол, этанол, н-пропанол, изопропанол, н-бутанол, изобутанол, трет-бутанол, изоамиловый спирт, диэтиленгликоль, глицерин, октанол, циклогексанол или 2-метоксиэтанол; или эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля; и представляет собой, предпочтительно, бензол, толуол или этанол.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между 0°C и 200°C, и, предпочтительно, между 50°C и 150°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 30 минут до 24 часов, и, предпочтительно, от 1 часа до 10 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

Когда остается соединение, имеющее гидроксильную группу, представляющее собой промежуточный продукт реакции, и реакция не завершена, желаемый продукт может быть получен проведением, кроме того, реакцией дегидратации в присутствии основания.

Используемым растворителем может быть, например, галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; или эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля, и он представляет собой, предпочтительно, галогенированный углеводород, и, более предпочтительно, дихлорметан.

Используемым основанием может быть органическое основание, такое как пирролидин, пиперидин, морфолин, N-метилморфолин, триэтиламин, трипропиламин, трибутиламин, диизопропилэтиламин, дициклогексиламин, N-метилпиперидин, пиридин, 4-пирролидинопиридин, пиколин, 4-(N,N-диметиламино)пиридин, 2,6-ди-(трет-бутил)-4-метилпиридин, хинолин, N,N-диметиланилин, N,N-диэтиланилин, 1,5-диазабицикло[4,3,0]нон-5-ен (DBN), 1,4-диазабицикло[2,2,2]октан (DABCO) или 1,8-диазабицикло[5,4,0]ундец-7-ен (DBU), и оно представляет собой, предпочтительно, 1,8-диазабицикло[5,4,0]ундец-7-ен (DBU).

Для используемого реагента нет особых ограничений, при условии, что он образует удаляемую группу путем взаимодействия с гидроксильной группой, и преобразование в удаляемую группу достигается добавлением агента галогенирования, агента сульфонилирования или агент ацилирования. Используемым агентом галогенирования может быть, например, тетрагалогенид углерода, такой как тетрабромид углерода или четыреххлористый углерод, и, в этих случаях, используемый в качестве реагента фосфин. Таким фосфином может быть, например, три-C1-C6 алкилфосфин, такой как триметилфосфин, триэтилфосфин, трипропилфосфин, трибутилфосфин, трипентилфосфин или тригексилфосфин; три-C6-C10 арилфосфин, такой как трифенилфосфин, триинденилфосфин или тринафтилфосфин; или три-C6-C10 арилфосфин, который может иметь C1-C4 алкильную(ые) группу(ы) в качестве заместителя(ей), такой как толилдифенилфосфин, тритолилфосфин, тримезитилфосфин, трибутилфенилфосфин или три-6-этил-2-нафтилфосфин, и он представляет собой, предпочтительно, три-C1-C6 алкилфосфин (в частности, триметилфосфин, триэтилфосфин, трипропилфосфин или трибутилфосфин) или три-C610арилфосфин (в частности, трифенилфосфин, триинденилфосфин или тринафтилфосфин), и, более предпочтительно, три-C610арилфосфин (в частности, трифенилфосфин). Используемым агентом сульфонилирования может быть, например, сульфонилгалогенид, такой как метансульфонилхлорид, этансульфонилхлорид или тозилхлорид, и он представляет собой, предпочтительно, метансульфонилхлорид. Используемым агентом ацилирования может быть, например, ацетилхлорид, уксусный ангидрид, трифторуксусный ангидрид или тому подобное.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -50°C и 100°C, и, предпочтительно, между -20°C и 80°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 30 минут до 24 часов, и, предпочтительно, от 1 часа до 10 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

(C-1b)

Используемым основанием может быть, например, органическое основание, такое как пирролидин, пиперидин, морфолин, N-метилморфолин, триэтиламин, трипропиламин, трибутиламин, диизопропилэтиламин, дициклогексиламин, N-метилпиперидин, пиридин, 4-пирролидинопиридин, пиколин, 4-(N,N-диметиламино)пиридин, 2,6-ди-(трет-бутил)-4-метилпиридин, хинолин, N,N-диметиланилин, N,N-диэтиланилин, 1,5-диазабицикло[4,3,0]нон-5-ен (DBN), 1,4-диазабицикло[2,2,2]октан (DABCO) или 1,8-диазабицикло[5,4,0]ундец-7-ен (DBU); или металлоорганическсое основание, такое как бутиллитий, диизопропиламид лития, бис(триметилсилил)амид лития, бис(триметилсилил)амид натрия или бис(триметилсилил)амид калия, и оно представляет собой, предпочтительно, диизопропиламид лития, бис(триметилсилил)амид лития, бис(триметилсилил)амид натрия или бис(триметилсилил)амид калия.

Используемым растворителем может быть, например, ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; спирт, такой как метанол, этанол, н-пропанол, изопропанол, н-бутанол, изобутанол, трет-бутанол, изоамиловый спирт, диэтиленгликоль, глицерин, октанол, циклогексанол или 2-метоксиэтанол; или эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля, и он представляет собой, предпочтительно, тетрагидрофуран.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -100°C и 20°C, и, предпочтительно, между -78°C и 0°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 30 минут до 24 часов, и, предпочтительно, от 1 часа до 5 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

Когда соединение, имеющее гидроксильную группу, которая представляет собой продукт промежуточной реакции, остается, реакция дегидратации может быть осуществлена способом, аналогичным описанному в (C-1a).

(C-2)

Эта стадия представляет собой стадию реакции восстановления путем преобразования карбонильной группы соединения (VII), полученного на стадии C-1, в гидроксильную группу (C-2a). Кроме того, когда R2b представляет собой атом водорода, R2a не представляет собой атом водорода и R3b представляет собой алкоксикарбонильную группу, может быть осуществлена реакция введения группы R2a (C-2b). Кроме того, когда группа R3b содержит группу сложного эфира, при необходимости, может быть осуществлена реакция введения соответствующей защитной группы в гидроксильную группу (C-2c), реакция восстановления для преобразования группы сложного эфира в гидроксиметильную группу (C-2d), реакция преобразования группы R3b, содержащей гидроксильную группу, в группу R3a (C-2e) и реакция удаления защитной группы у гидроксильной группы (C-2f). Стадии C-2c-C-2f могут быть проведены или до или после стадий C-2a и C-2b, а специалист в данной области сможет легко определить соответствующий порядок выполнения этих стадий.

(C-2a)

Используемым растворителем может быть, например, ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; простой эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля; спирт, такой как метанол, этанол, н-пропанол, изопропанол, н-бутанол, изобутанол, трет-бутанол, изоамиловый спирт, диэтиленгликоль, глицерин, октанол, циклогексанол или 2-метоксиэтанол; или смесь спирта и галогенированного углеводорода, и он представляет собой, предпочтительно, спирт, смесь спирта и галогенированного углеводорода, или эфир, и, более предпочтительно, метанол, этанол, тетрагидрофуран или смесь указанного спирта и дихлорметана.

Для используемого реагента нет особых ограничений, при условии, что он может быть использован для реакции восстановления карбонильной группы до гидроксильной группы, и может представлять собой, например, реагент на основе гидрида алюминия или соединение бора, такой как боргидрид натрия или диборан, и представляет собой, предпочтительно, боргидрид натрия.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -78°C и 100°C, и, предпочтительно, между 0°C и 50°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 10 минут до 12 часов, и, предпочтительно, от 30 минут до 5 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

Когда R3b отличается от R3a, возможно введение заместителя в аминогруппу, при необходимости. В этом случае, после удаления защитной группы у аминогруппы способом, аналогичным описанному в (A-7), введение заместителя может быть выполнено описанным ниже способом.

Используемым растворителем может быть, например, ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; сложный эфир, такой как этилформиат, этилацетат, пропилацетат, бутилацетат или диэтилкарбонат; простой эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля; кетон, такой как ацетон, метилэтилкетон, метилизобутилкетон, изофорон или циклогексанон; амид, такой как формамид, N,N-диметилформамид, N,N-диметилацетамид, N-метил-2-пирролидинон или триамид гексаметилфосфора; или сульфоксид, такой как диметилсульфоксид или сульфолан, и он представляет собой, предпочтительно, галогенированный углеводород или амид, и, более предпочтительно, N,N-диметилформамид, N,N-диметилацетамид или дихлорметан.

Для используемого реагента нет особых ограничений, при условии, что он может быть использован в реакции замещения аминогруппой, и может представлять собой, например, реагент, в котором удаляемая группа, такая как атом галогена или сульфонильная группа, связана с желаемой функциональной группой.

Используемым основанием может быть, например, неорганическое основание, включая карбонат щелочного металла, такой как карбонат натрия, карбонат калия или карбонат лития; гидрокарбонат щелочного металла, такой как гидрокарбонат натрия, гидрокарбонат калия или гидрокарбонат лития; гидрид щелочного металла, такой как гидрид лития, гидрид натрия или гидрид калия; гидроксид щелочного металла, такой как гидроксид натрия, гидроксид калия или гидроксид лития; и фторид щелочного металла, такой как фторид натрия или фторид калия; алкоксид щелочного металла, такой как метоксид натрия, этоксид натрия, метоксид калия, этоксид калия, трет-бутоксид калия или метоксид лития; меркаптан щелочного металла, такой как метилмеркаптан натрия или этилмеркаптан натрия; или органическое основание, такое как N-метилморфолин, триэтиламин, трипропиламин, трибутиламин, диизопропилэтиламин, дициклогексиламин, N-метилпиперидин, пиридин, 4-пирролидинопиридин, пиколин, 4-(N,N-диметиламино)пиридин, 2,6-ди-(трет-бутил)-4-метилпиридин, хинолин, N,N-диметиланилин, N,N-диэтиланилин, 1,5-диазабицикло[4,3,0]нон-5-ен (DBN), 1,4-диазабицикло[2,2,2]октан (DABCO) или 1,8-диазабицикло[5,4,0]ундец-7-ен (DBU), и оно представляет собой, предпочтительно, карбонат калия, гидрид натрия или DBU.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -30°C и 150°C, и, предпочтительно, между 0°C и 100°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 5 минут до 48 часов, и, предпочтительно, от 10 минут до 15 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобным способом.

(C-2b)

Эта стадия может быть осуществлена путем использования R2a-Lv или альдегида или кетона, который образует группу R2a в инертном растворителе, в присутствии основания с получением соединения общей формулы (VII).

Используемым растворителем может быть, например, алифатический углеводород, такой как гексан, циклогексан, гептан, лигроин или петролейный эфир; ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; простой эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля; или нитрил, такой как ацетонитрил или изобутиронитрил, и он представляет собой, предпочтительно, тетрагидрофуран.

Используемым основанием может быть, например, литий диизопропиламид лития, бензил(триметилсилил)амид лития, диметиламид лития, диэтиламид лития, бис(триметилсилил)амид лития или дициклогексиламид лития, и оно представляет собой, предпочтительно, диизопропиламид лития.

Используемым реагентом может быть, например, C1-C6 алкилгалогенид, такой как метилйодид, этилйодид или пропилйодид; C1-C6 алкилмезилат; C1-C6 алкилтозилат; C7-C15 аралкилгалогенид, такой как бензиларалкилгалогенид, 1-нафтилметилбромид, 2-нафтилметилбромид или фенетилбромид; C7-C15 аралкилмезилат; C7-C15 аралкилтозилат; C1-C6 алкилальдегид, такой как формальдегид или ацетоальдегид; или C1-C6 алкилкетон, такой как ацетон.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -100°C и 150°C, и, предпочтительно, между -80°C и 50°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реагента и вида используемого растворителя, и обычно составляет от 1 часа до 48 часов, и, предпочтительно, от 1 часа до 10 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

(C-2c)

Эта стадия представляет собой стадию введения защитной группы в гидроксильную группу, и может быть легко осуществлена способами, хорошо известными специалисту в данной области (например, спсобом, описанным в Protective groups in Organic Synthesis, Third Edition, T. W. Green, et al., John Wiley & Sons, Inc. (1999)), и представляет собой, предпочтительно, введение защитной силильной группы (в частности, трет-бутилдиметилсилильной группы).

(C-2d)

Эту стадию осуществляют восстановлением соединения (VII) в инертном растворителе в присутствии восстанавливающего агента.

Используемым растворителем может быть, например, алифатический углеводород, такой как гексан, циклогексан, гептан, лигроин или петролейный эфир; ароматический углеводород, такой как бензол, толуол или ксилол; галогенированный углеводород, такой как дихлорметан, хлороформ, четыреххлористый углерод, дихлорэтан, хлорбензол или дихлорбензол; простой эфир, такой как диэтиловый эфир, диизопропиловый эфир, тетрагидрофуран, диоксан, диметоксиэтан или диметиловый эфир диэтиленгликоля; или спирт, такой как метанол, этанол, пропанол или изобутанол. Когда восстанавливающий агент представляет собой алюмогидрид лития, диизобутил алюмогидрид или диборан, используемым растворителем может быть алифатический углеводород (в частности, гексан или циклогексан), ароматический углеводород (в частности, бензол или толуол), галогенированный углеводород (в частности, дихлорметан) или эфир (в частности, диэтиловый эфир или тетрагидрофуран). Когда восстанавливающий агент представляет собой боргидрид натрия, используемым растворителем может быть спирт (в частности, метанол или этанол).

Используемым восстанавливающим агентом может быть, например, соединение алюмогидрида, такое как алюмогидрид лития или диизобутил алюмогидрид; боргидрид натрия; или диборан, и он представляет собой, предпочтительно, диизобутил алюмогидрид.

Температура реакции изменяется в зависимости от исходного вещества и реагента, и находится между -100°C и 100°C, и, предпочтительно, между -80°C и 50°C.

Время реакции изменяется в зависимости от температуры реакции, исходного вещества, реакционного реагента и вида используемого растворителя, и обычно составляет от 10 минут до 24 часов, и, предпочтительно, от 30 минут до 5 часов.

После завершения реакции желаемый продукт этой реакции может быть выделен, например, концентрированием реакционной смеси, добавлением к смеси не смешивающегося с водой органического растворителя, такого как этилацетат, промыванием смеси водой, отделением органического слоя, содержащего желаемое соединение, высушиванием органического слоя над безводным сульфатом магния или подобным способом, с последующим упариванием органического растворителя с получением желаемого продукта.

Полученный продукт, при необходимости, дополнительно очищают обычными способами очистки, например, перекристаллизацией, переосаждением, колоночной хроматографией на силикагеле или подобными способами.

(C-2e)

Эту стадию осуществляют реакцией Мицунобу в инертном растворителе, используя амин или подобное соединение, (C-2e1) или реакцией замещения, используя амин или подобное соединение, после преобразования гидроксильной группы в удаляемую группу (C-2e2). Стадия (C-2e1) может быть осуществлена способом, аналогичным описанному в (B-2a), за исключением того, что вместо Pro1-SM используется амин или подобное соединение. Стадия (C-2e2) может быть осуществлена способом, аналогичным описанному в (B-2c), за исключением того, что вместо Pro1-SM используется амин или подобное соединение.

(C-2f)

Эта стадия представляет собой стадию снятия защитной группы у гидроксильной группы, и может быть легко осуществлена в соответствии со способами, хорошо известными специалисту в данной области (например, способом, описанным в Protective Groups in Organic Synthesis, Third Edition, T. W. Green, et al., John Wiley & Sons, Inc. (1999)).

(C-3)

Эту стадию осуществляют способом, аналогичным описанному в A-7, и проводят, наиболее предпочтительно, путем использования трифторуксусной кислоты или уксусной кислоты.

(C-4)

Эту стадию осуществляют способом, аналогичным описанному в B-2.

(C-5)

Эту стадию осуществляют способом, аналогичным описанному в C-3.

Соединение (I) по настоящему изобретению, его фармакологически приемлемые соли или его пролекарства проявляют ингибирующую активность в отношении ингибирования агрегации тромбоцитов. Кроме того, соединение (I) по настоящему изобретению, его фармакологически приемлемые соли или его пролекарства демонстрируют превосходные фармакокинетические свойства, такие как абсорбция, распределение, время полужизни плазмы и тому подобное, и низкую токсичность в органах, таких как почки, печень и тому подобное. Таким образом, соединение (I) по настоящему изобретению, его фармакологически приемлемые соли или пролекарства являются эффективными, например, в качестве лекарственных препаратов, и, в частности, эффективными в качестве средств для терапии или профилактики различных тромботических заболеваний.

Когда соединение по настоящему изобретению используют в качестве средства для профилактики или терапии заболеваний, как описано выше, указанное соединение, имеющее общую формулу (I) или его фармакологически приемлемые соли или пролекарства, могут быть введены отдельно или в виде смеси с фармакологически приемлемыми наполнителями, разбавителями и тому подобным, в виде различных лекарственных форм, таких как таблетки, капсулы, гранулы, порошки, сиропы и тому подобное для перорального введения; и инъекции, суппозитории, наружного аппликатора и тому подобное для парентерального введения.

Каждая из вышеуказанных лекарственных форм может быть получена хорошо известными способами, используя добавки для лекарственных форм, такие как наполнители (например, органические наполнители, включая производные сахара, такие как лактоза, сахароза, глюкоза, маннит или сорбит; производные крахмала, такие как кукурузный крахмал, картофельный крахмал, α-крахмал или декстрин; производные целлюлозы, такие как кристаллическая целлюлоза; гуммиарабик; декстран; пуллулан; и неорганические наполнители, включая производные силиката, такие как легкий ангидрид кремниевой кислоты, синтетический силикат алюминия, силикат кальция или метасиликат алюмината магния; производные фосфата, такие как гидрофосфат кальция; производные карбоната, такие как карбонат кальция; или производные сульфата, такие как сульфат кальция), смазывающие вещества (например, стеариновая кислота; производные стеарата металла, такие как стеарат кальция или стеарат магния; тальк; коллоидный оксид кремния; воски, такие как пчелиный воск или спермацет; борная кислота; адипиновая кислота; производные сульфата, такие как сульфат натрия; гликоль; фумаровая кислота; бензоат натрия; DL-лейцин; производные лаурилсульфата, такие как лаурилсульфат натрия или лаурилсульфат магния; производные кремниевой кислоты, такие как ангидрид кремния или гидрат кремниевой кислоты; или описанные выше производные крахмала), связывающие вещества (например, гидроксипропилцеллюлоза, гидроксипропилметилцеллюлоза, поливинилпирролидон, макрогол или наполнители, как описано выше), разрыхляющие вещества (например, производные целлюлозы, такие как гидроксипропилцеллюлоза низкого замещения, карбоксиметилцеллюлоза, карбоксиметилцеллюлоза кальция или карбоксиметилцеллюлоза натрия с поперечными межмолекулярными связями; или химически модифицированные производные крахмала или целлюлозы, такие как карбоксиметилкрахмал, карбоксиметилкрахмал натрия, или поливинилпирролидон с поперечными связями), эмульгаторы (например, коллоидная глина, такая как бентонит или вигум; гидроксиды металла, такие как гидроксид магния или гидроксид алюминия; анионные поверхностно-активные вещества, такие как лаурилсульфат натрия или стеарат кальция; катионные поверхностно-активные вещества, такие как хлорид бензалкония; и неионные поверхностно-активные вещества, такие как полиоксиэтиленовые алкиловые эфиры, полиоксиэтиленовые эфиры сорбита и жирных кислот или эфиры сахарозы и жирных кислот), стабилизаторы (например, производные эфира пара-гидроксибензойной кислоты, такие как метилпарабен или пропилпарабен; производные спирта, такие как хлорбутанол, бензил спирт или фенилэтиловый спирт; хлорид бензалкония; производные фенола, такие как фенол или крезол; тимерозал; дегидроуксусная кислота; или сорбиновая кислота), модификаторы (например, подсластители, вещества, придающие кислый вкус, ароматизаторы или подобные обычно используемые вещества) и разбавители.

Конкретная доза соединения по настоящему изобретению будет изменяться в зависимости от тяжести симптомов пациента, возраста и тому подобного. Для перорального введения взрослому человеку количество активного ингредиента в однократной дозе может быть в пределах от 0,016 мг/кг (предпочтительно, 0,5 мг/кг) до 33,3 мг/кг (предпочтительно, 25 мг/кг). Однократная доза для внутривенного введения может быть в пределах от 0,008 мг/кг (предпочтительно, 0,08 мг/кг) до 8,3 мг/кг (предпочтительно, 4,2 мг/кг) соединения по настоящему изобретению. Однократная доза может вводиться взрослому человеку от 1 до 6 раз в день, в зависимости от тяжести симптомов пациента.

Примеры

Далее настоящее изобретение описывается более подробно с помощью примеров, примеров исследований и примеров препаратов.

Когда для определения характеристик гидрохлоридных соединений в качестве растворителя используется CDCl3, данные ЯМР представлены для соответствующих свободных оснований. Свободные основания могут быть получены обработкой небольшого количества гидрохлоридных соединений водным раствором гидрокарбоната натрия и осуществлением экстракции этилацетатом или дихлорметаном.

(Пример 1) Дигидрохлорид (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(морфолин-4-ил)этилиден]пиперидина (гидрохлоридное производное соединения № 5-28)

(a) (E)-4-(трет-Бутилдиметилсилилокси)-3-[(этоксикарбонил)-метилиден]-1-(трифенилметил)пиперидин

К раствору (E)-3-[(этоксикарбонил)метилиден]-1-(трифенилметил)пиперидин-4-ола (14,97 г) в N,N-диметилформамиде (130 мл) добавляли хлорид трет-бутилдиметилсилила (6,86 г), имидазол (3,34 г) и 4-диметиламинопиридин (0,43 г) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение ночи. Реакционную смесь разбавляли этилацетатом и промывали насыщенным водным раствором хлорида натрия, и органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (этилацетат/гексан=1/19) с получением указанного в заголовке соединения (16,38 г, выход 86%) в виде бесцветного аморфного твердого вещества.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,01 (3H, c), 0,02 (3H, c), 0,90 (9H, c), 1,12 (3H, т, J=7,0), 1,59-1,74 (1H, м), 1,83-2,01 (3H, м), 3,00-3,12 (1H, м), 3,90 (1H, т, J=9,0), 3,96-4,15 (2H, м), 4,73 (1H, м), 6,06 (1H, c), 7,11-7,18 (3H, м), 7,20-7,28 (6H, м), 7,36-7,54 (6H, м).

(b) (E)-4-(трет-Бутилдиметилсилилокси)-3-(2-гидроксиэтилиден)-1-(трифенилметил)пиперидин

К раствору (E)-4-(трет-бутилдиметилсилилокси)-3-[(этоксикарбонил)метилиден]-1-(трифенилметил)пиперидина (15,14 г), полученного в (a) выше, в дихлорметане (110 мл) добавляли 1,01 н. раствор гидрида диизобутилалюминия в толуоле (66,40 мл) при -70°C и полученную смесь перемешивали при той же температуре в течение 3 часов. К реакционной смеси добавляли водный раствор хлорида аммония и затем экстрагировали этилацетатом. Экстракт промывали насыщенным водным раствором хлорида натрия и органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (этилацетат/гексан=1/3) с получением указанного в заголовке соединения (13,22 г, выход 95%) в виде бесцветного аморфного твердого вещества.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,01 (6H, c), 0,88 (9H, c), 1,62-2,00 (4H, м), 2,88-3,05 (1H, м), 3,51-3,71 (1H, м), 3,86 (1H, м), 4,07-4,24 (2H, м), 5,79 (1H, т, J=7,0), 7,11-7,33 (9H, м), 7,36-7,58 (6H, м).

(c) (E)-4-(трет-Бутилдиметилсилилокси)-3-[2-(тозилокси)этилиден]-1-(трифенилметил)пиперидин

К раствору (E)-4-(трет-бутилдиметилсилилокси)-3-(2-гидроксиэтилиден)-1-(трифенилметил)пиперидина (1,11 г), полученного в (b) выше, и ангидрида п-толуолсульфоновой кислоты (0,90 г) в дихлорметане (25 мл) добавляли триэтиламин (0,37 мл) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 2,5 часов. К реакционной смеси добавляли насыщенный водный раствор хлорида натрия и затем экстрагировали этилацетатом. Экстракт промывали насыщенным водным раствором хлорида натрия и органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме с получением указанного в заголовке соединения (1,64 г, количественный выход) в виде масла светло-желтого цвета.

1H ЯМР (400 МГц, CDCl3) δ м.д.: -0,04 (3H, c), -0,01 (3H, c), 0,86 (9H, c), 1,60-1,92 (4H, м), 2,47 (3H, c), 2,96 (1H, ушир. с), 3,47 (1H, м), 3,79 (1H, м), 4,61 (2H, м), 5,65 (1H, т, J=7,5), 7,13-7,48 (17H, м), 7,73 (2H, д, J=9,0).

(d) (E)-4-(трет-Бутилдиметилсилилокси)-3-[2-(морфолин-4-ил)этилиден]-1-(трифенилметил)пиперидин

К раствору (E)-4-(трет-бутилдиметилсилилокси)-3-[2-(тозилокси)этилиден]-1-(трифенилметил)пиперидина (1,64 г), полученного в (c) выше, и морфолина (0,29 мл) в смешанном растворителе, состоящем из N,N-диметилформамида (25 мл) и дихлорметана (5 мл), добавляли карбонат калия (0,34 г) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение ночи. К реакционной смеси добавляли насыщенный водный раствор хлорида натрия и затем экстрагировали этилацетатом. Экстракт промывали насыщенным водным раствором хлорида натрия и органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (этилацетат/гексан=2/3) с получением указанного в заголовке соединения (1,01 г, выход: 80%) в виде бесцветного масла.

1H ЯМР (400 МГц, CDCl3) δ м.д.: -0,03 (3H, c), -0,02 (3H, c), 0,84 (9H, c), 1,74-2,06 (4H, м), 2,42 (4H, ушир. с), 2,77-2,93 (1H, м), 2,99 (1H, дд, J=13,5, 6,5), 3,07 (1H, дд, J=13,5, 6,5), 3,38-3,56 (1H, м), 3,71 (4H, т, J=4,5), 3,87 (1H, м), 5,62 (1H, т, J=6,5), 7,11-7,30 (9H, м), 7,38-7,55 (6H, м).

(e) (E)-4-Гидрокси-3-[2-(морфолин-4-ил)этилиден]-1-(трифенилметил)пиперидин

К раствору (E)-4-(трет-бутилдиметилсилилокси)-3-[2-(морфолин-4-ил)этилиден]-1-(трифенилметил)пиперидина (1,00 г), полученного в (d) выше, в тетрагидрофуране (20 мл) добавляли фторид тетрабутиламмония (0,99 г) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 14 часов. К реакционной смеси добавляли воду и затем экстрагировали этилацетатом. Экстракт промывали насыщенным водным раствором хлорида натрия и органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (метанол/дихлорметан=9/91) с получением указанного в заголовке соединения (0,80 г, количественный выход) в виде бесцветного масла.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,74-1,86 (1H, м), 1,96-2,14 (2H, м), 2,45 (5H, ушир. с), 2,59-2,69 (1H, м), 3,01 (2H, м), 3,10-3,34 (1H, м), 3,72 (4H, т, J=4,5), 3,98 (1H, м), 5,61 (1H, т, J=6,5), 7,11-7,32 (9H, м), 7,39-7,57 (6H, м).

(f) Дигидрохлорид (E)-4-гидрокси-3-[2-(морфолин-4-ил)этилиден]пиперидина

К раствору (E)-4-гидрокси-3-[2-(морфолин-4-ил)этилиден]-1-(трифенилметил)пиперидина (1,08 г), полученного в (e) выше, в диоксане (9 мл) добавляли 4 н. раствор хлористого водорода в диоксане (3 мл) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 15 минут. Реакционную смесь упаривали в вакууме и остаток распределяли между водой и этилацетатом. Водный слой удаляли в вакууме с получением указанного в заголовке соединения (0,69 г, количественный выход) в виде аморфного твердого вещества светло-желтого цвета.

1H ЯМР (400 МГц, ДМСО-d6) δ м.д.: 1,66-1,77 (1H, м), 1,95-2,07 (1H, м), 3,10 (4H, м), 3,21-3,65 (3H, м), 3,73-4,02 (6H, м), 4,06 (1H, д, J=13,5), 4,19 (1H, м), 5,90 (1H, т, J=8,0).

(g) (E)-1-[2-Циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-гидрокси-3-[2-(морфолин-4-ил)этилиден]пиперидин

К раствору дигидрохлорида (E)-4-гидрокси-3-[2-(морфолин-4-ил)этилиден]пиперидина (0,65 г), полученного в (f) выше, и 2-бром-2-(2-фторфенил)-1-циклопропилэтанона (0,73 г) в N,N-диметилформамиде (12 мл) добавляли триэтиламин (1,16 мл) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение ночи. Реакционную смесь разбавляли этилацетатом и промывали водой и насыщенным водным раствором хлорида натрия, и органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (метанол/дихлорметан=3/17) с получением указанного в заголовке соединения (0,65 г, выход 74%) в виде аморфного твердого вещества светло-желтого цвета.

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,78-0,90 (2H, м), 0,96-1,09 (2H, м), 1,66-1,78 (1H, м), 1,95-2,04 (1H, м), 2,15-2,25 (1H, м), 2,42 (4H, ушир. с), 2,45-2,55 (1H, м), 2,78 и 3,00 (все 1H, каждый д, J=12,5), 2,79-2,88 (1H, м), 2,95 (2H, д, J=6,5), 3,31 и 3,45 (все 1H, каждый д, J=12,5), 3,70 (4H, т, J=4,5), 4,09 и 4,13 (все 1H, каждый м), 4,69 и 4,71 (все 1H, каждый c), 5,59 и 5,61 (все 1H, каждый т, J=6,5), 7,11 (1H, м), 7,17 (1H, м), 7,29-7,36 (1H, м), 7,38-7,45 (1H, м).

(h) Дигидрохлорид (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(морфолин-4-ил)этилиден]пиперидин

К раствору (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-гидрокси-3-[2-(морфолин-4-ил)этилиден]пиперидина (890 мг), полученного в (g) выше, в толуоле (15 мл) добавляли тиоуксусную кислоту (0,33 мл) и N,N-диметилформамид динеопентилацеталя (1,92 мл) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 3 часов. Реакционную смесь разбавляли этилацетатом и промывали насыщенным водным раствором хлорида натрия, и органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (метанол/дихлорметан=1/19) с получением в свободном виде (393 мг, выход 38%) указанного в заголовке соединения в виде бесцветного аморфного твердого вещества. К раствору части этого соединения (88 мг) в диоксане (4 мл) добавляли 4 н. раствор хлористого водорода в диоксане (0,25 мл) при комнатной температуре и растворитель удаляли в вакууме с получением указанного в заголовке соединения (111 мг, количественный выход) в виде бесцветного аморфного твердого вещества.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,76-0,90 (2H, м), 0,95-1,10 (2H, м), 1,74-1,85 (1H, м), 2,06-2,24 (2H, м), 2,28 и 2,29 (все 3H, каждый c), 2,38 (4H, ушир. с), 2,47-2,79 (2H, м), 2,80 и 3,06 (все 1H, каждый д, J=12,5), 2,88 и 2,94 (все 2H, каждый д, J=6,5), 3,29 и 3,37 (все 1H, каждый д, J=12,5), 3,69 (4H, м), 4,30 и 4,33 (все 1H, каждый т, J=4,5), 4,68 и 4,70 (все 1H, каждый c), 5,64 (1H, т, J=6,5), 7,07-7,20 (2H, м), 7,29-7,43 (2H, м);

ИК (KBr, см-1): 1700, 1494.

(Пример 2) Дигидрохлорид (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(морфолин-4-ил)этилиден]-4-сульфанилпиперидина (гидрохлоридное производное соединения № 5-27)

К раствору (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(морфолин-4-ил)этилиден]пиперидина (180 мг), полученного в примере 1 (h), в метаноле (4 мл) добавляли карбонат калия (48 мг) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 15 минут. Реакционную смесь разбавляли этилацетатом и промывали насыщенным водным раствором хлорида натрия и органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме и остаток очищали, используя препаративную ВЭЖХ (YMC-Pack ODS-A; YMC, элюент: ацетонитрил/0,024 н. соляная кислота=15/85) с получением указанного в заголовке соединения (83 мг, выход 50%) в виде бесцветного аморфного твердого вещества.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,77-0,91 (2H, м), 0,95-1,10 (2H, м), 1,67-1,77 (1H, м), 2,12-2,26 (2H, м), 2,39 (4H, ушир. с), 2,46-2,95 (3H, м), 2,88 и 3,20 (все 2H, каждый д, J=7,0), 3,13 и 3,37 (все 1H, каждый д, J=12,5), 3,69 (4H, м), 3,80 (1H, м), 4,71 и 4,73 (все 1H, каждый c), 5,59 и 5,62 (все 1H, каждый т, J=7,0), 7,07-7,21 (2H, м), 7,28-7,37 (1H, м), 7,39-7,45 (1H, м);

ИК (KBr, см-1): 2556, 1712, 1494.

(Пример 3)

(E)-4-(Ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(пиперидин-1-ил)этилиден]пиперидин (соединение № 5-2)

(a) (E)-4-(трет-Бутилдиметилсилилокси)-3-[2-(пиперидин-1-ил)этилиден]-1-(трифенилметил)пиперидин

Указанное в заголовке соединение синтезировали с выходом 67% в виде бесцветного масла, используя пиперидин вместо морфолина, проведением реакции, аналогичной описанной в примере 1 (d).

1H ЯМР (400 МГц, CDCl3) δ м.д.: -0,01 (6H, c), 0,81 (9H, c), 1,37-1,61 (8H, м), 1,74-1,93 (2H, м), 2,31-2,39 (4H, м), 2,75-3,07 (4H, м), 3,86 (1H, м), 5,63 (1H, т, J=6,5), 7,11-7,18 (3H, м), 7,21-7,28 (6H, м), 7,41-7,51 (6H, м).

(b) (E)-4-Гидрокси-3-[2-(пиперидин-1-ил)этилиден]-1-(трифенилметил)пиперидин

Указанное в заголовке соединение синтезировали с количественным выходом в виде бесцветного масла, используя (E)-4-(трет-бутилдиметилсилилокси)-3-[2-(пиперидин-1-ил)этилиден]-1-(трифенилметил)пиперидин, полученный в (a) выше, проведением реакции, аналогичной описанной в примере 1 (e).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 1,48-2,11 (14H, м), 2,69-3,46 (4H, м), 4,01 (1H, м), 5,89 (1H, т, J=5,0), 7,15-7,21 (3H, м), 7,24-7,31 (6H, м), 7,40-7,51 (6H, м).

(c) (E)-4-Гидрокси-3-[2-(пиперидин-1-ил)этилиден]пиперидин бис(гидротрифторацетат)

К раствору (E)-4-гидрокси-3-[2-(пиперидин-1-ил)этилиден]-1-(трифенилметил)пиперидина (412 мг), полученного в (b) выше, в дихлорметане (10 мл) добавляли трифторуксусную кислоту (0,21 мл) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 3 часов. К реакционной смеси добавляли трифторуксусную кислоту (0,21 мл) и полученную смесь перемешивали при комнатной температуре в течение еще 1 часа. К реакционной смеси добавляли метанол (5 мл) и полученную смесь упаривали в вакууме. Остаток распределяли между водой и этилацетатом и водный слой удаляли в вакууме с получением указанного в заголовке соединения (403 мг, количественный выход) в виде аморфного твердого вещества светло-желтого цвета.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,35-1,49 (2H, м), 1,82-2,21 (6H, м), 2,73-2,82 (2H, м), 3,45-3,88 (7H, м), 4,12 (1H, д, J=13,0), 4,31-4,36 (1H, м), 6,01 (1H, т, J=8,0).

(d) (E)-1-[2-Циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-гидрокси-3-[2-(пиперидин-1-ил)этилиден]пиперидин

Указанное в заголовке соединение синтезировали с выходом 60% в виде масла светло-желтого цвета, используя (E)-4-гидрокси-3-[2-(пиперидин-1-ил)этилиден]пиперидин бис(гидротрифторацетат), полученный в (c) выше, проведением реакции, аналогичной описанной в примере 1 (g).

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,79-1,10 (4H, м), 1,38-1,84 (8H, м), 1,93-2,03 (1H, м), 2,21-2,55 (6H, м), 2,78-3,01 (3H, м), 3,32 и 3,41 (все 1H, каждый д, J=12,5), 4,08-4,14 (1H, м), 4,67 и 4,69 (все 1H, каждый c), 5,63 и 5,64 (все 1H, каждый т, J=7,0), 7,07-7,19 (2H, м), 7,28-7,46 (2H, м).

(e) (E)-4-(Ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(пиперидин-1-ил)этилиден]пиперидин

К раствору трифенилфосфина (290 мг) в тетрагидрофуране (4,5 мл) в токе газообразного азота добавляли 40% раствор диизопропил азодикарбоксилата в толуоле (0,59 мл) при -10°C и полученную смесь перемешивали при той же температуре в течение 1 часа. Затем к реакционной смеси добавляли по каплям раствор (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-гидрокси-3-[2-(пиперидин-1-ил)этилиден]пиперидина (211 мг) в тетрагидрофуране (1,5 мл), полученного в (d) выше, и тиоуксусную кислоту (0,14 мл) и далее полученную смесь перемешивали при комнатной температуре в течение 22 часов. Реакционную смесь упаривали в вакууме и остаток очищали колоночной хроматографией на силикагеле (метанол/дихлорметан=1/49) с получением указанного в заголовке соединения (138 мг, выход 57%) в виде масла светло-желтого цвета.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,78-0,90 (2H, м), 0,96-1,08 (2H, м), 1,41-1,50 (2H, м), 1,59-1,71 (4H, м), 1,75-1,84 (1H, м), 2,07-2,23 (2H, м), 2,28 и 2,29 (все 3H, каждый c), 2,40-3,10 (9H, м), 3,16-3,39 (1H, м), 4,29 и 4,33 (все 1H, каждый т, J=4,5), 4,68 и 4,72 (все 1H, каждый c), 5,69 (1H, т, J=6,5), 7,08-7,21 (2H, м), 7,29-7,41 (2H, м);

ИК (жидкая пленка, см-1): 1696, 1488.

(Пример 4) (E)-1-[2-Циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(пиперидин-1-ил)этилиден]-4-сульфанилпиперидин бис(гидротрифторацетат) (трифторацетатное производное соединения № 5-1)

Указанное в заголовке соединение синтезировали с выходом 11% в виде бесцветного масла, используя (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(пиперидин-1-ил)этилиден]пиперидин, полученный в примере 3 (e), проведением реакции, аналогичной описанной в примере 2.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,76-0,93 (2H, м), 0,99-1,10 (2H, м), 1,31-1,47 (2H, м), 1,63-2,07 (7H, м), 2,22-2,32 (1H, м), 2,56-3,87 (10H, м), 4,93 и 4,98 (все 1H, каждый c), 5,74 (1H, т, J=6,5), 7,15-7,31 (3H, м), 7,36-7,46 (1H, м);

MS (FAB) m/z: 403 (M+H)+.

(Пример 5) Дигидрохлорид (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(тиоморфолин-4-ил)этилиден]пиперидина (гидрохлоридное производное соединения № 5-30)

(a) (E)-4-(трет-Бутилдиметилсилилокси)-3-[2-(тиоморфолин-4-ил)этилиден]-1-(трифенилметил)пиперидин

Указанное в заголовке соединение синтезировали с выходом 62% в виде бесцветного масла, используя тиоморфолин вместо морфолина, проведением реакции, аналогичной описанной в примере 1 (d).

1H ЯМР (500 МГц, CDCl3) δ м.д.: -0,03 (3H, c), -0,02 (3H, c), 0,84 (9H, c), 1,76-1,95 (4H, м), 2,61-2,72 (7H, м), 2,77-2,91 (1H, м), 2,98-3,10 (2H, м), 3,31-3,66 (2H, м), 3,87 (1H, м), 5,56-5,63 (1H, м), 7,10-7,19 (3H, м), 7,21-7,35 (6H,m), 7,38-7,53 (6H, м).

(b) (E)-4-Гидрокси-3-[2-(тиоморфолин-4-ил)этилиден]-1-(трифенилметил)пиперидин

Указанное в заголовке соединение синтезировали с выходом 99% в виде аморфного твердого вещества светло-желтого цвета, используя (E)-4-(трет-бутилдиметилсилилокси)-3-[2-(тиоморфолин-4-ил)этилиден]-1-(трифенилметил)пиперидин, полученный в (a) выше, проведением реакции, аналогичной описанной в примере 1 (e).

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,61-1,87 (2H, м), 1,98-2,14 (2H, м), 2,60-2,80 (8H, м), 2,98-3,06 (2H, м), 3,35-3,46 (2H, м), 3,93-4,02 (1H, м), 5,58 (1H, т, J=6,0), 7,12-7,20 (3H, м), 7,22-7,32 (6H, м), 7,38-7,56 (6H, м).

(c) (E)-4-Гидрокси-3-[2-(тиоморфолин-4-ил)этилиден]пиперидин бис(гидроацетат)

К раствору (E)-4-гидрокси-3-[2-(тиоморфолин-4-ил)этилиден]-1-(трифенилметил)пиперидина (4,91 г), полученного в (b) выше, в дихлорметане (100 мл) добавляли уксусную кислоту (44 мл) при комнатной температуре и полученную смесь нагревали с обратным холодильником в течении 1 часа. Реакционную смесь упаривали в вакууме и остаток очищали колоночной хроматографией на силикагеле (метанол/дихлорметан=1/4) с получением указанного в заголовке соединения (3,56 г, выход 98%) в виде светло-коричневого кристаллического вещества.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,61-1,70 (1H, м), 1,97-2,02 (1H, м), 2,62-2,77 (8H, м), 2,82-2,90 (1H, м), 3,02-3,08 (2H, м), 3,17-3,23 (2H, м), 3,74-3,78 (1H, м), 4,15-4,20 (1H, м), 5,58 (1H, т, J=6,0).

(d) (E)-1-[2-Циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-гидрокси-3-[2-(тиоморфолин-4-ил)этилиден]пиперидин

Указанное в заголовке соединение синтезировали с выходом 65% в виде аморфного твердого вещества светло-коричневого цвета, используя (E)-4-гидрокси-3-[2-(тиоморфолин-4-ил)этилиден]пиперидин бис(гидроацетат), полученный в (c) выше, проведением реакции, аналогичной описанной в примере 1 (g).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,76-1,12 (4H, м), 1,61-1,82 (1H, м), 1,94-2,04 (1H, м), 2,14-2,24 (1H, м), 2,44-2,54 (1H, м), 2,59-2,73 (8H, м), 2,76 и 2,98 (все 1H, каждый д, J=12,5), 2,77-2,89 (1H, м), 2,96 (2H, д, J=7,0), 3,30 и 3,45 (все 1H, каждый д, J=12,5), 4,05-4,16 (1H, м), 4,69 и 4,70 (все 1H, каждый c), 5,54-5,62 (1H, м), 7,06-7,22 (2H, м), 7,28-7,46 (2H, м).

(e) Дигидрохлорид (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(тиоморфолин-4-ил)этилиден]пиперидина

Указанное в заголовке соединение синтезировали с выходом 26% в виде порошкообразного кристаллического вещества светло-желтого цвета, используя (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-гидрокси-3-[2-(тиоморфолин-4-ил)этилиден]пиперидин, полученный в (d) выше, проведением реакции, аналогичной описанной в примере 1 (h).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,74-1,12 (4H, м), 1,50-1,62 (1H, м), 1,74-1,85 (1H, м), 2,06-2,27 (2H, м), 2,29 и 2,30 (все 3H, каждый c), 2,44-2,72 (9H, м), 2,77 и 3,04 (все 1H, каждый д, J=12,5), 2,84-2,98 (2H, м), 3,27 и 3,35 (все 1H, каждый д, J=12,5), 4,26-4,36 (1H, м), 4,67 и 4,70 (все 1H, каждый c), 5,57-5,64 (1H, м), 7,07-7,22 (2H, м), 7,28-2,45 (2H, м);

MS (FAB) m/z: 463 (M+H)+.

(Пример 6) (E)-1-[2-Циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанил-3-[2-(тиоморфолин-4-ил)этилиден]пиперидин дигидрохлорид (гидрохлоридное производное соединения № 5-29)

Указанное в заголовке соединение синтезировали с выходом 94% в виде порошкообразного кристаллического вещества светло-желтого цвета, используя (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(тиоморфолин-4-ил)этилиден]пиперидин, полученный в примере 5 (e), проведением реакции, аналогичной описанной в примере 2.

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,77-1,12 (4H, м), 1,68-1,77 (1H, м), 2,11-2,27 (2H, м), 2,55-2,71 (9H, м), 2,72-2,85 (1H, м), 2,86-2,97 (2H, м), 3,13-3,24 (1H, м), 3,11 и 3,36 (все 1H, каждый д, J=12,5), 3,70-3,82 (1H, м), 4,72 и 4,70 (все 1H, каждый c), 5,51-5,63 (1H, м), 7,07-7,21 (2H, м), 7,29-7,45 (2H, м);

MS (FAB) m/z: 418 (M+H)+.

(Пример 7) (E)-4-(Ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(3-оксопиперазин-1-ил)этилиден]пиперидин (производное соединения № 5-88)

(a) (E)-4-(трет-Бутилдиметилсилилокси)-3-[2-(3-оксопиперазин-1-ил)этилиден]-1-(трифенилметил)пиперидин

Указанное в заголовке соединение синтезировали с выходом 66% в виде светло-коричневого масла, используя 2-оксопиперазин вместо морфолина, проведением реакции, аналогичной описанной в примере 1 (d).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,02 (6H, c), 0,85 (9H, c), 1,72-1,95 (4H, м), 2,60-2,66 (2H, м), 2,80-3,19 (5H, м), 3,25-3,47 (3H, м), 3,82-3,90 (1H, м), 5,57-5,64 (1H, м), 7,13-7,21 (3H, м), 7,22-7,32 (6H, м), 7,39-7,57 (6H, м).

(b) (E)-4-Гидрокси-3-[2-(3-оксопиперазин-1-ил)этилиден]-1-(трифенилметил)пиперидин

Указанное в заголовке соединение синтезировали с выходом 96% в виде масла светло-желтого цвета, используя (E)-4-(трет-бутилдиметилсилилокси)-3-[2-(3-оксопиперазин-1-ил)этилиден]-1-(трифенилметил)пиперидин, полученный в (a) выше, проведением реакции, аналогичной описанной в примере 1 (e)

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,75-2,12 (4H, м), 2,62-2,69 (2H, м), 3,02-3,16 (2H, м), 3,32-3,42 (6H, м), 3,92-4,01 (1H, м), 5,57-5,62 (1H, м), 7,12-7,20 (3H, м), 7,22-7,31 (6H, м), 7,38-7,56 (6H, м).

(c) (E)-4-Гидрокси-3-[2-(3-оксопиперазин-1-ил)этилиден]пиперидин бис(гидроацетат)

Указанное в заголовке соединение синтезировали с выходом 85% в виде светло-коричневого кристаллического вещества, используя (E)-4-гидрокси-3-[2-(3-оксопиперазин-1-ил)этилиден]-1-(трифенилметил)пиперидин, полученный в (b) выше, проведением реакции, аналогичной описанной в примере 5 (c).

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,59-1,73 (2H, м), 2,57-2,61 (1H, м), 2,64-2,70 (2H, м), 3,08-3,25 (5H, м), 3,29-3,39 (3H, м), 3,73-3,78 (1H, м), 4,16-4,22 (1H, м), 5,56-5,63 (1H, м).

(d) (E)-1-[2-Циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-гидрокси-3-[2-(3-оксопиперазин-1-ил)этилиден]пиперидин

Указанное в заголовке соединение синтезировали с выходом 63% в виде аморфного твердого вещества светло-коричневого цвета, используя (E)-4-гидрокси-3-[2-(3-оксопиперазин-1-ил)этилиден]пиперидин бис(гидроацетат), полученный в (c) выше, проведением реакции, аналогичной описанной в примере 1 (g).

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,76-1,10 (4H, м), 1,62-1,80 (2H, м), 1,94-2,05 (1H, м), 2,12-2,23 (1H, м), 2,43-2,53 (1H, м), 2,57-2,68 (2H, м), 2,73 и 2,98 (все 1H, каждый д, J=12,5), 2,78-2,92 (1H, м), 2,94-3,08 (2H, м), 3,28-3,42 (3H, м), 3,45-3,52 (1H, м), 4,05-4,19 (1H, м), 4,67-4,74 (1H, м), 5,53-5,65 (1H, м), 7,06-7,23 (2H, м), 7,28-7,48 (2H, м).

(e) (E)-4-(Ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(3-оксопиперазин-1-ил)этилиден]пиперидин

Указанное в заголовке соединение синтезировали с выходом 22% в виде аморфного твердого вещества светло-желтого цвета, используя (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-гидрокси-3-[2-(3-оксопиперазин-1-ил)этилиден]пиперидин, полученный в (d) выше, проведением реакции, аналогичной описанной в примере 1 (h).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,69-1,10 (4H, м), 1,73-1,86 (1H, м), 2,06-2,26 (2H, м), 2,29 и 2,30 (все 3H, каждый c), 2,44-2,72 (4H, м), 2,74-2,85 (1H, м), 2,95 и 3,01 (все 2H, каждый д, J=7,0), 3,03-3,10 (2H, м), 3,28 и 3,38 (все 1H, каждый д, J=12,5), 3,29-3,38 (2H, м), 4,26-4,36 (1H, м), 4,69 и 4,71 (все 1H, каждый c), 5,62 (1H, т, J=7,0), 5,78 (1H, ушир. с), 7,07-7,24 (2H, м), 7,28-7,48 (2H, м);

MS (FAB) m/z: 460 (M+H)+.

(Пример 8) Дигидрохлорид (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(3-оксопиперазин-1-ил)этилиден]-4-сульфанилпиперидина (гидрохлоридное производное соединения № 5-87)

Указанное в заголовке соединение синтезировали с выходом 91% в виде порошкообразного кристаллического вещества светло-желтого цвета, используя (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(3-оксопиперазин-1-ил)этилиден]пиперидин, полученный в примере 7 (e), проведением реакции, аналогичной описанной в примере 2.

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,75-1,10 (4H, м), 1,69-1,78 (1H, м), 2,11-2,28 (2H, м), 2,53-2,70 (3H, м), 2,73-2,86 (1H, м), 2,92-3,22 (4H, м), 3,30-3,45 (3H, м), 3,66-3,82 (1H, м), 4,72 и 4,73 (все 1H, каждый c), 5,52-5,64 (1H, м), 7,07-7,22 (2H, м), 7,29-7,44 (2H, м);

MS (FAB) m/z: 418 (M+H)+.

(Пример 9) Тригидрохлорид (E)-4-(Ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(пиперазин-1-ил)этилиден]пиперидина (гидрохлоридное производное соединения № 5-32)

(a) (E)-3-{2-[4-(трет-Бутоксикарбонил)пиперазин-1-ил]этилиден}-4-(трет-бутилдиметилсилилокси)-1-(трифенилметил)пиперидин

Указанное в заголовке соединение синтезировали с выходом 61% в виде бесцветного аморфного твердого вещества, используя 1-(трет-бутоксикарбонил)пиперазин вместо морфолина, проведением реакции, аналогичной описанной в примере 1 (d).

1H ЯМР (500 МГц, CDCl3) δ м.д.: -0,03 (3H, c), -0,02 (3H, c), 0,84 (9H, c), 1,46 (9H, c), 1,73-1,96 (3H, м), 2,30-2,41 (4H, м), 2,74-3,12 (4H, м), 3,36-3,46 (4H, м), 3,47-3,52 (1H, м), 3,81-3,92 (1H, м), 5,66 (1H, т, J=6,0), 7,10-7,19 (3H, м), 7,20-7,32 (6H, м), 7,34-7,57 (6H, м).

(b) (E)-3-{2-[4-(трет-Бутоксикарбонил)пиперазин-1-ил]этилиден}-4-гидрокси-1-(трифенилметил)пиперидин

Указанное в заголовке соединение синтезировали с выходом 99% в виде бесцветного аморфного твердого вещества, используя (E)-3-{2-[4-(трет-бутоксикарбонил)пиперазин-1-ил]этилиден}-4-(трет-бутилдиметилсилилокси)-1-(трифенилметил)пиперидин, полученный в (a) выше, проведением реакции, аналогичной описанной в примере 1 (e).

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,47 (9H, c), 1,57-1,84 (4H, м), 2,32-2,45 (4H, м), 2,92-3,08 (2H, м), 3,36-3,52 (6H, м), 3,93-4,03 (1H, м), 5,61 (1H, т, J=6,0), 7,11-7,20 (3H, м), 7,21-7,33 (6H, м), 7,40-7,55 (6H, м).

(c) (E)-3-{2-[4-(трет-Бутоксикарбонил)пиперазин-1-ил]этилиден}-4-гидроксипиперидин бис(гидроацетат)

Указанное в заголовке соединение синтезировали с выходом 99% в виде светло-коричневого кристаллического вещества, используя (E)-3-{2-[4-(трет-бутоксикарбонил)пиперазин-1-ил]этилиден}-4-гидрокси-1-(трифенилметил)пиперидин, полученный в (b) выше, проведением реакции, аналогичной описанной в примере 5 (c).

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,45 (9H, c), 1,56-1,73 (1H, м), 1,86-2,04 (1H, м), 2,32-2,46 (4H, м), 2,80-2,91 (1H, м), 2,94-3,07 (2H, м), 3,17-3,29 (2H, м), 3,35-3,46 (4H, м), 3,51 и 3,74 (все 1H, каждый д, J=13,5), 4,03-4,11 (1H, м), 5,57-5,66 (1H, м).

(d) (E)-3-{2-[4-(трет-Бутоксикарбонил)пиперазин-1-ил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-гидроксипиперидин

Указанное в заголовке соединение синтезировали с выходом 64% в виде аморфного твердого вещества светло-коричневого цвета, используя (E)-3-{2-[4-(трет-бутоксикарбонил)пиперазин-1-ил]этилиден}-4-гидроксипиперидин бис(гидроацетат), полученный в (c) выше, проведением реакции, аналогичной описанной в примере 1 (g).

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,76-1,11 (4H, м), 1,46 (9H, c), 1,64-1,81 (2H, м), 1,93-2,04 (1H, м), 2,13-2,25 (1H, м), 2,28-2,40 (4H, м), 2,44-2,55 (1H, м), 2,76 и 2,99 (все 1H, каждый д, J=13,0), 2,78-2,90 (1H, м), 2,90-2,98 (1H, м), 3,31 и 3,45 (все 1H, каждый д, J=13,0), 3,37-3,45 (4H, м), 4,04-4,18 (1H, м), 4,69 и 4,70 (все 1H, каждый c), 5,55-5,64 (1H, м), 7,06-7,21 (2H, м), 7,27-7,36 (1H, м), 7,37-7,45 (1H, м).

(e) (E)-4-(Ацетилсульфанил)-3-{2-[4-(трет-бутоксикарбонил)пиперазин-1-ил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]пиперидин

Указанное в заголовке соединение синтезировали с выходом 36% в виде масла коричневого цвета, используя (E)-3-{2-[4-(трет-бутоксикарбонил)пиперазин-1-ил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-гидроксипиперидин, полученный в (d) выше, проведением реакции, аналогичной описанной в примере 1 (h).

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,76-1,10 (4H, м), 1,46 (9H, c), 1,75-1,84 (1H, м), 2,07-2,28 (2H, м), 2,22-2,37 (4H, м), 2,28 и 2,29 (все 3H, каждый c), 2,47-2,62 (1H, м), 2,65-2,80 (1H, м), 2,79 и 3,05 (все 1H, каждый д, J=13,0), 2,84-2,90 (1H, м), 2,91-2,96 (1H, м), 3,29 и 3,36 (все 1H, каждый д, J=13,0), 3,36-3,45 (4H, м), 4,27-4,36 (1H, м), 4,67 и 4,69 (все 1H, каждый c), 5,63 (1H, т, J=6,5), 7,08-7,20 (2H, м), 7,28-7,36 (1H, м), 7,40 (1H, м).

(f) Тригидрохлорид (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(пиперазин-1-ил)этилиден]пиперидина

К раствору (E)-4-(ацетилсульфанил)-3-{2-[4-(трет-бутоксикарбонил)пиперазин-1-ил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]пиперидина (1,06 г), полученного в (e) выше, в диоксане (21 мл) добавляли 4 н. раствор хлористого водорода в диоксане (24 мл) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 3 часов. Реакционную смесь упаривали в вакууме с получением указанного в заголовке соединения (1,25 г, количественный выход) в виде кристаллического вещества светло-желтого цвета.

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,76-1,10 (4H, м), 1,62-1,85 (2H, м), 2,09-2,25 (2H, м), 2,28 (3H, c), 2,31-2,45 (4H, м), 2,47-2,62 (1H, м), 2,64-2,81 (1H, м), 2,80 и 3,05 (все 1H, каждый д, J=12,5), 2,84-2,97 (4H, м), 3,29 и 3,35 (все 1H, каждый д, J=12,5), 3,40-3,67 (1H, м), 4,26-4,36 (1H, м), 4,67 и 4,69 (все 1H, каждый c), 5,64 (1H, т, J=7,0), 7,07-7,21 (2H, м), 7,28-7,45 (2H, м);

MS (FAB) m/z: 446 (M+H)+.

(Пример 10) (E)-1-[2-Циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(пиперазин-1-ил)этилиден]-4-сульфанилпиперидин (производное соединения № 5-31) и (E)-3-[2-(4-ацетилпиперазин-1-ил)этилиден]-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидин (производное соединения № 5-33)

Оба указанных в заголовке соединения синтезировали, используя (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(пиперазин-1-ил)этилиден]пиперидин, полученный в примере 9 (f), проведением реакции, аналогичной описанной в примере 2.

(E)-1-[2-Циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(пиперазин-1-ил)этилиден]-4-сульфанилпиперидин, имеющий высокую полярность: светло-желтое масло, выход 12%.

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,77-1,09 (4H, м), 1,67-1,76 (2H, м), 2,12-2,26 (2H, м), 2,29-2,43 (4H, м), 2,55-2,67 (1H, м), 2,70-2,82 (1H, м), 2,83-2,89 (4H, м), 2,90-2,95 (1H, м), 3,14 и 3,35 (все 1H, каждый д, J=12,5), 3,43-3,68 (1H, м), 3,72-3,83 (1H, м), 4,70 и 4,71 (все 1H, каждый c), 5,56-5,66 (1H, м), 7,06-7,21 (2H, м), 7,27-7,46 (2H, м);

MS (FAB) m/z: 404 (M+H)+.

(E)-3-[2-(4-Ацетилпиперазин-1-ил)этилиден]-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидин, имеющий низкую полярность: бесцветное масло, выход 46%.

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,75-1,09 (4H, м), 1,69-1,77 (1H, м), 2,08 (3H, c), 2,12-2,26 (2H, м), 2,27-2,43 (4H, м), 2,54-2,69 (1H, м), 2,73-2,85 (1H, м), 2,87-2,97 (2H, м), 3,08 и 3,37 (все 1H, каждый д, J=12,5), 3,13-3,24 (1H, м), 3,41-3,67 (4H, м), 3,69-3,82 (1H, м), 4,71 и 4,73 (все 1H, каждый c), 5,53-5,64 (1H, м), 7,08-7,20 (2H, м), 7,28-7,44 (2H, м);

MS (FAB) m/z: 446 (M+H)+.

(Пример 11) (E)-4-(Ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонилметил)пиперазин-1-ил]этилиден}пиперидин (производное соединения № 5-46)

(a) Тригидрохлорид (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-гидрокси-3-[2-(пиперазин-1-ил)этилиден]пиперидина

Указанное в заголовке соединение синтезировали с выходом 99% в виде светло-желтого кристаллического порошка, используя (E)-3-{2-[4-(трет-бутоксикарбонил)пиперазин-1-ил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-гидроксипиперидин, полученный в примере 9 (d), проведением реакции, аналогичной описанной в примере 9 (f).

1H ЯМР (400 МГц, ДМСО-d6) δ м.д.: 0,89-1,15 (4H, м), 1,74-1,96 (2H, м), 2,00-2,15 (1H, м), 2,82-4,25 (15H, м), 5,94-6,19 (2H, м), 7,40-7,54 (2H, м), 7,64-7,84 (2H, м).

(b) (E)-1-[2-Циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонилметил)пиперазин-1-ил]этилиден}-4-гидроксипиперидин

К суспензии тригидрохлорида (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-гидрокси-3-[2-(пиперазин-1-ил)этилиден]пиперидина (1,14 г), полученного в (a) выше, в ацетонитриле (35 мл) добавляли этилбромацетат (0,31 мл) и триэтиламин (1,92 мл) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 1 часа. После упаривания реакционной смеси в вакууме добавляли воду и смесь экстрагировали смешанным растворителем, состоящим из дихлорметана и изопропанола. Органический слой промывали насыщенным водным раствором хлорида натрия и сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (метанол/дихлорметан=1/9) с получением указанного в заголовке соединения (0,71 г, выход 66%) в виде масла светло-желтого цвета.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,77-0,90 (2H, м), 0,95-1,08 (2H, м), 1,28 (3H, т, J=7,0), 1,65-1,80 (2H, м), 1,94-2,03 (1H, м), 2,16-2,25 (1H, м), 2,41-2,70 (8H, м), 2,75-2,88 (2H, м), 2,96-3,02 (2H, м), 3,20 (2H, c), 3,30 и 3,44 (все 1H, каждый д, J=12,5), 4,06-4,15 (1H, м), 4,19 (2H, кв, J=7,0), 4,68 и 4,70 (все 1H, каждый c), 5,58-5,66 (1H, м), 7,07-7,21 (2H, м), 7,28-7,45 (2H, м).

(c) (E)-4-(Ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонилметил)пиперазин-1-ил]этилиден}пиперидин

Указанное в заголовке соединение синтезировали с выходом 23% в виде светло-коричневого масла, используя (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонилметил)пиперазин-1-ил]этилиден}-4-гидроксипиперидин, полученный в (b) выше, проведением реакции, аналогичной описанной в примере 1 (h).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,77-1,09 (4H, м), 1,27 (3H, т, J=7,0), 1,75-1,83 (1H, м), 2,06-2,24 (2H, м), 2,28 (3H, c), 2,37-2,64 (8H, м), 2,65-2,81 (2H, м), 2,79 и 3,03 (все 1H, каждый д, J=12,5), 2,85-2,90 (1H, м), 2,92-2,98 (1H, м), 3,19 (2H, c), 3,28 и 3,34 (все 1H, каждый д, J=12,5), 4,19 (2H, кв, J=7,0), 4,26-4,35 (1H, м), 4,66 и 4,68 (все 1H, каждый c), 5,61-5,67 (1H, м), 7,06-7,20 (2H, м), 7,29-7,43 (2H, м);

MS (FAB) m/z: 532 (M+H)+.

(Пример 12) (E)-1-[2-Циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонилметил)пиперазин-1-ил]этилиден}-4-сульфанилпиперидин (производное соединения № 5-45)

К раствору (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонилметил)пиперазин-1-ил]этилиден}пиперидина (111 мг), полученного в примере 11 (c), в этаноле (3 мл) добавляли карбонат калия (289 мг) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 2 часов. После обработки реакционной смеси водой и экстрагирования дихлорметаном органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме с получением указанного в заголовке соединения (77 мг, выход 75%) в виде масла светло-желтого цвета.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,75-1,09 (4H, м), 1,27 (3H, т, J=7,0), 1,66-1,76 (1H, м), 2,09-2,26 (2H, м), 2,35-2,67 (8H, м), 2,69-2,84 (1H, м), 2,86-2,91 (1H, м), 2,91-2,98 (1H, м), 3,11 и 3,35 (все 1H, каждый д, J=12,5), 3,18 (2H, c), 3,48 (2H, c), 3,68-3,81 (1H, м), 4,17 (2H, кв, J=7,0), 4,68 и 4,69 (все 1H, каждый c), 5,52-5,64 (1H, м), 7,02-7,19 (2H, м), 7,23-7,43 (2H, м);

MS (FAB) m/z: 490 (M+H)+.

(Пример 13) (E)-4-(Ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонилметил)-3-оксопиперазин-1-ил]этилиден}пиперидин (производное соединения № 5-102)

(a) (E)-4-(трет-Бутилдиметилсилилокси)-3-{2-[4-(этоксикарбонилметил)-3-оксопиперазин-1-ил]этилиден}-1-(трифенилметил)пиперидин

Указанное в заголовке соединение синтезировали с выходом 13% в виде аморфного твердого вещества светло-желтого цвета, используя гидрохлорид 1-(этоксикарбонилметил)-2-оксопиперазина вместо морфолина, проведением реакции, аналогичной описанной в примере 1 (d).

1H ЯМР (500 МГц, CDCl3) δ м.д.: -0,01 (3H, c), -0,02 (3H, c), 0,85 (9H, c), 1,28 (3H, т, J=7,0), 1,69-2,08 (2H, м), 2,67-2,74 (2H, м), 3,00-3,20 (2H, м), 3,17 (2H, c), 3,34-3,42 (2H, м), 3,61-3,67 (2H, м), 3,73-3,81 (2H, м), 3,82-3,91 (1H, м), 4,11 (2H, c), 4,21 (2H, кв, J=7,0), 5,56-5,65 (1H, м), 7,11-7,20 (3H, м), 7,21-7,32 (6H, м), 7,36-7,56 (6H, м).

(b) (E)-3-{2-[4-(этоксикарбонилметил)-3-оксопиперазин-1-ил]этилиден}-4-гидрокси-1-(трифенилметил)пиперидин

Указанное в заголовке соединение синтезировали с выходом 80% в виде аморфного твердого вещества светло-желтого цвета, используя (E)-4-(трет-бутилдиметилсилилокси)-3-{2-[4-(этоксикарбонилметил)-3-оксопиперазин-1-ил]этилиден}-1-(трифенилметил)пиперидин, полученный в (a) выше, и проведением реакции, аналогичной описанной в примере 1 (e).

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,28 (3H, т, J=7,0), 1,76-1,86 (1H, м), 2,02-2,12 (1H, м), 2,70-2,78 (2H, м), 3,02-3,14 (2H, м), 3,20 (2H, c), 3,37-3,44 (2H, м), 3,60-3,68 (2H, м), 3,73-3,81 (2H, м), 3,93-4,02 (1H, м), 4,12 (2H, c), 4,21 (2H, кв, J=7,0), 5,60 (1H, т, J=7,0), 7,11-7,20 (3H, м), 7,21-7,31 (6H, м), 7,38-7,53 (6H, м).

(c) (E)-3-{2-[4-(этоксикарбонилметил)-3-оксопиперазин-1-ил]этилиден}-4-гидроксипиперидин бис(гидроацетат)

Указанное в заголовке соединение синтезировали с выходом 99% в виде светло-коричневого кристаллического вещества, используя (E)-3-{2-[4-(этоксикарбонилметил)-3-оксопиперазин-1-ил]этилиден}-4-гидрокси-1-(трифенилметил)пиперидин, полученный в (b) выше, проведением реакции, аналогичной описанной в примере 5 (c).

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,28 (3H, т, J=7,0), 1,56-1,69 (1H, м), 1,94-2,06 (2H, м), 2,70-2,88 (4H, м), 3,20 (2H, c), 3,37-3,49 (2H, м), 3,70-3,79 (2H, м), 4,10 (2H, c), 4,14-4,20 (2H, м), 4,20 (2H, кв, J=7,0), 5,60 (1H, т, J=7,0).

(d) (E)-1-[2-Циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонилметил)-3-оксопиперазин-1-ил]этилиден}-4-гидроксипиперидин

Указанное в заголовке соединение синтезировали с выходом 68% в виде аморфного твердого вещества светло-коричневого цвета, используя (E)-3-{2-[4-(этоксикарбонилметил)-3-оксопиперазин-1-ил]этилиден}-4-гидроксипиперидин бис(гидроацетат), полученный в (c) выше, проведением реакции, аналогичной описанной в примере 1 (g).

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,76-1,09 (4H, м), 1,28 (3H, т, J=7,0), 1,60-1,77 (2H, м), 1,94-2,04 (1H, м), 2,13-2,23 (1H, м), 2,43-2,53 (1H, м), 2,65-2,77 (2H, м), 2,79-2,90 (1H, м), 2,93-3,07 (2H, м), 3,16 (2H, c), 3,33 и 3,47 (все 1H, каждый д, J=12,5), 3,35-3,42 (2H, м), 4,04-4,14 (1H, м), 4,11 (2H, c), 4,21 (2H, кв, J=7,0), 4,70 и 4,71 (все 1H, каждый c), 5,54-5,63 (1H, м), 7,05-7,21 (2H, м), 7,28-7,36 (1H, м), 7,37-7,45 (1H, м).

(e) (E)-4-(Ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонилметил)-3-оксопиперазин-1-ил]этилиден}пиперидин

Указанное в заголовке соединение синтезировали с выходом 34% в виде масла желтого цвета, используя (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонилметил)-3-оксопиперазин-1-ил]этилиден}-4-гидроксипиперидин, полученный в (d) выше, проведением реакции, аналогичной описанной в примере 1 (h).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,76-1,09 (4H, м), 1,28 (3H, т, J=7,0), 1,75-1,84 (1H, м), 2,09-2,25 (2H, м), 2,29 и 2,30 (все 3H, каждый c), 2,48-2,59 (1H, м), 2,60-2,74 (2H, м), 2,75-2,83 (1H, м), 2,92-2,97 (1H, м), 2,99-3,03 (1H, м), 3,07 и 3,28 (все 1H, каждый д, J=12,5), 3,09-3,17 (2H, м), 3,34-3,41 (2H, м), 3,46-3,52 (1H, м), 4,11 (2H, c), 4,21 (2H, кв, J=7,0), 4,26-4,34 (1H, м), 4,69 и 4,70 (все 1H, каждый c), 5,61 (1H, т, J=7,0), 7,07-7,21 (2H, м), 7,29-7,44 (2H, м);

MS (FAB) m/z: 546 (M+H)+.

(Пример 14) (E)-1-[2-Циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(метоксикарбонилметил)-3-оксопиперазин-1-ил]этилиден}-4-сульфанилпиперидин (производное соединения № 5-99)

Указанное в заголовке соединение синтезировали с выходом 93% в виде масла желтого цвета, используя (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонилметил)-3-оксопиперазин-1-ил]этилиден}пиперидин, полученный в примере 13 (e), проведением реакции, аналогичной описанной в примере 2.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,76-1,09 (4H, м), 1,69-1,77 (1H, м), 2,12-2,26 (2H, м), 2,53-2,73 (3H, м), 2,74-2,85 (1H, м), 2,93-3,04 (2H, м), 3,07 и 3,38 (все 1H, каждый д, J=12,5), 3,12-3,22 (3H, м), 3,35-3,44 (2H, м), 3,68-3,81 (1H, м), 3,75 (3H, c), 4,13 (2H, c), 4,72 и 4,73 (все 1H, каждый c), 5,57 и 5,61 (все 1H, каждый т, J=7,0), 7,07-7,21 (2H, м), 7,29-7,44 (2H, м);

MS (FAB) m/z: 490 (M+H)+.

(Пример 15) Дигидрохлорид (E)-3-{2-[4-(карбоксиметил)-3-оксопиперазин-1-ил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидина (гидрохлоридное производное соединения № 5-97)

К раствору (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(метоксикарбонилметил)-3-оксопиперазин-1-ил]этилиден}-4-сульфанилпиперидина (280 мг), полученного в примере 14, в воде (1 мл) добавляли 3 н. соляную кислоту (5 мл) при комнатной температуре, и полученную смесь перемешивали при 50°C в течение 2,5 часов. Реакционную смесь упаривали в вакууме, и остаток очищали, используя препаративную ВЭЖХ (YMC-Pack ODS-A; YMC, элюент: ацетонитрил/0,024 н. соляная кислота=15/85) с получением указанного в заголовке соединения (203 мг, выход 65%) в виде бесцветного порошкообразного кристаллического вещества.

1H ЯМР (400 МГц, пиридин-d5) δ м.д.: 0,78-0,88 (2H, м), 0,94-1,18 (2H, м), 1,74-1,86 (1H, м), 2,14-2,28 (1H, м), 2,40-2,60 (1H, м), 2,60-2,80 (3H, м), 2,86-3,02 (1H, м), 3,02-3,15 (2H, м), 3,30-3,46 (3H, м), 3,50-3,66 (3H, м), 3,88 (1H, ушир. с), 4,50 (2H, c), 4,94 (1H, c), 5,80 (1H, т, J=7,0), 7,18-7,36 (3H, м), 7,70-7,78 (1H, м);

MS (FAB) m/z: 476 (M+H)+.

(Пример 16) Дигидрохлорид (E)-4-(ацетилсульфанил)-3-{2-[4-(карбоксиметил)-3-оксопиперазин-1-ил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]пиперидина (гидрохлоридное производное соединения № 5-98)

К суспензии дигидрохлорида (E)-3-{2-[4-(карбоксиметил)-3-оксопиперазин-1-ил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидина (100 мг), полученного в примере 15, в дихлорметане (5 мл) добавляли уксусный ангидрид (259 мкл) и пиридин (514 мкл) при охлаждении на льду, и полученную смесь перемешивали при комнатной температуре в течение 4 часов. Реакционную смесь упаривали в вакууме и остаток очищали колоночной хроматографией на силикагеле (метанол/дихлорметан=3/17) с получением в свободном виде (85 мг, выход 90%) соединения, указанного в заголовке, в виде твердого вещества коричневого цвета. К раствору этого соединения в дихлорметане (3 мл) добавляли 4 н. раствор хлористого водорода в диоксане (82 мкл) при комнатной температуре и реакционную смесь упаривали в вакууме. Остаток кристаллизовали из эфира с получением указанного в заголовке соединения (44 мг, выход 45%) в виде аморфного твердого вещества светло-желтого цвета.

1H ЯМР (400 МГц, пиридин-d5) δ м.д.: 0,72-0,85 (2H, м), 0,98-1,05 (1H, м), 1,06-1,16 (1H, м), 1,79-1,90 (1H, м), 2,15-2,26 (1H, м), 2,23 и 2,24 (все 3H, каждый c), 2,35-2,49 (1H, м), 2,53-2,75 (3H, м), 2,75-2,91 (1H, м), 2,97-3,22 (3H, м), 3,30-3,38 (2H, м), 3,47-3,55 (2H, м), 3,56-3,65 (1H, м), 4,44-4,47 (2H, м), 4,51-4,55 (1H, м), 4,93 и 4,94 (все 1H, каждый c), 5,81 и 5,83 (все 1H, каждый т, J=7,0), 7,16-7,36 (3H, м), 7,64-7,72 (1H, м);

MS (FAB) m/z: 518 (M+H)+.

(Пример 17) (E)-4-(Ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{4-[2-(этоксикарбонил)этил]-3-оксопиперазин-1-ил}этилиден)пиперидин (производное соединения № 5-108)

(a) (E)-4-(трет-Бутилдиметилсилилокси)-3-(2-{4-[2-(этоксикарбонил)этил]-3-оксопиперазин-1-ил}этилиден)-1-(трифенилметил)пиперидин

Указанное в заголовке соединение синтезировали с выходом 44% в виде масла светло-желтого цвета, используя гидрохлорид 1-[2-(этоксикарбонил)-этил]-2-оксопиперазина вместо морфолина, проведением реакции, аналогичной описанной в примере 1 (d).

1H ЯМР (500 МГц, CDCl3) δ м.д.: -0,01 (3H, c), -0,02 (3H, c), 0,86 (9H, c), 1,27 (3H, т, J=7,0), 1,70-1,95 (4H, м), 2,59-2,67 (2H, м), 2,63 (2H, т, J=7,0), 2,84-2,97 (2H, м), 2,99-3,17 (2H, м), 3,11 (2H, c), 3,34-3,42 (2H, м), 3,64 (2H, т, J=7,0), 3,83-3,92 (1H, м), 4,14 (2H, кв, J=7,0), 5,57-5,64 (1H, м), 7,10-7,21 (3H, м), 7,22-7,33 (6H, м), 7,37-7,57 (6H, м).

(b) (E)-3-(2-{4-[2-(этоксикарбонил)этил]-3-оксопиперазин-1-ил}этилиден)-4-гидрокси-1-(трифенилметил)пиперидин

Указанное в заголовке соединение синтезировали с выходом 96% в виде аморфного твердого вещества светло-желтого цвета, используя (E)-4-(трет-бутилдиметилсилилокси)-3-(2-{4-[2-(этоксикарбонил)этил]-3-оксопиперазин-1-ил}этилиден)-1-(трифенилметил)пиперидин, полученный в (a) выше, проведением реакции, аналогичной описанной в примере 1 (e).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 1,26 (3H, т, J=7,0), 1,64-1,87 (4H, м), 2,62 (2H, т, J=7,0), 2,64-2,71 (2H, м), 2,98-3,17 (2H, м), 3,12 (2H, c), 3,35-3,43 (4H, м), 3,63 (2H, т, J=7,0), 3,91-4,01 (1H, м), 4,14 (2H, кв, J=7,0), 5,58 (1H, т, J=7,0), 7,10-7,20 (3H, м), 7,21-7,33 (6H, м), 7,37-7,57 (6H, м).

(c) (E)-3-(2-{4-[2-(этоксикарбонил)этил]-3-оксопиперазин-1-ил}этилиден)-4-гидроксипиперидин бис(гидроацетат)

Указанное в заголовке соединение синтезировали с выходом 98% в виде светло-коричневого масла, используя (E)-3-(2-{4-[2-(этоксикарбонил)этил]-3-оксопиперазин-1-ил}этилиден)-4-гидрокси-1-(трифенилметил)пиперидин, полученный в (b) выше, проведением реакции, аналогичной описанной в примере 5 (c).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 1,26 (3H, т, J=7,0), 1,63-1,73 (2H, м), 2,61 (2H, т, J=7,0), 2,65-2,72 (2H, м), 3,07-3,15 (4H, м), 3,17-3,41 (6H, м), 3,62 (2H, т, J=7,0), 4,13 (2H, кв, J=7,0), 4,17-4,22 (1H, м), 5,61 (1H, т, J=7,0).

(d) (E)-1-[2-Циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{4-[2-(этоксикарбонил)этил]-3-оксопиперазин-1-ил}этилиден)-4-гидроксипиперидин

Указанное в заголовке соединение синтезировали с выходом 77% в виде светло-коричневого масла, используя (E)-3-(2-{4-[2-(этоксикарбонил)этил]-3-оксопиперазин-1-ил}этилиден)-4-гидроксипиперидин бис(гидроацетат), полученный в (c) выше, проведением реакции, аналогичной описанной в примере 1 (g).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,78-0,90 (2H, м), 0,95-1,09 (2H, м), 1,26 (3H, т, J=7,0), 1,52-1,65 (2H, м), 1,67-1,78 (1H, м), 1,95-2,04 (1H, м), 2,13-2,22 (1H, м), 2,44-2,52 (1H, м), 2,56-2,68 (4H, м), 2,72 и 2,96 (все 1H, каждый д, J=13,0), 2,79-2,90 (1H, м), 2,93-3,02 (2H, м), 3,32 и 3,47 (все 1H, каждый д, J=13,0), 3,35-3,41 (2H, м), 3,63 (2H, т, J=7,0), 4,05-4,12 (1H, м), 4,14 (2H, кв, J=7,0), 4,70 и 4,71 (все 1H, каждый c), 5,53-5,60 (1H, м), 7,08-7,21 (2H, м), 7,29-7,44 (2H, м).

(e) (E)-4-(Ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{4-[2-(этоксикарбонил)этил]-3-оксопиперазин-1-ил}этилиден)пиперидин

Указанное в заголовке соединение синтезировали с выходом 22% в виде светло-коричневого масла, используя (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{4-[2-(этоксикарбонил)этил]-3-оксопиперазин-1-ил}этилиден)-4-гидроксипиперидин, полученный в (d) выше, проведением реакции, аналогичной описанной в примере 1 (h).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,77-1,08 (4H, м), 1,26 (3H, т, J=7,0), 1,76-1,84 (1H, м), 2,08-2,24 (2H, м), 2,29 и 2,30 (все 3H, каждый c), 2,46-2,72 (6H, м), 2,74-2,82 (1H, м), 2,89-3,00 (2H, м), 3,01-3,09 (2H, м), 3,05 и 3,27 (все 1H, каждый д, J=13,0), 3,33-3,40 (2H, м), 3,63 (2H, т, J=7,0), 4,14 (2H, кв, J=7,0), 4,26-4,35 (1H, м), 4,68 и 4,70 (все 1H, каждый c), 5,60 (1H, т, J=7,0), 7,08-7,20 (2H, м), 7,29-7,43 (2H, м);

MS (FAB) m/z: 560 (M+H)+.

(Пример 18) Дигидрохлорид (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{4-[2-(метоксикарбонил)этил]-3-оксопиперазин-1-ил}этилиден)-4-сульфанилпиперидина (гидрохлоридное производное соединения № 5-105)

Указанное в заголовке соединение синтезировали с выходом 71% в виде порошкообразного кристаллического вещества белого цвета, используя (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{4-[2-(этоксикарбонил)этил]-3-оксопиперазин-1-ил}этилиден)пиперидин, полученный в примере 17 (e), проведением реакции, аналогичной описанной в примере 2.

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,78-0,90 (2H, м), 0,96-1,08 (2H, м), 1,68-1,78 (1H, м), 2,12-2,26 (2H, м), 2,53-2,68 (5H, м), 2,74-2,85 (1H, м), 2,90-3,01 (2H, м), 3,03-3,10 (3H, м), 3,19 (1H, c), 3,34-3,43 (2H, м), 3,63 (2H, т, J=7,0), 3,67-3,81 (1H, м), 3,69 (3H, c), 4,71 и 4,73 (все 1H, каждый c), 5,55 и 5,59 (все 1H, каждый т, J=7,0), 7,08-7,21 (2H, м), 7,30-7,36 (1H, м), 7,38-7,43 (1H, м);

MS (FAB) m/z: 504 (M+H)+.

(Пример 19) Дигидрохлорид (E)-3-(2-{4-[2-(карбоксиэтил)]-3-оксопиперазин-1-ил}этилиден)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидина (гидрохлоридное производное соединения № 5-103)

Указанное в заголовке соединение синтезировали с выходом 48% в виде порошкообразного кристаллического вещества белого цвета, используя (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{4-[2-(метоксикарбонил)этил]-3-оксопиперазин-1-ил}этилиден)-4-сульфанилпиперидин, полученный в примере 18, проведением реакции, аналогичной описанной в примере 15.

1H ЯМР (400 МГц, пиридин-d5) δ м.д.: 0,77-1,11 (4H, м), 1,76-1,87 (1H, м), 2,14-2,27 (1H, м), 2,40-2,48 (1H, м), 2,64-2,73 (3H, м), 2,87-2,99 (3H, м), 3,04-3,13 (2H, м), 3,28-3,34 (3H, м), 3,44-3,47 (2H, м), 3,50 и 3,59 (все 1H, каждый д, J=12,5), 3,85-3,93 (3H, м), 4,95 (1H, c), 5,77-5,82 (1H, м), 7,21-7,37 (3H, м), 7,69-7,75 (1H, м);

MS (FAB) m/z: 490 (M+H)+.

(Пример 20) Дигидрохлорид (E)-4-(ацетилсульфанил)-3-(2-{4-[2-(карбоксиэтил)]-3-оксопиперазин-1-ил}этилиден)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]пиперидина (гидрохлоридное производное соединения № 5-104)

Указанное в заголовке соединение синтезировали с выходом 35% в виде порошкообразного кристаллического вещества светло-желтого цвета, используя дигидрохлорид (E)-3-(2-{4-[2-(карбоксиэтил)]-3-оксопиперазин-1-ил}этилиден)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидина, полученный в примере 19, проведением реакции, аналогичной описанной в примере 16.

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,78-1,17 (4H, м), 1,84-1,90 (1H, м), 2,21-2,29 (1H, м), 2,25 и 2,26 (все 3H, каждый c), 2,39-2,46 (1H, м), 2,57-2,88 (3H, м), 2,90-2,94 (3H, м), 2,98-3,01 (2H, м), 3,19-3,28 (2H, м), 3,33-3,38 (2H, м), 3,41-3,44 (2H, м), 3,88-3,93 (2H, м), 4,54-4,55 (1H, м), 4,95 и 4,96 (все 1H, каждый c), 5,82-5,86 (1H, м), 7,21-7,38 (3H, м), 7,66-7,73 (1H, м);

MS (FAB) m/z: 532 (M+H)+.

(Пример 21) Дигидрохлорид (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{4-[2-(этоксикарбонил)этил]-2-оксопиперазин-1-ил}этилиден)пиперидина (гидрохлоридное производное соединения № 5-80)

(a) (E)-4-(трет-Бутилдиметилсилилокси)-3-(2-{4-[2-(этоксикарбонил)этил]-2-оксопиперазин-1-ил}этилиден)-1-(трифенилметил)пиперидин

К раствору гидрида натрия (1,94 г) в N,N-диметилформамиде (430 мл) добавляли раствор (E)-4-(трет-бутилдиметилсилилокси)-3-[2-(тозилокси)этилиден]-1-(трифенилметил)пиперидина (27,37 г), полученный в примере 1 (c), и 1-[2-(этоксикарбонил)этил]-3-оксопиперазин (9,70 г) в N,N-диметилформамиде (100 мл) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 3 часов. К реакционной смеси добавляли насыщенный водный раствор хлорида натрия и затем экстрагировали этилацетатом. Экстракт промывали насыщенным водным раствором хлорида натрия и органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (этилацетат/гексан=2/3-1/1) с получением указанного в заголовке соединения (14,79 г, выход 54%) в виде аморфного твердого вещества светло-желтого цвета.

1H ЯМР (500 МГц, CDCl3) δ м.д.: -0,05 (3H, c), -0,02 (3H, c), 0,83 (9H, c), 1,26 (3H, т, J=7,5), 1,73-1,94 (2H, м), 2,48 (2H, т, J=7,5), 2,65-2,76 (4H, м), 2,84-2,93 (1H, м), 3,16 (2H, c), 3,20-3,27 (2H, м), 3,40-3,55 (1H, м), 3,81-4,18 (7H, м), 5,41-5,48 (1H, м), 7,11-7,29 (9H, м), 7,41-7,52 (6H, м).

(b) (E)-3-(2-{4-[2-(этоксикарбонил)этил]-2-оксопиперазин-1-ил}этилиден)-4-гидрокси-1-(трифенилметил)пиперидин

Указанное в заголовке соединение синтезировали с выходом 99% в виде аморфного твердого вещества светло-желтого цвета, используя (E)-4-(трет-бутилдиметилсилилокси)-3-(2-{4-[2-(этоксикарбонил)этил]-2-оксопиперазин-1-ил}этилиден)-1-(трифенилметил)пиперидин, полученный в (a) выше, проведением реакции, аналогичной описанной в примере 1 (e).

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,26 (3H, т, J=7,0), 1,60-1,86 (2H, м), 1,98-2,11 (1H, м), 2,49 (2H, т, J=7,0), 2,65-2,77 (4H, м), 3,16 (2H, c), 3,21-3,44 (3H, м), 3,88-4,20 (7H, м), 5,44 (1H, т, J=6,5), 7,10-7,31 (9H, м), 7,39-7,53 (6H, м).

(c) (E)-3-(2-{4-[2-(этоксикарбонил)этил]-2-оксопиперазин-1-ил}этилиден)-4-гидроксипиперидин бис(гидроацетат)

Указанное в заголовке соединение синтезировали с выходом 99% в виде светло-коричневого масла, используя (E)-3-(2-{4-[2-(этоксикарбонил)этил]-2-оксопиперазин-1-ил}этилиден)-4-гидрокси-1-(трифенилметил)пиперидин, полученный в (b) выше, проведением реакции, аналогичной описанной в примере 5 (c).

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,26 (3H, т, J=7,0), 1,62-1,83 (2H, м), 2,01-2,12 (1H, м), 2,49 (2H, т, J=7,0), 2,66-2,77 (4H, м), 2,90-3,01 (1H, м), 3,15 (2H, c), 3,23-3,45 (3H, м), 3,83-4,27 (6H, м), 5,57 (1H, т, J=7,5).

(d) (E)-1-[2-Циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{4-[2-(этоксикарбонил)этил]-2-оксопиперазин-1-ил}этилиден)-4-гидроксипиперидин

Указанное в заголовке соединение синтезировали с выходом 93% в виде масла светло-желтого цвета, используя (E)-3-(2-{4-[2-(этоксикарбонил)этил]-2-оксопиперазин-1-ил}этилиден)-4-гидроксипиперидин бис(гидроацетат), полученный в (c) выше, проведением реакции, аналогичной описанной в примере 1 (g).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,78-0,91 (2H, м), 0,97-1,10 (2H, м), 1,26 (3H, т, J=7,5), 1,62-1,77 (2H, м), 1,95-2,03 (1H, м), 2,09-2,16 (1H, м), 2,43-2,54 (2H, м), 2,65-2,77 (4H, м), 2,78-2,89 (1H, м), 3,00 и 3,33 (все 1H, каждый д, J=12,5), 3,15 (2H, c), 3,22-3,30 (2H, м), 3,47-3,55 (1H, м), 3,88-4,19 (5H, м), 4,73 и 4,75 (все 1H, каждый c), 5,42-5,49 (1H, м), 7,08-7,20 (2H, м), 7,29-7,41 (2H, м).

(e) Дигидрохлорид (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{4-[2-(этоксикарбонил)этил]-2-оксопиперазин-1-ил}этилиден)пиперидина

Указанное в заголовке соединение синтезировали с выходом 4% в виде порошкообразного кристаллического вещества светло-желтого цвета, используя (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{4-[2-(этоксикарбонил)этил]-2-оксопиперазин-1-ил}этилиден)-4-гидроксипиперидин, полученный в (d) выше, проведением реакции, аналогичной описанной в примере 1 (h).

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,75-1,09 (4H, м), 1,27 (3H, т, J=7,0), 1,72-1,84 (1H, м), 2,05-2,32 (6H, м), 2,43-2,83 (7H, м), 3,04-3,42 (6H, м), 3,77-4,35 (5H, м), 4,71 и 4,74 (все 1H, каждый c), 5,43-5,52 (1H, м), 7,06-7,22 (2H, м), 7,29-7,41 (2H, м);

MS (FAB) m/z: 560 (M+H)+.

(Пример 22) Дигидрохлорид (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{4-[2-(этоксикарбонил)этил]-2-оксопиперазин-1-ил}этилиден)-4-сульфанилпиперидина (гидрохлоридное производное соединения № 5-79)

Указанное в заголовке соединение синтезировали с выходом 80% в виде порошкообразного кристаллического вещества белого цвета, используя (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{4-[2-(этоксикарбонил)этил]-2-оксопиперазин-1-ил}этилиден)пиперидин, полученный в примере 21 (e), проведением реакции, аналогичной описанной в примере 12.

1H ЯМР (400 МГц, пиридин-d5) δ м.д.: 0,76-0,89 (2H, м), 0,99-1,08 (2H, м), 1,13 (3H, т, J=7,5), 1,72-1,85 (1H, м), 2,12-2,26 (1H, м), 2,38-3,00 (9H, м), 3,21-3,42 (5H, м), 3,51-3,68 (1H, м), 3,81 (1H, ушир. с), 4,06-4,21 (4H, м), 4,96 (1H, c), 5,62-5,71 (1H, м), 7,19-7,40 (3H, м), 7,66-7,76 (1H, м);

MS (FAB) m/z: 518 (M+H)+.

(Пример 23) Дигидрохлорид (E)-3-(2-{4-[2-(карбоксиэтил)]-2-оксопиперазин-1-ил}этилиден)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидина (гидрохлоридное производное соединения № 5-75)

Указанное в заголовке соединение синтезировали с выходом 88% в виде порошкообразного кристаллического вещества белого цвета, используя (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-{4-[2-(этоксикарбонил)этил]-2-оксопиперазин-1-ил}этилиден)-4-сульфанилпиперидин, полученный в примере 22, проведением реакции, аналогичной описанной в примере 15.

1H ЯМР (400 МГц, пиридин-d5) δ м.д.: 0,77-0,89 (2H, м), 0,98-1,19 (2H, м), 1,71-1,84 (1H, м), 2,10-2,28 (1H, м), 2,38-3,01 (9H, м), 3,23-3,69 (6H, м), 3,81 (1H, ушир. с), 4,05-4,29 (2H, м), 4,96 (1H, c), 5,63-5,72 (1H, м), 7,16-7,40 (3H, м), 7,67-7,78 (1H, м);

MS (FAB) m/z: 490 (M+H)+.

(Пример 24) Дигидрохлорид (E)-4-(ацетилсульфанил)-3-(2-{4-[2-(карбоксиэтил)]-2-оксопиперазин-1-ил}этилиден)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]пиперидина (гидрохлоридное производное соединения № 5-76)

Указанное в заголовке соединение синтезировали с выходом 44% в виде порошкообразного кристаллического вещества светло-желтого цвета, используя дигидрохлорид (E)-3-(2-{4-[2-(карбоксиэтил)]-2-оксопиперазин-1-ил}этилиден)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидина, полученный в примере 23, проведением реакции, аналогичной описанной в примере 16.

1H ЯМР (400 МГц, пиридин-d5) δ м.д.: 0,76-0,91 (2H, м), 1,01-1,20 (2H, м), 1,81-1,90 (1H, м), 2,14-2,29 (4H, м), 2,34-2,48 (1H, м), 2,53-2,92 (8H, м), 3,17-3,72 (6H, м), 4,00-4,31 (2H, м), 4,46-4,56 (1H, м), 4,95 и 4,97 (все 1H, каждый c), 5,69-5,80 (1H, м), 7,18-7,40 (3H, м), 7,62-7,75 (1H, м);

MS (FAB) m/z: 532 (M+H)+.

(Пример 25) Дигидрохлорид (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[(2S)-(метоксикарбонил)пирролидин-1-ил]этилиден}пиперидина (гидрохлоридное производное соединения № 5-148)

(a) (E)-4-(трет-Бутилдиметилсилилокси)-3-{2-[(2S)-(метоксикарбонил)пирролидин-1-ил]этилиден}-1-(трифенилметил)пиперидин

К раствору (E)-4-(трет-бутилдиметилсилилокси)-3-[2-(тозилокси)этилиден]-1-(трифенилметил)пиперидина (4,50 г), полученного в примере 1 (c), в N,N-диметилформамиде (60 мл) добавляли гидрохлорид (2S)-(метоксикарбонил)пирролидина (1,14 г) и триэтиламин (2,11 мл) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение ночи. К реакционной смеси добавляли насыщенный водный раствор хлорида натрия и затем экстрагировали этилацетатом. Экстракт промывали насыщенным водным раствором хлорида натрия и органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (этилацетат/гексан=1/9) с получением указанного в заголовке соединения (1,46 г, выход 35%) в виде бесцветного аморфного твердого вещества.

1H ЯМР (500 МГц, CDCl3) δ м.д.: -0,04 (3H, c), -0,02 (3H, c), 0,84 (9H, c), 1,69-1,98 (7H, м), 2,03-2,13 (1H, м), 2,31-2,54 (1H, м), 2,71-2,98 (1H, м), 3,03-3,29 (3H, м), 3,37-3,48 (2H, м), 3,59 и 3,62 (все 3H, каждый c), 3,80-3,93 (1H, м), 5,63-5,73 (1H, м), 7,08-7,19 (3H, м), 7,20-7,30 (6H, м), 7,36-7,56 (6H, м).

(b) (E)-4-Гидрокси-3-{2-[(2S)-(метоксикарбонил)пирролидин-1-ил]этилиден}-1-(трифенилметил)пиперидин

Указанное в заголовке соединение синтезировали с выходом 99% в виде аморфного твердого вещества светло-желтого цвета, используя (E)-4-(трет-бутилдиметилсилилокси)-3-{2-[(2S)-(метоксикарбонил)пирролидин-1-ил]этилиден}-1-(трифенилметил)пиперидин, полученный в (a) выше, проведением реакции, аналогичной описанной в примере 1 (e).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 1,73-1,85 (2H, м), 1,87-1,98 (2H, м), 2,01-2,18 (3H, м), 2,33-2,43 (2H, м), 2,53-2,75 (1H, м), 3,05-3,23 (4H, м), 3,26-3,37 (1H, м), 3,64 и 3,66 (все 3H, каждый c), 3,92-4,04 (1H, м), 5,60-5,70 (1H, м), 7,10-7,20 (3H, м), 7,21-7,32 (6H, м), 7,37-7,57 (6H, м).

(c) (E)-4-Гидрокси-3-{2-[(2S)-(метоксикарбонил)пирролидин-1-ил]этилиден}пиперидин бис(гидроацетат)

Указанное в заголовке соединение синтезировали с количественным выходом в виде светло-коричневого масла, используя (E)-4-гидрокси-3-{2-[(2S)-(метоксикарбонил)пирролидин-1-ил]этилиден}-1-(трифенилметил)пиперидин, полученный в (b) выше, проведением реакции, аналогичной описанной в примере 5 (c).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 1,71-1,81 (2H, м), 1,87-2,05 (3H, м), 2,09-2,19 (2H, м), 2,34-2,43 (1H, м), 2,90-2,98 (1H, м), 3,09-3,33 (4H, м), 3,37-3,45 (1H, м), 3,73 и 3,74 (все 3H, каждый c), 3,78 (1H, д, J=14,0), 4,18-4,25 (1H, м), 5,70 (1H, т, J=7,5).

(d) (E)-1-[2-Циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-гидрокси-3-{2-[(2S)-(метоксикарбонил)пирролидин-1-ил]этилиден}пиперидин

Указанное в заголовке соединение синтезировали с выходом 54% в виде светло-коричневого масла, используя (E)-4-гидрокси-3-{2-[(2S)-(метоксикарбонил)пирролидин-1-ил]этилиден}пиперидин бис(гидроацетат), полученный в (c) выше, проведением реакции, аналогичной описанной в примере 1 (g).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,79-0,90 (2H, м), 0,96-1,09 (2H, м), 1,66-1,84 (2H, м), 1,87-2,02 (3H, м), 2,06-2,16 (1H, м), 2,20-2,29 (1H, м), 2,31-2,39 (1H, м), 2,42-2,56 (1H, м), 2,74-2,86 (1H, м), 2,85 и 2,95 (все 1H, каждый д, J=12,5), 2,98 и 3,06 (все 1H, каждый д, J=12,5), 3,08-3,19 (2H, м), 3,21-3,45 (2H, м), 3,70 и 3,71 (все 3H, каждый c), 4,06-4,16 (1H, м), 4,68 и 4,69 и 4,70 (все 1H, каждый c), 5,61-5,70 (1H, м), 7,06-7,21 (2H, м), 7,28-7,35 (1H, м), 7,39-7,47 (1H, м).

(e) Дигидрохлорид (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[(2S)-(метоксикарбонил)пирролидин-1-ил]этилиден}пиперидина

Указанное в заголовке соединение синтезировали с выходом 22% в виде порошкообразного кристаллического вещества светло-коричневого цвета, используя (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-гидрокси-3-{2-[(2S)-(метоксикарбонил)пирролидин-1-ил]этилиден}пиперидин, полученный в (d) выше, проведением реакции, аналогичной описанной в примере 1 (h).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,78-0,90 (2H, м), 0,95-1,09 (2H, м), 1,72-1,82 (2H, м), 1,84-1,97 (2H, м), 2,04-2,40 (4H, м), 2,28 и 2,29 (все 3H, каждый c), 2,43-2,63 (1H, м), 2,65-2,78 (1H, м), 2,81-3,35 (6H, м), 3,69 и 3,70 и 3,71 и 3,72 (все 3H, каждый c), 4,26-4,32 (1H, м), 4,65 и 4,67 и 4,68 и 4,69 (все 1H, каждый c), 5,67-5,73 (1H, м), 7,07-7,19 (2H, м), 7,29-7,35 (1H, м), 7,39-7,45 (1H, м);

MS (FAB) m/z: 489 (M+H)+.

(Пример 26) Дигидрохлорид (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[(2S)-(метоксикарбонил)пирролидин-1-ил]этилиден}-4-сульфанилпиперидина (гидрохлоридное производное соединения № 5-147)

Указанное в заголовке соединение синтезировали с выходом 46% в виде порошкообразного кристаллического вещества светло-розового цвета, используя (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[(2S)-(метоксикарбонил)пирролидин-1-ил]этилиден}пиперидин, полученный в примере 25 (e), проведением реакции, аналогичной описанной в примере 2.

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,78-0,90 (2H, м), 0,95-1,08 (2H, м), 1,66-1,99 (4H, м), 2,05-2,38 (4H, м), 2,53-2,66 (1H, м), 2,67-2,86 (1H, м), 3,01-3,39 (6H, м), 3,65-3,79 (1H, м), 3,71 и 3,72 (все 3H, каждый c), 4,69 и 4,71 (все 1H, каждый c), 5,63-5,71 (1H, м), 7,07-7,19 (2H, м), 7,28-7,35 (1H, м), 7,40-7,46 (1H, м);

MS (FAB )m/z: 447 (M+H)+.

(Пример 27) Дигидрохлорид (E)-3-{2-[(2S)-карбоксипирролидин-1-ил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидина (гидрохлоридное производное соединения № 5-145)

Указанное в заголовке соединение синтезировали с выходом 76% в виде порошкообразного кристаллического вещества светло-желтого цвета, используя (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[(2S)-(метоксикарбонил)пирролидин-1-ил]этилиден}-4-сульфанилпиперидин, полученный в примере 26, проведением реакции, аналогичной описанной в примере 15.

1H ЯМР (400 МГц, пиридин-d5) δ м.д.: 0,72-0,90 (2H, м), 0,95-1,20 (2H, м), 1,67-2,26 (4H, м), 2,28-2,53 (3H, м), 2,55-3,21 (3H, м), 3,37-4,38 (7H, м), 4,94-5,09 (1H, м), 6,10-6,31 (1H, м), 7,11-7,37 (3H, м), 7,62-7,83 (1H, м);

MS (FAB) m/z: 433 (M+H)+.

(Пример 28) Дигидрохлорид (E)-4-(ацетилсульфанил)-3-{2-[(2S)-карбоксипирролидин-1-ил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]пиперидина (гидрохлоридное производное соединения № 5-146)

К суспензии дигидрохлорида (E)-3-{2-[(2S)-карбоксипирролидин-1-ил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидина (100 мг), полученного в примере 27, в дихлорметане (5 мл) добавляли уксусный ангидрид (28 мкл) и триэтиламин (97 мкл) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 2 часов. Растворитель удаляли в вакууме и остаток очищали, используя препаративную ВЭЖХ (YMC-Pack ODS-A; YMC, элюент: ацетонитрил/вода, содержащая триэтиламин (0,2%) и уксусную кислоту (0,2%)=3/7) с получением в свободном виде (57 мг, выход 61%) указанного в заголовке соединения в виде светло-коричневого масла. К раствору этого соединения в дихлорметане (1 мл) добавляли при комнатной температуре 4 н. раствор хлористого водорода в диоксане (60 мкл) и реакционную смесь упаривали в вакууме. Остаток кристаллизовали из эфира с получением указанного в заголовке соединения (41 мг, выход 62%) в виде порошкообразного кристаллического вещества светло-коричневого цвета.

1H ЯМР (400 МГц, пиридин-d5) δ м.д.: 0,72-0,92 (2H, м), 0,99-1,21 (2H, м), 1,71-2,00 (3H, м), 2,12-2,35 (2H, м), 2,25 и 2,26 и 2,27 (все 3H, каждый c), 2,38-2,89 (4H, м), 3,17-3,50 (3H, м), 3,55-4,06 (4H, м), 4,53 (1H, м), 4,94 и 4,97 и 4,99 (все 1H, каждый c), 6,10-6,21 (1H, м), 7,16-7,39 (3H, м), 7,63-7,77 (1H, м);

MS (FAB) m/z: 475 (M+H)+.

(Пример 29) (E)-4-(Ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонил)пиперидин-1-ил]этилиден}пиперидина дигидрохлорид (гидрохлоридное производное соединения № 5-8)

(a) (E)-4-(трет-Бутилдиметилсилилокси)-3-{2-[4-(этоксикарбонил)пиперидин-1-ил]этилиден}-1-(трифенилметил)пиперидин

Указанное в заголовке соединение синтезировали с выходом 37% в виде бесцветного аморфного твердого вещества, используя 4-(этоксикарбонил)пиперидин вместо морфолина, проведением реакции, аналогичной описанной в примере 1 (d).

1H ЯМР (500 МГц, CDCl3) δ м.д.: -0,04 (3H, c), -0,02 (3H, c), 0,83 (9H, c), 1,25 (3H, т, J=7,0), 1,68-2,07 (10H, м), 2,20-2,30 (1H, м), 2,77-2,91 (3H, м), 2,93-3,10 (2H, м), 3,27-3,65 (1H, м), 3,82-3,92 (1H, м), 4,13 (2H, кв, J=7,0), 5,57-5,66 (1H, м), 7,06-7,19 (3H, м), 7,20-7,30 (6H, м), 7,36-7,58 (6H, м).

(b) (E)-3-{2-[4-(этоксикарбонил)пиперидин-1-ил]этилиден}-4-гидрокси-1-(трифенилметил)пиперидин

Указанное в заголовке соединение синтезировали с выходом 99% в виде бесцветного масла, используя (E)-4-(трет-бутилдиметилсилилокси)-3-{2-[4-(этоксикарбонил)пиперидин-1-ил]этилиден}-1-(трифенилметил)пиперидин, полученный в (a) выше, проведением реакции, аналогичной описанной в примере 1 (e).

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,25 (3H, т, J=7,0), 1,64-2,11 (10H, м), 2,24-2,35 (1H, м), 2,83-2,94 (2H, м), 2,94-3,07 (2H, м), 3,35-3,44 (2H, м), 3,95-4,01 (1H, м), 4,14 (2H, кв, J=7,0), 5,62 (1H, т, J=6,0), 7,13-7,21 (3H, м), 7,23-7,33 (6H, м), 7,41-7,55 (6H, м).

(c) (E)-3-{2-[4-(этоксикарбонил)пиперидин-1-ил]этилиден}-4-гидроксипиперидин бис(гидроацетат)

Указанное в заголовке соединение синтезировали с выходом 99% в виде кристаллического вещества коричневого цвета, используя (E)-3-{2-[4-(этоксикарбонил)пиперидин-1-ил]этилиден}-4-гидрокси-1-(трифенилметил)пиперидин, полученный в (b) выше, проведением реакции, аналогичной описанной в примере 5 (c).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 1,25 (3H, т, J=7,0), 1,41-1,50 (1H, м), 1,60-2,12 (6H, м), 2,23-2,34 (1H, м), 2,83-3,09 (5H, м), 3,30 (2H, кв, J=7,0), 3,39-3,51 (1H, м), 3,75-3,82 (1H, м), 4,13 (2H, кв, J=7,0), 4,19-4,25 (1H, м), 5,58-5,75 (1H, м).

(d) (E)-1-[2-Циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонил)пиперидин-1-ил]этилиден}-4-гидроксипиперидин

Указанное в заголовке соединение синтезировали с выходом 63% в виде светло-коричневого масла, используя (E)-3-{2-[4-(этоксикарбонил)пиперидин-1-ил]этилиден}-4-гидроксипиперидин бис(гидроацетат), полученный в (c) выше, проведением реакции, аналогичной описанной в примере 1 (g).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,76-1,10 (4H, м), 1,25 (3H, т, J=7,0), 1,42-1,51 (1H, м), 1,65-2,04 (8H, м), 2,08-2,23 (2H, м), 2,27-2,37 (1H, м), 2,42-2,53 (1H, м), 2,76 и 2,96 (все 1H, каждый д, J=12,5), 2,77-2,95 (1H, м), 3,00-3,07 (2H, м), 3,32 и 3,45 (все 1H, каждый д, J=12,5), 4,06-4,11 (1H, м), 4,13 (2H, кв, J=7,0), 4,69 и 4,72 (все 1H, каждый c), 5,61-5,70 (1H, м), 7,07-7,21 (2H, м), 7,28-7,45 (2H, м).

(e) Дигидрохлорид (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонил)пиперидин-1-ил]этилиден}пиперидина

Указанное в заголовке соединение синтезировали с выходом 17% в виде порошкообразного кристаллического вещества желтого цвета, используя (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонил)пиперидин-1-ил]этилиден}-4-гидроксипиперидин, полученный в (d) выше, проведением реакции, аналогичной описанной в примере 1 (h).

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,77-1,11 (4H, м), 1,25 (3H, т, J=7,0), 1,67-1,98 (7H, м), 2,07-2,29 (3H, м), 2,28 и 2,29 (все 3H, каждый c), 2,47-2,62 (1H, м), 2,65-2,96 (5H, м), 2,81 и 3,02 (все 1H, каждый д, J=12,5), 3,26-3,39 (1H, м), 4,13 (2H, кв, J=7,0), 4,27-4,36 (1H, м), 4,66 и 4,69 (все 1H, каждый c), 5,64 (1H, т, J=7,0), 7,07-7,20 (2H, м), 7,28-7,45 (2H, м);

MS (FAB) m/z: 517 (M+H)+.

(Пример 30) Дигидрохлорид (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонил)пиперидин-1-ил]этилиден}-4-сульфанилпиперидина (гидрохлоридное производное соединения № 5-7)

Указанное в заголовке соединение синтезировали с выходом 97% в виде порошкообразного кристаллического вещества светло-желтого цвета, используя (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонил)пиперидин-1-ил]этилиден}пиперидин, полученный в примере 29 (e), проведением реакции, аналогичной описанной в примере 12.

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,75-1,10 (4H, м), 1,25 (3H, т, J=7,0), 1,67-1,80 (3H, м), 1,82-1,99 (4H, м), 2,10-2,31 (3H, м), 2,54-2,68 (1H, м), 2,69-2,97 (5H, м), 3,14 и 3,35 (все 1H, каждый д, J=12,5), 3,16-3,23 (1H, м), 3,72-3,83 (1H, м), 4,13 (2H, кв, J=7,0), 4,69 и 4,71 (все 1H, каждый c), 5,61 (1H, м), 7,05-7,21 (2H, м), 7,23-7,46 (2H, м);

MS (FAB) m/z: 475 (M+H)+.

(Пример 31) Дигидрохлорид (E)-3-{2-[4-(карбоксипиперидин)-1-ил]этилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидина (гидрохлоридное производное соединения № 5-3)

Указанное в заголовке соединение синтезировали с выходом 90% в виде порошкообразного кристаллического вещества светло-желтого цвета, используя дигидрохлорид (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонил)пиперидин-1-ил]этилиден}-4-сульфанилпиперидина, полученный в примере 30, проведением реакции, аналогичной описанной в примере 15.

1H ЯМР (400 МГц, пиридин-d5) δ м.д.: 0,73-0,83 (2H, м), 1,03-1,13 (2H, м), 1,73-1,81 (1H, м), 2,13-2,31 (2H, м), 2,47 (2H, br), 2,59-2,98 (7H, м), 3,04-3,27 (1H, м), 3,39 и 3,45 (все 1H, каждый д, J=12,0), 3,51-3,68 (2H, м), 3,80-3,89 (3H, м), 5,00 и 5,01 (все 1H, каждый c), 6,41 (1H, т, J=7,5), 7,22-7,25 (2H, м), 7,27-7,35 (1H, м), 7,58-7,60 (1H, м);

MS (FAB) m/z: 447 (M+H)+.

(Пример 32) (E)-4-(Ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-гидроксиэтилиден)пиперидин (производное соединения № 3-2)

(a) (E)-4-(Ацетилсульфанил)-3-[(этоксикарбонил)метилиден]-1-(трифенилметил)пиперидин

К раствору (E)-3-[(этоксикарбонил)метилиден]-1-(трифенилметил)пиперидин-4-ола (23,06 г) в дихлорметане (200 мл) добавляли метансульфонилхлорид (4,60 мл) и триэтиламин (9,77 мл) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 1 часа. После обработки реакционной смеси насыщенным водным раствором гидрокарбоната натрия и экстрагирования полученной смеси дихлорметаном органический слой сушили над безводным сульфатом магния. Растворитель удаляли в вакууме с получением сырого продукта (E)-3-[(этоксикарбонил)метилиден]-4-мезилокси-1-(трифенилметил)пиперидин в виде аморфного твердого вещества светло-желтого цвета. К раствору этого соединения в этаноле (250 мл) добавляли при комнатной температуре тиоацетат калия (12,32 г) и полученную смесь перемешивали при 70°C в течение 1 часа. Реакционную смесь упаривали в вакууме. Остаток разбавляли этилацетатом и промывали водой и насыщенным водным раствором хлорида натрия и органический слой сушили над безводным сульфатом магния. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (этилацетат/гексан=1/5) с получением указанного в заголовке соединения (18,35 г, выход 70%) в виде аморфного твердого вещества светло-желтого цвета.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,11(3H, т, J=7,0), 1,89-1,99 (1H, м), 2,10-2,24 (1H, м), 2,27 (3H, c), 2,30-2,40 (2H, м), 2,51-2,65 (1H, м), 3,83 (1H, м), 3,98-4,08 (2H, м), 4,30-4,37 (1H, м), 5,98 (1H, c), 7,12-7,51 (15H, м).

(b) (E)-3-(2-Гидроксиэтилиден)-4-сульфанил-1-(трифенилметил)пиперидин

К раствору (E)-4-(ацетилсульфанил)-3-[(этоксикарбонил)метилиден]-1-(трифенилметил)пиперидина (18,35 г), полученного в (a) выше, в дихлорметане (300 мл) по каплям добавляли при -78°C 1,01 н. раствор гидрида диизобутилалюминия в толуоле (151 мл) и полученную смесь перемешивали при той же температуре в течение 1 часа. К реакционной смеси добавляли насыщенный водный раствор тетрагидрата тартрата калия натрия и полученную смесь перемешивали при комнатной температуре в течение 3 часов. Реакционную смесь экстрагировали этилацетатом и промывали водой и насыщенным водным раствором хлорида натрия и органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (этилацетат/гексан/дихлорметан=1/2/1) с получением указанного в заголовке соединения (10,00 г, выход 66%) в виде аморфного твердого вещества светло-желтого цвета.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,75-1,92 (1H, м), 2,25-2,57 (3H, м), 2,74-3,13 (2H, м), 3,53-3,72 (1H, м), 4,03-4,22 (2H, м), 5,71-5,85 (1H, м), 7,10-7,60 (15H, м).

(c) (E)-3-[2-(трет-Бутилдиметилсилилокси)этилиден]-4-сульфанил-1-(трифенилметил)пиперидин

К раствору (E)-3-(2-гидроксиэтилиден)-4-сульфанил-1-(трифенилметил)пиперидина (10,00 г), полученного в (b) выше, в дихлорметане (100 мл) добавляли хлорид трет-бутилдиметилсилила (5,63 г), триэтиламин (5,23 мл) и 4-диметиламинопиридин (0,15 г) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 1 часа. Реакционную смесь упаривали в вакууме. Остаток разбавляли дихлорметаном и промывали водой и насыщенным водным раствором хлорида натрия, и органический слой сушили над безводным сульфатом магния. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (этилацетат/гексан=1/10) с получением указанного в заголовке соединения (10,66 г, выход 83%) в виде бесцветного аморфного твердого вещества.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,01-0,05 (6H, м), 0,85-0,90 (9H, м), 1,73-1,85 (1H, м), 2,20-2,51 (3H, м), 2,86-3,20 (2H, м), 3,60-3,64 (1H, м), 4,11-4,19 (2H, м), 5,64-5,71 (1H, м), 7,12-7,53 (15H, м).

(d) (E)-4-(Ацетилсульфанил)-3-[2-(трет-бутилдиметилсилилокси)этилиден]-1-(трифенилметил)пиперидин

К раствору (E)-3-[2-(трет-бутилдиметилсилилокси)этилиден]-4-сульфанил-1-(трифенилметил)пиперидина (10,66 г), полученного в (c) выше, в дихлорметане (100 мл) добавляли уксусный ангидрид (2,93 мл), пиридин (5,00 мл) и 4-диметиламинопиридин (0,13 г) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 3 часов. Реакционную смесь упаривали в вакууме. Остаток разбавляли этилацетатом и промывали водой и насыщенным водным раствором хлорида натрия и органический слой сушили над безводным сульфатом магния. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (этилацетат/гексан=1/10) с получением указанного в заголовке соединения (10,95 г, выход 95%) в виде бесцветного аморфного твердого вещества.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,04-0,07 (6H, м), 0,83-0,92 (9H, м), 1,75-1,92 (1H, м), 2,19-2,34 (5H, м), 2,41-2,70 (1H, м), 2,90-3,13 (2H, м), 4,06-4,21 (2H, м), 4,21-4,34 (1H, м), 5,66 (1H, т, J=6,0), 7,11-7,54 (15H, м).

(e) (E)-4-(Ацетилсульфанил)-3-(2-гидроксиэтилиден)пиперидин гидротрифторацетат

К раствору (E)-4-(ацетилсульфанил)-3-[2-(трет-бутилдиметилсилилокси)этилиден]-1-(трифенилметил)пиперидина (10,95 г), полученного в (d) выше, в дихлорметане (10 мл) добавляли трифторуксусную кислоту (15 мл) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 1 часа. Реакционную смесь упаривали в вакууме и остаток очищали колоночной хроматографией на силикагеле (метанол/дихлорметан=1/10-1/1) с получением указанного в заголовке соединения (6,90 г, количественный выход) в виде масла коричневого цвета.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,96-2,10 (1H, м), 2,26-2,43 (4H, м), 3,13-3,28 (1H, м), 3,29-3,41 (1H, м), 3,57-3,67 (1H, м), 4,02-4,11 (1H, м), 4,14-4,28 (2H, м), 4,40-4,45 (1H, м), 6,04-6,11 (1H, м).

(f) (E)-4-(Ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-гидроксиэтилиден)пиперидин

Указанное в заголовке соединение синтезировали с выходом 74% в виде масла желтого цвета, используя гидротрифторацетат (E)-4-(ацетилсульфанил)-3-(2-гидроксиэтилиден)пиперидина (6,90 г), полученный в (e) выше, проведением реакции, аналогичной описанной в примере 1 (g).

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,75-0,92 (2H, м), 0,96-1,11 (2H, м), 1,59-1,87 (2H, м), 2,07-2,19 (1H, м), 2,19-2,34 (3H, м), 2,44-2,63 (1H, м), 2,64-2,79 (1H, м), 2,82 и 3,09 (все 1H, каждый д, J=12,5), 3,26 и 3,41 (все 1H, каждый д, J=12,5), 3,97-4,18 (2H, м), 4,23-4,37 (1H, м), 4,73 и 4,78 (все 1H, каждый c), 5,75-5,87 (1H, м), 7,70-7,24 (2H, м), 7,29-7,41 (2H, м).

(Пример 33) (E)-4-(Ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонилметил)пиперидин-1-ил]этилиден}пиперидин (производное соединения № 5-14)

К раствору (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-(2-гидроксиэтилиден)пиперидина (500 мг), полученного в примере 32 (f), и ангидрида п-толуолсульфоновой кислоты (580 мг) в ацетонитриле (5 мл) добавляли триэтиламин (0,22 мл) при охлаждении на льду, полученную смесь перемешивали при комнатной температуре в течение 5,5 часов. К реакционной смеси добавляли 4-(этоксикарбонилметил)пиперидин (450 мг) и триэтиламин (0,37 мл) и полученную смесь перемешивали при комнатной температуре в течение 3 часов и затем оставляли стоять в течение 3 дней. Реакционную смесь разбавляли этилацетатом и промывали водой, и органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме и остаток грубо очищали колоночной хроматографией на силикагеле (метанол/дихлорметан=1/10) и затем очищали, используя препаративную ВЭЖХ (YMC-Pack ODS-A; YMC, элюент: ацетонитрил/вода, содержащая триэтиламин (0,2%) и уксусную кислоту (0,2%)=13/7). Элюированную фракцию экстрагировали этилацетатом и промывали насыщенным водным раствором хлорида магния и органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме с получением указанного в заголовке соединения (204 мг, выход 29%) в виде масла желтого цвета.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,77-0,92 (2H, м), 0,94-1,10 (2H, м), 1,26 (3H, т, J=7,0), 1,55-1,89 (7H, м), 2,08-2,19 (2H, м), 2,21-2,26 (2H, м), 2,27-2,32 (3H, м), 2,48-2,61 (1H, м), 2,62-2,72 (1H, м), 2,72-3,40 (7H, м), 4,07-4,17 (2H, м), 4,24-4,36 (1H, м), 4,65-4,75 (1H, м), 5,69 (1H, ушир. с), 7,08-7,22 (2H, м), 7,29-7,42 (2H, м).

(Пример 34) Дигидрохлорид (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонилметил)пиперидин-1-ил]этилиден}-4-сульфанилпиперидина (гидрохлоридное производное соединения № 5-13)

В раствор (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонилметил)пиперидин-1-ил]этилиден}пиперидина (204 мг), полученного в примере 33, в этаноле (10 мл) барботировали хлористый водород при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в герметично закрытом сосуде в течение ночи. Реакционную смесь упаривали в вакууме с получением указанного в заголовке соединения (201 мг, выход 93%) в виде бесцветного аморфного твердого вещества.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,71-0,86 (2H, м), 1,03-1,12 (2H, м), 1,14 (3H, т, J=7,0), 1,71-1,82 (1H, м), 1,94-2,08 (2H, м), 2,09-2,49 (6H, м), 2,57-3,02 (4H, м), 3,33-3,48 (1H, м), 3,49-3,71 (4H, м), 3,76-3,83 (2H, м), 3,83-3,92 (1H, м), 4,11 (2H, кв, J=7,0), 5,03 и 5,04 (все 1H, каждый c), 6,31-6,43 (1H, м), 7,13-7,31 (2H, м), 7,31-7,42 (1H, м), 7,54-7,65 (1H, м).

(Пример 35) Дигидрохлорид (E)-3-[2-(4-карбоксиметилпиперидин-1-ил)этилиден]-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидина (гидрохлоридное производное соединения № 5-9)

Указанное в заголовке соединение синтезировали с выходом 57% в виде бесцветного аморфного твердого вещества, используя дигидрохлорид (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{2-[4-(этоксикарбонилметил)пиперидин-1-ил]этилиден}-4-сульфанилпиперидина, полученный в примере 34, проведением реакции, аналогичной описанной в примере 15.

1H ЯМР (500 МГц, CDCl3) δ м.д.: 0,72-0,88 (2H, м), 1,04-1,17 (2H, м), 1,71-1,83 (1H, м), 1,94-2,11 (2H, м), 2,11-2,34 (5H, м), 2,46 (2H, ушир. с), 2,65-2,76 (1H, м), 2,76-3,07 (4H, м), 3,46 (1H, д, J=12,5), 3,59 (1H, д, J=12,5), 3,62-3,75 (2H, м), 3,83-3,96 (2H, м), 5,08 (1H, c), 6,40 (1H, м), 7,22-7,31 (2H, м), 7,34-7,41 (1H, м), 7,61-7,67 (1H, м);

ИК (KBr, см-1):2556, 1714, 1493.

(Пример 36) Дигидрохлорид (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{[1-(этоксикарбонилметил)пиперидин-4-ил]метилиден}пиперидина (гидрохлоридное производное соединения № 3-32)

(a) 3-{[1-(этоксикарбонилметил)пиперидин-4-ил]гидроксиметил}-1-(трифенилметил)пиперидин-4-он

К раствору 1-(трифенилметил)пиперидин-4-она (22,99 г) в тетрагидрофуране (250 мл) по каплям добавляли 1,0 н. раствор бис(триметилсилил)амида натрия в тетрагидрофуране (68 мл) при -78°C и полученную смесь перемешивали при той же температуре в течение 20 минут. К реакционной смеси по каплям добавляли раствор 1-(этоксикарбонилметил)пиперидин-4-карбальдегида (13,43 г) в тетрагидрофуране (35 мл) при -78°C и полученную смесь перемешивали при той же температуре в течение 2 часов. К реакционной смеси добавляли насыщенный водный раствор хлорида аммония и затем экстрагировали смешанным растворителем, состоящим из этилацетата и диэтилового эфира. Экстракт промывали водой и насыщенным водным раствором хлорида натрия, и органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (этилацетат/гексан=1/4-1/0) с получением указанного в заголовке соединения (12,32 г, выход 34%) в виде аморфного твердого вещества светло-желтого цвета.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,27 (3H, т, J=7,0), 1,41-2,18 (8H, м), 2,30-2,51 (1H, м), 2,67-3,25 (8H, м), 3,45-3,71 (2H, м), 4,18 (2H, кв, J=7,0), 7,11-7,60 (15H, м).

(b) (E)-3-{[1-(этоксикарбонилметил)пиперидин-4-ил]метилиден}-1-(трифенилметил)пиперидин-4-он

К раствору 3-{[1-(этоксикарбонилметил)пиперидин-4-ил]гидроксиметил}-1-(трифенилметил)-пиперидин-4-она (9,87 г), полученного в (a) выше, в тетрагидрофуране (150 мл) добавляли метансульфонилхлорид (7,0 мл), 1,8-диазабицикло[5,4,0]ундец-7-ен (19 мл) и 4-диметиламинопиридин (0,23 г) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 17 часов. Реакционную смесь разбавляли смешанным растворителем, состоящим из этилацетата и диэтилового эфира, и промывали водой и насыщенным водным раствором хлорида натрия, и органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (этилацетат/гексан=1/4-4/1) с получением указанного в заголовке соединения (3,92 г, выход 41%) в виде аморфного твердого вещества желтого цвета.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,27 (3H, т, J=7,0), 1,50-1,66 (4H, м), 1,89-2,01 (1H, м), 2,10-2,21 (2H, м), 2,50-2,69 (4H, м), 2,83-2,93 (2H, м), 3,08-3,23 (4H, м), 4,18 (2H, кв, J=7,0), 6,49 (1H, д, J=10,0), 7,14-7,33 (9H, м), 7,46-7,56 (6H, м).

(c) (E)-3-{[1-(этоксикарбонилметил)пиперидин-4-ил]метилиден}-1-(трифенилметил)пиперидин-4-ол

К раствору (E)-3-{[1-(этоксикарбонилметил)пиперидин-4-ил]метилиден}-1-(трифенилметил)пиперидин-4-она (6,14 г), полученного в (b) выше, в смешанном растворителе, состоящем из этанола (40 мл) и дихлорметана (40 мл), добавляли борогидрид натрия (0,55 г) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 1 часа. Реакционную смесь разбавляли этилацетатом и промывали насыщенным водным раствором гидрокарбоната натрия и насыщенным водным раствором хлорида натрия, и органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (этилацетат/гексан=2/3) с получением указанного в заголовке соединения (4,17 г, выход 68%) в виде бесцветного аморфного твердого вещества.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,29 (3H, т, J=7,5), 1,44-2,18 (7H, м), 2,77-3,22 (10H, м), 3,91-4,02 (1H, м), 4,20 (2H, кв, J=7,5), 5,31 (1H, д, J=10,0), 7,09-7,30 (9H, м), 7,38-7,56 (6H, м).

(d) (E)-4-(Ацетилсульфанил)-3-{[1-(этоксикарбонилметил)пиперидин-4-ил]метилиден}пиперидин бис(гидротрифторацетат)

К раствору (E)-3-{[1-(этоксикарбонилметил)пиперидин-4-ил]метилиден}-1-(трифенилметил)пиперидин-4-ола (2,98 г), полученного в (c) выше, в толуоле (50 мл) добавляли тиоуксусную кислоту (1,20 мл) и N,N-диметилформамид динеопентилацеталя (4,80 мл) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 1,5 часов. Реакционную смесь разбавляли этилацетатом и промывали водой и насыщенным водным раствором хлорида натрия, и органический слой сушили над безводным сульфатом натрия. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (этилацетат/гексан=2/3) с получением (E)-4-(ацетилсульфанил)-3-{[1-(этоксикарбонилметил)пиперидин-4-ил]метилиден}-1-(трифенилметил)пиперидина (1,97 г, содержащего примеси) в виде аморфного твердого вещества светло-желтого цвета.

К раствору вышеуказанной смеси (1,97 г) в дихлорметане (30 мл) добавляли трифторуксусную кислоту (0,60 мл) при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в течение 30 минут. Растворитель удаляли в вакууме и остаток очищали колоночной хроматографией на силикагеле (этанол/дихлорметан=1/4-2/3) с получением указанного в заголовке соединения (1,53 г, выход 48%) в виде аморфного твердого вещества желтого цвета.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 1,29 (3H, т, J=7,0), 1,67-2,61 (10H, м), 3,00-4,03 (10H, м), 4,25 (2H, кв, J=7,0), 4,39 (1H, т, J=4,5), 5,71 (1H, д, J=10,0).

(e) Дигидрохлорид (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{[1-(этоксикарбонилметил)пиперидин-4-ил]метилиден}пиперидина

Указанное в заголовке соединение синтезировали с выходом 81% в виде бесцветного аморфного твердого вещества, используя (E)-4-(ацетилсульфанил)-3-{[1-(этоксикарбонилметил)пиперидин-4-ил]метилиден}пиперидин бис(гидротрифторацетат), полученный в (d) выше, проведением реакции, аналогичной описанной в примере 1 (g).

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,76-0,89 (2H, м), 0,90-1,12 (2H, м), 1,28 (3H, т, J=7,0), 1,39-2,34 (11H, м), 2,41-2,98 (7H, м), 3,18 и 3,19 (все 2H, каждый c), 3,28-3,39 (1H, м), 4,13-4,33 (3H, м), 4,63 и 4,70 (все 1H, каждый c), 5,38 (1H, д, J=9,0), 7,05-7,21 (2H, м), 7,27-7,37 (1H, м), 7,39-7,51 (1H, м);

ИК (KBr, см-1): 2614, 1697.

(Пример 37) Дигидрохлорид (E)-3-{[1-(карбоксиметил)пиперидин-4-ил]метилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидина (гидрохлоридное производное соединения № 3-27)

В раствор (E)-4-(ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{[1-(этоксикарбонилметил)пиперидин-4-ил]метилиден}пиперидина (1,13 г), полученного в примере 36 (e), в этаноле (20 мл) барботировали хлористый водород при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в герметично закрытом сосуде в течение 3 часов. После упаривания реакционной смеси в вакууме полученный остаток растворяли в 3 н. соляной кислоте (20 мл) и полученную смесь перемешивали при 50°C в течение 12,5 часов. Реакционную смесь удаляли в вакууме и остаток очищали, используя препаративную ВЭЖХ (YMC-Pack ODS-A; YMC, элюент: ацетонитрил/0,024 н. соляная кислота=10/90) с получением указанного в заголовке соединения (0,38 г, выход 34%) в виде бесцветного аморфного твердого вещества.

1H ЯМР (400 МГц, пиридин-d5) δ м.д.: 0,75-0,87 (2H, м), 0,96-1,19 (2H, м), 1,62-2,54 (8H, м), 2,62-3,19 (4H, м), 3,31-3,87 (5H, м), 4,10 и 4,11 (все 2H, каждый c), 4,94 и 4,95 (все 1H, каждый c), 5,49 и 5,50 (все 1H, каждый д, J=9,0), 7,18-7,39 (3H, м), 7,70-7,78 (1H, м);

ИК (KBr, см-1): 2659, 1713, 1494.

(Пример 38) Дигидрохлорид (E)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-{[1-(этоксикарбонилметил)пиперидин-4-ил]метилиден}-4-сульфанилпиперидина (гидрохлоридное производное соединения № 3-31)

В раствор дигидрохлорида (E)-3-{[1-(карбоксиметил)пиперидин-4-ил]метилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидина (0,17 г) полученный в примере 37, в этаноле (4 мл) барботировали хлористый водород при охлаждении на льду и полученную смесь перемешивали при комнатной температуре в герметично закрытом сосуде в течение 7 часов. Реакционную смесь оставляли отстаиваться при -20°C в течение 3 дней и затем перемешивали при комнатной температуре в течение еще 7 часов. Реакционную смесь упаривали в вакууме и остаток очищали колоночной хроматографией на силикагеле (этанол/дихлорметан=1/99 - 1/4) с получением указанного в заголовке соединения (0,16 г, выход 89%) в виде бесцветного аморфного твердого вещества.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,77-1,12 (4H, м), 1,28 (3H, т, J=7,0), 1,41-2,36 (8H, м), 2,55-3,36 (10H, м), 3,68-3,81 (1H, м), 4,19 (2H, кв, J=7,0), 4,66 и 4,72 (все 1H, каждый c), 5,32 и 5,34 (все 1H, каждый д, J=9,0), 7,03-7,55 (4H, м);

ИК (KBr, см-1): 2617, 1713, 1494.

(Пример 39) Дигидрохлорид (E)-4-(ацетилсульфанил)-3-{[(1-карбоксиметил)пиперидин-4-ил]метилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]пиперидина (гидрохлоридное производное соединения № 3-28)

Указанное в заголовке соединение синтезировали с выходом 52% в виде бесцветного аморфного твердого вещества, используя дигидрохлорид (E)-3-{[1-(карбоксиметил)пиперидин-4-ил]метилиден}-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-4-сульфанилпиперидина, полученный в примере 37, проведением реакции, аналогичной описанной в примере 28.

1H ЯМР (400 МГц, CDCl3) δ м.д.: 0,73-0,89 (2H, м), 0,95-1,07 (2H, м), 1,67-2,34 (11H, м), 2,47-3,42 (10H, м), 4,21 и 4,27 (все 1H, каждый т, J=4,5), 4,73 и 4,75 (все 1H, каждый c), 5,37-5,45 (1H, м), 7,09-7,20 (2H, м), 7,31-7,39 (2H, м);

ИК (KBr, см-1): 2627, 1698.

(Пример 40) (E)-4-(Ацетилсульфанил)-1-[2-циклопропил-1-(2-фторфенил)-2-оксоэтил]-3-[2-(1H-пиразол-1-ил)этилиден]пиперидин (производное соединения № 1-2)

(a) (E)-4-(трет-Бутилдиметилсилилокси)-3-[2-(1H-пиразол-1-ил)этилиден]-1-(трифенилметил)пиперидин

К раствору (E)-4-(трет-бутилдиметилсилилокси)-3-(2-гидроксиэтилиден)-1-(трифенилметил)пиперидина (14,7 г), полученного в примере 1 (b), 1H-пиразола (2,0 г) и 1,1'-(азодикарбонил)дипиперидина (8,9 г) в толуоле (150 мл) в токе газообразного азота добавляли трибутилфосфин (8,8 мл) при охлажд